","import { Component, Input, OnInit } from '@angular/core';\r\nimport { Router, RouterModule } from '@angular/router';\r\nimport { CartService } from 'src/app/services/cart.service';\r\nimport { CatalogService } from 'src/app/services/catalog.service';\r\nimport { Category } from 'src/app/services/categoryToy';\r\nimport { RecommendationsTsService } from 'src/app/services/recommendations.ts.service';\r\n\r\n@Component({\r\n selector: 'app-catalog-item',\r\n templateUrl: './catalog-item.component.html',\r\n styleUrls: ['./catalog-item.component.scss']\r\n})\r\nexport class CatalogItemComponent implements OnInit {\r\n \r\n constructor(private router: Router, private cartService: CartService, private catalog: CatalogService,\r\n private recommendationService: RecommendationsTsService) { \r\n }\r\n\r\n @Input()\r\n item : any;\r\n\r\n @Input()\r\n isMoreLink: boolean;\r\n\r\n @Input()\r\n categoryId: number;\r\n\r\n @Input()\r\n ageCategory: string | null;\r\n\r\n @Input()\r\n category: Category;\r\n\r\n @Input()\r\n itemsFromSameCategory: any[];\r\n\r\n ngOnInit(): void {\r\n \r\n if(this.item!== undefined) {\r\n this.catalog.getStockCount(this.item.id).subscribe(val=>{\r\n this.stockCount = val;\r\n \r\n })\r\n this.catalog.fetchStockCount(this.item.id); \r\n }\r\n\r\n this.catalog.selectedCategory$.subscribe(val=>{\r\n if((val!== null) && (this.categoryId==null)) {\r\n this.categoryId = val\r\n }\r\n })\r\n }\r\n\r\n \r\n\r\n openProduct() {\r\n if(this.ageCategory!== null) {\r\n this.router.navigate(['/product', this.item.id], { queryParams: { ageCategory: this.ageCategory } });\r\n }else \r\n {\r\n this.router.navigate(['/product', this.item.id]);\r\n }\r\n }\r\n\r\n public stockCount: number = 0;\r\n\r\n public isOutofStock() {\r\n return !(this.stockCount>0);\r\n }\r\n\r\n\r\n private addedToCartFlag: boolean = false;\r\n\r\n public isAddedToCart() {\r\n this.cartService.isItemInCartFromItemId(this.item.id).subscribe(val=>{\r\n this.addedToCartFlag = val;\r\n })\r\n return this.addedToCartFlag;\r\n }\r\n\r\n calculateDiscountedPrice(amount: number, percentVal: number)\r\n {\r\n return amount * ((100-percentVal)/100);\r\n }\r\n\r\n\r\n \r\n public hasDiscount(discount: any): boolean\r\n {\r\n if((discount == null) || (discount == undefined) || (discount.discountPercent == 0 ) ) {\r\n return false;\r\n } \r\n return true;\r\n }\r\n \r\n}\r\n","import { NgModule } from '@angular/core';\r\nimport { CommonModule } from '@angular/common';\r\nimport { CatalogItemComponent } from './catalog-item.component';\r\nimport { RouterModule } from '@angular/router';\r\nimport { FormsModule } from '@angular/forms';\r\n\r\n\r\n@NgModule({\r\n declarations: [\r\n CatalogItemComponent\r\n ],\r\n imports: [\r\n CommonModule,\r\n RouterModule,\r\n FormsModule\r\n ],\r\n exports: [\r\n CatalogItemComponent\r\n ]\r\n})\r\nexport class CatalogItemModule { }\r\n","import * as i0 from '@angular/core';\nimport { ElementRef, Injector, Directive, EventEmitter, Inject, Output, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Throws an exception when attempting to attach a null portal to a host.\n * @docs-private\n */\nfunction throwNullPortalError() {\n throw Error('Must provide a portal to attach');\n}\n/**\n * Throws an exception when attempting to attach a portal to a host that is already attached.\n * @docs-private\n */\nfunction throwPortalAlreadyAttachedError() {\n throw Error('Host already has a portal attached');\n}\n/**\n * Throws an exception when attempting to attach a portal to an already-disposed host.\n * @docs-private\n */\nfunction throwPortalOutletAlreadyDisposedError() {\n throw Error('This PortalOutlet has already been disposed');\n}\n/**\n * Throws an exception when attempting to attach an unknown portal type.\n * @docs-private\n */\nfunction throwUnknownPortalTypeError() {\n throw Error('Attempting to attach an unknown Portal type. BasePortalOutlet accepts either ' +\n 'a ComponentPortal or a TemplatePortal.');\n}\n/**\n * Throws an exception when attempting to attach a portal to a null host.\n * @docs-private\n */\nfunction throwNullPortalOutletError() {\n throw Error('Attempting to attach a portal to a null PortalOutlet');\n}\n/**\n * Throws an exception when attempting to detach a portal that is not attached.\n * @docs-private\n */\nfunction throwNoPortalAttachedError() {\n throw Error('Attempting to detach a portal that is not attached to a host');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A `Portal` is something that you want to render somewhere else.\n * It can be attach to / detached from a `PortalOutlet`.\n */\nclass Portal {\n /** Attach this portal to a host. */\n attach(host) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (host == null) {\n throwNullPortalOutletError();\n }\n if (host.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n }\n this._attachedHost = host;\n return host.attach(this);\n }\n /** Detach this portal from its host */\n detach() {\n let host = this._attachedHost;\n if (host != null) {\n this._attachedHost = null;\n host.detach();\n }\n else if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwNoPortalAttachedError();\n }\n }\n /** Whether this portal is attached to a host. */\n get isAttached() {\n return this._attachedHost != null;\n }\n /**\n * Sets the PortalOutlet reference without performing `attach()`. This is used directly by\n * the PortalOutlet when it is performing an `attach()` or `detach()`.\n */\n setAttachedHost(host) {\n this._attachedHost = host;\n }\n}\n/**\n * A `ComponentPortal` is a portal that instantiates some Component upon attachment.\n */\nclass ComponentPortal extends Portal {\n constructor(component, viewContainerRef, injector, componentFactoryResolver) {\n super();\n this.component = component;\n this.viewContainerRef = viewContainerRef;\n this.injector = injector;\n this.componentFactoryResolver = componentFactoryResolver;\n }\n}\n/**\n * A `TemplatePortal` is a portal that represents some embedded template (TemplateRef).\n */\nclass TemplatePortal extends Portal {\n constructor(template, viewContainerRef, context) {\n super();\n this.templateRef = template;\n this.viewContainerRef = viewContainerRef;\n this.context = context;\n }\n get origin() {\n return this.templateRef.elementRef;\n }\n /**\n * Attach the portal to the provided `PortalOutlet`.\n * When a context is provided it will override the `context` property of the `TemplatePortal`\n * instance.\n */\n attach(host, context = this.context) {\n this.context = context;\n return super.attach(host);\n }\n detach() {\n this.context = undefined;\n return super.detach();\n }\n}\n/**\n * A `DomPortal` is a portal whose DOM element will be taken from its current position\n * in the DOM and moved into a portal outlet, when it is attached. On detach, the content\n * will be restored to its original position.\n */\nclass DomPortal extends Portal {\n constructor(element) {\n super();\n this.element = element instanceof ElementRef ? element.nativeElement : element;\n }\n}\n/**\n * Partial implementation of PortalOutlet that handles attaching\n * ComponentPortal and TemplatePortal.\n */\nclass BasePortalOutlet {\n constructor() {\n /** Whether this host has already been permanently disposed. */\n this._isDisposed = false;\n // @breaking-change 10.0.0 `attachDomPortal` to become a required abstract method.\n this.attachDomPortal = null;\n }\n /** Whether this host has an attached portal. */\n hasAttached() {\n return !!this._attachedPortal;\n }\n /** Attaches a portal. */\n attach(portal) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!portal) {\n throwNullPortalError();\n }\n if (this.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n if (this._isDisposed) {\n throwPortalOutletAlreadyDisposedError();\n }\n }\n if (portal instanceof ComponentPortal) {\n this._attachedPortal = portal;\n return this.attachComponentPortal(portal);\n }\n else if (portal instanceof TemplatePortal) {\n this._attachedPortal = portal;\n return this.attachTemplatePortal(portal);\n // @breaking-change 10.0.0 remove null check for `this.attachDomPortal`.\n }\n else if (this.attachDomPortal && portal instanceof DomPortal) {\n this._attachedPortal = portal;\n return this.attachDomPortal(portal);\n }\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwUnknownPortalTypeError();\n }\n }\n /** Detaches a previously attached portal. */\n detach() {\n if (this._attachedPortal) {\n this._attachedPortal.setAttachedHost(null);\n this._attachedPortal = null;\n }\n this._invokeDisposeFn();\n }\n /** Permanently dispose of this portal host. */\n dispose() {\n if (this.hasAttached()) {\n this.detach();\n }\n this._invokeDisposeFn();\n this._isDisposed = true;\n }\n /** @docs-private */\n setDisposeFn(fn) {\n this._disposeFn = fn;\n }\n _invokeDisposeFn() {\n if (this._disposeFn) {\n this._disposeFn();\n this._disposeFn = null;\n }\n }\n}\n/**\n * @deprecated Use `BasePortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass BasePortalHost extends BasePortalOutlet {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A PortalOutlet for attaching portals to an arbitrary DOM element outside of the Angular\n * application context.\n */\nclass DomPortalOutlet extends BasePortalOutlet {\n /**\n * @param outletElement Element into which the content is projected.\n * @param _componentFactoryResolver Used to resolve the component factory.\n * Only required when attaching component portals.\n * @param _appRef Reference to the application. Only used in component portals when there\n * is no `ViewContainerRef` available.\n * @param _defaultInjector Injector to use as a fallback when the portal being attached doesn't\n * have one. Only used for component portals.\n * @param _document Reference to the document. Used when attaching a DOM portal. Will eventually\n * become a required parameter.\n */\n constructor(\n /** Element into which the content is projected. */\n outletElement, _componentFactoryResolver, _appRef, _defaultInjector, \n /**\n * @deprecated `_document` Parameter to be made required.\n * @breaking-change 10.0.0\n */\n _document) {\n super();\n this.outletElement = outletElement;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._appRef = _appRef;\n this._defaultInjector = _defaultInjector;\n /**\n * Attaches a DOM portal by transferring its content into the outlet.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n // @breaking-change 10.0.0 Remove check and error once the\n // `_document` constructor parameter is required.\n if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Cannot attach DOM portal without _document constructor parameter');\n }\n const element = portal.element;\n if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('DOM portal content must be attached to a parent node.');\n }\n // Anchor used to save the element's previous position so\n // that we can restore it when the portal is detached.\n const anchorNode = this._document.createComment('dom-portal');\n element.parentNode.insertBefore(anchorNode, element);\n this.outletElement.appendChild(element);\n this._attachedPortal = portal;\n super.setDisposeFn(() => {\n // We can't use `replaceWith` here because IE doesn't support it.\n if (anchorNode.parentNode) {\n anchorNode.parentNode.replaceChild(element, anchorNode);\n }\n });\n };\n this._document = _document;\n }\n /**\n * Attach the given ComponentPortal to DOM element using the ComponentFactoryResolver.\n * @param portal Portal to be attached\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n const resolver = (portal.componentFactoryResolver || this._componentFactoryResolver);\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !resolver) {\n throw Error('Cannot attach component portal to outlet without a ComponentFactoryResolver.');\n }\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n let componentRef;\n // If the portal specifies a ViewContainerRef, we will use that as the attachment point\n // for the component (in terms of Angular's component tree, not rendering).\n // When the ViewContainerRef is missing, we use the factory to create the component directly\n // and then manually attach the view to the application.\n if (portal.viewContainerRef) {\n componentRef = portal.viewContainerRef.createComponent(componentFactory, portal.viewContainerRef.length, portal.injector || portal.viewContainerRef.injector);\n this.setDisposeFn(() => componentRef.destroy());\n }\n else {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !this._appRef) {\n throw Error('Cannot attach component portal to outlet without an ApplicationRef.');\n }\n componentRef = componentFactory.create(portal.injector || this._defaultInjector || Injector.NULL);\n this._appRef.attachView(componentRef.hostView);\n this.setDisposeFn(() => {\n // Verify that the ApplicationRef has registered views before trying to detach a host view.\n // This check also protects the `detachView` from being called on a destroyed ApplicationRef.\n if (this._appRef.viewCount > 0) {\n this._appRef.detachView(componentRef.hostView);\n }\n componentRef.destroy();\n });\n }\n // At this point the component has been instantiated, so we move it to the location in the DOM\n // where we want it to be rendered.\n this.outletElement.appendChild(this._getComponentRootNode(componentRef));\n this._attachedPortal = portal;\n return componentRef;\n }\n /**\n * Attaches a template portal to the DOM as an embedded view.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n let viewContainer = portal.viewContainerRef;\n let viewRef = viewContainer.createEmbeddedView(portal.templateRef, portal.context);\n // The method `createEmbeddedView` will add the view as a child of the viewContainer.\n // But for the DomPortalOutlet the view can be added everywhere in the DOM\n // (e.g Overlay Container) To move the view to the specified host element. We just\n // re-append the existing root nodes.\n viewRef.rootNodes.forEach(rootNode => this.outletElement.appendChild(rootNode));\n // Note that we want to detect changes after the nodes have been moved so that\n // any directives inside the portal that are looking at the DOM inside a lifecycle\n // hook won't be invoked too early.\n viewRef.detectChanges();\n this.setDisposeFn(() => {\n let index = viewContainer.indexOf(viewRef);\n if (index !== -1) {\n viewContainer.remove(index);\n }\n });\n this._attachedPortal = portal;\n // TODO(jelbourn): Return locals from view.\n return viewRef;\n }\n /**\n * Clears out a portal from the DOM.\n */\n dispose() {\n super.dispose();\n this.outletElement.remove();\n }\n /** Gets the root HTMLElement for an instantiated component. */\n _getComponentRootNode(componentRef) {\n return componentRef.hostView.rootNodes[0];\n }\n}\n/**\n * @deprecated Use `DomPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass DomPortalHost extends DomPortalOutlet {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Directive version of a `TemplatePortal`. Because the directive *is* a TemplatePortal,\n * the directive instance itself can be attached to a host, enabling declarative use of portals.\n */\nclass CdkPortal extends TemplatePortal {\n constructor(templateRef, viewContainerRef) {\n super(templateRef, viewContainerRef);\n }\n}\nCdkPortal.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkPortal, deps: [{ token: i0.TemplateRef }, { token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nCdkPortal.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: CdkPortal, selector: \"[cdkPortal]\", exportAs: [\"cdkPortal\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkPortal, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortal]',\n exportAs: 'cdkPortal',\n }]\n }], ctorParameters: function () { return [{ type: i0.TemplateRef }, { type: i0.ViewContainerRef }]; } });\n/**\n * @deprecated Use `CdkPortal` instead.\n * @breaking-change 9.0.0\n */\nclass TemplatePortalDirective extends CdkPortal {\n}\nTemplatePortalDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: TemplatePortalDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive });\nTemplatePortalDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: TemplatePortalDirective, selector: \"[cdk-portal], [portal]\", providers: [\n {\n provide: CdkPortal,\n useExisting: TemplatePortalDirective,\n },\n ], exportAs: [\"cdkPortal\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: TemplatePortalDirective, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-portal], [portal]',\n exportAs: 'cdkPortal',\n providers: [\n {\n provide: CdkPortal,\n useExisting: TemplatePortalDirective,\n },\n ],\n }]\n }] });\n/**\n * Directive version of a PortalOutlet. Because the directive *is* a PortalOutlet, portals can be\n * directly attached to it, enabling declarative use.\n *\n * Usage:\n * ``\n */\nclass CdkPortalOutlet extends BasePortalOutlet {\n constructor(_componentFactoryResolver, _viewContainerRef, \n /**\n * @deprecated `_document` parameter to be made required.\n * @breaking-change 9.0.0\n */\n _document) {\n super();\n this._componentFactoryResolver = _componentFactoryResolver;\n this._viewContainerRef = _viewContainerRef;\n /** Whether the portal component is initialized. */\n this._isInitialized = false;\n /** Emits when a portal is attached to the outlet. */\n this.attached = new EventEmitter();\n /**\n * Attaches the given DomPortal to this PortalHost by moving all of the portal content into it.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n // @breaking-change 9.0.0 Remove check and error once the\n // `_document` constructor parameter is required.\n if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Cannot attach DOM portal without _document constructor parameter');\n }\n const element = portal.element;\n if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('DOM portal content must be attached to a parent node.');\n }\n // Anchor used to save the element's previous position so\n // that we can restore it when the portal is detached.\n const anchorNode = this._document.createComment('dom-portal');\n portal.setAttachedHost(this);\n element.parentNode.insertBefore(anchorNode, element);\n this._getRootNode().appendChild(element);\n this._attachedPortal = portal;\n super.setDisposeFn(() => {\n if (anchorNode.parentNode) {\n anchorNode.parentNode.replaceChild(element, anchorNode);\n }\n });\n };\n this._document = _document;\n }\n /** Portal associated with the Portal outlet. */\n get portal() {\n return this._attachedPortal;\n }\n set portal(portal) {\n // Ignore the cases where the `portal` is set to a falsy value before the lifecycle hooks have\n // run. This handles the cases where the user might do something like `
`\n // and attach a portal programmatically in the parent component. When Angular does the first CD\n // round, it will fire the setter with empty string, causing the user's content to be cleared.\n if (this.hasAttached() && !portal && !this._isInitialized) {\n return;\n }\n if (this.hasAttached()) {\n super.detach();\n }\n if (portal) {\n super.attach(portal);\n }\n this._attachedPortal = portal || null;\n }\n /** Component or view reference that is attached to the portal. */\n get attachedRef() {\n return this._attachedRef;\n }\n ngOnInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n super.dispose();\n this._attachedPortal = null;\n this._attachedRef = null;\n }\n /**\n * Attach the given ComponentPortal to this PortalOutlet using the ComponentFactoryResolver.\n *\n * @param portal Portal to be attached to the portal outlet.\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n portal.setAttachedHost(this);\n // If the portal specifies an origin, use that as the logical location of the component\n // in the application tree. Otherwise use the location of this PortalOutlet.\n const viewContainerRef = portal.viewContainerRef != null ? portal.viewContainerRef : this._viewContainerRef;\n const resolver = portal.componentFactoryResolver || this._componentFactoryResolver;\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n const ref = viewContainerRef.createComponent(componentFactory, viewContainerRef.length, portal.injector || viewContainerRef.injector);\n // If we're using a view container that's different from the injected one (e.g. when the portal\n // specifies its own) we need to move the component into the outlet, otherwise it'll be rendered\n // inside of the alternate view container.\n if (viewContainerRef !== this._viewContainerRef) {\n this._getRootNode().appendChild(ref.hostView.rootNodes[0]);\n }\n super.setDisposeFn(() => ref.destroy());\n this._attachedPortal = portal;\n this._attachedRef = ref;\n this.attached.emit(ref);\n return ref;\n }\n /**\n * Attach the given TemplatePortal to this PortalHost as an embedded View.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n portal.setAttachedHost(this);\n const viewRef = this._viewContainerRef.createEmbeddedView(portal.templateRef, portal.context);\n super.setDisposeFn(() => this._viewContainerRef.clear());\n this._attachedPortal = portal;\n this._attachedRef = viewRef;\n this.attached.emit(viewRef);\n return viewRef;\n }\n /** Gets the root node of the portal outlet. */\n _getRootNode() {\n const nativeElement = this._viewContainerRef.element.nativeElement;\n // The directive could be set on a template which will result in a comment\n // node being the root. Use the comment's parent node if that is the case.\n return (nativeElement.nodeType === nativeElement.ELEMENT_NODE\n ? nativeElement\n : nativeElement.parentNode);\n }\n}\nCdkPortalOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkPortalOutlet, deps: [{ token: i0.ComponentFactoryResolver }, { token: i0.ViewContainerRef }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Directive });\nCdkPortalOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: CdkPortalOutlet, selector: \"[cdkPortalOutlet]\", inputs: { portal: [\"cdkPortalOutlet\", \"portal\"] }, outputs: { attached: \"attached\" }, exportAs: [\"cdkPortalOutlet\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkPortalOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalOutlet]',\n exportAs: 'cdkPortalOutlet',\n inputs: ['portal: cdkPortalOutlet'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ComponentFactoryResolver }, { type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, propDecorators: { attached: [{\n type: Output\n }] } });\n/**\n * @deprecated Use `CdkPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass PortalHostDirective extends CdkPortalOutlet {\n}\nPortalHostDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: PortalHostDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive });\nPortalHostDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: PortalHostDirective, selector: \"[cdkPortalHost], [portalHost]\", inputs: { portal: [\"cdkPortalHost\", \"portal\"] }, providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ], exportAs: [\"cdkPortalHost\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: PortalHostDirective, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalHost], [portalHost]',\n exportAs: 'cdkPortalHost',\n inputs: ['portal: cdkPortalHost'],\n providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ],\n }]\n }] });\nclass PortalModule {\n}\nPortalModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: PortalModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nPortalModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: PortalModule, declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective], exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective] });\nPortalModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: PortalModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: PortalModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Custom injector to be used when providing custom\n * injection tokens to components inside a portal.\n * @docs-private\n * @deprecated Use `Injector.create` instead.\n * @breaking-change 11.0.0\n */\nclass PortalInjector {\n constructor(_parentInjector, _customTokens) {\n this._parentInjector = _parentInjector;\n this._customTokens = _customTokens;\n }\n get(token, notFoundValue) {\n const value = this._customTokens.get(token);\n if (typeof value !== 'undefined') {\n return value;\n }\n return this._parentInjector.get(token, notFoundValue);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BasePortalHost, BasePortalOutlet, CdkPortal, CdkPortalOutlet, ComponentPortal, DomPortal, DomPortalHost, DomPortalOutlet, Portal, PortalHostDirective, PortalInjector, PortalModule, TemplatePortal, TemplatePortalDirective };\n","import * as i1 from '@angular/cdk/scrolling';\nimport { ScrollingModule } from '@angular/cdk/scrolling';\nexport { CdkScrollable, ScrollDispatcher, ViewportRuler } from '@angular/cdk/scrolling';\nimport * as i6 from '@angular/common';\nimport { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, Inject, Optional, ElementRef, ApplicationRef, InjectionToken, Directive, EventEmitter, Input, Output, NgModule } from '@angular/core';\nimport { coerceCssPixelValue, coerceArray, coerceBooleanProperty } from '@angular/cdk/coercion';\nimport * as i1$1 from '@angular/cdk/platform';\nimport { supportsScrollBehavior, _getEventTarget, _isTestEnvironment } from '@angular/cdk/platform';\nimport * as i5 from '@angular/cdk/bidi';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport { DomPortalOutlet, TemplatePortal, PortalModule } from '@angular/cdk/portal';\nimport { Subject, Subscription, merge } from 'rxjs';\nimport { take, takeUntil, takeWhile } from 'rxjs/operators';\nimport { ESCAPE, hasModifierKey } from '@angular/cdk/keycodes';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst scrollBehaviorSupported = supportsScrollBehavior();\n/**\n * Strategy that will prevent the user from scrolling while the overlay is visible.\n */\nclass BlockScrollStrategy {\n constructor(_viewportRuler, document) {\n this._viewportRuler = _viewportRuler;\n this._previousHTMLStyles = { top: '', left: '' };\n this._isEnabled = false;\n this._document = document;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach() { }\n /** Blocks page-level scroll while the attached overlay is open. */\n enable() {\n if (this._canBeEnabled()) {\n const root = this._document.documentElement;\n this._previousScrollPosition = this._viewportRuler.getViewportScrollPosition();\n // Cache the previous inline styles in case the user had set them.\n this._previousHTMLStyles.left = root.style.left || '';\n this._previousHTMLStyles.top = root.style.top || '';\n // Note: we're using the `html` node, instead of the `body`, because the `body` may\n // have the user agent margin, whereas the `html` is guaranteed not to have one.\n root.style.left = coerceCssPixelValue(-this._previousScrollPosition.left);\n root.style.top = coerceCssPixelValue(-this._previousScrollPosition.top);\n root.classList.add('cdk-global-scrollblock');\n this._isEnabled = true;\n }\n }\n /** Unblocks page-level scroll while the attached overlay is open. */\n disable() {\n if (this._isEnabled) {\n const html = this._document.documentElement;\n const body = this._document.body;\n const htmlStyle = html.style;\n const bodyStyle = body.style;\n const previousHtmlScrollBehavior = htmlStyle.scrollBehavior || '';\n const previousBodyScrollBehavior = bodyStyle.scrollBehavior || '';\n this._isEnabled = false;\n htmlStyle.left = this._previousHTMLStyles.left;\n htmlStyle.top = this._previousHTMLStyles.top;\n html.classList.remove('cdk-global-scrollblock');\n // Disable user-defined smooth scrolling temporarily while we restore the scroll position.\n // See https://developer.mozilla.org/en-US/docs/Web/CSS/scroll-behavior\n // Note that we don't mutate the property if the browser doesn't support `scroll-behavior`,\n // because it can throw off feature detections in `supportsScrollBehavior` which\n // checks for `'scrollBehavior' in documentElement.style`.\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = bodyStyle.scrollBehavior = 'auto';\n }\n window.scroll(this._previousScrollPosition.left, this._previousScrollPosition.top);\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = previousHtmlScrollBehavior;\n bodyStyle.scrollBehavior = previousBodyScrollBehavior;\n }\n }\n }\n _canBeEnabled() {\n // Since the scroll strategies can't be singletons, we have to use a global CSS class\n // (`cdk-global-scrollblock`) to make sure that we don't try to disable global\n // scrolling multiple times.\n const html = this._document.documentElement;\n if (html.classList.contains('cdk-global-scrollblock') || this._isEnabled) {\n return false;\n }\n const body = this._document.body;\n const viewport = this._viewportRuler.getViewportSize();\n return body.scrollHeight > viewport.height || body.scrollWidth > viewport.width;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Returns an error to be thrown when attempting to attach an already-attached scroll strategy.\n */\nfunction getMatScrollStrategyAlreadyAttachedError() {\n return Error(`Scroll strategy has already been attached.`);\n}\n\n/**\n * Strategy that will close the overlay as soon as the user starts scrolling.\n */\nclass CloseScrollStrategy {\n constructor(_scrollDispatcher, _ngZone, _viewportRuler, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._ngZone = _ngZone;\n this._viewportRuler = _viewportRuler;\n this._config = _config;\n this._scrollSubscription = null;\n /** Detaches the overlay ref and disables the scroll strategy. */\n this._detach = () => {\n this.disable();\n if (this._overlayRef.hasAttached()) {\n this._ngZone.run(() => this._overlayRef.detach());\n }\n };\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables the closing of the attached overlay on scroll. */\n enable() {\n if (this._scrollSubscription) {\n return;\n }\n const stream = this._scrollDispatcher.scrolled(0);\n if (this._config && this._config.threshold && this._config.threshold > 1) {\n this._initialScrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n this._scrollSubscription = stream.subscribe(() => {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n if (Math.abs(scrollPosition - this._initialScrollPosition) > this._config.threshold) {\n this._detach();\n }\n else {\n this._overlayRef.updatePosition();\n }\n });\n }\n else {\n this._scrollSubscription = stream.subscribe(this._detach);\n }\n }\n /** Disables the closing the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Scroll strategy that doesn't do anything. */\nclass NoopScrollStrategy {\n /** Does nothing, as this scroll strategy is a no-op. */\n enable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n disable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n attach() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Gets whether an element is scrolled outside of view by any of its parent scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is scrolled out of view\n * @docs-private\n */\nfunction isElementScrolledOutsideView(element, scrollContainers) {\n return scrollContainers.some(containerBounds => {\n const outsideAbove = element.bottom < containerBounds.top;\n const outsideBelow = element.top > containerBounds.bottom;\n const outsideLeft = element.right < containerBounds.left;\n const outsideRight = element.left > containerBounds.right;\n return outsideAbove || outsideBelow || outsideLeft || outsideRight;\n });\n}\n/**\n * Gets whether an element is clipped by any of its scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is clipped\n * @docs-private\n */\nfunction isElementClippedByScrolling(element, scrollContainers) {\n return scrollContainers.some(scrollContainerRect => {\n const clippedAbove = element.top < scrollContainerRect.top;\n const clippedBelow = element.bottom > scrollContainerRect.bottom;\n const clippedLeft = element.left < scrollContainerRect.left;\n const clippedRight = element.right > scrollContainerRect.right;\n return clippedAbove || clippedBelow || clippedLeft || clippedRight;\n });\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Strategy that will update the element position as the user is scrolling.\n */\nclass RepositionScrollStrategy {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n this._config = _config;\n this._scrollSubscription = null;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables repositioning of the attached overlay on scroll. */\n enable() {\n if (!this._scrollSubscription) {\n const throttle = this._config ? this._config.scrollThrottle : 0;\n this._scrollSubscription = this._scrollDispatcher.scrolled(throttle).subscribe(() => {\n this._overlayRef.updatePosition();\n // TODO(crisbeto): make `close` on by default once all components can handle it.\n if (this._config && this._config.autoClose) {\n const overlayRect = this._overlayRef.overlayElement.getBoundingClientRect();\n const { width, height } = this._viewportRuler.getViewportSize();\n // TODO(crisbeto): include all ancestor scroll containers here once\n // we have a way of exposing the trigger element to the scroll strategy.\n const parentRects = [{ width, height, bottom: height, right: width, top: 0, left: 0 }];\n if (isElementScrolledOutsideView(overlayRect, parentRects)) {\n this.disable();\n this._ngZone.run(() => this._overlayRef.detach());\n }\n }\n });\n }\n }\n /** Disables repositioning of the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Options for how an overlay will handle scrolling.\n *\n * Users can provide a custom value for `ScrollStrategyOptions` to replace the default\n * behaviors. This class primarily acts as a factory for ScrollStrategy instances.\n */\nclass ScrollStrategyOptions {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, document) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n /** Do nothing on scroll. */\n this.noop = () => new NoopScrollStrategy();\n /**\n * Close the overlay as soon as the user scrolls.\n * @param config Configuration to be used inside the scroll strategy.\n */\n this.close = (config) => new CloseScrollStrategy(this._scrollDispatcher, this._ngZone, this._viewportRuler, config);\n /** Block scrolling. */\n this.block = () => new BlockScrollStrategy(this._viewportRuler, this._document);\n /**\n * Update the overlay's position on scroll.\n * @param config Configuration to be used inside the scroll strategy.\n * Allows debouncing the reposition calls.\n */\n this.reposition = (config) => new RepositionScrollStrategy(this._scrollDispatcher, this._viewportRuler, this._ngZone, config);\n this._document = document;\n }\n}\nScrollStrategyOptions.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ScrollStrategyOptions, deps: [{ token: i1.ScrollDispatcher }, { token: i1.ViewportRuler }, { token: i0.NgZone }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nScrollStrategyOptions.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ScrollStrategyOptions, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ScrollStrategyOptions, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.ScrollDispatcher }, { type: i1.ViewportRuler }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Initial configuration used when creating an overlay. */\nclass OverlayConfig {\n constructor(config) {\n /** Strategy to be used when handling scroll events while the overlay is open. */\n this.scrollStrategy = new NoopScrollStrategy();\n /** Custom class to add to the overlay pane. */\n this.panelClass = '';\n /** Whether the overlay has a backdrop. */\n this.hasBackdrop = false;\n /** Custom class to add to the backdrop */\n this.backdropClass = 'cdk-overlay-dark-backdrop';\n /**\n * Whether the overlay should be disposed of when the user goes backwards/forwards in history.\n * Note that this usually doesn't include clicking on links (unless the user is using\n * the `HashLocationStrategy`).\n */\n this.disposeOnNavigation = false;\n if (config) {\n // Use `Iterable` instead of `Array` because TypeScript, as of 3.6.3,\n // loses the array generic type in the `for of`. But we *also* have to use `Array` because\n // typescript won't iterate over an `Iterable` unless you compile with `--downlevelIteration`\n const configKeys = Object.keys(config);\n for (const key of configKeys) {\n if (config[key] !== undefined) {\n // TypeScript, as of version 3.5, sees the left-hand-side of this expression\n // as \"I don't know *which* key this is, so the only valid value is the intersection\n // of all the posible values.\" In this case, that happens to be `undefined`. TypeScript\n // is not smart enough to see that the right-hand-side is actually an access of the same\n // exact type with the same exact key, meaning that the value type must be identical.\n // So we use `any` to work around this.\n this[key] = config[key];\n }\n }\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The points of the origin element and the overlay element to connect. */\nclass ConnectionPositionPair {\n constructor(origin, overlay, \n /** Offset along the X axis. */\n offsetX, \n /** Offset along the Y axis. */\n offsetY, \n /** Class(es) to be applied to the panel while this position is active. */\n panelClass) {\n this.offsetX = offsetX;\n this.offsetY = offsetY;\n this.panelClass = panelClass;\n this.originX = origin.originX;\n this.originY = origin.originY;\n this.overlayX = overlay.overlayX;\n this.overlayY = overlay.overlayY;\n }\n}\n/**\n * Set of properties regarding the position of the origin and overlay relative to the viewport\n * with respect to the containing Scrollable elements.\n *\n * The overlay and origin are clipped if any part of their bounding client rectangle exceeds the\n * bounds of any one of the strategy's Scrollable's bounding client rectangle.\n *\n * The overlay and origin are outside view if there is no overlap between their bounding client\n * rectangle and any one of the strategy's Scrollable's bounding client rectangle.\n *\n * ----------- -----------\n * | outside | | clipped |\n * | view | --------------------------\n * | | | | | |\n * ---------- | ----------- |\n * -------------------------- | |\n * | | | Scrollable |\n * | | | |\n * | | --------------------------\n * | Scrollable |\n * | |\n * --------------------------\n *\n * @docs-private\n */\nclass ScrollingVisibility {\n}\n/** The change event emitted by the strategy when a fallback position is used. */\nclass ConnectedOverlayPositionChange {\n constructor(\n /** The position used as a result of this change. */\n connectionPair, \n /** @docs-private */\n scrollableViewProperties) {\n this.connectionPair = connectionPair;\n this.scrollableViewProperties = scrollableViewProperties;\n }\n}\n/**\n * Validates whether a vertical position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateVerticalPosition(property, value) {\n if (value !== 'top' && value !== 'bottom' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"top\", \"bottom\" or \"center\".`);\n }\n}\n/**\n * Validates whether a horizontal position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateHorizontalPosition(property, value) {\n if (value !== 'start' && value !== 'end' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"start\", \"end\" or \"center\".`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass BaseOverlayDispatcher {\n constructor(document) {\n /** Currently attached overlays in the order they were attached. */\n this._attachedOverlays = [];\n this._document = document;\n }\n ngOnDestroy() {\n this.detach();\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n // Ensure that we don't get the same overlay multiple times.\n this.remove(overlayRef);\n this._attachedOverlays.push(overlayRef);\n }\n /** Remove an overlay from the list of attached overlay refs. */\n remove(overlayRef) {\n const index = this._attachedOverlays.indexOf(overlayRef);\n if (index > -1) {\n this._attachedOverlays.splice(index, 1);\n }\n // Remove the global listener once there are no more overlays.\n if (this._attachedOverlays.length === 0) {\n this.detach();\n }\n }\n}\nBaseOverlayDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: BaseOverlayDispatcher, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBaseOverlayDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: BaseOverlayDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: BaseOverlayDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching keyboard events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayKeyboardDispatcher extends BaseOverlayDispatcher {\n constructor(document, \n /** @breaking-change 14.0.0 _ngZone will be required. */\n _ngZone) {\n super(document);\n this._ngZone = _ngZone;\n /** Keyboard event listener that will be attached to the body. */\n this._keydownListener = (event) => {\n const overlays = this._attachedOverlays;\n for (let i = overlays.length - 1; i > -1; i--) {\n // Dispatch the keydown event to the top overlay which has subscribers to its keydown events.\n // We want to target the most recent overlay, rather than trying to match where the event came\n // from, because some components might open an overlay, but keep focus on a trigger element\n // (e.g. for select and autocomplete). We skip overlays without keydown event subscriptions,\n // because we don't want overlays that don't handle keyboard events to block the ones below\n // them that do.\n if (overlays[i]._keydownEvents.observers.length > 0) {\n const keydownEvents = overlays[i]._keydownEvents;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.run(() => keydownEvents.next(event));\n }\n else {\n keydownEvents.next(event);\n }\n break;\n }\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Lazily start dispatcher once first overlay is added\n if (!this._isAttached) {\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.runOutsideAngular(() => this._document.body.addEventListener('keydown', this._keydownListener));\n }\n else {\n this._document.body.addEventListener('keydown', this._keydownListener);\n }\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n this._document.body.removeEventListener('keydown', this._keydownListener);\n this._isAttached = false;\n }\n }\n}\nOverlayKeyboardDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayKeyboardDispatcher, deps: [{ token: DOCUMENT }, { token: i0.NgZone, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayKeyboardDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayKeyboardDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayKeyboardDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i0.NgZone, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching mouse click events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayOutsideClickDispatcher extends BaseOverlayDispatcher {\n constructor(document, _platform, \n /** @breaking-change 14.0.0 _ngZone will be required. */\n _ngZone) {\n super(document);\n this._platform = _platform;\n this._ngZone = _ngZone;\n this._cursorStyleIsSet = false;\n /** Store pointerdown event target to track origin of click. */\n this._pointerDownListener = (event) => {\n this._pointerDownEventTarget = _getEventTarget(event);\n };\n /** Click event listener that will be attached to the body propagate phase. */\n this._clickListener = (event) => {\n const target = _getEventTarget(event);\n // In case of a click event, we want to check the origin of the click\n // (e.g. in case where a user starts a click inside the overlay and\n // releases the click outside of it).\n // This is done by using the event target of the preceding pointerdown event.\n // Every click event caused by a pointer device has a preceding pointerdown\n // event, unless the click was programmatically triggered (e.g. in a unit test).\n const origin = event.type === 'click' && this._pointerDownEventTarget\n ? this._pointerDownEventTarget\n : target;\n // Reset the stored pointerdown event target, to avoid having it interfere\n // in subsequent events.\n this._pointerDownEventTarget = null;\n // We copy the array because the original may be modified asynchronously if the\n // outsidePointerEvents listener decides to detach overlays resulting in index errors inside\n // the for loop.\n const overlays = this._attachedOverlays.slice();\n // Dispatch the mouse event to the top overlay which has subscribers to its mouse events.\n // We want to target all overlays for which the click could be considered as outside click.\n // As soon as we reach an overlay for which the click is not outside click we break off\n // the loop.\n for (let i = overlays.length - 1; i > -1; i--) {\n const overlayRef = overlays[i];\n if (overlayRef._outsidePointerEvents.observers.length < 1 || !overlayRef.hasAttached()) {\n continue;\n }\n // If it's a click inside the overlay, just break - we should do nothing\n // If it's an outside click (both origin and target of the click) dispatch the mouse event,\n // and proceed with the next overlay\n if (overlayRef.overlayElement.contains(target) ||\n overlayRef.overlayElement.contains(origin)) {\n break;\n }\n const outsidePointerEvents = overlayRef._outsidePointerEvents;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.run(() => outsidePointerEvents.next(event));\n }\n else {\n outsidePointerEvents.next(event);\n }\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Safari on iOS does not generate click events for non-interactive\n // elements. However, we want to receive a click for any element outside\n // the overlay. We can force a \"clickable\" state by setting\n // `cursor: pointer` on the document body. See:\n // https://developer.mozilla.org/en-US/docs/Web/API/Element/click_event#Safari_Mobile\n // https://developer.apple.com/library/archive/documentation/AppleApplications/Reference/SafariWebContent/HandlingEvents/HandlingEvents.html\n if (!this._isAttached) {\n const body = this._document.body;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.runOutsideAngular(() => this._addEventListeners(body));\n }\n else {\n this._addEventListeners(body);\n }\n // click event is not fired on iOS. To make element \"clickable\" we are\n // setting the cursor to pointer\n if (this._platform.IOS && !this._cursorStyleIsSet) {\n this._cursorOriginalValue = body.style.cursor;\n body.style.cursor = 'pointer';\n this._cursorStyleIsSet = true;\n }\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n const body = this._document.body;\n body.removeEventListener('pointerdown', this._pointerDownListener, true);\n body.removeEventListener('click', this._clickListener, true);\n body.removeEventListener('auxclick', this._clickListener, true);\n body.removeEventListener('contextmenu', this._clickListener, true);\n if (this._platform.IOS && this._cursorStyleIsSet) {\n body.style.cursor = this._cursorOriginalValue;\n this._cursorStyleIsSet = false;\n }\n this._isAttached = false;\n }\n }\n _addEventListeners(body) {\n body.addEventListener('pointerdown', this._pointerDownListener, true);\n body.addEventListener('click', this._clickListener, true);\n body.addEventListener('auxclick', this._clickListener, true);\n body.addEventListener('contextmenu', this._clickListener, true);\n }\n}\nOverlayOutsideClickDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }, { token: i0.NgZone, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayOutsideClickDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }, { type: i0.NgZone, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Container inside which all overlays will render. */\nclass OverlayContainer {\n constructor(document, _platform) {\n this._platform = _platform;\n this._document = document;\n }\n ngOnDestroy() {\n this._containerElement?.remove();\n }\n /**\n * This method returns the overlay container element. It will lazily\n * create the element the first time it is called to facilitate using\n * the container in non-browser environments.\n * @returns the container element\n */\n getContainerElement() {\n if (!this._containerElement) {\n this._createContainer();\n }\n return this._containerElement;\n }\n /**\n * Create the overlay container element, which is simply a div\n * with the 'cdk-overlay-container' class on the document body.\n */\n _createContainer() {\n const containerClass = 'cdk-overlay-container';\n // TODO(crisbeto): remove the testing check once we have an overlay testing\n // module or Angular starts tearing down the testing `NgModule`. See:\n // https://github.com/angular/angular/issues/18831\n if (this._platform.isBrowser || _isTestEnvironment()) {\n const oppositePlatformContainers = this._document.querySelectorAll(`.${containerClass}[platform=\"server\"], ` + `.${containerClass}[platform=\"test\"]`);\n // Remove any old containers from the opposite platform.\n // This can happen when transitioning from the server to the client.\n for (let i = 0; i < oppositePlatformContainers.length; i++) {\n oppositePlatformContainers[i].remove();\n }\n }\n const container = this._document.createElement('div');\n container.classList.add(containerClass);\n // A long time ago we kept adding new overlay containers whenever a new app was instantiated,\n // but at some point we added logic which clears the duplicate ones in order to avoid leaks.\n // The new logic was a little too aggressive since it was breaking some legitimate use cases.\n // To mitigate the problem we made it so that only containers from a different platform are\n // cleared, but the side-effect was that people started depending on the overly-aggressive\n // logic to clean up their tests for them. Until we can introduce an overlay-specific testing\n // module which does the cleanup, we try to detect that we're in a test environment and we\n // always clear the container. See #17006.\n // TODO(crisbeto): remove the test environment check once we have an overlay testing module.\n if (_isTestEnvironment()) {\n container.setAttribute('platform', 'test');\n }\n else if (!this._platform.isBrowser) {\n container.setAttribute('platform', 'server');\n }\n this._document.body.appendChild(container);\n this._containerElement = container;\n }\n}\nOverlayContainer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayContainer, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayContainer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayContainer, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayContainer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Reference to an overlay that has been created with the Overlay service.\n * Used to manipulate or dispose of said overlay.\n */\nclass OverlayRef {\n constructor(_portalOutlet, _host, _pane, _config, _ngZone, _keyboardDispatcher, _document, _location, _outsideClickDispatcher) {\n this._portalOutlet = _portalOutlet;\n this._host = _host;\n this._pane = _pane;\n this._config = _config;\n this._ngZone = _ngZone;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._document = _document;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n this._backdropElement = null;\n this._backdropClick = new Subject();\n this._attachments = new Subject();\n this._detachments = new Subject();\n this._locationChanges = Subscription.EMPTY;\n this._backdropClickHandler = (event) => this._backdropClick.next(event);\n this._backdropTransitionendHandler = (event) => {\n this._disposeBackdrop(event.target);\n };\n /** Stream of keydown events dispatched to this overlay. */\n this._keydownEvents = new Subject();\n /** Stream of mouse outside events dispatched to this overlay. */\n this._outsidePointerEvents = new Subject();\n if (_config.scrollStrategy) {\n this._scrollStrategy = _config.scrollStrategy;\n this._scrollStrategy.attach(this);\n }\n this._positionStrategy = _config.positionStrategy;\n }\n /** The overlay's HTML element */\n get overlayElement() {\n return this._pane;\n }\n /** The overlay's backdrop HTML element. */\n get backdropElement() {\n return this._backdropElement;\n }\n /**\n * Wrapper around the panel element. Can be used for advanced\n * positioning where a wrapper with specific styling is\n * required around the overlay pane.\n */\n get hostElement() {\n return this._host;\n }\n /**\n * Attaches content, given via a Portal, to the overlay.\n * If the overlay is configured to have a backdrop, it will be created.\n *\n * @param portal Portal instance to which to attach the overlay.\n * @returns The portal attachment result.\n */\n attach(portal) {\n // Insert the host into the DOM before attaching the portal, otherwise\n // the animations module will skip animations on repeat attachments.\n if (!this._host.parentElement && this._previousHostParent) {\n this._previousHostParent.appendChild(this._host);\n }\n const attachResult = this._portalOutlet.attach(portal);\n if (this._positionStrategy) {\n this._positionStrategy.attach(this);\n }\n this._updateStackingOrder();\n this._updateElementSize();\n this._updateElementDirection();\n if (this._scrollStrategy) {\n this._scrollStrategy.enable();\n }\n // Update the position once the zone is stable so that the overlay will be fully rendered\n // before attempting to position it, as the position may depend on the size of the rendered\n // content.\n this._ngZone.onStable.pipe(take(1)).subscribe(() => {\n // The overlay could've been detached before the zone has stabilized.\n if (this.hasAttached()) {\n this.updatePosition();\n }\n });\n // Enable pointer events for the overlay pane element.\n this._togglePointerEvents(true);\n if (this._config.hasBackdrop) {\n this._attachBackdrop();\n }\n if (this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, true);\n }\n // Only emit the `attachments` event once all other setup is done.\n this._attachments.next();\n // Track this overlay by the keyboard dispatcher\n this._keyboardDispatcher.add(this);\n if (this._config.disposeOnNavigation) {\n this._locationChanges = this._location.subscribe(() => this.dispose());\n }\n this._outsideClickDispatcher.add(this);\n return attachResult;\n }\n /**\n * Detaches an overlay from a portal.\n * @returns The portal detachment result.\n */\n detach() {\n if (!this.hasAttached()) {\n return;\n }\n this.detachBackdrop();\n // When the overlay is detached, the pane element should disable pointer events.\n // This is necessary because otherwise the pane element will cover the page and disable\n // pointer events therefore. Depends on the position strategy and the applied pane boundaries.\n this._togglePointerEvents(false);\n if (this._positionStrategy && this._positionStrategy.detach) {\n this._positionStrategy.detach();\n }\n if (this._scrollStrategy) {\n this._scrollStrategy.disable();\n }\n const detachmentResult = this._portalOutlet.detach();\n // Only emit after everything is detached.\n this._detachments.next();\n // Remove this overlay from keyboard dispatcher tracking.\n this._keyboardDispatcher.remove(this);\n // Keeping the host element in the DOM can cause scroll jank, because it still gets\n // rendered, even though it's transparent and unclickable which is why we remove it.\n this._detachContentWhenStable();\n this._locationChanges.unsubscribe();\n this._outsideClickDispatcher.remove(this);\n return detachmentResult;\n }\n /** Cleans up the overlay from the DOM. */\n dispose() {\n const isAttached = this.hasAttached();\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._disposeScrollStrategy();\n this._disposeBackdrop(this._backdropElement);\n this._locationChanges.unsubscribe();\n this._keyboardDispatcher.remove(this);\n this._portalOutlet.dispose();\n this._attachments.complete();\n this._backdropClick.complete();\n this._keydownEvents.complete();\n this._outsidePointerEvents.complete();\n this._outsideClickDispatcher.remove(this);\n this._host?.remove();\n this._previousHostParent = this._pane = this._host = null;\n if (isAttached) {\n this._detachments.next();\n }\n this._detachments.complete();\n }\n /** Whether the overlay has attached content. */\n hasAttached() {\n return this._portalOutlet.hasAttached();\n }\n /** Gets an observable that emits when the backdrop has been clicked. */\n backdropClick() {\n return this._backdropClick;\n }\n /** Gets an observable that emits when the overlay has been attached. */\n attachments() {\n return this._attachments;\n }\n /** Gets an observable that emits when the overlay has been detached. */\n detachments() {\n return this._detachments;\n }\n /** Gets an observable of keydown events targeted to this overlay. */\n keydownEvents() {\n return this._keydownEvents;\n }\n /** Gets an observable of pointer events targeted outside this overlay. */\n outsidePointerEvents() {\n return this._outsidePointerEvents;\n }\n /** Gets the current overlay configuration, which is immutable. */\n getConfig() {\n return this._config;\n }\n /** Updates the position of the overlay based on the position strategy. */\n updatePosition() {\n if (this._positionStrategy) {\n this._positionStrategy.apply();\n }\n }\n /** Switches to a new position strategy and updates the overlay position. */\n updatePositionStrategy(strategy) {\n if (strategy === this._positionStrategy) {\n return;\n }\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._positionStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n this.updatePosition();\n }\n }\n /** Update the size properties of the overlay. */\n updateSize(sizeConfig) {\n this._config = { ...this._config, ...sizeConfig };\n this._updateElementSize();\n }\n /** Sets the LTR/RTL direction for the overlay. */\n setDirection(dir) {\n this._config = { ...this._config, direction: dir };\n this._updateElementDirection();\n }\n /** Add a CSS class or an array of classes to the overlay pane. */\n addPanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, true);\n }\n }\n /** Remove a CSS class or an array of classes from the overlay pane. */\n removePanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, false);\n }\n }\n /**\n * Returns the layout direction of the overlay panel.\n */\n getDirection() {\n const direction = this._config.direction;\n if (!direction) {\n return 'ltr';\n }\n return typeof direction === 'string' ? direction : direction.value;\n }\n /** Switches to a new scroll strategy. */\n updateScrollStrategy(strategy) {\n if (strategy === this._scrollStrategy) {\n return;\n }\n this._disposeScrollStrategy();\n this._scrollStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n strategy.enable();\n }\n }\n /** Updates the text direction of the overlay panel. */\n _updateElementDirection() {\n this._host.setAttribute('dir', this.getDirection());\n }\n /** Updates the size of the overlay element based on the overlay config. */\n _updateElementSize() {\n if (!this._pane) {\n return;\n }\n const style = this._pane.style;\n style.width = coerceCssPixelValue(this._config.width);\n style.height = coerceCssPixelValue(this._config.height);\n style.minWidth = coerceCssPixelValue(this._config.minWidth);\n style.minHeight = coerceCssPixelValue(this._config.minHeight);\n style.maxWidth = coerceCssPixelValue(this._config.maxWidth);\n style.maxHeight = coerceCssPixelValue(this._config.maxHeight);\n }\n /** Toggles the pointer events for the overlay pane element. */\n _togglePointerEvents(enablePointer) {\n this._pane.style.pointerEvents = enablePointer ? '' : 'none';\n }\n /** Attaches a backdrop for this overlay. */\n _attachBackdrop() {\n const showingClass = 'cdk-overlay-backdrop-showing';\n this._backdropElement = this._document.createElement('div');\n this._backdropElement.classList.add('cdk-overlay-backdrop');\n if (this._config.backdropClass) {\n this._toggleClasses(this._backdropElement, this._config.backdropClass, true);\n }\n // Insert the backdrop before the pane in the DOM order,\n // in order to handle stacked overlays properly.\n this._host.parentElement.insertBefore(this._backdropElement, this._host);\n // Forward backdrop clicks such that the consumer of the overlay can perform whatever\n // action desired when such a click occurs (usually closing the overlay).\n this._backdropElement.addEventListener('click', this._backdropClickHandler);\n // Add class to fade-in the backdrop after one frame.\n if (typeof requestAnimationFrame !== 'undefined') {\n this._ngZone.runOutsideAngular(() => {\n requestAnimationFrame(() => {\n if (this._backdropElement) {\n this._backdropElement.classList.add(showingClass);\n }\n });\n });\n }\n else {\n this._backdropElement.classList.add(showingClass);\n }\n }\n /**\n * Updates the stacking order of the element, moving it to the top if necessary.\n * This is required in cases where one overlay was detached, while another one,\n * that should be behind it, was destroyed. The next time both of them are opened,\n * the stacking will be wrong, because the detached element's pane will still be\n * in its original DOM position.\n */\n _updateStackingOrder() {\n if (this._host.nextSibling) {\n this._host.parentNode.appendChild(this._host);\n }\n }\n /** Detaches the backdrop (if any) associated with the overlay. */\n detachBackdrop() {\n const backdropToDetach = this._backdropElement;\n if (!backdropToDetach) {\n return;\n }\n backdropToDetach.classList.remove('cdk-overlay-backdrop-showing');\n this._ngZone.runOutsideAngular(() => {\n backdropToDetach.addEventListener('transitionend', this._backdropTransitionendHandler);\n });\n // If the backdrop doesn't have a transition, the `transitionend` event won't fire.\n // In this case we make it unclickable and we try to remove it after a delay.\n backdropToDetach.style.pointerEvents = 'none';\n // Run this outside the Angular zone because there's nothing that Angular cares about.\n // If it were to run inside the Angular zone, every test that used Overlay would have to be\n // either async or fakeAsync.\n this._backdropTimeout = this._ngZone.runOutsideAngular(() => setTimeout(() => {\n this._disposeBackdrop(backdropToDetach);\n }, 500));\n }\n /** Toggles a single CSS class or an array of classes on an element. */\n _toggleClasses(element, cssClasses, isAdd) {\n const classes = coerceArray(cssClasses || []).filter(c => !!c);\n if (classes.length) {\n isAdd ? element.classList.add(...classes) : element.classList.remove(...classes);\n }\n }\n /** Detaches the overlay content next time the zone stabilizes. */\n _detachContentWhenStable() {\n // Normally we wouldn't have to explicitly run this outside the `NgZone`, however\n // if the consumer is using `zone-patch-rxjs`, the `Subscription.unsubscribe` call will\n // be patched to run inside the zone, which will throw us into an infinite loop.\n this._ngZone.runOutsideAngular(() => {\n // We can't remove the host here immediately, because the overlay pane's content\n // might still be animating. This stream helps us avoid interrupting the animation\n // by waiting for the pane to become empty.\n const subscription = this._ngZone.onStable\n .pipe(takeUntil(merge(this._attachments, this._detachments)))\n .subscribe(() => {\n // Needs a couple of checks for the pane and host, because\n // they may have been removed by the time the zone stabilizes.\n if (!this._pane || !this._host || this._pane.children.length === 0) {\n if (this._pane && this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, false);\n }\n if (this._host && this._host.parentElement) {\n this._previousHostParent = this._host.parentElement;\n this._host.remove();\n }\n subscription.unsubscribe();\n }\n });\n });\n }\n /** Disposes of a scroll strategy. */\n _disposeScrollStrategy() {\n const scrollStrategy = this._scrollStrategy;\n if (scrollStrategy) {\n scrollStrategy.disable();\n if (scrollStrategy.detach) {\n scrollStrategy.detach();\n }\n }\n }\n /** Removes a backdrop element from the DOM. */\n _disposeBackdrop(backdrop) {\n if (backdrop) {\n backdrop.removeEventListener('click', this._backdropClickHandler);\n backdrop.removeEventListener('transitionend', this._backdropTransitionendHandler);\n backdrop.remove();\n // It is possible that a new portal has been attached to this overlay since we started\n // removing the backdrop. If that is the case, only clear the backdrop reference if it\n // is still the same instance that we started to remove.\n if (this._backdropElement === backdrop) {\n this._backdropElement = null;\n }\n }\n if (this._backdropTimeout) {\n clearTimeout(this._backdropTimeout);\n this._backdropTimeout = undefined;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// TODO: refactor clipping detection into a separate thing (part of scrolling module)\n// TODO: doesn't handle both flexible width and height when it has to scroll along both axis.\n/** Class to be added to the overlay bounding box. */\nconst boundingBoxClass = 'cdk-overlay-connected-position-bounding-box';\n/** Regex used to split a string on its CSS units. */\nconst cssUnitPattern = /([A-Za-z%]+)$/;\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * implicit position relative some origin element. The relative position is defined in terms of\n * a point on the origin element that is connected to a point on the overlay element. For example,\n * a basic dropdown is connecting the bottom-left corner of the origin to the top-left corner\n * of the overlay.\n */\nclass FlexibleConnectedPositionStrategy {\n constructor(connectedTo, _viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n /** Last size used for the bounding box. Used to avoid resizing the overlay after open. */\n this._lastBoundingBoxSize = { width: 0, height: 0 };\n /** Whether the overlay was pushed in a previous positioning. */\n this._isPushed = false;\n /** Whether the overlay can be pushed on-screen on the initial open. */\n this._canPush = true;\n /** Whether the overlay can grow via flexible width/height after the initial open. */\n this._growAfterOpen = false;\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n this._hasFlexibleDimensions = true;\n /** Whether the overlay position is locked. */\n this._positionLocked = false;\n /** Amount of space that must be maintained between the overlay and the edge of the viewport. */\n this._viewportMargin = 0;\n /** The Scrollable containers used to check scrollable view properties on position change. */\n this._scrollables = [];\n /** Ordered list of preferred positions, from most to least desirable. */\n this._preferredPositions = [];\n /** Subject that emits whenever the position changes. */\n this._positionChanges = new Subject();\n /** Subscription to viewport size changes. */\n this._resizeSubscription = Subscription.EMPTY;\n /** Default offset for the overlay along the x axis. */\n this._offsetX = 0;\n /** Default offset for the overlay along the y axis. */\n this._offsetY = 0;\n /** Keeps track of the CSS classes that the position strategy has applied on the overlay panel. */\n this._appliedPanelClasses = [];\n /** Observable sequence of position changes. */\n this.positionChanges = this._positionChanges;\n this.setOrigin(connectedTo);\n }\n /** Ordered list of preferred positions, from most to least desirable. */\n get positions() {\n return this._preferredPositions;\n }\n /** Attaches this position strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef &&\n overlayRef !== this._overlayRef &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('This position strategy is already attached to an overlay');\n }\n this._validatePositions();\n overlayRef.hostElement.classList.add(boundingBoxClass);\n this._overlayRef = overlayRef;\n this._boundingBox = overlayRef.hostElement;\n this._pane = overlayRef.overlayElement;\n this._isDisposed = false;\n this._isInitialRender = true;\n this._lastPosition = null;\n this._resizeSubscription.unsubscribe();\n this._resizeSubscription = this._viewportRuler.change().subscribe(() => {\n // When the window is resized, we want to trigger the next reposition as if it\n // was an initial render, in order for the strategy to pick a new optimal position,\n // otherwise position locking will cause it to stay at the old one.\n this._isInitialRender = true;\n this.apply();\n });\n }\n /**\n * Updates the position of the overlay element, using whichever preferred position relative\n * to the origin best fits on-screen.\n *\n * The selection of a position goes as follows:\n * - If any positions fit completely within the viewport as-is,\n * choose the first position that does so.\n * - If flexible dimensions are enabled and at least one satifies the given minimum width/height,\n * choose the position with the greatest available size modified by the positions' weight.\n * - If pushing is enabled, take the position that went off-screen the least and push it\n * on-screen.\n * - If none of the previous criteria were met, use the position that goes off-screen the least.\n * @docs-private\n */\n apply() {\n // We shouldn't do anything if the strategy was disposed or we're on the server.\n if (this._isDisposed || !this._platform.isBrowser) {\n return;\n }\n // If the position has been applied already (e.g. when the overlay was opened) and the\n // consumer opted into locking in the position, re-use the old position, in order to\n // prevent the overlay from jumping around.\n if (!this._isInitialRender && this._positionLocked && this._lastPosition) {\n this.reapplyLastPosition();\n return;\n }\n this._clearPanelClasses();\n this._resetOverlayElementStyles();\n this._resetBoundingBoxStyles();\n // We need the bounding rects for the origin, the overlay and the container to determine how to position\n // the overlay relative to the origin.\n // We use the viewport rect to determine whether a position would go off-screen.\n this._viewportRect = this._getNarrowedViewportRect();\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n this._containerRect = this._overlayContainer.getContainerElement().getBoundingClientRect();\n const originRect = this._originRect;\n const overlayRect = this._overlayRect;\n const viewportRect = this._viewportRect;\n const containerRect = this._containerRect;\n // Positions where the overlay will fit with flexible dimensions.\n const flexibleFits = [];\n // Fallback if none of the preferred positions fit within the viewport.\n let fallback;\n // Go through each of the preferred positions looking for a good fit.\n // If a good fit is found, it will be applied immediately.\n for (let pos of this._preferredPositions) {\n // Get the exact (x, y) coordinate for the point-of-origin on the origin element.\n let originPoint = this._getOriginPoint(originRect, containerRect, pos);\n // From that point-of-origin, get the exact (x, y) coordinate for the top-left corner of the\n // overlay in this position. We use the top-left corner for calculations and later translate\n // this into an appropriate (top, left, bottom, right) style.\n let overlayPoint = this._getOverlayPoint(originPoint, overlayRect, pos);\n // Calculate how well the overlay would fit into the viewport with this point.\n let overlayFit = this._getOverlayFit(overlayPoint, overlayRect, viewportRect, pos);\n // If the overlay, without any further work, fits into the viewport, use this position.\n if (overlayFit.isCompletelyWithinViewport) {\n this._isPushed = false;\n this._applyPosition(pos, originPoint);\n return;\n }\n // If the overlay has flexible dimensions, we can use this position\n // so long as there's enough space for the minimum dimensions.\n if (this._canFitWithFlexibleDimensions(overlayFit, overlayPoint, viewportRect)) {\n // Save positions where the overlay will fit with flexible dimensions. We will use these\n // if none of the positions fit *without* flexible dimensions.\n flexibleFits.push({\n position: pos,\n origin: originPoint,\n overlayRect,\n boundingBoxRect: this._calculateBoundingBoxRect(originPoint, pos),\n });\n continue;\n }\n // If the current preferred position does not fit on the screen, remember the position\n // if it has more visible area on-screen than we've seen and move onto the next preferred\n // position.\n if (!fallback || fallback.overlayFit.visibleArea < overlayFit.visibleArea) {\n fallback = { overlayFit, overlayPoint, originPoint, position: pos, overlayRect };\n }\n }\n // If there are any positions where the overlay would fit with flexible dimensions, choose the\n // one that has the greatest area available modified by the position's weight\n if (flexibleFits.length) {\n let bestFit = null;\n let bestScore = -1;\n for (const fit of flexibleFits) {\n const score = fit.boundingBoxRect.width * fit.boundingBoxRect.height * (fit.position.weight || 1);\n if (score > bestScore) {\n bestScore = score;\n bestFit = fit;\n }\n }\n this._isPushed = false;\n this._applyPosition(bestFit.position, bestFit.origin);\n return;\n }\n // When none of the preferred positions fit within the viewport, take the position\n // that went off-screen the least and attempt to push it on-screen.\n if (this._canPush) {\n // TODO(jelbourn): after pushing, the opening \"direction\" of the overlay might not make sense.\n this._isPushed = true;\n this._applyPosition(fallback.position, fallback.originPoint);\n return;\n }\n // All options for getting the overlay within the viewport have been exhausted, so go with the\n // position that went off-screen the least.\n this._applyPosition(fallback.position, fallback.originPoint);\n }\n detach() {\n this._clearPanelClasses();\n this._lastPosition = null;\n this._previousPushAmount = null;\n this._resizeSubscription.unsubscribe();\n }\n /** Cleanup after the element gets destroyed. */\n dispose() {\n if (this._isDisposed) {\n return;\n }\n // We can't use `_resetBoundingBoxStyles` here, because it resets\n // some properties to zero, rather than removing them.\n if (this._boundingBox) {\n extendStyles(this._boundingBox.style, {\n top: '',\n left: '',\n right: '',\n bottom: '',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n if (this._pane) {\n this._resetOverlayElementStyles();\n }\n if (this._overlayRef) {\n this._overlayRef.hostElement.classList.remove(boundingBoxClass);\n }\n this.detach();\n this._positionChanges.complete();\n this._overlayRef = this._boundingBox = null;\n this._isDisposed = true;\n }\n /**\n * This re-aligns the overlay element with the trigger in its last calculated position,\n * even if a position higher in the \"preferred positions\" list would now fit. This\n * allows one to re-align the panel without changing the orientation of the panel.\n */\n reapplyLastPosition() {\n if (this._isDisposed || !this._platform.isBrowser) {\n return;\n }\n const lastPosition = this._lastPosition;\n if (lastPosition) {\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n this._viewportRect = this._getNarrowedViewportRect();\n this._containerRect = this._overlayContainer.getContainerElement().getBoundingClientRect();\n const originPoint = this._getOriginPoint(this._originRect, this._containerRect, lastPosition);\n this._applyPosition(lastPosition, originPoint);\n }\n else {\n this.apply();\n }\n }\n /**\n * Sets the list of Scrollable containers that host the origin element so that\n * on reposition we can evaluate if it or the overlay has been clipped or outside view. Every\n * Scrollable must be an ancestor element of the strategy's origin element.\n */\n withScrollableContainers(scrollables) {\n this._scrollables = scrollables;\n return this;\n }\n /**\n * Adds new preferred positions.\n * @param positions List of positions options for this overlay.\n */\n withPositions(positions) {\n this._preferredPositions = positions;\n // If the last calculated position object isn't part of the positions anymore, clear\n // it in order to avoid it being picked up if the consumer tries to re-apply.\n if (positions.indexOf(this._lastPosition) === -1) {\n this._lastPosition = null;\n }\n this._validatePositions();\n return this;\n }\n /**\n * Sets a minimum distance the overlay may be positioned to the edge of the viewport.\n * @param margin Required margin between the overlay and the viewport edge in pixels.\n */\n withViewportMargin(margin) {\n this._viewportMargin = margin;\n return this;\n }\n /** Sets whether the overlay's width and height can be constrained to fit within the viewport. */\n withFlexibleDimensions(flexibleDimensions = true) {\n this._hasFlexibleDimensions = flexibleDimensions;\n return this;\n }\n /** Sets whether the overlay can grow after the initial open via flexible width/height. */\n withGrowAfterOpen(growAfterOpen = true) {\n this._growAfterOpen = growAfterOpen;\n return this;\n }\n /** Sets whether the overlay can be pushed on-screen if none of the provided positions fit. */\n withPush(canPush = true) {\n this._canPush = canPush;\n return this;\n }\n /**\n * Sets whether the overlay's position should be locked in after it is positioned\n * initially. When an overlay is locked in, it won't attempt to reposition itself\n * when the position is re-applied (e.g. when the user scrolls away).\n * @param isLocked Whether the overlay should locked in.\n */\n withLockedPosition(isLocked = true) {\n this._positionLocked = isLocked;\n return this;\n }\n /**\n * Sets the origin, relative to which to position the overlay.\n * Using an element origin is useful for building components that need to be positioned\n * relatively to a trigger (e.g. dropdown menus or tooltips), whereas using a point can be\n * used for cases like contextual menus which open relative to the user's pointer.\n * @param origin Reference to the new origin.\n */\n setOrigin(origin) {\n this._origin = origin;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the x-axis.\n * @param offset New offset in the X axis.\n */\n withDefaultOffsetX(offset) {\n this._offsetX = offset;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the y-axis.\n * @param offset New offset in the Y axis.\n */\n withDefaultOffsetY(offset) {\n this._offsetY = offset;\n return this;\n }\n /**\n * Configures that the position strategy should set a `transform-origin` on some elements\n * inside the overlay, depending on the current position that is being applied. This is\n * useful for the cases where the origin of an animation can change depending on the\n * alignment of the overlay.\n * @param selector CSS selector that will be used to find the target\n * elements onto which to set the transform origin.\n */\n withTransformOriginOn(selector) {\n this._transformOriginSelector = selector;\n return this;\n }\n /**\n * Gets the (x, y) coordinate of a connection point on the origin based on a relative position.\n */\n _getOriginPoint(originRect, containerRect, pos) {\n let x;\n if (pos.originX == 'center') {\n // Note: when centering we should always use the `left`\n // offset, otherwise the position will be wrong in RTL.\n x = originRect.left + originRect.width / 2;\n }\n else {\n const startX = this._isRtl() ? originRect.right : originRect.left;\n const endX = this._isRtl() ? originRect.left : originRect.right;\n x = pos.originX == 'start' ? startX : endX;\n }\n // When zooming in Safari the container rectangle contains negative values for the position\n // and we need to re-add them to the calculated coordinates.\n if (containerRect.left < 0) {\n x -= containerRect.left;\n }\n let y;\n if (pos.originY == 'center') {\n y = originRect.top + originRect.height / 2;\n }\n else {\n y = pos.originY == 'top' ? originRect.top : originRect.bottom;\n }\n // Normally the containerRect's top value would be zero, however when the overlay is attached to an input\n // (e.g. in an autocomplete), mobile browsers will shift everything in order to put the input in the middle\n // of the screen and to make space for the virtual keyboard. We need to account for this offset,\n // otherwise our positioning will be thrown off.\n // Additionally, when zooming in Safari this fixes the vertical position.\n if (containerRect.top < 0) {\n y -= containerRect.top;\n }\n return { x, y };\n }\n /**\n * Gets the (x, y) coordinate of the top-left corner of the overlay given a given position and\n * origin point to which the overlay should be connected.\n */\n _getOverlayPoint(originPoint, overlayRect, pos) {\n // Calculate the (overlayStartX, overlayStartY), the start of the\n // potential overlay position relative to the origin point.\n let overlayStartX;\n if (pos.overlayX == 'center') {\n overlayStartX = -overlayRect.width / 2;\n }\n else if (pos.overlayX === 'start') {\n overlayStartX = this._isRtl() ? -overlayRect.width : 0;\n }\n else {\n overlayStartX = this._isRtl() ? 0 : -overlayRect.width;\n }\n let overlayStartY;\n if (pos.overlayY == 'center') {\n overlayStartY = -overlayRect.height / 2;\n }\n else {\n overlayStartY = pos.overlayY == 'top' ? 0 : -overlayRect.height;\n }\n // The (x, y) coordinates of the overlay.\n return {\n x: originPoint.x + overlayStartX,\n y: originPoint.y + overlayStartY,\n };\n }\n /** Gets how well an overlay at the given point will fit within the viewport. */\n _getOverlayFit(point, rawOverlayRect, viewport, position) {\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n let { x, y } = point;\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n // Account for the offsets since they could push the overlay out of the viewport.\n if (offsetX) {\n x += offsetX;\n }\n if (offsetY) {\n y += offsetY;\n }\n // How much the overlay would overflow at this position, on each side.\n let leftOverflow = 0 - x;\n let rightOverflow = x + overlay.width - viewport.width;\n let topOverflow = 0 - y;\n let bottomOverflow = y + overlay.height - viewport.height;\n // Visible parts of the element on each axis.\n let visibleWidth = this._subtractOverflows(overlay.width, leftOverflow, rightOverflow);\n let visibleHeight = this._subtractOverflows(overlay.height, topOverflow, bottomOverflow);\n let visibleArea = visibleWidth * visibleHeight;\n return {\n visibleArea,\n isCompletelyWithinViewport: overlay.width * overlay.height === visibleArea,\n fitsInViewportVertically: visibleHeight === overlay.height,\n fitsInViewportHorizontally: visibleWidth == overlay.width,\n };\n }\n /**\n * Whether the overlay can fit within the viewport when it may resize either its width or height.\n * @param fit How well the overlay fits in the viewport at some position.\n * @param point The (x, y) coordinates of the overlay at some position.\n * @param viewport The geometry of the viewport.\n */\n _canFitWithFlexibleDimensions(fit, point, viewport) {\n if (this._hasFlexibleDimensions) {\n const availableHeight = viewport.bottom - point.y;\n const availableWidth = viewport.right - point.x;\n const minHeight = getPixelValue(this._overlayRef.getConfig().minHeight);\n const minWidth = getPixelValue(this._overlayRef.getConfig().minWidth);\n const verticalFit = fit.fitsInViewportVertically || (minHeight != null && minHeight <= availableHeight);\n const horizontalFit = fit.fitsInViewportHorizontally || (minWidth != null && minWidth <= availableWidth);\n return verticalFit && horizontalFit;\n }\n return false;\n }\n /**\n * Gets the point at which the overlay can be \"pushed\" on-screen. If the overlay is larger than\n * the viewport, the top-left corner will be pushed on-screen (with overflow occuring on the\n * right and bottom).\n *\n * @param start Starting point from which the overlay is pushed.\n * @param rawOverlayRect Dimensions of the overlay.\n * @param scrollPosition Current viewport scroll position.\n * @returns The point at which to position the overlay after pushing. This is effectively a new\n * originPoint.\n */\n _pushOverlayOnScreen(start, rawOverlayRect, scrollPosition) {\n // If the position is locked and we've pushed the overlay already, reuse the previous push\n // amount, rather than pushing it again. If we were to continue pushing, the element would\n // remain in the viewport, which goes against the expectations when position locking is enabled.\n if (this._previousPushAmount && this._positionLocked) {\n return {\n x: start.x + this._previousPushAmount.x,\n y: start.y + this._previousPushAmount.y,\n };\n }\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n const viewport = this._viewportRect;\n // Determine how much the overlay goes outside the viewport on each\n // side, which we'll use to decide which direction to push it.\n const overflowRight = Math.max(start.x + overlay.width - viewport.width, 0);\n const overflowBottom = Math.max(start.y + overlay.height - viewport.height, 0);\n const overflowTop = Math.max(viewport.top - scrollPosition.top - start.y, 0);\n const overflowLeft = Math.max(viewport.left - scrollPosition.left - start.x, 0);\n // Amount by which to push the overlay in each axis such that it remains on-screen.\n let pushX = 0;\n let pushY = 0;\n // If the overlay fits completely within the bounds of the viewport, push it from whichever\n // direction is goes off-screen. Otherwise, push the top-left corner such that its in the\n // viewport and allow for the trailing end of the overlay to go out of bounds.\n if (overlay.width <= viewport.width) {\n pushX = overflowLeft || -overflowRight;\n }\n else {\n pushX = start.x < this._viewportMargin ? viewport.left - scrollPosition.left - start.x : 0;\n }\n if (overlay.height <= viewport.height) {\n pushY = overflowTop || -overflowBottom;\n }\n else {\n pushY = start.y < this._viewportMargin ? viewport.top - scrollPosition.top - start.y : 0;\n }\n this._previousPushAmount = { x: pushX, y: pushY };\n return {\n x: start.x + pushX,\n y: start.y + pushY,\n };\n }\n /**\n * Applies a computed position to the overlay and emits a position change.\n * @param position The position preference\n * @param originPoint The point on the origin element where the overlay is connected.\n */\n _applyPosition(position, originPoint) {\n this._setTransformOrigin(position);\n this._setOverlayElementStyles(originPoint, position);\n this._setBoundingBoxStyles(originPoint, position);\n if (position.panelClass) {\n this._addPanelClasses(position.panelClass);\n }\n // Save the last connected position in case the position needs to be re-calculated.\n this._lastPosition = position;\n // Notify that the position has been changed along with its change properties.\n // We only emit if we've got any subscriptions, because the scroll visibility\n // calculcations can be somewhat expensive.\n if (this._positionChanges.observers.length) {\n const scrollableViewProperties = this._getScrollVisibility();\n const changeEvent = new ConnectedOverlayPositionChange(position, scrollableViewProperties);\n this._positionChanges.next(changeEvent);\n }\n this._isInitialRender = false;\n }\n /** Sets the transform origin based on the configured selector and the passed-in position. */\n _setTransformOrigin(position) {\n if (!this._transformOriginSelector) {\n return;\n }\n const elements = this._boundingBox.querySelectorAll(this._transformOriginSelector);\n let xOrigin;\n let yOrigin = position.overlayY;\n if (position.overlayX === 'center') {\n xOrigin = 'center';\n }\n else if (this._isRtl()) {\n xOrigin = position.overlayX === 'start' ? 'right' : 'left';\n }\n else {\n xOrigin = position.overlayX === 'start' ? 'left' : 'right';\n }\n for (let i = 0; i < elements.length; i++) {\n elements[i].style.transformOrigin = `${xOrigin} ${yOrigin}`;\n }\n }\n /**\n * Gets the position and size of the overlay's sizing container.\n *\n * This method does no measuring and applies no styles so that we can cheaply compute the\n * bounds for all positions and choose the best fit based on these results.\n */\n _calculateBoundingBoxRect(origin, position) {\n const viewport = this._viewportRect;\n const isRtl = this._isRtl();\n let height, top, bottom;\n if (position.overlayY === 'top') {\n // Overlay is opening \"downward\" and thus is bound by the bottom viewport edge.\n top = origin.y;\n height = viewport.height - top + this._viewportMargin;\n }\n else if (position.overlayY === 'bottom') {\n // Overlay is opening \"upward\" and thus is bound by the top viewport edge. We need to add\n // the viewport margin back in, because the viewport rect is narrowed down to remove the\n // margin, whereas the `origin` position is calculated based on its `ClientRect`.\n bottom = viewport.height - origin.y + this._viewportMargin * 2;\n height = viewport.height - bottom + this._viewportMargin;\n }\n else {\n // If neither top nor bottom, it means that the overlay is vertically centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.bottom - origin.y` and\n // `origin.y - viewport.top`.\n const smallestDistanceToViewportEdge = Math.min(viewport.bottom - origin.y + viewport.top, origin.y);\n const previousHeight = this._lastBoundingBoxSize.height;\n height = smallestDistanceToViewportEdge * 2;\n top = origin.y - smallestDistanceToViewportEdge;\n if (height > previousHeight && !this._isInitialRender && !this._growAfterOpen) {\n top = origin.y - previousHeight / 2;\n }\n }\n // The overlay is opening 'right-ward' (the content flows to the right).\n const isBoundedByRightViewportEdge = (position.overlayX === 'start' && !isRtl) || (position.overlayX === 'end' && isRtl);\n // The overlay is opening 'left-ward' (the content flows to the left).\n const isBoundedByLeftViewportEdge = (position.overlayX === 'end' && !isRtl) || (position.overlayX === 'start' && isRtl);\n let width, left, right;\n if (isBoundedByLeftViewportEdge) {\n right = viewport.width - origin.x + this._viewportMargin;\n width = origin.x - this._viewportMargin;\n }\n else if (isBoundedByRightViewportEdge) {\n left = origin.x;\n width = viewport.right - origin.x;\n }\n else {\n // If neither start nor end, it means that the overlay is horizontally centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.right - origin.x` and\n // `origin.x - viewport.left`.\n const smallestDistanceToViewportEdge = Math.min(viewport.right - origin.x + viewport.left, origin.x);\n const previousWidth = this._lastBoundingBoxSize.width;\n width = smallestDistanceToViewportEdge * 2;\n left = origin.x - smallestDistanceToViewportEdge;\n if (width > previousWidth && !this._isInitialRender && !this._growAfterOpen) {\n left = origin.x - previousWidth / 2;\n }\n }\n return { top: top, left: left, bottom: bottom, right: right, width, height };\n }\n /**\n * Sets the position and size of the overlay's sizing wrapper. The wrapper is positioned on the\n * origin's connection point and stetches to the bounds of the viewport.\n *\n * @param origin The point on the origin element where the overlay is connected.\n * @param position The position preference\n */\n _setBoundingBoxStyles(origin, position) {\n const boundingBoxRect = this._calculateBoundingBoxRect(origin, position);\n // It's weird if the overlay *grows* while scrolling, so we take the last size into account\n // when applying a new size.\n if (!this._isInitialRender && !this._growAfterOpen) {\n boundingBoxRect.height = Math.min(boundingBoxRect.height, this._lastBoundingBoxSize.height);\n boundingBoxRect.width = Math.min(boundingBoxRect.width, this._lastBoundingBoxSize.width);\n }\n const styles = {};\n if (this._hasExactPosition()) {\n styles.top = styles.left = '0';\n styles.bottom = styles.right = styles.maxHeight = styles.maxWidth = '';\n styles.width = styles.height = '100%';\n }\n else {\n const maxHeight = this._overlayRef.getConfig().maxHeight;\n const maxWidth = this._overlayRef.getConfig().maxWidth;\n styles.height = coerceCssPixelValue(boundingBoxRect.height);\n styles.top = coerceCssPixelValue(boundingBoxRect.top);\n styles.bottom = coerceCssPixelValue(boundingBoxRect.bottom);\n styles.width = coerceCssPixelValue(boundingBoxRect.width);\n styles.left = coerceCssPixelValue(boundingBoxRect.left);\n styles.right = coerceCssPixelValue(boundingBoxRect.right);\n // Push the pane content towards the proper direction.\n if (position.overlayX === 'center') {\n styles.alignItems = 'center';\n }\n else {\n styles.alignItems = position.overlayX === 'end' ? 'flex-end' : 'flex-start';\n }\n if (position.overlayY === 'center') {\n styles.justifyContent = 'center';\n }\n else {\n styles.justifyContent = position.overlayY === 'bottom' ? 'flex-end' : 'flex-start';\n }\n if (maxHeight) {\n styles.maxHeight = coerceCssPixelValue(maxHeight);\n }\n if (maxWidth) {\n styles.maxWidth = coerceCssPixelValue(maxWidth);\n }\n }\n this._lastBoundingBoxSize = boundingBoxRect;\n extendStyles(this._boundingBox.style, styles);\n }\n /** Resets the styles for the bounding box so that a new positioning can be computed. */\n _resetBoundingBoxStyles() {\n extendStyles(this._boundingBox.style, {\n top: '0',\n left: '0',\n right: '0',\n bottom: '0',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n /** Resets the styles for the overlay pane so that a new positioning can be computed. */\n _resetOverlayElementStyles() {\n extendStyles(this._pane.style, {\n top: '',\n left: '',\n bottom: '',\n right: '',\n position: '',\n transform: '',\n });\n }\n /** Sets positioning styles to the overlay element. */\n _setOverlayElementStyles(originPoint, position) {\n const styles = {};\n const hasExactPosition = this._hasExactPosition();\n const hasFlexibleDimensions = this._hasFlexibleDimensions;\n const config = this._overlayRef.getConfig();\n if (hasExactPosition) {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n extendStyles(styles, this._getExactOverlayY(position, originPoint, scrollPosition));\n extendStyles(styles, this._getExactOverlayX(position, originPoint, scrollPosition));\n }\n else {\n styles.position = 'static';\n }\n // Use a transform to apply the offsets. We do this because the `center` positions rely on\n // being in the normal flex flow and setting a `top` / `left` at all will completely throw\n // off the position. We also can't use margins, because they won't have an effect in some\n // cases where the element doesn't have anything to \"push off of\". Finally, this works\n // better both with flexible and non-flexible positioning.\n let transformString = '';\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n if (offsetX) {\n transformString += `translateX(${offsetX}px) `;\n }\n if (offsetY) {\n transformString += `translateY(${offsetY}px)`;\n }\n styles.transform = transformString.trim();\n // If a maxWidth or maxHeight is specified on the overlay, we remove them. We do this because\n // we need these values to both be set to \"100%\" for the automatic flexible sizing to work.\n // The maxHeight and maxWidth are set on the boundingBox in order to enforce the constraint.\n // Note that this doesn't apply when we have an exact position, in which case we do want to\n // apply them because they'll be cleared from the bounding box.\n if (config.maxHeight) {\n if (hasExactPosition) {\n styles.maxHeight = coerceCssPixelValue(config.maxHeight);\n }\n else if (hasFlexibleDimensions) {\n styles.maxHeight = '';\n }\n }\n if (config.maxWidth) {\n if (hasExactPosition) {\n styles.maxWidth = coerceCssPixelValue(config.maxWidth);\n }\n else if (hasFlexibleDimensions) {\n styles.maxWidth = '';\n }\n }\n extendStyles(this._pane.style, styles);\n }\n /** Gets the exact top/bottom for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayY(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the\n // preferred position has changed since the last `apply`.\n let styles = { top: '', bottom: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n // We want to set either `top` or `bottom` based on whether the overlay wants to appear\n // above or below the origin and the direction in which the element will expand.\n if (position.overlayY === 'bottom') {\n // When using `bottom`, we adjust the y position such that it is the distance\n // from the bottom of the viewport rather than the top.\n const documentHeight = this._document.documentElement.clientHeight;\n styles.bottom = `${documentHeight - (overlayPoint.y + this._overlayRect.height)}px`;\n }\n else {\n styles.top = coerceCssPixelValue(overlayPoint.y);\n }\n return styles;\n }\n /** Gets the exact left/right for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayX(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the preferred position has\n // changed since the last `apply`.\n let styles = { left: '', right: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n // We want to set either `left` or `right` based on whether the overlay wants to appear \"before\"\n // or \"after\" the origin, which determines the direction in which the element will expand.\n // For the horizontal axis, the meaning of \"before\" and \"after\" change based on whether the\n // page is in RTL or LTR.\n let horizontalStyleProperty;\n if (this._isRtl()) {\n horizontalStyleProperty = position.overlayX === 'end' ? 'left' : 'right';\n }\n else {\n horizontalStyleProperty = position.overlayX === 'end' ? 'right' : 'left';\n }\n // When we're setting `right`, we adjust the x position such that it is the distance\n // from the right edge of the viewport rather than the left edge.\n if (horizontalStyleProperty === 'right') {\n const documentWidth = this._document.documentElement.clientWidth;\n styles.right = `${documentWidth - (overlayPoint.x + this._overlayRect.width)}px`;\n }\n else {\n styles.left = coerceCssPixelValue(overlayPoint.x);\n }\n return styles;\n }\n /**\n * Gets the view properties of the trigger and overlay, including whether they are clipped\n * or completely outside the view of any of the strategy's scrollables.\n */\n _getScrollVisibility() {\n // Note: needs fresh rects since the position could've changed.\n const originBounds = this._getOriginRect();\n const overlayBounds = this._pane.getBoundingClientRect();\n // TODO(jelbourn): instead of needing all of the client rects for these scrolling containers\n // every time, we should be able to use the scrollTop of the containers if the size of those\n // containers hasn't changed.\n const scrollContainerBounds = this._scrollables.map(scrollable => {\n return scrollable.getElementRef().nativeElement.getBoundingClientRect();\n });\n return {\n isOriginClipped: isElementClippedByScrolling(originBounds, scrollContainerBounds),\n isOriginOutsideView: isElementScrolledOutsideView(originBounds, scrollContainerBounds),\n isOverlayClipped: isElementClippedByScrolling(overlayBounds, scrollContainerBounds),\n isOverlayOutsideView: isElementScrolledOutsideView(overlayBounds, scrollContainerBounds),\n };\n }\n /** Subtracts the amount that an element is overflowing on an axis from its length. */\n _subtractOverflows(length, ...overflows) {\n return overflows.reduce((currentValue, currentOverflow) => {\n return currentValue - Math.max(currentOverflow, 0);\n }, length);\n }\n /** Narrows the given viewport rect by the current _viewportMargin. */\n _getNarrowedViewportRect() {\n // We recalculate the viewport rect here ourselves, rather than using the ViewportRuler,\n // because we want to use the `clientWidth` and `clientHeight` as the base. The difference\n // being that the client properties don't include the scrollbar, as opposed to `innerWidth`\n // and `innerHeight` that do. This is necessary, because the overlay container uses\n // 100% `width` and `height` which don't include the scrollbar either.\n const width = this._document.documentElement.clientWidth;\n const height = this._document.documentElement.clientHeight;\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n return {\n top: scrollPosition.top + this._viewportMargin,\n left: scrollPosition.left + this._viewportMargin,\n right: scrollPosition.left + width - this._viewportMargin,\n bottom: scrollPosition.top + height - this._viewportMargin,\n width: width - 2 * this._viewportMargin,\n height: height - 2 * this._viewportMargin,\n };\n }\n /** Whether the we're dealing with an RTL context */\n _isRtl() {\n return this._overlayRef.getDirection() === 'rtl';\n }\n /** Determines whether the overlay uses exact or flexible positioning. */\n _hasExactPosition() {\n return !this._hasFlexibleDimensions || this._isPushed;\n }\n /** Retrieves the offset of a position along the x or y axis. */\n _getOffset(position, axis) {\n if (axis === 'x') {\n // We don't do something like `position['offset' + axis]` in\n // order to avoid breking minifiers that rename properties.\n return position.offsetX == null ? this._offsetX : position.offsetX;\n }\n return position.offsetY == null ? this._offsetY : position.offsetY;\n }\n /** Validates that the current position match the expected values. */\n _validatePositions() {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!this._preferredPositions.length) {\n throw Error('FlexibleConnectedPositionStrategy: At least one position is required.');\n }\n // TODO(crisbeto): remove these once Angular's template type\n // checking is advanced enough to catch these cases.\n this._preferredPositions.forEach(pair => {\n validateHorizontalPosition('originX', pair.originX);\n validateVerticalPosition('originY', pair.originY);\n validateHorizontalPosition('overlayX', pair.overlayX);\n validateVerticalPosition('overlayY', pair.overlayY);\n });\n }\n }\n /** Adds a single CSS class or an array of classes on the overlay panel. */\n _addPanelClasses(cssClasses) {\n if (this._pane) {\n coerceArray(cssClasses).forEach(cssClass => {\n if (cssClass !== '' && this._appliedPanelClasses.indexOf(cssClass) === -1) {\n this._appliedPanelClasses.push(cssClass);\n this._pane.classList.add(cssClass);\n }\n });\n }\n }\n /** Clears the classes that the position strategy has applied from the overlay panel. */\n _clearPanelClasses() {\n if (this._pane) {\n this._appliedPanelClasses.forEach(cssClass => {\n this._pane.classList.remove(cssClass);\n });\n this._appliedPanelClasses = [];\n }\n }\n /** Returns the ClientRect of the current origin. */\n _getOriginRect() {\n const origin = this._origin;\n if (origin instanceof ElementRef) {\n return origin.nativeElement.getBoundingClientRect();\n }\n // Check for Element so SVG elements are also supported.\n if (origin instanceof Element) {\n return origin.getBoundingClientRect();\n }\n const width = origin.width || 0;\n const height = origin.height || 0;\n // If the origin is a point, return a client rect as if it was a 0x0 element at the point.\n return {\n top: origin.y,\n bottom: origin.y + height,\n left: origin.x,\n right: origin.x + width,\n height,\n width,\n };\n }\n}\n/** Shallow-extends a stylesheet object with another stylesheet object. */\nfunction extendStyles(destination, source) {\n for (let key in source) {\n if (source.hasOwnProperty(key)) {\n destination[key] = source[key];\n }\n }\n return destination;\n}\n/**\n * Extracts the pixel value as a number from a value, if it's a number\n * or a CSS pixel string (e.g. `1337px`). Otherwise returns null.\n */\nfunction getPixelValue(input) {\n if (typeof input !== 'number' && input != null) {\n const [value, units] = input.split(cssUnitPattern);\n return !units || units === 'px' ? parseFloat(value) : null;\n }\n return input || null;\n}\n/**\n * Gets a version of an element's bounding `ClientRect` where all the values are rounded down to\n * the nearest pixel. This allows us to account for the cases where there may be sub-pixel\n * deviations in the `ClientRect` returned by the browser (e.g. when zoomed in with a percentage\n * size, see #21350).\n */\nfunction getRoundedBoundingClientRect(clientRect) {\n return {\n top: Math.floor(clientRect.top),\n right: Math.floor(clientRect.right),\n bottom: Math.floor(clientRect.bottom),\n left: Math.floor(clientRect.left),\n width: Math.floor(clientRect.width),\n height: Math.floor(clientRect.height),\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Class to be added to the overlay pane wrapper. */\nconst wrapperClass = 'cdk-global-overlay-wrapper';\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * explicit position relative to the browser's viewport. We use flexbox, instead of\n * transforms, in order to avoid issues with subpixel rendering which can cause the\n * element to become blurry.\n */\nclass GlobalPositionStrategy {\n constructor() {\n this._cssPosition = 'static';\n this._topOffset = '';\n this._bottomOffset = '';\n this._leftOffset = '';\n this._rightOffset = '';\n this._alignItems = '';\n this._justifyContent = '';\n this._width = '';\n this._height = '';\n }\n attach(overlayRef) {\n const config = overlayRef.getConfig();\n this._overlayRef = overlayRef;\n if (this._width && !config.width) {\n overlayRef.updateSize({ width: this._width });\n }\n if (this._height && !config.height) {\n overlayRef.updateSize({ height: this._height });\n }\n overlayRef.hostElement.classList.add(wrapperClass);\n this._isDisposed = false;\n }\n /**\n * Sets the top position of the overlay. Clears any previously set vertical position.\n * @param value New top offset.\n */\n top(value = '') {\n this._bottomOffset = '';\n this._topOffset = value;\n this._alignItems = 'flex-start';\n return this;\n }\n /**\n * Sets the left position of the overlay. Clears any previously set horizontal position.\n * @param value New left offset.\n */\n left(value = '') {\n this._rightOffset = '';\n this._leftOffset = value;\n this._justifyContent = 'flex-start';\n return this;\n }\n /**\n * Sets the bottom position of the overlay. Clears any previously set vertical position.\n * @param value New bottom offset.\n */\n bottom(value = '') {\n this._topOffset = '';\n this._bottomOffset = value;\n this._alignItems = 'flex-end';\n return this;\n }\n /**\n * Sets the right position of the overlay. Clears any previously set horizontal position.\n * @param value New right offset.\n */\n right(value = '') {\n this._leftOffset = '';\n this._rightOffset = value;\n this._justifyContent = 'flex-end';\n return this;\n }\n /**\n * Sets the overlay width and clears any previously set width.\n * @param value New width for the overlay\n * @deprecated Pass the `width` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n width(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ width: value });\n }\n else {\n this._width = value;\n }\n return this;\n }\n /**\n * Sets the overlay height and clears any previously set height.\n * @param value New height for the overlay\n * @deprecated Pass the `height` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n height(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ height: value });\n }\n else {\n this._height = value;\n }\n return this;\n }\n /**\n * Centers the overlay horizontally with an optional offset.\n * Clears any previously set horizontal position.\n *\n * @param offset Overlay offset from the horizontal center.\n */\n centerHorizontally(offset = '') {\n this.left(offset);\n this._justifyContent = 'center';\n return this;\n }\n /**\n * Centers the overlay vertically with an optional offset.\n * Clears any previously set vertical position.\n *\n * @param offset Overlay offset from the vertical center.\n */\n centerVertically(offset = '') {\n this.top(offset);\n this._alignItems = 'center';\n return this;\n }\n /**\n * Apply the position to the element.\n * @docs-private\n */\n apply() {\n // Since the overlay ref applies the strategy asynchronously, it could\n // have been disposed before it ends up being applied. If that is the\n // case, we shouldn't do anything.\n if (!this._overlayRef || !this._overlayRef.hasAttached()) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parentStyles = this._overlayRef.hostElement.style;\n const config = this._overlayRef.getConfig();\n const { width, height, maxWidth, maxHeight } = config;\n const shouldBeFlushHorizontally = (width === '100%' || width === '100vw') &&\n (!maxWidth || maxWidth === '100%' || maxWidth === '100vw');\n const shouldBeFlushVertically = (height === '100%' || height === '100vh') &&\n (!maxHeight || maxHeight === '100%' || maxHeight === '100vh');\n styles.position = this._cssPosition;\n styles.marginLeft = shouldBeFlushHorizontally ? '0' : this._leftOffset;\n styles.marginTop = shouldBeFlushVertically ? '0' : this._topOffset;\n styles.marginBottom = this._bottomOffset;\n styles.marginRight = this._rightOffset;\n if (shouldBeFlushHorizontally) {\n parentStyles.justifyContent = 'flex-start';\n }\n else if (this._justifyContent === 'center') {\n parentStyles.justifyContent = 'center';\n }\n else if (this._overlayRef.getConfig().direction === 'rtl') {\n // In RTL the browser will invert `flex-start` and `flex-end` automatically, but we\n // don't want that because our positioning is explicitly `left` and `right`, hence\n // why we do another inversion to ensure that the overlay stays in the same position.\n // TODO: reconsider this if we add `start` and `end` methods.\n if (this._justifyContent === 'flex-start') {\n parentStyles.justifyContent = 'flex-end';\n }\n else if (this._justifyContent === 'flex-end') {\n parentStyles.justifyContent = 'flex-start';\n }\n }\n else {\n parentStyles.justifyContent = this._justifyContent;\n }\n parentStyles.alignItems = shouldBeFlushVertically ? 'flex-start' : this._alignItems;\n }\n /**\n * Cleans up the DOM changes from the position strategy.\n * @docs-private\n */\n dispose() {\n if (this._isDisposed || !this._overlayRef) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parent = this._overlayRef.hostElement;\n const parentStyles = parent.style;\n parent.classList.remove(wrapperClass);\n parentStyles.justifyContent =\n parentStyles.alignItems =\n styles.marginTop =\n styles.marginBottom =\n styles.marginLeft =\n styles.marginRight =\n styles.position =\n '';\n this._overlayRef = null;\n this._isDisposed = true;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Builder for overlay position strategy. */\nclass OverlayPositionBuilder {\n constructor(_viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n }\n /**\n * Creates a global position strategy.\n */\n global() {\n return new GlobalPositionStrategy();\n }\n /**\n * Creates a flexible position strategy.\n * @param origin Origin relative to which to position the overlay.\n */\n flexibleConnectedTo(origin) {\n return new FlexibleConnectedPositionStrategy(origin, this._viewportRuler, this._document, this._platform, this._overlayContainer);\n }\n}\nOverlayPositionBuilder.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayPositionBuilder, deps: [{ token: i1.ViewportRuler }, { token: DOCUMENT }, { token: i1$1.Platform }, { token: OverlayContainer }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayPositionBuilder.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayPositionBuilder, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayPositionBuilder, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.ViewportRuler }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }, { type: OverlayContainer }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Next overlay unique ID. */\nlet nextUniqueId = 0;\n// Note that Overlay is *not* scoped to the app root because of the ComponentFactoryResolver\n// which needs to be different depending on where OverlayModule is imported.\n/**\n * Service to create Overlays. Overlays are dynamically added pieces of floating UI, meant to be\n * used as a low-level building block for other components. Dialogs, tooltips, menus,\n * selects, etc. can all be built using overlays. The service should primarily be used by authors\n * of re-usable components rather than developers building end-user applications.\n *\n * An overlay *is* a PortalOutlet, so any kind of Portal can be loaded into one.\n */\nclass Overlay {\n constructor(\n /** Scrolling strategies that can be used when creating an overlay. */\n scrollStrategies, _overlayContainer, _componentFactoryResolver, _positionBuilder, _keyboardDispatcher, _injector, _ngZone, _document, _directionality, _location, _outsideClickDispatcher) {\n this.scrollStrategies = scrollStrategies;\n this._overlayContainer = _overlayContainer;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._positionBuilder = _positionBuilder;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._injector = _injector;\n this._ngZone = _ngZone;\n this._document = _document;\n this._directionality = _directionality;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n }\n /**\n * Creates an overlay.\n * @param config Configuration applied to the overlay.\n * @returns Reference to the created overlay.\n */\n create(config) {\n const host = this._createHostElement();\n const pane = this._createPaneElement(host);\n const portalOutlet = this._createPortalOutlet(pane);\n const overlayConfig = new OverlayConfig(config);\n overlayConfig.direction = overlayConfig.direction || this._directionality.value;\n return new OverlayRef(portalOutlet, host, pane, overlayConfig, this._ngZone, this._keyboardDispatcher, this._document, this._location, this._outsideClickDispatcher);\n }\n /**\n * Gets a position builder that can be used, via fluent API,\n * to construct and configure a position strategy.\n * @returns An overlay position builder.\n */\n position() {\n return this._positionBuilder;\n }\n /**\n * Creates the DOM element for an overlay and appends it to the overlay container.\n * @returns Newly-created pane element\n */\n _createPaneElement(host) {\n const pane = this._document.createElement('div');\n pane.id = `cdk-overlay-${nextUniqueId++}`;\n pane.classList.add('cdk-overlay-pane');\n host.appendChild(pane);\n return pane;\n }\n /**\n * Creates the host element that wraps around an overlay\n * and can be used for advanced positioning.\n * @returns Newly-create host element.\n */\n _createHostElement() {\n const host = this._document.createElement('div');\n this._overlayContainer.getContainerElement().appendChild(host);\n return host;\n }\n /**\n * Create a DomPortalOutlet into which the overlay content can be loaded.\n * @param pane The DOM element to turn into a portal outlet.\n * @returns A portal outlet for the given DOM element.\n */\n _createPortalOutlet(pane) {\n // We have to resolve the ApplicationRef later in order to allow people\n // to use overlay-based providers during app initialization.\n if (!this._appRef) {\n this._appRef = this._injector.get(ApplicationRef);\n }\n return new DomPortalOutlet(pane, this._componentFactoryResolver, this._appRef, this._injector, this._document);\n }\n}\nOverlay.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: Overlay, deps: [{ token: ScrollStrategyOptions }, { token: OverlayContainer }, { token: i0.ComponentFactoryResolver }, { token: OverlayPositionBuilder }, { token: OverlayKeyboardDispatcher }, { token: i0.Injector }, { token: i0.NgZone }, { token: DOCUMENT }, { token: i5.Directionality }, { token: i6.Location }, { token: OverlayOutsideClickDispatcher }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlay.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: Overlay });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: Overlay, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: ScrollStrategyOptions }, { type: OverlayContainer }, { type: i0.ComponentFactoryResolver }, { type: OverlayPositionBuilder }, { type: OverlayKeyboardDispatcher }, { type: i0.Injector }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i5.Directionality }, { type: i6.Location }, { type: OverlayOutsideClickDispatcher }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Default set of positions for the overlay. Follows the behavior of a dropdown. */\nconst defaultPositionList = [\n {\n originX: 'start',\n originY: 'bottom',\n overlayX: 'start',\n overlayY: 'top',\n },\n {\n originX: 'start',\n originY: 'top',\n overlayX: 'start',\n overlayY: 'bottom',\n },\n {\n originX: 'end',\n originY: 'top',\n overlayX: 'end',\n overlayY: 'bottom',\n },\n {\n originX: 'end',\n originY: 'bottom',\n overlayX: 'end',\n overlayY: 'top',\n },\n];\n/** Injection token that determines the scroll handling while the connected overlay is open. */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY = new InjectionToken('cdk-connected-overlay-scroll-strategy');\n/**\n * Directive applied to an element to make it usable as an origin for an Overlay using a\n * ConnectedPositionStrategy.\n */\nclass CdkOverlayOrigin {\n constructor(\n /** Reference to the element on which the directive is applied. */\n elementRef) {\n this.elementRef = elementRef;\n }\n}\nCdkOverlayOrigin.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkOverlayOrigin, deps: [{ token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\nCdkOverlayOrigin.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: CdkOverlayOrigin, selector: \"[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]\", exportAs: [\"cdkOverlayOrigin\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkOverlayOrigin, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]',\n exportAs: 'cdkOverlayOrigin',\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }]; } });\n/**\n * Directive to facilitate declarative creation of an\n * Overlay using a FlexibleConnectedPositionStrategy.\n */\nclass CdkConnectedOverlay {\n // TODO(jelbourn): inputs for size, scroll behavior, animation, etc.\n constructor(_overlay, templateRef, viewContainerRef, scrollStrategyFactory, _dir) {\n this._overlay = _overlay;\n this._dir = _dir;\n this._hasBackdrop = false;\n this._lockPosition = false;\n this._growAfterOpen = false;\n this._flexibleDimensions = false;\n this._push = false;\n this._backdropSubscription = Subscription.EMPTY;\n this._attachSubscription = Subscription.EMPTY;\n this._detachSubscription = Subscription.EMPTY;\n this._positionSubscription = Subscription.EMPTY;\n /** Margin between the overlay and the viewport edges. */\n this.viewportMargin = 0;\n /** Whether the overlay is open. */\n this.open = false;\n /** Whether the overlay can be closed by user interaction. */\n this.disableClose = false;\n /** Event emitted when the backdrop is clicked. */\n this.backdropClick = new EventEmitter();\n /** Event emitted when the position has changed. */\n this.positionChange = new EventEmitter();\n /** Event emitted when the overlay has been attached. */\n this.attach = new EventEmitter();\n /** Event emitted when the overlay has been detached. */\n this.detach = new EventEmitter();\n /** Emits when there are keyboard events that are targeted at the overlay. */\n this.overlayKeydown = new EventEmitter();\n /** Emits when there are mouse outside click events that are targeted at the overlay. */\n this.overlayOutsideClick = new EventEmitter();\n this._templatePortal = new TemplatePortal(templateRef, viewContainerRef);\n this._scrollStrategyFactory = scrollStrategyFactory;\n this.scrollStrategy = this._scrollStrategyFactory();\n }\n /** The offset in pixels for the overlay connection point on the x-axis */\n get offsetX() {\n return this._offsetX;\n }\n set offsetX(offsetX) {\n this._offsetX = offsetX;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** The offset in pixels for the overlay connection point on the y-axis */\n get offsetY() {\n return this._offsetY;\n }\n set offsetY(offsetY) {\n this._offsetY = offsetY;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** Whether or not the overlay should attach a backdrop. */\n get hasBackdrop() {\n return this._hasBackdrop;\n }\n set hasBackdrop(value) {\n this._hasBackdrop = coerceBooleanProperty(value);\n }\n /** Whether or not the overlay should be locked when scrolling. */\n get lockPosition() {\n return this._lockPosition;\n }\n set lockPosition(value) {\n this._lockPosition = coerceBooleanProperty(value);\n }\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n get flexibleDimensions() {\n return this._flexibleDimensions;\n }\n set flexibleDimensions(value) {\n this._flexibleDimensions = coerceBooleanProperty(value);\n }\n /** Whether the overlay can grow after the initial open when flexible positioning is turned on. */\n get growAfterOpen() {\n return this._growAfterOpen;\n }\n set growAfterOpen(value) {\n this._growAfterOpen = coerceBooleanProperty(value);\n }\n /** Whether the overlay can be pushed on-screen if none of the provided positions fit. */\n get push() {\n return this._push;\n }\n set push(value) {\n this._push = coerceBooleanProperty(value);\n }\n /** The associated overlay reference. */\n get overlayRef() {\n return this._overlayRef;\n }\n /** The element's layout direction. */\n get dir() {\n return this._dir ? this._dir.value : 'ltr';\n }\n ngOnDestroy() {\n this._attachSubscription.unsubscribe();\n this._detachSubscription.unsubscribe();\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n if (this._overlayRef) {\n this._overlayRef.dispose();\n }\n }\n ngOnChanges(changes) {\n if (this._position) {\n this._updatePositionStrategy(this._position);\n this._overlayRef.updateSize({\n width: this.width,\n minWidth: this.minWidth,\n height: this.height,\n minHeight: this.minHeight,\n });\n if (changes['origin'] && this.open) {\n this._position.apply();\n }\n }\n if (changes['open']) {\n this.open ? this._attachOverlay() : this._detachOverlay();\n }\n }\n /** Creates an overlay */\n _createOverlay() {\n if (!this.positions || !this.positions.length) {\n this.positions = defaultPositionList;\n }\n const overlayRef = (this._overlayRef = this._overlay.create(this._buildConfig()));\n this._attachSubscription = overlayRef.attachments().subscribe(() => this.attach.emit());\n this._detachSubscription = overlayRef.detachments().subscribe(() => this.detach.emit());\n overlayRef.keydownEvents().subscribe((event) => {\n this.overlayKeydown.next(event);\n if (event.keyCode === ESCAPE && !this.disableClose && !hasModifierKey(event)) {\n event.preventDefault();\n this._detachOverlay();\n }\n });\n this._overlayRef.outsidePointerEvents().subscribe((event) => {\n this.overlayOutsideClick.next(event);\n });\n }\n /** Builds the overlay config based on the directive's inputs */\n _buildConfig() {\n const positionStrategy = (this._position =\n this.positionStrategy || this._createPositionStrategy());\n const overlayConfig = new OverlayConfig({\n direction: this._dir,\n positionStrategy,\n scrollStrategy: this.scrollStrategy,\n hasBackdrop: this.hasBackdrop,\n });\n if (this.width || this.width === 0) {\n overlayConfig.width = this.width;\n }\n if (this.height || this.height === 0) {\n overlayConfig.height = this.height;\n }\n if (this.minWidth || this.minWidth === 0) {\n overlayConfig.minWidth = this.minWidth;\n }\n if (this.minHeight || this.minHeight === 0) {\n overlayConfig.minHeight = this.minHeight;\n }\n if (this.backdropClass) {\n overlayConfig.backdropClass = this.backdropClass;\n }\n if (this.panelClass) {\n overlayConfig.panelClass = this.panelClass;\n }\n return overlayConfig;\n }\n /** Updates the state of a position strategy, based on the values of the directive inputs. */\n _updatePositionStrategy(positionStrategy) {\n const positions = this.positions.map(currentPosition => ({\n originX: currentPosition.originX,\n originY: currentPosition.originY,\n overlayX: currentPosition.overlayX,\n overlayY: currentPosition.overlayY,\n offsetX: currentPosition.offsetX || this.offsetX,\n offsetY: currentPosition.offsetY || this.offsetY,\n panelClass: currentPosition.panelClass || undefined,\n }));\n return positionStrategy\n .setOrigin(this._getFlexibleConnectedPositionStrategyOrigin())\n .withPositions(positions)\n .withFlexibleDimensions(this.flexibleDimensions)\n .withPush(this.push)\n .withGrowAfterOpen(this.growAfterOpen)\n .withViewportMargin(this.viewportMargin)\n .withLockedPosition(this.lockPosition)\n .withTransformOriginOn(this.transformOriginSelector);\n }\n /** Returns the position strategy of the overlay to be set on the overlay config */\n _createPositionStrategy() {\n const strategy = this._overlay\n .position()\n .flexibleConnectedTo(this._getFlexibleConnectedPositionStrategyOrigin());\n this._updatePositionStrategy(strategy);\n return strategy;\n }\n _getFlexibleConnectedPositionStrategyOrigin() {\n if (this.origin instanceof CdkOverlayOrigin) {\n return this.origin.elementRef;\n }\n else {\n return this.origin;\n }\n }\n /** Attaches the overlay and subscribes to backdrop clicks if backdrop exists */\n _attachOverlay() {\n if (!this._overlayRef) {\n this._createOverlay();\n }\n else {\n // Update the overlay size, in case the directive's inputs have changed\n this._overlayRef.getConfig().hasBackdrop = this.hasBackdrop;\n }\n if (!this._overlayRef.hasAttached()) {\n this._overlayRef.attach(this._templatePortal);\n }\n if (this.hasBackdrop) {\n this._backdropSubscription = this._overlayRef.backdropClick().subscribe(event => {\n this.backdropClick.emit(event);\n });\n }\n else {\n this._backdropSubscription.unsubscribe();\n }\n this._positionSubscription.unsubscribe();\n // Only subscribe to `positionChanges` if requested, because putting\n // together all the information for it can be expensive.\n if (this.positionChange.observers.length > 0) {\n this._positionSubscription = this._position.positionChanges\n .pipe(takeWhile(() => this.positionChange.observers.length > 0))\n .subscribe(position => {\n this.positionChange.emit(position);\n if (this.positionChange.observers.length === 0) {\n this._positionSubscription.unsubscribe();\n }\n });\n }\n }\n /** Detaches the overlay and unsubscribes to backdrop clicks if backdrop exists */\n _detachOverlay() {\n if (this._overlayRef) {\n this._overlayRef.detach();\n }\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n }\n}\nCdkConnectedOverlay.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkConnectedOverlay, deps: [{ token: Overlay }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY }, { token: i5.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkConnectedOverlay.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: CdkConnectedOverlay, selector: \"[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]\", inputs: { origin: [\"cdkConnectedOverlayOrigin\", \"origin\"], positions: [\"cdkConnectedOverlayPositions\", \"positions\"], positionStrategy: [\"cdkConnectedOverlayPositionStrategy\", \"positionStrategy\"], offsetX: [\"cdkConnectedOverlayOffsetX\", \"offsetX\"], offsetY: [\"cdkConnectedOverlayOffsetY\", \"offsetY\"], width: [\"cdkConnectedOverlayWidth\", \"width\"], height: [\"cdkConnectedOverlayHeight\", \"height\"], minWidth: [\"cdkConnectedOverlayMinWidth\", \"minWidth\"], minHeight: [\"cdkConnectedOverlayMinHeight\", \"minHeight\"], backdropClass: [\"cdkConnectedOverlayBackdropClass\", \"backdropClass\"], panelClass: [\"cdkConnectedOverlayPanelClass\", \"panelClass\"], viewportMargin: [\"cdkConnectedOverlayViewportMargin\", \"viewportMargin\"], scrollStrategy: [\"cdkConnectedOverlayScrollStrategy\", \"scrollStrategy\"], open: [\"cdkConnectedOverlayOpen\", \"open\"], disableClose: [\"cdkConnectedOverlayDisableClose\", \"disableClose\"], transformOriginSelector: [\"cdkConnectedOverlayTransformOriginOn\", \"transformOriginSelector\"], hasBackdrop: [\"cdkConnectedOverlayHasBackdrop\", \"hasBackdrop\"], lockPosition: [\"cdkConnectedOverlayLockPosition\", \"lockPosition\"], flexibleDimensions: [\"cdkConnectedOverlayFlexibleDimensions\", \"flexibleDimensions\"], growAfterOpen: [\"cdkConnectedOverlayGrowAfterOpen\", \"growAfterOpen\"], push: [\"cdkConnectedOverlayPush\", \"push\"] }, outputs: { backdropClick: \"backdropClick\", positionChange: \"positionChange\", attach: \"attach\", detach: \"detach\", overlayKeydown: \"overlayKeydown\", overlayOutsideClick: \"overlayOutsideClick\" }, exportAs: [\"cdkConnectedOverlay\"], usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkConnectedOverlay, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]',\n exportAs: 'cdkConnectedOverlay',\n }]\n }], ctorParameters: function () { return [{ type: Overlay }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY]\n }] }, { type: i5.Directionality, decorators: [{\n type: Optional\n }] }]; }, propDecorators: { origin: [{\n type: Input,\n args: ['cdkConnectedOverlayOrigin']\n }], positions: [{\n type: Input,\n args: ['cdkConnectedOverlayPositions']\n }], positionStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayPositionStrategy']\n }], offsetX: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetX']\n }], offsetY: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetY']\n }], width: [{\n type: Input,\n args: ['cdkConnectedOverlayWidth']\n }], height: [{\n type: Input,\n args: ['cdkConnectedOverlayHeight']\n }], minWidth: [{\n type: Input,\n args: ['cdkConnectedOverlayMinWidth']\n }], minHeight: [{\n type: Input,\n args: ['cdkConnectedOverlayMinHeight']\n }], backdropClass: [{\n type: Input,\n args: ['cdkConnectedOverlayBackdropClass']\n }], panelClass: [{\n type: Input,\n args: ['cdkConnectedOverlayPanelClass']\n }], viewportMargin: [{\n type: Input,\n args: ['cdkConnectedOverlayViewportMargin']\n }], scrollStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayScrollStrategy']\n }], open: [{\n type: Input,\n args: ['cdkConnectedOverlayOpen']\n }], disableClose: [{\n type: Input,\n args: ['cdkConnectedOverlayDisableClose']\n }], transformOriginSelector: [{\n type: Input,\n args: ['cdkConnectedOverlayTransformOriginOn']\n }], hasBackdrop: [{\n type: Input,\n args: ['cdkConnectedOverlayHasBackdrop']\n }], lockPosition: [{\n type: Input,\n args: ['cdkConnectedOverlayLockPosition']\n }], flexibleDimensions: [{\n type: Input,\n args: ['cdkConnectedOverlayFlexibleDimensions']\n }], growAfterOpen: [{\n type: Input,\n args: ['cdkConnectedOverlayGrowAfterOpen']\n }], push: [{\n type: Input,\n args: ['cdkConnectedOverlayPush']\n }], backdropClick: [{\n type: Output\n }], positionChange: [{\n type: Output\n }], attach: [{\n type: Output\n }], detach: [{\n type: Output\n }], overlayKeydown: [{\n type: Output\n }], overlayOutsideClick: [{\n type: Output\n }] } });\n/** @docs-private */\nfunction CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY(overlay) {\n return () => overlay.scrollStrategies.reposition();\n}\n/** @docs-private */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER = {\n provide: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY,\n deps: [Overlay],\n useFactory: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY,\n};\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass OverlayModule {\n}\nOverlayModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nOverlayModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayModule, declarations: [CdkConnectedOverlay, CdkOverlayOrigin], imports: [BidiModule, PortalModule, ScrollingModule], exports: [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule] });\nOverlayModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayModule, providers: [Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER], imports: [[BidiModule, PortalModule, ScrollingModule], ScrollingModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: OverlayModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [BidiModule, PortalModule, ScrollingModule],\n exports: [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule],\n declarations: [CdkConnectedOverlay, CdkOverlayOrigin],\n providers: [Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Alternative to OverlayContainer that supports correct displaying of overlay elements in\n * Fullscreen mode\n * https://developer.mozilla.org/en-US/docs/Web/API/Element/requestFullScreen\n *\n * Should be provided in the root component.\n */\nclass FullscreenOverlayContainer extends OverlayContainer {\n constructor(_document, platform) {\n super(_document, platform);\n }\n ngOnDestroy() {\n super.ngOnDestroy();\n if (this._fullScreenEventName && this._fullScreenListener) {\n this._document.removeEventListener(this._fullScreenEventName, this._fullScreenListener);\n }\n }\n _createContainer() {\n super._createContainer();\n this._adjustParentForFullscreenChange();\n this._addFullscreenChangeListener(() => this._adjustParentForFullscreenChange());\n }\n _adjustParentForFullscreenChange() {\n if (!this._containerElement) {\n return;\n }\n const fullscreenElement = this.getFullscreenElement();\n const parent = fullscreenElement || this._document.body;\n parent.appendChild(this._containerElement);\n }\n _addFullscreenChangeListener(fn) {\n const eventName = this._getEventName();\n if (eventName) {\n if (this._fullScreenListener) {\n this._document.removeEventListener(eventName, this._fullScreenListener);\n }\n this._document.addEventListener(eventName, fn);\n this._fullScreenListener = fn;\n }\n }\n _getEventName() {\n if (!this._fullScreenEventName) {\n const _document = this._document;\n if (_document.fullscreenEnabled) {\n this._fullScreenEventName = 'fullscreenchange';\n }\n else if (_document.webkitFullscreenEnabled) {\n this._fullScreenEventName = 'webkitfullscreenchange';\n }\n else if (_document.mozFullScreenEnabled) {\n this._fullScreenEventName = 'mozfullscreenchange';\n }\n else if (_document.msFullscreenEnabled) {\n this._fullScreenEventName = 'MSFullscreenChange';\n }\n }\n return this._fullScreenEventName;\n }\n /**\n * When the page is put into fullscreen mode, a specific element is specified.\n * Only that element and its children are visible when in fullscreen mode.\n */\n getFullscreenElement() {\n const _document = this._document;\n return (_document.fullscreenElement ||\n _document.webkitFullscreenElement ||\n _document.mozFullScreenElement ||\n _document.msFullscreenElement ||\n null);\n }\n}\nFullscreenOverlayContainer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FullscreenOverlayContainer, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nFullscreenOverlayContainer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FullscreenOverlayContainer, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FullscreenOverlayContainer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BlockScrollStrategy, CdkConnectedOverlay, CdkOverlayOrigin, CloseScrollStrategy, ConnectedOverlayPositionChange, ConnectionPositionPair, FlexibleConnectedPositionStrategy, FullscreenOverlayContainer, GlobalPositionStrategy, NoopScrollStrategy, Overlay, OverlayConfig, OverlayContainer, OverlayKeyboardDispatcher, OverlayModule, OverlayOutsideClickDispatcher, OverlayPositionBuilder, OverlayRef, RepositionScrollStrategy, ScrollStrategyOptions, ScrollingVisibility, validateHorizontalPosition, validateVerticalPosition };\n","import { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, Inject, QueryList, Directive, Input, InjectionToken, Optional, EventEmitter, Output, NgModule } from '@angular/core';\nimport * as i1 from '@angular/cdk/platform';\nimport { _getFocusedElementPierceShadowDom, normalizePassiveListenerOptions, _getEventTarget, _getShadowRoot } from '@angular/cdk/platform';\nimport { Subject, Subscription, BehaviorSubject, of } from 'rxjs';\nimport { hasModifierKey, A, Z, ZERO, NINE, END, HOME, LEFT_ARROW, RIGHT_ARROW, UP_ARROW, DOWN_ARROW, TAB, ALT, CONTROL, MAC_META, META, SHIFT } from '@angular/cdk/keycodes';\nimport { tap, debounceTime, filter, map, take, skip, distinctUntilChanged, takeUntil } from 'rxjs/operators';\nimport { coerceBooleanProperty, coerceElement } from '@angular/cdk/coercion';\nimport * as i1$1 from '@angular/cdk/observers';\nimport { ObserversModule } from '@angular/cdk/observers';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** IDs are delimited by an empty space, as per the spec. */\nconst ID_DELIMITER = ' ';\n/**\n * Adds the given ID to the specified ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction addAriaReferencedId(el, attr, id) {\n const ids = getAriaReferenceIds(el, attr);\n if (ids.some(existingId => existingId.trim() == id.trim())) {\n return;\n }\n ids.push(id.trim());\n el.setAttribute(attr, ids.join(ID_DELIMITER));\n}\n/**\n * Removes the given ID from the specified ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction removeAriaReferencedId(el, attr, id) {\n const ids = getAriaReferenceIds(el, attr);\n const filteredIds = ids.filter(val => val != id.trim());\n if (filteredIds.length) {\n el.setAttribute(attr, filteredIds.join(ID_DELIMITER));\n }\n else {\n el.removeAttribute(attr);\n }\n}\n/**\n * Gets the list of IDs referenced by the given ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction getAriaReferenceIds(el, attr) {\n // Get string array of all individual ids (whitespace delimited) in the attribute value\n return (el.getAttribute(attr) || '').match(/\\S+/g) || [];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * ID used for the body container where all messages are appended.\n * @deprecated No longer being used. To be removed.\n * @breaking-change 14.0.0\n */\nconst MESSAGES_CONTAINER_ID = 'cdk-describedby-message-container';\n/**\n * ID prefix used for each created message element.\n * @deprecated To be turned into a private variable.\n * @breaking-change 14.0.0\n */\nconst CDK_DESCRIBEDBY_ID_PREFIX = 'cdk-describedby-message';\n/**\n * Attribute given to each host element that is described by a message element.\n * @deprecated To be turned into a private variable.\n * @breaking-change 14.0.0\n */\nconst CDK_DESCRIBEDBY_HOST_ATTRIBUTE = 'cdk-describedby-host';\n/** Global incremental identifier for each registered message element. */\nlet nextId = 0;\n/**\n * Utility that creates visually hidden elements with a message content. Useful for elements that\n * want to use aria-describedby to further describe themselves without adding additional visual\n * content.\n */\nclass AriaDescriber {\n constructor(_document, \n /**\n * @deprecated To be turned into a required parameter.\n * @breaking-change 14.0.0\n */\n _platform) {\n this._platform = _platform;\n /** Map of all registered message elements that have been placed into the document. */\n this._messageRegistry = new Map();\n /** Container for all registered messages. */\n this._messagesContainer = null;\n /** Unique ID for the service. */\n this._id = `${nextId++}`;\n this._document = _document;\n }\n describe(hostElement, message, role) {\n if (!this._canBeDescribed(hostElement, message)) {\n return;\n }\n const key = getKey(message, role);\n if (typeof message !== 'string') {\n // We need to ensure that the element has an ID.\n setMessageId(message);\n this._messageRegistry.set(key, { messageElement: message, referenceCount: 0 });\n }\n else if (!this._messageRegistry.has(key)) {\n this._createMessageElement(message, role);\n }\n if (!this._isElementDescribedByMessage(hostElement, key)) {\n this._addMessageReference(hostElement, key);\n }\n }\n removeDescription(hostElement, message, role) {\n if (!message || !this._isElementNode(hostElement)) {\n return;\n }\n const key = getKey(message, role);\n if (this._isElementDescribedByMessage(hostElement, key)) {\n this._removeMessageReference(hostElement, key);\n }\n // If the message is a string, it means that it's one that we created for the\n // consumer so we can remove it safely, otherwise we should leave it in place.\n if (typeof message === 'string') {\n const registeredMessage = this._messageRegistry.get(key);\n if (registeredMessage && registeredMessage.referenceCount === 0) {\n this._deleteMessageElement(key);\n }\n }\n if (this._messagesContainer?.childNodes.length === 0) {\n this._messagesContainer.remove();\n this._messagesContainer = null;\n }\n }\n /** Unregisters all created message elements and removes the message container. */\n ngOnDestroy() {\n const describedElements = this._document.querySelectorAll(`[${CDK_DESCRIBEDBY_HOST_ATTRIBUTE}=\"${this._id}\"]`);\n for (let i = 0; i < describedElements.length; i++) {\n this._removeCdkDescribedByReferenceIds(describedElements[i]);\n describedElements[i].removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE);\n }\n this._messagesContainer?.remove();\n this._messagesContainer = null;\n this._messageRegistry.clear();\n }\n /**\n * Creates a new element in the visually hidden message container element with the message\n * as its content and adds it to the message registry.\n */\n _createMessageElement(message, role) {\n const messageElement = this._document.createElement('div');\n setMessageId(messageElement);\n messageElement.textContent = message;\n if (role) {\n messageElement.setAttribute('role', role);\n }\n this._createMessagesContainer();\n this._messagesContainer.appendChild(messageElement);\n this._messageRegistry.set(getKey(message, role), { messageElement, referenceCount: 0 });\n }\n /** Deletes the message element from the global messages container. */\n _deleteMessageElement(key) {\n this._messageRegistry.get(key)?.messageElement?.remove();\n this._messageRegistry.delete(key);\n }\n /** Creates the global container for all aria-describedby messages. */\n _createMessagesContainer() {\n if (this._messagesContainer) {\n return;\n }\n const containerClassName = 'cdk-describedby-message-container';\n const serverContainers = this._document.querySelectorAll(`.${containerClassName}[platform=\"server\"]`);\n for (let i = 0; i < serverContainers.length; i++) {\n // When going from the server to the client, we may end up in a situation where there's\n // already a container on the page, but we don't have a reference to it. Clear the\n // old container so we don't get duplicates. Doing this, instead of emptying the previous\n // container, should be slightly faster.\n serverContainers[i].remove();\n }\n const messagesContainer = this._document.createElement('div');\n // We add `visibility: hidden` in order to prevent text in this container from\n // being searchable by the browser's Ctrl + F functionality.\n // Screen-readers will still read the description for elements with aria-describedby even\n // when the description element is not visible.\n messagesContainer.style.visibility = 'hidden';\n // Even though we use `visibility: hidden`, we still apply `cdk-visually-hidden` so that\n // the description element doesn't impact page layout.\n messagesContainer.classList.add(containerClassName);\n messagesContainer.classList.add('cdk-visually-hidden');\n // @breaking-change 14.0.0 Remove null check for `_platform`.\n if (this._platform && !this._platform.isBrowser) {\n messagesContainer.setAttribute('platform', 'server');\n }\n this._document.body.appendChild(messagesContainer);\n this._messagesContainer = messagesContainer;\n }\n /** Removes all cdk-describedby messages that are hosted through the element. */\n _removeCdkDescribedByReferenceIds(element) {\n // Remove all aria-describedby reference IDs that are prefixed by CDK_DESCRIBEDBY_ID_PREFIX\n const originalReferenceIds = getAriaReferenceIds(element, 'aria-describedby').filter(id => id.indexOf(CDK_DESCRIBEDBY_ID_PREFIX) != 0);\n element.setAttribute('aria-describedby', originalReferenceIds.join(' '));\n }\n /**\n * Adds a message reference to the element using aria-describedby and increments the registered\n * message's reference count.\n */\n _addMessageReference(element, key) {\n const registeredMessage = this._messageRegistry.get(key);\n // Add the aria-describedby reference and set the\n // describedby_host attribute to mark the element.\n addAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id);\n element.setAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE, this._id);\n registeredMessage.referenceCount++;\n }\n /**\n * Removes a message reference from the element using aria-describedby\n * and decrements the registered message's reference count.\n */\n _removeMessageReference(element, key) {\n const registeredMessage = this._messageRegistry.get(key);\n registeredMessage.referenceCount--;\n removeAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id);\n element.removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE);\n }\n /** Returns true if the element has been described by the provided message ID. */\n _isElementDescribedByMessage(element, key) {\n const referenceIds = getAriaReferenceIds(element, 'aria-describedby');\n const registeredMessage = this._messageRegistry.get(key);\n const messageId = registeredMessage && registeredMessage.messageElement.id;\n return !!messageId && referenceIds.indexOf(messageId) != -1;\n }\n /** Determines whether a message can be described on a particular element. */\n _canBeDescribed(element, message) {\n if (!this._isElementNode(element)) {\n return false;\n }\n if (message && typeof message === 'object') {\n // We'd have to make some assumptions about the description element's text, if the consumer\n // passed in an element. Assume that if an element is passed in, the consumer has verified\n // that it can be used as a description.\n return true;\n }\n const trimmedMessage = message == null ? '' : `${message}`.trim();\n const ariaLabel = element.getAttribute('aria-label');\n // We shouldn't set descriptions if they're exactly the same as the `aria-label` of the\n // element, because screen readers will end up reading out the same text twice in a row.\n return trimmedMessage ? !ariaLabel || ariaLabel.trim() !== trimmedMessage : false;\n }\n /** Checks whether a node is an Element node. */\n _isElementNode(element) {\n return element.nodeType === this._document.ELEMENT_NODE;\n }\n}\nAriaDescriber.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: AriaDescriber, deps: [{ token: DOCUMENT }, { token: i1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nAriaDescriber.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: AriaDescriber, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: AriaDescriber, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1.Platform }]; } });\n/** Gets a key that can be used to look messages up in the registry. */\nfunction getKey(message, role) {\n return typeof message === 'string' ? `${role || ''}/${message}` : message;\n}\n/** Assigns a unique ID to an element, if it doesn't have one already. */\nfunction setMessageId(element) {\n if (!element.id) {\n element.id = `${CDK_DESCRIBEDBY_ID_PREFIX}-${nextId++}`;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This class manages keyboard events for selectable lists. If you pass it a query list\n * of items, it will set the active item correctly when arrow events occur.\n */\nclass ListKeyManager {\n constructor(_items) {\n this._items = _items;\n this._activeItemIndex = -1;\n this._activeItem = null;\n this._wrap = false;\n this._letterKeyStream = new Subject();\n this._typeaheadSubscription = Subscription.EMPTY;\n this._vertical = true;\n this._allowedModifierKeys = [];\n this._homeAndEnd = false;\n /**\n * Predicate function that can be used to check whether an item should be skipped\n * by the key manager. By default, disabled items are skipped.\n */\n this._skipPredicateFn = (item) => item.disabled;\n // Buffer for the letters that the user has pressed when the typeahead option is turned on.\n this._pressedLetters = [];\n /**\n * Stream that emits any time the TAB key is pressed, so components can react\n * when focus is shifted off of the list.\n */\n this.tabOut = new Subject();\n /** Stream that emits whenever the active item of the list manager changes. */\n this.change = new Subject();\n // We allow for the items to be an array because, in some cases, the consumer may\n // not have access to a QueryList of the items they want to manage (e.g. when the\n // items aren't being collected via `ViewChildren` or `ContentChildren`).\n if (_items instanceof QueryList) {\n _items.changes.subscribe((newItems) => {\n if (this._activeItem) {\n const itemArray = newItems.toArray();\n const newIndex = itemArray.indexOf(this._activeItem);\n if (newIndex > -1 && newIndex !== this._activeItemIndex) {\n this._activeItemIndex = newIndex;\n }\n }\n });\n }\n }\n /**\n * Sets the predicate function that determines which items should be skipped by the\n * list key manager.\n * @param predicate Function that determines whether the given item should be skipped.\n */\n skipPredicate(predicate) {\n this._skipPredicateFn = predicate;\n return this;\n }\n /**\n * Configures wrapping mode, which determines whether the active item will wrap to\n * the other end of list when there are no more items in the given direction.\n * @param shouldWrap Whether the list should wrap when reaching the end.\n */\n withWrap(shouldWrap = true) {\n this._wrap = shouldWrap;\n return this;\n }\n /**\n * Configures whether the key manager should be able to move the selection vertically.\n * @param enabled Whether vertical selection should be enabled.\n */\n withVerticalOrientation(enabled = true) {\n this._vertical = enabled;\n return this;\n }\n /**\n * Configures the key manager to move the selection horizontally.\n * Passing in `null` will disable horizontal movement.\n * @param direction Direction in which the selection can be moved.\n */\n withHorizontalOrientation(direction) {\n this._horizontal = direction;\n return this;\n }\n /**\n * Modifier keys which are allowed to be held down and whose default actions will be prevented\n * as the user is pressing the arrow keys. Defaults to not allowing any modifier keys.\n */\n withAllowedModifierKeys(keys) {\n this._allowedModifierKeys = keys;\n return this;\n }\n /**\n * Turns on typeahead mode which allows users to set the active item by typing.\n * @param debounceInterval Time to wait after the last keystroke before setting the active item.\n */\n withTypeAhead(debounceInterval = 200) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n this._items.length &&\n this._items.some(item => typeof item.getLabel !== 'function')) {\n throw Error('ListKeyManager items in typeahead mode must implement the `getLabel` method.');\n }\n this._typeaheadSubscription.unsubscribe();\n // Debounce the presses of non-navigational keys, collect the ones that correspond to letters\n // and convert those letters back into a string. Afterwards find the first item that starts\n // with that string and select it.\n this._typeaheadSubscription = this._letterKeyStream\n .pipe(tap(letter => this._pressedLetters.push(letter)), debounceTime(debounceInterval), filter(() => this._pressedLetters.length > 0), map(() => this._pressedLetters.join('')))\n .subscribe(inputString => {\n const items = this._getItemsArray();\n // Start at 1 because we want to start searching at the item immediately\n // following the current active item.\n for (let i = 1; i < items.length + 1; i++) {\n const index = (this._activeItemIndex + i) % items.length;\n const item = items[index];\n if (!this._skipPredicateFn(item) &&\n item.getLabel().toUpperCase().trim().indexOf(inputString) === 0) {\n this.setActiveItem(index);\n break;\n }\n }\n this._pressedLetters = [];\n });\n return this;\n }\n /**\n * Configures the key manager to activate the first and last items\n * respectively when the Home or End key is pressed.\n * @param enabled Whether pressing the Home or End key activates the first/last item.\n */\n withHomeAndEnd(enabled = true) {\n this._homeAndEnd = enabled;\n return this;\n }\n setActiveItem(item) {\n const previousActiveItem = this._activeItem;\n this.updateActiveItem(item);\n if (this._activeItem !== previousActiveItem) {\n this.change.next(this._activeItemIndex);\n }\n }\n /**\n * Sets the active item depending on the key event passed in.\n * @param event Keyboard event to be used for determining which element should be active.\n */\n onKeydown(event) {\n const keyCode = event.keyCode;\n const modifiers = ['altKey', 'ctrlKey', 'metaKey', 'shiftKey'];\n const isModifierAllowed = modifiers.every(modifier => {\n return !event[modifier] || this._allowedModifierKeys.indexOf(modifier) > -1;\n });\n switch (keyCode) {\n case TAB:\n this.tabOut.next();\n return;\n case DOWN_ARROW:\n if (this._vertical && isModifierAllowed) {\n this.setNextItemActive();\n break;\n }\n else {\n return;\n }\n case UP_ARROW:\n if (this._vertical && isModifierAllowed) {\n this.setPreviousItemActive();\n break;\n }\n else {\n return;\n }\n case RIGHT_ARROW:\n if (this._horizontal && isModifierAllowed) {\n this._horizontal === 'rtl' ? this.setPreviousItemActive() : this.setNextItemActive();\n break;\n }\n else {\n return;\n }\n case LEFT_ARROW:\n if (this._horizontal && isModifierAllowed) {\n this._horizontal === 'rtl' ? this.setNextItemActive() : this.setPreviousItemActive();\n break;\n }\n else {\n return;\n }\n case HOME:\n if (this._homeAndEnd && isModifierAllowed) {\n this.setFirstItemActive();\n break;\n }\n else {\n return;\n }\n case END:\n if (this._homeAndEnd && isModifierAllowed) {\n this.setLastItemActive();\n break;\n }\n else {\n return;\n }\n default:\n if (isModifierAllowed || hasModifierKey(event, 'shiftKey')) {\n // Attempt to use the `event.key` which also maps it to the user's keyboard language,\n // otherwise fall back to resolving alphanumeric characters via the keyCode.\n if (event.key && event.key.length === 1) {\n this._letterKeyStream.next(event.key.toLocaleUpperCase());\n }\n else if ((keyCode >= A && keyCode <= Z) || (keyCode >= ZERO && keyCode <= NINE)) {\n this._letterKeyStream.next(String.fromCharCode(keyCode));\n }\n }\n // Note that we return here, in order to avoid preventing\n // the default action of non-navigational keys.\n return;\n }\n this._pressedLetters = [];\n event.preventDefault();\n }\n /** Index of the currently active item. */\n get activeItemIndex() {\n return this._activeItemIndex;\n }\n /** The active item. */\n get activeItem() {\n return this._activeItem;\n }\n /** Gets whether the user is currently typing into the manager using the typeahead feature. */\n isTyping() {\n return this._pressedLetters.length > 0;\n }\n /** Sets the active item to the first enabled item in the list. */\n setFirstItemActive() {\n this._setActiveItemByIndex(0, 1);\n }\n /** Sets the active item to the last enabled item in the list. */\n setLastItemActive() {\n this._setActiveItemByIndex(this._items.length - 1, -1);\n }\n /** Sets the active item to the next enabled item in the list. */\n setNextItemActive() {\n this._activeItemIndex < 0 ? this.setFirstItemActive() : this._setActiveItemByDelta(1);\n }\n /** Sets the active item to a previous enabled item in the list. */\n setPreviousItemActive() {\n this._activeItemIndex < 0 && this._wrap\n ? this.setLastItemActive()\n : this._setActiveItemByDelta(-1);\n }\n updateActiveItem(item) {\n const itemArray = this._getItemsArray();\n const index = typeof item === 'number' ? item : itemArray.indexOf(item);\n const activeItem = itemArray[index];\n // Explicitly check for `null` and `undefined` because other falsy values are valid.\n this._activeItem = activeItem == null ? null : activeItem;\n this._activeItemIndex = index;\n }\n /**\n * This method sets the active item, given a list of items and the delta between the\n * currently active item and the new active item. It will calculate differently\n * depending on whether wrap mode is turned on.\n */\n _setActiveItemByDelta(delta) {\n this._wrap ? this._setActiveInWrapMode(delta) : this._setActiveInDefaultMode(delta);\n }\n /**\n * Sets the active item properly given \"wrap\" mode. In other words, it will continue to move\n * down the list until it finds an item that is not disabled, and it will wrap if it\n * encounters either end of the list.\n */\n _setActiveInWrapMode(delta) {\n const items = this._getItemsArray();\n for (let i = 1; i <= items.length; i++) {\n const index = (this._activeItemIndex + delta * i + items.length) % items.length;\n const item = items[index];\n if (!this._skipPredicateFn(item)) {\n this.setActiveItem(index);\n return;\n }\n }\n }\n /**\n * Sets the active item properly given the default mode. In other words, it will\n * continue to move down the list until it finds an item that is not disabled. If\n * it encounters either end of the list, it will stop and not wrap.\n */\n _setActiveInDefaultMode(delta) {\n this._setActiveItemByIndex(this._activeItemIndex + delta, delta);\n }\n /**\n * Sets the active item to the first enabled item starting at the index specified. If the\n * item is disabled, it will move in the fallbackDelta direction until it either\n * finds an enabled item or encounters the end of the list.\n */\n _setActiveItemByIndex(index, fallbackDelta) {\n const items = this._getItemsArray();\n if (!items[index]) {\n return;\n }\n while (this._skipPredicateFn(items[index])) {\n index += fallbackDelta;\n if (!items[index]) {\n return;\n }\n }\n this.setActiveItem(index);\n }\n /** Returns the items as an array. */\n _getItemsArray() {\n return this._items instanceof QueryList ? this._items.toArray() : this._items;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass ActiveDescendantKeyManager extends ListKeyManager {\n setActiveItem(index) {\n if (this.activeItem) {\n this.activeItem.setInactiveStyles();\n }\n super.setActiveItem(index);\n if (this.activeItem) {\n this.activeItem.setActiveStyles();\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass FocusKeyManager extends ListKeyManager {\n constructor() {\n super(...arguments);\n this._origin = 'program';\n }\n /**\n * Sets the focus origin that will be passed in to the items for any subsequent `focus` calls.\n * @param origin Focus origin to be used when focusing items.\n */\n setFocusOrigin(origin) {\n this._origin = origin;\n return this;\n }\n setActiveItem(item) {\n super.setActiveItem(item);\n if (this.activeItem) {\n this.activeItem.focus(this._origin);\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Configuration for the isFocusable method.\n */\nclass IsFocusableConfig {\n constructor() {\n /**\n * Whether to count an element as focusable even if it is not currently visible.\n */\n this.ignoreVisibility = false;\n }\n}\n// The InteractivityChecker leans heavily on the ally.js accessibility utilities.\n// Methods like `isTabbable` are only covering specific edge-cases for the browsers which are\n// supported.\n/**\n * Utility for checking the interactivity of an element, such as whether is is focusable or\n * tabbable.\n */\nclass InteractivityChecker {\n constructor(_platform) {\n this._platform = _platform;\n }\n /**\n * Gets whether an element is disabled.\n *\n * @param element Element to be checked.\n * @returns Whether the element is disabled.\n */\n isDisabled(element) {\n // This does not capture some cases, such as a non-form control with a disabled attribute or\n // a form control inside of a disabled form, but should capture the most common cases.\n return element.hasAttribute('disabled');\n }\n /**\n * Gets whether an element is visible for the purposes of interactivity.\n *\n * This will capture states like `display: none` and `visibility: hidden`, but not things like\n * being clipped by an `overflow: hidden` parent or being outside the viewport.\n *\n * @returns Whether the element is visible.\n */\n isVisible(element) {\n return hasGeometry(element) && getComputedStyle(element).visibility === 'visible';\n }\n /**\n * Gets whether an element can be reached via Tab key.\n * Assumes that the element has already been checked with isFocusable.\n *\n * @param element Element to be checked.\n * @returns Whether the element is tabbable.\n */\n isTabbable(element) {\n // Nothing is tabbable on the server 😎\n if (!this._platform.isBrowser) {\n return false;\n }\n const frameElement = getFrameElement(getWindow(element));\n if (frameElement) {\n // Frame elements inherit their tabindex onto all child elements.\n if (getTabIndexValue(frameElement) === -1) {\n return false;\n }\n // Browsers disable tabbing to an element inside of an invisible frame.\n if (!this.isVisible(frameElement)) {\n return false;\n }\n }\n let nodeName = element.nodeName.toLowerCase();\n let tabIndexValue = getTabIndexValue(element);\n if (element.hasAttribute('contenteditable')) {\n return tabIndexValue !== -1;\n }\n if (nodeName === 'iframe' || nodeName === 'object') {\n // The frame or object's content may be tabbable depending on the content, but it's\n // not possibly to reliably detect the content of the frames. We always consider such\n // elements as non-tabbable.\n return false;\n }\n // In iOS, the browser only considers some specific elements as tabbable.\n if (this._platform.WEBKIT && this._platform.IOS && !isPotentiallyTabbableIOS(element)) {\n return false;\n }\n if (nodeName === 'audio') {\n // Audio elements without controls enabled are never tabbable, regardless\n // of the tabindex attribute explicitly being set.\n if (!element.hasAttribute('controls')) {\n return false;\n }\n // Audio elements with controls are by default tabbable unless the\n // tabindex attribute is set to `-1` explicitly.\n return tabIndexValue !== -1;\n }\n if (nodeName === 'video') {\n // For all video elements, if the tabindex attribute is set to `-1`, the video\n // is not tabbable. Note: We cannot rely on the default `HTMLElement.tabIndex`\n // property as that one is set to `-1` in Chrome, Edge and Safari v13.1. The\n // tabindex attribute is the source of truth here.\n if (tabIndexValue === -1) {\n return false;\n }\n // If the tabindex is explicitly set, and not `-1` (as per check before), the\n // video element is always tabbable (regardless of whether it has controls or not).\n if (tabIndexValue !== null) {\n return true;\n }\n // Otherwise (when no explicit tabindex is set), a video is only tabbable if it\n // has controls enabled. Firefox is special as videos are always tabbable regardless\n // of whether there are controls or not.\n return this._platform.FIREFOX || element.hasAttribute('controls');\n }\n return element.tabIndex >= 0;\n }\n /**\n * Gets whether an element can be focused by the user.\n *\n * @param element Element to be checked.\n * @param config The config object with options to customize this method's behavior\n * @returns Whether the element is focusable.\n */\n isFocusable(element, config) {\n // Perform checks in order of left to most expensive.\n // Again, naive approach that does not capture many edge cases and browser quirks.\n return (isPotentiallyFocusable(element) &&\n !this.isDisabled(element) &&\n (config?.ignoreVisibility || this.isVisible(element)));\n }\n}\nInteractivityChecker.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: InteractivityChecker, deps: [{ token: i1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nInteractivityChecker.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: InteractivityChecker, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: InteractivityChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }]; } });\n/**\n * Returns the frame element from a window object. Since browsers like MS Edge throw errors if\n * the frameElement property is being accessed from a different host address, this property\n * should be accessed carefully.\n */\nfunction getFrameElement(window) {\n try {\n return window.frameElement;\n }\n catch {\n return null;\n }\n}\n/** Checks whether the specified element has any geometry / rectangles. */\nfunction hasGeometry(element) {\n // Use logic from jQuery to check for an invisible element.\n // See https://github.com/jquery/jquery/blob/master/src/css/hiddenVisibleSelectors.js#L12\n return !!(element.offsetWidth ||\n element.offsetHeight ||\n (typeof element.getClientRects === 'function' && element.getClientRects().length));\n}\n/** Gets whether an element's */\nfunction isNativeFormElement(element) {\n let nodeName = element.nodeName.toLowerCase();\n return (nodeName === 'input' ||\n nodeName === 'select' ||\n nodeName === 'button' ||\n nodeName === 'textarea');\n}\n/** Gets whether an element is an ``. */\nfunction isHiddenInput(element) {\n return isInputElement(element) && element.type == 'hidden';\n}\n/** Gets whether an element is an anchor that has an href attribute. */\nfunction isAnchorWithHref(element) {\n return isAnchorElement(element) && element.hasAttribute('href');\n}\n/** Gets whether an element is an input element. */\nfunction isInputElement(element) {\n return element.nodeName.toLowerCase() == 'input';\n}\n/** Gets whether an element is an anchor element. */\nfunction isAnchorElement(element) {\n return element.nodeName.toLowerCase() == 'a';\n}\n/** Gets whether an element has a valid tabindex. */\nfunction hasValidTabIndex(element) {\n if (!element.hasAttribute('tabindex') || element.tabIndex === undefined) {\n return false;\n }\n let tabIndex = element.getAttribute('tabindex');\n return !!(tabIndex && !isNaN(parseInt(tabIndex, 10)));\n}\n/**\n * Returns the parsed tabindex from the element attributes instead of returning the\n * evaluated tabindex from the browsers defaults.\n */\nfunction getTabIndexValue(element) {\n if (!hasValidTabIndex(element)) {\n return null;\n }\n // See browser issue in Gecko https://bugzilla.mozilla.org/show_bug.cgi?id=1128054\n const tabIndex = parseInt(element.getAttribute('tabindex') || '', 10);\n return isNaN(tabIndex) ? -1 : tabIndex;\n}\n/** Checks whether the specified element is potentially tabbable on iOS */\nfunction isPotentiallyTabbableIOS(element) {\n let nodeName = element.nodeName.toLowerCase();\n let inputType = nodeName === 'input' && element.type;\n return (inputType === 'text' ||\n inputType === 'password' ||\n nodeName === 'select' ||\n nodeName === 'textarea');\n}\n/**\n * Gets whether an element is potentially focusable without taking current visible/disabled state\n * into account.\n */\nfunction isPotentiallyFocusable(element) {\n // Inputs are potentially focusable *unless* they're type=\"hidden\".\n if (isHiddenInput(element)) {\n return false;\n }\n return (isNativeFormElement(element) ||\n isAnchorWithHref(element) ||\n element.hasAttribute('contenteditable') ||\n hasValidTabIndex(element));\n}\n/** Gets the parent window of a DOM node with regards of being inside of an iframe. */\nfunction getWindow(node) {\n // ownerDocument is null if `node` itself *is* a document.\n return (node.ownerDocument && node.ownerDocument.defaultView) || window;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class that allows for trapping focus within a DOM element.\n *\n * This class currently uses a relatively simple approach to focus trapping.\n * It assumes that the tab order is the same as DOM order, which is not necessarily true.\n * Things like `tabIndex > 0`, flex `order`, and shadow roots can cause the two to be misaligned.\n *\n * @deprecated Use `ConfigurableFocusTrap` instead.\n * @breaking-change 11.0.0\n */\nclass FocusTrap {\n constructor(_element, _checker, _ngZone, _document, deferAnchors = false) {\n this._element = _element;\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._document = _document;\n this._hasAttached = false;\n // Event listeners for the anchors. Need to be regular functions so that we can unbind them later.\n this.startAnchorListener = () => this.focusLastTabbableElement();\n this.endAnchorListener = () => this.focusFirstTabbableElement();\n this._enabled = true;\n if (!deferAnchors) {\n this.attachAnchors();\n }\n }\n /** Whether the focus trap is active. */\n get enabled() {\n return this._enabled;\n }\n set enabled(value) {\n this._enabled = value;\n if (this._startAnchor && this._endAnchor) {\n this._toggleAnchorTabIndex(value, this._startAnchor);\n this._toggleAnchorTabIndex(value, this._endAnchor);\n }\n }\n /** Destroys the focus trap by cleaning up the anchors. */\n destroy() {\n const startAnchor = this._startAnchor;\n const endAnchor = this._endAnchor;\n if (startAnchor) {\n startAnchor.removeEventListener('focus', this.startAnchorListener);\n startAnchor.remove();\n }\n if (endAnchor) {\n endAnchor.removeEventListener('focus', this.endAnchorListener);\n endAnchor.remove();\n }\n this._startAnchor = this._endAnchor = null;\n this._hasAttached = false;\n }\n /**\n * Inserts the anchors into the DOM. This is usually done automatically\n * in the constructor, but can be deferred for cases like directives with `*ngIf`.\n * @returns Whether the focus trap managed to attach successfully. This may not be the case\n * if the target element isn't currently in the DOM.\n */\n attachAnchors() {\n // If we're not on the browser, there can be no focus to trap.\n if (this._hasAttached) {\n return true;\n }\n this._ngZone.runOutsideAngular(() => {\n if (!this._startAnchor) {\n this._startAnchor = this._createAnchor();\n this._startAnchor.addEventListener('focus', this.startAnchorListener);\n }\n if (!this._endAnchor) {\n this._endAnchor = this._createAnchor();\n this._endAnchor.addEventListener('focus', this.endAnchorListener);\n }\n });\n if (this._element.parentNode) {\n this._element.parentNode.insertBefore(this._startAnchor, this._element);\n this._element.parentNode.insertBefore(this._endAnchor, this._element.nextSibling);\n this._hasAttached = true;\n }\n return this._hasAttached;\n }\n /**\n * Waits for the zone to stabilize, then focuses the first tabbable element.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusInitialElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusInitialElement(options)));\n });\n }\n /**\n * Waits for the zone to stabilize, then focuses\n * the first tabbable element within the focus trap region.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusFirstTabbableElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusFirstTabbableElement(options)));\n });\n }\n /**\n * Waits for the zone to stabilize, then focuses\n * the last tabbable element within the focus trap region.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusLastTabbableElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusLastTabbableElement(options)));\n });\n }\n /**\n * Get the specified boundary element of the trapped region.\n * @param bound The boundary to get (start or end of trapped region).\n * @returns The boundary element.\n */\n _getRegionBoundary(bound) {\n // Contains the deprecated version of selector, for temporary backwards comparability.\n const markers = this._element.querySelectorAll(`[cdk-focus-region-${bound}], ` + `[cdkFocusRegion${bound}], ` + `[cdk-focus-${bound}]`);\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n for (let i = 0; i < markers.length; i++) {\n // @breaking-change 8.0.0\n if (markers[i].hasAttribute(`cdk-focus-${bound}`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-${bound}', ` +\n `use 'cdkFocusRegion${bound}' instead. The deprecated ` +\n `attribute will be removed in 8.0.0.`, markers[i]);\n }\n else if (markers[i].hasAttribute(`cdk-focus-region-${bound}`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-region-${bound}', ` +\n `use 'cdkFocusRegion${bound}' instead. The deprecated attribute ` +\n `will be removed in 8.0.0.`, markers[i]);\n }\n }\n }\n if (bound == 'start') {\n return markers.length ? markers[0] : this._getFirstTabbableElement(this._element);\n }\n return markers.length\n ? markers[markers.length - 1]\n : this._getLastTabbableElement(this._element);\n }\n /**\n * Focuses the element that should be focused when the focus trap is initialized.\n * @returns Whether focus was moved successfully.\n */\n focusInitialElement(options) {\n // Contains the deprecated version of selector, for temporary backwards comparability.\n const redirectToElement = this._element.querySelector(`[cdk-focus-initial], ` + `[cdkFocusInitial]`);\n if (redirectToElement) {\n // @breaking-change 8.0.0\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n redirectToElement.hasAttribute(`cdk-focus-initial`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-initial', ` +\n `use 'cdkFocusInitial' instead. The deprecated attribute ` +\n `will be removed in 8.0.0`, redirectToElement);\n }\n // Warn the consumer if the element they've pointed to\n // isn't focusable, when not in production mode.\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n !this._checker.isFocusable(redirectToElement)) {\n console.warn(`Element matching '[cdkFocusInitial]' is not focusable.`, redirectToElement);\n }\n if (!this._checker.isFocusable(redirectToElement)) {\n const focusableChild = this._getFirstTabbableElement(redirectToElement);\n focusableChild?.focus(options);\n return !!focusableChild;\n }\n redirectToElement.focus(options);\n return true;\n }\n return this.focusFirstTabbableElement(options);\n }\n /**\n * Focuses the first tabbable element within the focus trap region.\n * @returns Whether focus was moved successfully.\n */\n focusFirstTabbableElement(options) {\n const redirectToElement = this._getRegionBoundary('start');\n if (redirectToElement) {\n redirectToElement.focus(options);\n }\n return !!redirectToElement;\n }\n /**\n * Focuses the last tabbable element within the focus trap region.\n * @returns Whether focus was moved successfully.\n */\n focusLastTabbableElement(options) {\n const redirectToElement = this._getRegionBoundary('end');\n if (redirectToElement) {\n redirectToElement.focus(options);\n }\n return !!redirectToElement;\n }\n /**\n * Checks whether the focus trap has successfully been attached.\n */\n hasAttached() {\n return this._hasAttached;\n }\n /** Get the first tabbable element from a DOM subtree (inclusive). */\n _getFirstTabbableElement(root) {\n if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) {\n return root;\n }\n const children = root.children;\n for (let i = 0; i < children.length; i++) {\n const tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE\n ? this._getFirstTabbableElement(children[i])\n : null;\n if (tabbableChild) {\n return tabbableChild;\n }\n }\n return null;\n }\n /** Get the last tabbable element from a DOM subtree (inclusive). */\n _getLastTabbableElement(root) {\n if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) {\n return root;\n }\n // Iterate in reverse DOM order.\n const children = root.children;\n for (let i = children.length - 1; i >= 0; i--) {\n const tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE\n ? this._getLastTabbableElement(children[i])\n : null;\n if (tabbableChild) {\n return tabbableChild;\n }\n }\n return null;\n }\n /** Creates an anchor element. */\n _createAnchor() {\n const anchor = this._document.createElement('div');\n this._toggleAnchorTabIndex(this._enabled, anchor);\n anchor.classList.add('cdk-visually-hidden');\n anchor.classList.add('cdk-focus-trap-anchor');\n anchor.setAttribute('aria-hidden', 'true');\n return anchor;\n }\n /**\n * Toggles the `tabindex` of an anchor, based on the enabled state of the focus trap.\n * @param isEnabled Whether the focus trap is enabled.\n * @param anchor Anchor on which to toggle the tabindex.\n */\n _toggleAnchorTabIndex(isEnabled, anchor) {\n // Remove the tabindex completely, rather than setting it to -1, because if the\n // element has a tabindex, the user might still hit it when navigating with the arrow keys.\n isEnabled ? anchor.setAttribute('tabindex', '0') : anchor.removeAttribute('tabindex');\n }\n /**\n * Toggles the`tabindex` of both anchors to either trap Tab focus or allow it to escape.\n * @param enabled: Whether the anchors should trap Tab.\n */\n toggleAnchors(enabled) {\n if (this._startAnchor && this._endAnchor) {\n this._toggleAnchorTabIndex(enabled, this._startAnchor);\n this._toggleAnchorTabIndex(enabled, this._endAnchor);\n }\n }\n /** Executes a function when the zone is stable. */\n _executeOnStable(fn) {\n if (this._ngZone.isStable) {\n fn();\n }\n else {\n this._ngZone.onStable.pipe(take(1)).subscribe(fn);\n }\n }\n}\n/**\n * Factory that allows easy instantiation of focus traps.\n * @deprecated Use `ConfigurableFocusTrapFactory` instead.\n * @breaking-change 11.0.0\n */\nclass FocusTrapFactory {\n constructor(_checker, _ngZone, _document) {\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._document = _document;\n }\n /**\n * Creates a focus-trapped region around the given element.\n * @param element The element around which focus will be trapped.\n * @param deferCaptureElements Defers the creation of focus-capturing elements to be done\n * manually by the user.\n * @returns The created focus trap instance.\n */\n create(element, deferCaptureElements = false) {\n return new FocusTrap(element, this._checker, this._ngZone, this._document, deferCaptureElements);\n }\n}\nFocusTrapFactory.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FocusTrapFactory, deps: [{ token: InteractivityChecker }, { token: i0.NgZone }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nFocusTrapFactory.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FocusTrapFactory, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FocusTrapFactory, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: InteractivityChecker }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n/** Directive for trapping focus within a region. */\nclass CdkTrapFocus {\n constructor(_elementRef, _focusTrapFactory, \n /**\n * @deprecated No longer being used. To be removed.\n * @breaking-change 13.0.0\n */\n _document) {\n this._elementRef = _elementRef;\n this._focusTrapFactory = _focusTrapFactory;\n /** Previously focused element to restore focus to upon destroy when using autoCapture. */\n this._previouslyFocusedElement = null;\n this.focusTrap = this._focusTrapFactory.create(this._elementRef.nativeElement, true);\n }\n /** Whether the focus trap is active. */\n get enabled() {\n return this.focusTrap.enabled;\n }\n set enabled(value) {\n this.focusTrap.enabled = coerceBooleanProperty(value);\n }\n /**\n * Whether the directive should automatically move focus into the trapped region upon\n * initialization and return focus to the previous activeElement upon destruction.\n */\n get autoCapture() {\n return this._autoCapture;\n }\n set autoCapture(value) {\n this._autoCapture = coerceBooleanProperty(value);\n }\n ngOnDestroy() {\n this.focusTrap.destroy();\n // If we stored a previously focused element when using autoCapture, return focus to that\n // element now that the trapped region is being destroyed.\n if (this._previouslyFocusedElement) {\n this._previouslyFocusedElement.focus();\n this._previouslyFocusedElement = null;\n }\n }\n ngAfterContentInit() {\n this.focusTrap.attachAnchors();\n if (this.autoCapture) {\n this._captureFocus();\n }\n }\n ngDoCheck() {\n if (!this.focusTrap.hasAttached()) {\n this.focusTrap.attachAnchors();\n }\n }\n ngOnChanges(changes) {\n const autoCaptureChange = changes['autoCapture'];\n if (autoCaptureChange &&\n !autoCaptureChange.firstChange &&\n this.autoCapture &&\n this.focusTrap.hasAttached()) {\n this._captureFocus();\n }\n }\n _captureFocus() {\n this._previouslyFocusedElement = _getFocusedElementPierceShadowDom();\n this.focusTrap.focusInitialElementWhenReady();\n }\n}\nCdkTrapFocus.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkTrapFocus, deps: [{ token: i0.ElementRef }, { token: FocusTrapFactory }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Directive });\nCdkTrapFocus.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: CdkTrapFocus, selector: \"[cdkTrapFocus]\", inputs: { enabled: [\"cdkTrapFocus\", \"enabled\"], autoCapture: [\"cdkTrapFocusAutoCapture\", \"autoCapture\"] }, exportAs: [\"cdkTrapFocus\"], usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkTrapFocus, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkTrapFocus]',\n exportAs: 'cdkTrapFocus',\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: FocusTrapFactory }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, propDecorators: { enabled: [{\n type: Input,\n args: ['cdkTrapFocus']\n }], autoCapture: [{\n type: Input,\n args: ['cdkTrapFocusAutoCapture']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class that allows for trapping focus within a DOM element.\n *\n * This class uses a strategy pattern that determines how it traps focus.\n * See FocusTrapInertStrategy.\n */\nclass ConfigurableFocusTrap extends FocusTrap {\n constructor(_element, _checker, _ngZone, _document, _focusTrapManager, _inertStrategy, config) {\n super(_element, _checker, _ngZone, _document, config.defer);\n this._focusTrapManager = _focusTrapManager;\n this._inertStrategy = _inertStrategy;\n this._focusTrapManager.register(this);\n }\n /** Whether the FocusTrap is enabled. */\n get enabled() {\n return this._enabled;\n }\n set enabled(value) {\n this._enabled = value;\n if (this._enabled) {\n this._focusTrapManager.register(this);\n }\n else {\n this._focusTrapManager.deregister(this);\n }\n }\n /** Notifies the FocusTrapManager that this FocusTrap will be destroyed. */\n destroy() {\n this._focusTrapManager.deregister(this);\n super.destroy();\n }\n /** @docs-private Implemented as part of ManagedFocusTrap. */\n _enable() {\n this._inertStrategy.preventFocus(this);\n this.toggleAnchors(true);\n }\n /** @docs-private Implemented as part of ManagedFocusTrap. */\n _disable() {\n this._inertStrategy.allowFocus(this);\n this.toggleAnchors(false);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The injection token used to specify the inert strategy. */\nconst FOCUS_TRAP_INERT_STRATEGY = new InjectionToken('FOCUS_TRAP_INERT_STRATEGY');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Lightweight FocusTrapInertStrategy that adds a document focus event\n * listener to redirect focus back inside the FocusTrap.\n */\nclass EventListenerFocusTrapInertStrategy {\n constructor() {\n /** Focus event handler. */\n this._listener = null;\n }\n /** Adds a document event listener that keeps focus inside the FocusTrap. */\n preventFocus(focusTrap) {\n // Ensure there's only one listener per document\n if (this._listener) {\n focusTrap._document.removeEventListener('focus', this._listener, true);\n }\n this._listener = (e) => this._trapFocus(focusTrap, e);\n focusTrap._ngZone.runOutsideAngular(() => {\n focusTrap._document.addEventListener('focus', this._listener, true);\n });\n }\n /** Removes the event listener added in preventFocus. */\n allowFocus(focusTrap) {\n if (!this._listener) {\n return;\n }\n focusTrap._document.removeEventListener('focus', this._listener, true);\n this._listener = null;\n }\n /**\n * Refocuses the first element in the FocusTrap if the focus event target was outside\n * the FocusTrap.\n *\n * This is an event listener callback. The event listener is added in runOutsideAngular,\n * so all this code runs outside Angular as well.\n */\n _trapFocus(focusTrap, event) {\n const target = event.target;\n const focusTrapRoot = focusTrap._element;\n // Don't refocus if target was in an overlay, because the overlay might be associated\n // with an element inside the FocusTrap, ex. mat-select.\n if (target && !focusTrapRoot.contains(target) && !target.closest?.('div.cdk-overlay-pane')) {\n // Some legacy FocusTrap usages have logic that focuses some element on the page\n // just before FocusTrap is destroyed. For backwards compatibility, wait\n // to be sure FocusTrap is still enabled before refocusing.\n setTimeout(() => {\n // Check whether focus wasn't put back into the focus trap while the timeout was pending.\n if (focusTrap.enabled && !focusTrapRoot.contains(focusTrap._document.activeElement)) {\n focusTrap.focusFirstTabbableElement();\n }\n });\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Injectable that ensures only the most recently enabled FocusTrap is active. */\nclass FocusTrapManager {\n constructor() {\n // A stack of the FocusTraps on the page. Only the FocusTrap at the\n // top of the stack is active.\n this._focusTrapStack = [];\n }\n /**\n * Disables the FocusTrap at the top of the stack, and then pushes\n * the new FocusTrap onto the stack.\n */\n register(focusTrap) {\n // Dedupe focusTraps that register multiple times.\n this._focusTrapStack = this._focusTrapStack.filter(ft => ft !== focusTrap);\n let stack = this._focusTrapStack;\n if (stack.length) {\n stack[stack.length - 1]._disable();\n }\n stack.push(focusTrap);\n focusTrap._enable();\n }\n /**\n * Removes the FocusTrap from the stack, and activates the\n * FocusTrap that is the new top of the stack.\n */\n deregister(focusTrap) {\n focusTrap._disable();\n const stack = this._focusTrapStack;\n const i = stack.indexOf(focusTrap);\n if (i !== -1) {\n stack.splice(i, 1);\n if (stack.length) {\n stack[stack.length - 1]._enable();\n }\n }\n }\n}\nFocusTrapManager.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FocusTrapManager, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nFocusTrapManager.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FocusTrapManager, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FocusTrapManager, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Factory that allows easy instantiation of configurable focus traps. */\nclass ConfigurableFocusTrapFactory {\n constructor(_checker, _ngZone, _focusTrapManager, _document, _inertStrategy) {\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._focusTrapManager = _focusTrapManager;\n this._document = _document;\n // TODO split up the strategies into different modules, similar to DateAdapter.\n this._inertStrategy = _inertStrategy || new EventListenerFocusTrapInertStrategy();\n }\n create(element, config = { defer: false }) {\n let configObject;\n if (typeof config === 'boolean') {\n configObject = { defer: config };\n }\n else {\n configObject = config;\n }\n return new ConfigurableFocusTrap(element, this._checker, this._ngZone, this._document, this._focusTrapManager, this._inertStrategy, configObject);\n }\n}\nConfigurableFocusTrapFactory.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ConfigurableFocusTrapFactory, deps: [{ token: InteractivityChecker }, { token: i0.NgZone }, { token: FocusTrapManager }, { token: DOCUMENT }, { token: FOCUS_TRAP_INERT_STRATEGY, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nConfigurableFocusTrapFactory.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ConfigurableFocusTrapFactory, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ConfigurableFocusTrapFactory, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: InteractivityChecker }, { type: i0.NgZone }, { type: FocusTrapManager }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [FOCUS_TRAP_INERT_STRATEGY]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Gets whether an event could be a faked `mousedown` event dispatched by a screen reader. */\nfunction isFakeMousedownFromScreenReader(event) {\n // Some screen readers will dispatch a fake `mousedown` event when pressing enter or space on\n // a clickable element. We can distinguish these events when both `offsetX` and `offsetY` are\n // zero or `event.buttons` is zero, depending on the browser:\n // - `event.buttons` works on Firefox, but fails on Chrome.\n // - `offsetX` and `offsetY` work on Chrome, but fail on Firefox.\n // Note that there's an edge case where the user could click the 0x0 spot of the\n // screen themselves, but that is unlikely to contain interactive elements.\n return event.buttons === 0 || (event.offsetX === 0 && event.offsetY === 0);\n}\n/** Gets whether an event could be a faked `touchstart` event dispatched by a screen reader. */\nfunction isFakeTouchstartFromScreenReader(event) {\n const touch = (event.touches && event.touches[0]) || (event.changedTouches && event.changedTouches[0]);\n // A fake `touchstart` can be distinguished from a real one by looking at the `identifier`\n // which is typically >= 0 on a real device versus -1 from a screen reader. Just to be safe,\n // we can also look at `radiusX` and `radiusY`. This behavior was observed against a Windows 10\n // device with a touch screen running NVDA v2020.4 and Firefox 85 or Chrome 88.\n return (!!touch &&\n touch.identifier === -1 &&\n (touch.radiusX == null || touch.radiusX === 1) &&\n (touch.radiusY == null || touch.radiusY === 1));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injectable options for the InputModalityDetector. These are shallowly merged with the default\n * options.\n */\nconst INPUT_MODALITY_DETECTOR_OPTIONS = new InjectionToken('cdk-input-modality-detector-options');\n/**\n * Default options for the InputModalityDetector.\n *\n * Modifier keys are ignored by default (i.e. when pressed won't cause the service to detect\n * keyboard input modality) for two reasons:\n *\n * 1. Modifier keys are commonly used with mouse to perform actions such as 'right click' or 'open\n * in new tab', and are thus less representative of actual keyboard interaction.\n * 2. VoiceOver triggers some keyboard events when linearly navigating with Control + Option (but\n * confusingly not with Caps Lock). Thus, to have parity with other screen readers, we ignore\n * these keys so as to not update the input modality.\n *\n * Note that we do not by default ignore the right Meta key on Safari because it has the same key\n * code as the ContextMenu key on other browsers. When we switch to using event.key, we can\n * distinguish between the two.\n */\nconst INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS = {\n ignoreKeys: [ALT, CONTROL, MAC_META, META, SHIFT],\n};\n/**\n * The amount of time needed to pass after a touchstart event in order for a subsequent mousedown\n * event to be attributed as mouse and not touch.\n *\n * This is the value used by AngularJS Material. Through trial and error (on iPhone 6S) they found\n * that a value of around 650ms seems appropriate.\n */\nconst TOUCH_BUFFER_MS = 650;\n/**\n * Event listener options that enable capturing and also mark the listener as passive if the browser\n * supports it.\n */\nconst modalityEventListenerOptions = normalizePassiveListenerOptions({\n passive: true,\n capture: true,\n});\n/**\n * Service that detects the user's input modality.\n *\n * This service does not update the input modality when a user navigates with a screen reader\n * (e.g. linear navigation with VoiceOver, object navigation / browse mode with NVDA, virtual PC\n * cursor mode with JAWS). This is in part due to technical limitations (i.e. keyboard events do not\n * fire as expected in these modes) but is also arguably the correct behavior. Navigating with a\n * screen reader is akin to visually scanning a page, and should not be interpreted as actual user\n * input interaction.\n *\n * When a user is not navigating but *interacting* with a screen reader, this service attempts to\n * update the input modality to keyboard, but in general this service's behavior is largely\n * undefined.\n */\nclass InputModalityDetector {\n constructor(_platform, ngZone, document, options) {\n this._platform = _platform;\n /**\n * The most recently detected input modality event target. Is null if no input modality has been\n * detected or if the associated event target is null for some unknown reason.\n */\n this._mostRecentTarget = null;\n /** The underlying BehaviorSubject that emits whenever an input modality is detected. */\n this._modality = new BehaviorSubject(null);\n /**\n * The timestamp of the last touch input modality. Used to determine whether mousedown events\n * should be attributed to mouse or touch.\n */\n this._lastTouchMs = 0;\n /**\n * Handles keydown events. Must be an arrow function in order to preserve the context when it gets\n * bound.\n */\n this._onKeydown = (event) => {\n // If this is one of the keys we should ignore, then ignore it and don't update the input\n // modality to keyboard.\n if (this._options?.ignoreKeys?.some(keyCode => keyCode === event.keyCode)) {\n return;\n }\n this._modality.next('keyboard');\n this._mostRecentTarget = _getEventTarget(event);\n };\n /**\n * Handles mousedown events. Must be an arrow function in order to preserve the context when it\n * gets bound.\n */\n this._onMousedown = (event) => {\n // Touches trigger both touch and mouse events, so we need to distinguish between mouse events\n // that were triggered via mouse vs touch. To do so, check if the mouse event occurs closely\n // after the previous touch event.\n if (Date.now() - this._lastTouchMs < TOUCH_BUFFER_MS) {\n return;\n }\n // Fake mousedown events are fired by some screen readers when controls are activated by the\n // screen reader. Attribute them to keyboard input modality.\n this._modality.next(isFakeMousedownFromScreenReader(event) ? 'keyboard' : 'mouse');\n this._mostRecentTarget = _getEventTarget(event);\n };\n /**\n * Handles touchstart events. Must be an arrow function in order to preserve the context when it\n * gets bound.\n */\n this._onTouchstart = (event) => {\n // Same scenario as mentioned in _onMousedown, but on touch screen devices, fake touchstart\n // events are fired. Again, attribute to keyboard input modality.\n if (isFakeTouchstartFromScreenReader(event)) {\n this._modality.next('keyboard');\n return;\n }\n // Store the timestamp of this touch event, as it's used to distinguish between mouse events\n // triggered via mouse vs touch.\n this._lastTouchMs = Date.now();\n this._modality.next('touch');\n this._mostRecentTarget = _getEventTarget(event);\n };\n this._options = {\n ...INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS,\n ...options,\n };\n // Skip the first emission as it's null.\n this.modalityDetected = this._modality.pipe(skip(1));\n this.modalityChanged = this.modalityDetected.pipe(distinctUntilChanged());\n // If we're not in a browser, this service should do nothing, as there's no relevant input\n // modality to detect.\n if (_platform.isBrowser) {\n ngZone.runOutsideAngular(() => {\n document.addEventListener('keydown', this._onKeydown, modalityEventListenerOptions);\n document.addEventListener('mousedown', this._onMousedown, modalityEventListenerOptions);\n document.addEventListener('touchstart', this._onTouchstart, modalityEventListenerOptions);\n });\n }\n }\n /** The most recently detected input modality. */\n get mostRecentModality() {\n return this._modality.value;\n }\n ngOnDestroy() {\n this._modality.complete();\n if (this._platform.isBrowser) {\n document.removeEventListener('keydown', this._onKeydown, modalityEventListenerOptions);\n document.removeEventListener('mousedown', this._onMousedown, modalityEventListenerOptions);\n document.removeEventListener('touchstart', this._onTouchstart, modalityEventListenerOptions);\n }\n }\n}\nInputModalityDetector.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: InputModalityDetector, deps: [{ token: i1.Platform }, { token: i0.NgZone }, { token: DOCUMENT }, { token: INPUT_MODALITY_DETECTOR_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nInputModalityDetector.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: InputModalityDetector, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: InputModalityDetector, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }, { type: i0.NgZone }, { type: Document, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [INPUT_MODALITY_DETECTOR_OPTIONS]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst LIVE_ANNOUNCER_ELEMENT_TOKEN = new InjectionToken('liveAnnouncerElement', {\n providedIn: 'root',\n factory: LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY,\n});\n/** @docs-private */\nfunction LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY() {\n return null;\n}\n/** Injection token that can be used to configure the default options for the LiveAnnouncer. */\nconst LIVE_ANNOUNCER_DEFAULT_OPTIONS = new InjectionToken('LIVE_ANNOUNCER_DEFAULT_OPTIONS');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass LiveAnnouncer {\n constructor(elementToken, _ngZone, _document, _defaultOptions) {\n this._ngZone = _ngZone;\n this._defaultOptions = _defaultOptions;\n // We inject the live element and document as `any` because the constructor signature cannot\n // reference browser globals (HTMLElement, Document) on non-browser environments, since having\n // a class decorator causes TypeScript to preserve the constructor signature types.\n this._document = _document;\n this._liveElement = elementToken || this._createLiveElement();\n }\n announce(message, ...args) {\n const defaultOptions = this._defaultOptions;\n let politeness;\n let duration;\n if (args.length === 1 && typeof args[0] === 'number') {\n duration = args[0];\n }\n else {\n [politeness, duration] = args;\n }\n this.clear();\n clearTimeout(this._previousTimeout);\n if (!politeness) {\n politeness =\n defaultOptions && defaultOptions.politeness ? defaultOptions.politeness : 'polite';\n }\n if (duration == null && defaultOptions) {\n duration = defaultOptions.duration;\n }\n // TODO: ensure changing the politeness works on all environments we support.\n this._liveElement.setAttribute('aria-live', politeness);\n // This 100ms timeout is necessary for some browser + screen-reader combinations:\n // - Both JAWS and NVDA over IE11 will not announce anything without a non-zero timeout.\n // - With Chrome and IE11 with NVDA or JAWS, a repeated (identical) message won't be read a\n // second time without clearing and then using a non-zero delay.\n // (using JAWS 17 at time of this writing).\n return this._ngZone.runOutsideAngular(() => {\n if (!this._currentPromise) {\n this._currentPromise = new Promise(resolve => (this._currentResolve = resolve));\n }\n clearTimeout(this._previousTimeout);\n this._previousTimeout = setTimeout(() => {\n this._liveElement.textContent = message;\n if (typeof duration === 'number') {\n this._previousTimeout = setTimeout(() => this.clear(), duration);\n }\n this._currentResolve();\n this._currentPromise = this._currentResolve = undefined;\n }, 100);\n return this._currentPromise;\n });\n }\n /**\n * Clears the current text from the announcer element. Can be used to prevent\n * screen readers from reading the text out again while the user is going\n * through the page landmarks.\n */\n clear() {\n if (this._liveElement) {\n this._liveElement.textContent = '';\n }\n }\n ngOnDestroy() {\n clearTimeout(this._previousTimeout);\n this._liveElement?.remove();\n this._liveElement = null;\n this._currentResolve?.();\n this._currentPromise = this._currentResolve = undefined;\n }\n _createLiveElement() {\n const elementClass = 'cdk-live-announcer-element';\n const previousElements = this._document.getElementsByClassName(elementClass);\n const liveEl = this._document.createElement('div');\n // Remove any old containers. This can happen when coming in from a server-side-rendered page.\n for (let i = 0; i < previousElements.length; i++) {\n previousElements[i].remove();\n }\n liveEl.classList.add(elementClass);\n liveEl.classList.add('cdk-visually-hidden');\n liveEl.setAttribute('aria-atomic', 'true');\n liveEl.setAttribute('aria-live', 'polite');\n this._document.body.appendChild(liveEl);\n return liveEl;\n }\n}\nLiveAnnouncer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: LiveAnnouncer, deps: [{ token: LIVE_ANNOUNCER_ELEMENT_TOKEN, optional: true }, { token: i0.NgZone }, { token: DOCUMENT }, { token: LIVE_ANNOUNCER_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nLiveAnnouncer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: LiveAnnouncer, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: LiveAnnouncer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [LIVE_ANNOUNCER_ELEMENT_TOKEN]\n }] }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [LIVE_ANNOUNCER_DEFAULT_OPTIONS]\n }] }]; } });\n/**\n * A directive that works similarly to aria-live, but uses the LiveAnnouncer to ensure compatibility\n * with a wider range of browsers and screen readers.\n */\nclass CdkAriaLive {\n constructor(_elementRef, _liveAnnouncer, _contentObserver, _ngZone) {\n this._elementRef = _elementRef;\n this._liveAnnouncer = _liveAnnouncer;\n this._contentObserver = _contentObserver;\n this._ngZone = _ngZone;\n this._politeness = 'polite';\n }\n /** The aria-live politeness level to use when announcing messages. */\n get politeness() {\n return this._politeness;\n }\n set politeness(value) {\n this._politeness = value === 'off' || value === 'assertive' ? value : 'polite';\n if (this._politeness === 'off') {\n if (this._subscription) {\n this._subscription.unsubscribe();\n this._subscription = null;\n }\n }\n else if (!this._subscription) {\n this._subscription = this._ngZone.runOutsideAngular(() => {\n return this._contentObserver.observe(this._elementRef).subscribe(() => {\n // Note that we use textContent here, rather than innerText, in order to avoid a reflow.\n const elementText = this._elementRef.nativeElement.textContent;\n // The `MutationObserver` fires also for attribute\n // changes which we don't want to announce.\n if (elementText !== this._previousAnnouncedText) {\n this._liveAnnouncer.announce(elementText, this._politeness);\n this._previousAnnouncedText = elementText;\n }\n });\n });\n }\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._subscription.unsubscribe();\n }\n }\n}\nCdkAriaLive.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkAriaLive, deps: [{ token: i0.ElementRef }, { token: LiveAnnouncer }, { token: i1$1.ContentObserver }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive });\nCdkAriaLive.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: CdkAriaLive, selector: \"[cdkAriaLive]\", inputs: { politeness: [\"cdkAriaLive\", \"politeness\"] }, exportAs: [\"cdkAriaLive\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkAriaLive, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkAriaLive]',\n exportAs: 'cdkAriaLive',\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: LiveAnnouncer }, { type: i1$1.ContentObserver }, { type: i0.NgZone }]; }, propDecorators: { politeness: [{\n type: Input,\n args: ['cdkAriaLive']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** InjectionToken for FocusMonitorOptions. */\nconst FOCUS_MONITOR_DEFAULT_OPTIONS = new InjectionToken('cdk-focus-monitor-default-options');\n/**\n * Event listener options that enable capturing and also\n * mark the listener as passive if the browser supports it.\n */\nconst captureEventListenerOptions = normalizePassiveListenerOptions({\n passive: true,\n capture: true,\n});\n/** Monitors mouse and keyboard events to determine the cause of focus events. */\nclass FocusMonitor {\n constructor(_ngZone, _platform, _inputModalityDetector, \n /** @breaking-change 11.0.0 make document required */\n document, options) {\n this._ngZone = _ngZone;\n this._platform = _platform;\n this._inputModalityDetector = _inputModalityDetector;\n /** The focus origin that the next focus event is a result of. */\n this._origin = null;\n /** Whether the window has just been focused. */\n this._windowFocused = false;\n /**\n * Whether the origin was determined via a touch interaction. Necessary as properly attributing\n * focus events to touch interactions requires special logic.\n */\n this._originFromTouchInteraction = false;\n /** Map of elements being monitored to their info. */\n this._elementInfo = new Map();\n /** The number of elements currently being monitored. */\n this._monitoredElementCount = 0;\n /**\n * Keeps track of the root nodes to which we've currently bound a focus/blur handler,\n * as well as the number of monitored elements that they contain. We have to treat focus/blur\n * handlers differently from the rest of the events, because the browser won't emit events\n * to the document when focus moves inside of a shadow root.\n */\n this._rootNodeFocusListenerCount = new Map();\n /**\n * Event listener for `focus` events on the window.\n * Needs to be an arrow function in order to preserve the context when it gets bound.\n */\n this._windowFocusListener = () => {\n // Make a note of when the window regains focus, so we can\n // restore the origin info for the focused element.\n this._windowFocused = true;\n this._windowFocusTimeoutId = window.setTimeout(() => (this._windowFocused = false));\n };\n /** Subject for stopping our InputModalityDetector subscription. */\n this._stopInputModalityDetector = new Subject();\n /**\n * Event listener for `focus` and 'blur' events on the document.\n * Needs to be an arrow function in order to preserve the context when it gets bound.\n */\n this._rootNodeFocusAndBlurListener = (event) => {\n const target = _getEventTarget(event);\n const handler = event.type === 'focus' ? this._onFocus : this._onBlur;\n // We need to walk up the ancestor chain in order to support `checkChildren`.\n for (let element = target; element; element = element.parentElement) {\n handler.call(this, event, element);\n }\n };\n this._document = document;\n this._detectionMode = options?.detectionMode || 0 /* IMMEDIATE */;\n }\n monitor(element, checkChildren = false) {\n const nativeElement = coerceElement(element);\n // Do nothing if we're not on the browser platform or the passed in node isn't an element.\n if (!this._platform.isBrowser || nativeElement.nodeType !== 1) {\n return of(null);\n }\n // If the element is inside the shadow DOM, we need to bind our focus/blur listeners to\n // the shadow root, rather than the `document`, because the browser won't emit focus events\n // to the `document`, if focus is moving within the same shadow root.\n const rootNode = _getShadowRoot(nativeElement) || this._getDocument();\n const cachedInfo = this._elementInfo.get(nativeElement);\n // Check if we're already monitoring this element.\n if (cachedInfo) {\n if (checkChildren) {\n // TODO(COMP-318): this can be problematic, because it'll turn all non-checkChildren\n // observers into ones that behave as if `checkChildren` was turned on. We need a more\n // robust solution.\n cachedInfo.checkChildren = true;\n }\n return cachedInfo.subject;\n }\n // Create monitored element info.\n const info = {\n checkChildren: checkChildren,\n subject: new Subject(),\n rootNode,\n };\n this._elementInfo.set(nativeElement, info);\n this._registerGlobalListeners(info);\n return info.subject;\n }\n stopMonitoring(element) {\n const nativeElement = coerceElement(element);\n const elementInfo = this._elementInfo.get(nativeElement);\n if (elementInfo) {\n elementInfo.subject.complete();\n this._setClasses(nativeElement);\n this._elementInfo.delete(nativeElement);\n this._removeGlobalListeners(elementInfo);\n }\n }\n focusVia(element, origin, options) {\n const nativeElement = coerceElement(element);\n const focusedElement = this._getDocument().activeElement;\n // If the element is focused already, calling `focus` again won't trigger the event listener\n // which means that the focus classes won't be updated. If that's the case, update the classes\n // directly without waiting for an event.\n if (nativeElement === focusedElement) {\n this._getClosestElementsInfo(nativeElement).forEach(([currentElement, info]) => this._originChanged(currentElement, origin, info));\n }\n else {\n this._setOrigin(origin);\n // `focus` isn't available on the server\n if (typeof nativeElement.focus === 'function') {\n nativeElement.focus(options);\n }\n }\n }\n ngOnDestroy() {\n this._elementInfo.forEach((_info, element) => this.stopMonitoring(element));\n }\n /** Access injected document if available or fallback to global document reference */\n _getDocument() {\n return this._document || document;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n const doc = this._getDocument();\n return doc.defaultView || window;\n }\n _getFocusOrigin(focusEventTarget) {\n if (this._origin) {\n // If the origin was realized via a touch interaction, we need to perform additional checks\n // to determine whether the focus origin should be attributed to touch or program.\n if (this._originFromTouchInteraction) {\n return this._shouldBeAttributedToTouch(focusEventTarget) ? 'touch' : 'program';\n }\n else {\n return this._origin;\n }\n }\n // If the window has just regained focus, we can restore the most recent origin from before the\n // window blurred. Otherwise, we've reached the point where we can't identify the source of the\n // focus. This typically means one of two things happened:\n //\n // 1) The element was programmatically focused, or\n // 2) The element was focused via screen reader navigation (which generally doesn't fire\n // events).\n //\n // Because we can't distinguish between these two cases, we default to setting `program`.\n return this._windowFocused && this._lastFocusOrigin ? this._lastFocusOrigin : 'program';\n }\n /**\n * Returns whether the focus event should be attributed to touch. Recall that in IMMEDIATE mode, a\n * touch origin isn't immediately reset at the next tick (see _setOrigin). This means that when we\n * handle a focus event following a touch interaction, we need to determine whether (1) the focus\n * event was directly caused by the touch interaction or (2) the focus event was caused by a\n * subsequent programmatic focus call triggered by the touch interaction.\n * @param focusEventTarget The target of the focus event under examination.\n */\n _shouldBeAttributedToTouch(focusEventTarget) {\n // Please note that this check is not perfect. Consider the following edge case:\n //\n //
\n // \n //
\n //\n // Suppose there is a FocusMonitor in IMMEDIATE mode attached to #parent. When the user touches\n // #child, #parent is programmatically focused. This code will attribute the focus to touch\n // instead of program. This is a relatively minor edge-case that can be worked around by using\n // focusVia(parent, 'program') to focus #parent.\n return (this._detectionMode === 1 /* EVENTUAL */ ||\n !!focusEventTarget?.contains(this._inputModalityDetector._mostRecentTarget));\n }\n /**\n * Sets the focus classes on the element based on the given focus origin.\n * @param element The element to update the classes on.\n * @param origin The focus origin.\n */\n _setClasses(element, origin) {\n element.classList.toggle('cdk-focused', !!origin);\n element.classList.toggle('cdk-touch-focused', origin === 'touch');\n element.classList.toggle('cdk-keyboard-focused', origin === 'keyboard');\n element.classList.toggle('cdk-mouse-focused', origin === 'mouse');\n element.classList.toggle('cdk-program-focused', origin === 'program');\n }\n /**\n * Updates the focus origin. If we're using immediate detection mode, we schedule an async\n * function to clear the origin at the end of a timeout. The duration of the timeout depends on\n * the origin being set.\n * @param origin The origin to set.\n * @param isFromInteraction Whether we are setting the origin from an interaction event.\n */\n _setOrigin(origin, isFromInteraction = false) {\n this._ngZone.runOutsideAngular(() => {\n this._origin = origin;\n this._originFromTouchInteraction = origin === 'touch' && isFromInteraction;\n // If we're in IMMEDIATE mode, reset the origin at the next tick (or in `TOUCH_BUFFER_MS` ms\n // for a touch event). We reset the origin at the next tick because Firefox focuses one tick\n // after the interaction event. We wait `TOUCH_BUFFER_MS` ms before resetting the origin for\n // a touch event because when a touch event is fired, the associated focus event isn't yet in\n // the event queue. Before doing so, clear any pending timeouts.\n if (this._detectionMode === 0 /* IMMEDIATE */) {\n clearTimeout(this._originTimeoutId);\n const ms = this._originFromTouchInteraction ? TOUCH_BUFFER_MS : 1;\n this._originTimeoutId = setTimeout(() => (this._origin = null), ms);\n }\n });\n }\n /**\n * Handles focus events on a registered element.\n * @param event The focus event.\n * @param element The monitored element.\n */\n _onFocus(event, element) {\n // NOTE(mmalerba): We currently set the classes based on the focus origin of the most recent\n // focus event affecting the monitored element. If we want to use the origin of the first event\n // instead we should check for the cdk-focused class here and return if the element already has\n // it. (This only matters for elements that have includesChildren = true).\n // If we are not counting child-element-focus as focused, make sure that the event target is the\n // monitored element itself.\n const elementInfo = this._elementInfo.get(element);\n const focusEventTarget = _getEventTarget(event);\n if (!elementInfo || (!elementInfo.checkChildren && element !== focusEventTarget)) {\n return;\n }\n this._originChanged(element, this._getFocusOrigin(focusEventTarget), elementInfo);\n }\n /**\n * Handles blur events on a registered element.\n * @param event The blur event.\n * @param element The monitored element.\n */\n _onBlur(event, element) {\n // If we are counting child-element-focus as focused, make sure that we aren't just blurring in\n // order to focus another child of the monitored element.\n const elementInfo = this._elementInfo.get(element);\n if (!elementInfo ||\n (elementInfo.checkChildren &&\n event.relatedTarget instanceof Node &&\n element.contains(event.relatedTarget))) {\n return;\n }\n this._setClasses(element);\n this._emitOrigin(elementInfo.subject, null);\n }\n _emitOrigin(subject, origin) {\n this._ngZone.run(() => subject.next(origin));\n }\n _registerGlobalListeners(elementInfo) {\n if (!this._platform.isBrowser) {\n return;\n }\n const rootNode = elementInfo.rootNode;\n const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode) || 0;\n if (!rootNodeFocusListeners) {\n this._ngZone.runOutsideAngular(() => {\n rootNode.addEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n rootNode.addEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n });\n }\n this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners + 1);\n // Register global listeners when first element is monitored.\n if (++this._monitoredElementCount === 1) {\n // Note: we listen to events in the capture phase so we\n // can detect them even if the user stops propagation.\n this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n window.addEventListener('focus', this._windowFocusListener);\n });\n // The InputModalityDetector is also just a collection of global listeners.\n this._inputModalityDetector.modalityDetected\n .pipe(takeUntil(this._stopInputModalityDetector))\n .subscribe(modality => {\n this._setOrigin(modality, true /* isFromInteraction */);\n });\n }\n }\n _removeGlobalListeners(elementInfo) {\n const rootNode = elementInfo.rootNode;\n if (this._rootNodeFocusListenerCount.has(rootNode)) {\n const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode);\n if (rootNodeFocusListeners > 1) {\n this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners - 1);\n }\n else {\n rootNode.removeEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n rootNode.removeEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n this._rootNodeFocusListenerCount.delete(rootNode);\n }\n }\n // Unregister global listeners when last element is unmonitored.\n if (!--this._monitoredElementCount) {\n const window = this._getWindow();\n window.removeEventListener('focus', this._windowFocusListener);\n // Equivalently, stop our InputModalityDetector subscription.\n this._stopInputModalityDetector.next();\n // Clear timeouts for all potentially pending timeouts to prevent the leaks.\n clearTimeout(this._windowFocusTimeoutId);\n clearTimeout(this._originTimeoutId);\n }\n }\n /** Updates all the state on an element once its focus origin has changed. */\n _originChanged(element, origin, elementInfo) {\n this._setClasses(element, origin);\n this._emitOrigin(elementInfo.subject, origin);\n this._lastFocusOrigin = origin;\n }\n /**\n * Collects the `MonitoredElementInfo` of a particular element and\n * all of its ancestors that have enabled `checkChildren`.\n * @param element Element from which to start the search.\n */\n _getClosestElementsInfo(element) {\n const results = [];\n this._elementInfo.forEach((info, currentElement) => {\n if (currentElement === element || (info.checkChildren && currentElement.contains(element))) {\n results.push([currentElement, info]);\n }\n });\n return results;\n }\n}\nFocusMonitor.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FocusMonitor, deps: [{ token: i0.NgZone }, { token: i1.Platform }, { token: InputModalityDetector }, { token: DOCUMENT, optional: true }, { token: FOCUS_MONITOR_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nFocusMonitor.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FocusMonitor, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: FocusMonitor, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i0.NgZone }, { type: i1.Platform }, { type: InputModalityDetector }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [FOCUS_MONITOR_DEFAULT_OPTIONS]\n }] }]; } });\n/**\n * Directive that determines how a particular element was focused (via keyboard, mouse, touch, or\n * programmatically) and adds corresponding classes to the element.\n *\n * There are two variants of this directive:\n * 1) cdkMonitorElementFocus: does not consider an element to be focused if one of its children is\n * focused.\n * 2) cdkMonitorSubtreeFocus: considers an element focused if it or any of its children are focused.\n */\nclass CdkMonitorFocus {\n constructor(_elementRef, _focusMonitor) {\n this._elementRef = _elementRef;\n this._focusMonitor = _focusMonitor;\n this.cdkFocusChange = new EventEmitter();\n }\n ngAfterViewInit() {\n const element = this._elementRef.nativeElement;\n this._monitorSubscription = this._focusMonitor\n .monitor(element, element.nodeType === 1 && element.hasAttribute('cdkMonitorSubtreeFocus'))\n .subscribe(origin => this.cdkFocusChange.emit(origin));\n }\n ngOnDestroy() {\n this._focusMonitor.stopMonitoring(this._elementRef);\n if (this._monitorSubscription) {\n this._monitorSubscription.unsubscribe();\n }\n }\n}\nCdkMonitorFocus.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkMonitorFocus, deps: [{ token: i0.ElementRef }, { token: FocusMonitor }], target: i0.ɵɵFactoryTarget.Directive });\nCdkMonitorFocus.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: CdkMonitorFocus, selector: \"[cdkMonitorElementFocus], [cdkMonitorSubtreeFocus]\", outputs: { cdkFocusChange: \"cdkFocusChange\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkMonitorFocus, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkMonitorElementFocus], [cdkMonitorSubtreeFocus]',\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: FocusMonitor }]; }, propDecorators: { cdkFocusChange: [{\n type: Output\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** CSS class applied to the document body when in black-on-white high-contrast mode. */\nconst BLACK_ON_WHITE_CSS_CLASS = 'cdk-high-contrast-black-on-white';\n/** CSS class applied to the document body when in white-on-black high-contrast mode. */\nconst WHITE_ON_BLACK_CSS_CLASS = 'cdk-high-contrast-white-on-black';\n/** CSS class applied to the document body when in high-contrast mode. */\nconst HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS = 'cdk-high-contrast-active';\n/**\n * Service to determine whether the browser is currently in a high-contrast-mode environment.\n *\n * Microsoft Windows supports an accessibility feature called \"High Contrast Mode\". This mode\n * changes the appearance of all applications, including web applications, to dramatically increase\n * contrast.\n *\n * IE, Edge, and Firefox currently support this mode. Chrome does not support Windows High Contrast\n * Mode. This service does not detect high-contrast mode as added by the Chrome \"High Contrast\"\n * browser extension.\n */\nclass HighContrastModeDetector {\n constructor(_platform, document) {\n this._platform = _platform;\n this._document = document;\n }\n /** Gets the current high-contrast-mode for the page. */\n getHighContrastMode() {\n if (!this._platform.isBrowser) {\n return 0 /* NONE */;\n }\n // Create a test element with an arbitrary background-color that is neither black nor\n // white; high-contrast mode will coerce the color to either black or white. Also ensure that\n // appending the test element to the DOM does not affect layout by absolutely positioning it\n const testElement = this._document.createElement('div');\n testElement.style.backgroundColor = 'rgb(1,2,3)';\n testElement.style.position = 'absolute';\n this._document.body.appendChild(testElement);\n // Get the computed style for the background color, collapsing spaces to normalize between\n // browsers. Once we get this color, we no longer need the test element. Access the `window`\n // via the document so we can fake it in tests. Note that we have extra null checks, because\n // this logic will likely run during app bootstrap and throwing can break the entire app.\n const documentWindow = this._document.defaultView || window;\n const computedStyle = documentWindow && documentWindow.getComputedStyle\n ? documentWindow.getComputedStyle(testElement)\n : null;\n const computedColor = ((computedStyle && computedStyle.backgroundColor) || '').replace(/ /g, '');\n testElement.remove();\n switch (computedColor) {\n case 'rgb(0,0,0)':\n return 2 /* WHITE_ON_BLACK */;\n case 'rgb(255,255,255)':\n return 1 /* BLACK_ON_WHITE */;\n }\n return 0 /* NONE */;\n }\n /** Applies CSS classes indicating high-contrast mode to document body (browser-only). */\n _applyBodyHighContrastModeCssClasses() {\n if (!this._hasCheckedHighContrastMode && this._platform.isBrowser && this._document.body) {\n const bodyClasses = this._document.body.classList;\n // IE11 doesn't support `classList` operations with multiple arguments\n bodyClasses.remove(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS);\n bodyClasses.remove(BLACK_ON_WHITE_CSS_CLASS);\n bodyClasses.remove(WHITE_ON_BLACK_CSS_CLASS);\n this._hasCheckedHighContrastMode = true;\n const mode = this.getHighContrastMode();\n if (mode === 1 /* BLACK_ON_WHITE */) {\n bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS);\n bodyClasses.add(BLACK_ON_WHITE_CSS_CLASS);\n }\n else if (mode === 2 /* WHITE_ON_BLACK */) {\n bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS);\n bodyClasses.add(WHITE_ON_BLACK_CSS_CLASS);\n }\n }\n }\n}\nHighContrastModeDetector.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: HighContrastModeDetector, deps: [{ token: i1.Platform }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nHighContrastModeDetector.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: HighContrastModeDetector, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: HighContrastModeDetector, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass A11yModule {\n constructor(highContrastModeDetector) {\n highContrastModeDetector._applyBodyHighContrastModeCssClasses();\n }\n}\nA11yModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: A11yModule, deps: [{ token: HighContrastModeDetector }], target: i0.ɵɵFactoryTarget.NgModule });\nA11yModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: A11yModule, declarations: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus], imports: [ObserversModule], exports: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus] });\nA11yModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: A11yModule, imports: [[ObserversModule]] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: A11yModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [ObserversModule],\n declarations: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus],\n exports: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus],\n }]\n }], ctorParameters: function () { return [{ type: HighContrastModeDetector }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { A11yModule, ActiveDescendantKeyManager, AriaDescriber, CDK_DESCRIBEDBY_HOST_ATTRIBUTE, CDK_DESCRIBEDBY_ID_PREFIX, CdkAriaLive, CdkMonitorFocus, CdkTrapFocus, ConfigurableFocusTrap, ConfigurableFocusTrapFactory, EventListenerFocusTrapInertStrategy, FOCUS_MONITOR_DEFAULT_OPTIONS, FOCUS_TRAP_INERT_STRATEGY, FocusKeyManager, FocusMonitor, FocusTrap, FocusTrapFactory, HighContrastModeDetector, INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS, INPUT_MODALITY_DETECTOR_OPTIONS, InputModalityDetector, InteractivityChecker, IsFocusableConfig, LIVE_ANNOUNCER_DEFAULT_OPTIONS, LIVE_ANNOUNCER_ELEMENT_TOKEN, LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY, ListKeyManager, LiveAnnouncer, MESSAGES_CONTAINER_ID, isFakeMousedownFromScreenReader, isFakeTouchstartFromScreenReader };\n","/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst MAC_ENTER = 3;\nconst BACKSPACE = 8;\nconst TAB = 9;\nconst NUM_CENTER = 12;\nconst ENTER = 13;\nconst SHIFT = 16;\nconst CONTROL = 17;\nconst ALT = 18;\nconst PAUSE = 19;\nconst CAPS_LOCK = 20;\nconst ESCAPE = 27;\nconst SPACE = 32;\nconst PAGE_UP = 33;\nconst PAGE_DOWN = 34;\nconst END = 35;\nconst HOME = 36;\nconst LEFT_ARROW = 37;\nconst UP_ARROW = 38;\nconst RIGHT_ARROW = 39;\nconst DOWN_ARROW = 40;\nconst PLUS_SIGN = 43;\nconst PRINT_SCREEN = 44;\nconst INSERT = 45;\nconst DELETE = 46;\nconst ZERO = 48;\nconst ONE = 49;\nconst TWO = 50;\nconst THREE = 51;\nconst FOUR = 52;\nconst FIVE = 53;\nconst SIX = 54;\nconst SEVEN = 55;\nconst EIGHT = 56;\nconst NINE = 57;\nconst FF_SEMICOLON = 59; // Firefox (Gecko) fires this for semicolon instead of 186\nconst FF_EQUALS = 61; // Firefox (Gecko) fires this for equals instead of 187\nconst QUESTION_MARK = 63;\nconst AT_SIGN = 64;\nconst A = 65;\nconst B = 66;\nconst C = 67;\nconst D = 68;\nconst E = 69;\nconst F = 70;\nconst G = 71;\nconst H = 72;\nconst I = 73;\nconst J = 74;\nconst K = 75;\nconst L = 76;\nconst M = 77;\nconst N = 78;\nconst O = 79;\nconst P = 80;\nconst Q = 81;\nconst R = 82;\nconst S = 83;\nconst T = 84;\nconst U = 85;\nconst V = 86;\nconst W = 87;\nconst X = 88;\nconst Y = 89;\nconst Z = 90;\nconst META = 91; // WIN_KEY_LEFT\nconst MAC_WK_CMD_LEFT = 91;\nconst MAC_WK_CMD_RIGHT = 93;\nconst CONTEXT_MENU = 93;\nconst NUMPAD_ZERO = 96;\nconst NUMPAD_ONE = 97;\nconst NUMPAD_TWO = 98;\nconst NUMPAD_THREE = 99;\nconst NUMPAD_FOUR = 100;\nconst NUMPAD_FIVE = 101;\nconst NUMPAD_SIX = 102;\nconst NUMPAD_SEVEN = 103;\nconst NUMPAD_EIGHT = 104;\nconst NUMPAD_NINE = 105;\nconst NUMPAD_MULTIPLY = 106;\nconst NUMPAD_PLUS = 107;\nconst NUMPAD_MINUS = 109;\nconst NUMPAD_PERIOD = 110;\nconst NUMPAD_DIVIDE = 111;\nconst F1 = 112;\nconst F2 = 113;\nconst F3 = 114;\nconst F4 = 115;\nconst F5 = 116;\nconst F6 = 117;\nconst F7 = 118;\nconst F8 = 119;\nconst F9 = 120;\nconst F10 = 121;\nconst F11 = 122;\nconst F12 = 123;\nconst NUM_LOCK = 144;\nconst SCROLL_LOCK = 145;\nconst FIRST_MEDIA = 166;\nconst FF_MINUS = 173;\nconst MUTE = 173; // Firefox (Gecko) fires 181 for MUTE\nconst VOLUME_DOWN = 174; // Firefox (Gecko) fires 182 for VOLUME_DOWN\nconst VOLUME_UP = 175; // Firefox (Gecko) fires 183 for VOLUME_UP\nconst FF_MUTE = 181;\nconst FF_VOLUME_DOWN = 182;\nconst LAST_MEDIA = 183;\nconst FF_VOLUME_UP = 183;\nconst SEMICOLON = 186; // Firefox (Gecko) fires 59 for SEMICOLON\nconst EQUALS = 187; // Firefox (Gecko) fires 61 for EQUALS\nconst COMMA = 188;\nconst DASH = 189; // Firefox (Gecko) fires 173 for DASH/MINUS\nconst PERIOD = 190;\nconst SLASH = 191;\nconst APOSTROPHE = 192;\nconst TILDE = 192;\nconst OPEN_SQUARE_BRACKET = 219;\nconst BACKSLASH = 220;\nconst CLOSE_SQUARE_BRACKET = 221;\nconst SINGLE_QUOTE = 222;\nconst MAC_META = 224;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Checks whether a modifier key is pressed.\n * @param event Event to be checked.\n */\nfunction hasModifierKey(event, ...modifiers) {\n if (modifiers.length) {\n return modifiers.some(modifier => event[modifier]);\n }\n return event.altKey || event.shiftKey || event.ctrlKey || event.metaKey;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { A, ALT, APOSTROPHE, AT_SIGN, B, BACKSLASH, BACKSPACE, C, CAPS_LOCK, CLOSE_SQUARE_BRACKET, COMMA, CONTEXT_MENU, CONTROL, D, DASH, DELETE, DOWN_ARROW, E, EIGHT, END, ENTER, EQUALS, ESCAPE, F, F1, F10, F11, F12, F2, F3, F4, F5, F6, F7, F8, F9, FF_EQUALS, FF_MINUS, FF_MUTE, FF_SEMICOLON, FF_VOLUME_DOWN, FF_VOLUME_UP, FIRST_MEDIA, FIVE, FOUR, G, H, HOME, I, INSERT, J, K, L, LAST_MEDIA, LEFT_ARROW, M, MAC_ENTER, MAC_META, MAC_WK_CMD_LEFT, MAC_WK_CMD_RIGHT, META, MUTE, N, NINE, NUMPAD_DIVIDE, NUMPAD_EIGHT, NUMPAD_FIVE, NUMPAD_FOUR, NUMPAD_MINUS, NUMPAD_MULTIPLY, NUMPAD_NINE, NUMPAD_ONE, NUMPAD_PERIOD, NUMPAD_PLUS, NUMPAD_SEVEN, NUMPAD_SIX, NUMPAD_THREE, NUMPAD_TWO, NUMPAD_ZERO, NUM_CENTER, NUM_LOCK, O, ONE, OPEN_SQUARE_BRACKET, P, PAGE_DOWN, PAGE_UP, PAUSE, PERIOD, PLUS_SIGN, PRINT_SCREEN, Q, QUESTION_MARK, R, RIGHT_ARROW, S, SCROLL_LOCK, SEMICOLON, SEVEN, SHIFT, SINGLE_QUOTE, SIX, SLASH, SPACE, T, TAB, THREE, TILDE, TWO, U, UP_ARROW, V, VOLUME_DOWN, VOLUME_UP, W, X, Y, Z, ZERO, hasModifierKey };\n","import * as i0 from '@angular/core';\nimport { Version, InjectionToken, NgModule, Optional, Inject, inject, LOCALE_ID, Injectable, Directive, Input, Component, ViewEncapsulation, ChangeDetectionStrategy, EventEmitter, Output } from '@angular/core';\nimport * as i1 from '@angular/cdk/a11y';\nimport { isFakeMousedownFromScreenReader, isFakeTouchstartFromScreenReader } from '@angular/cdk/a11y';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport { VERSION as VERSION$1 } from '@angular/cdk';\nimport * as i3 from '@angular/common';\nimport { DOCUMENT, CommonModule } from '@angular/common';\nimport * as i1$1 from '@angular/cdk/platform';\nimport { _isTestEnvironment, normalizePassiveListenerOptions } from '@angular/cdk/platform';\nimport { coerceBooleanProperty, coerceNumberProperty, coerceElement } from '@angular/cdk/coercion';\nimport { Subject, Observable } from 'rxjs';\nimport { startWith } from 'rxjs/operators';\nimport { ANIMATION_MODULE_TYPE } from '@angular/platform-browser/animations';\nimport { ENTER, SPACE, hasModifierKey } from '@angular/cdk/keycodes';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Current version of Angular Material. */\nconst VERSION = new Version('13.3.9');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** @docs-private */\nclass AnimationCurves {\n}\nAnimationCurves.STANDARD_CURVE = 'cubic-bezier(0.4,0.0,0.2,1)';\nAnimationCurves.DECELERATION_CURVE = 'cubic-bezier(0.0,0.0,0.2,1)';\nAnimationCurves.ACCELERATION_CURVE = 'cubic-bezier(0.4,0.0,1,1)';\nAnimationCurves.SHARP_CURVE = 'cubic-bezier(0.4,0.0,0.6,1)';\n/** @docs-private */\nclass AnimationDurations {\n}\nAnimationDurations.COMPLEX = '375ms';\nAnimationDurations.ENTERING = '225ms';\nAnimationDurations.EXITING = '195ms';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** @docs-private */\nfunction MATERIAL_SANITY_CHECKS_FACTORY() {\n return true;\n}\n/** Injection token that configures whether the Material sanity checks are enabled. */\nconst MATERIAL_SANITY_CHECKS = new InjectionToken('mat-sanity-checks', {\n providedIn: 'root',\n factory: MATERIAL_SANITY_CHECKS_FACTORY,\n});\n/**\n * Module that captures anything that should be loaded and/or run for *all* Angular Material\n * components. This includes Bidi, etc.\n *\n * This module should be imported to each top-level component module (e.g., MatTabsModule).\n */\nclass MatCommonModule {\n constructor(highContrastModeDetector, _sanityChecks, _document) {\n this._sanityChecks = _sanityChecks;\n this._document = _document;\n /** Whether we've done the global sanity checks (e.g. a theme is loaded, there is a doctype). */\n this._hasDoneGlobalChecks = false;\n // While A11yModule also does this, we repeat it here to avoid importing A11yModule\n // in MatCommonModule.\n highContrastModeDetector._applyBodyHighContrastModeCssClasses();\n if (!this._hasDoneGlobalChecks) {\n this._hasDoneGlobalChecks = true;\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (this._checkIsEnabled('doctype')) {\n _checkDoctypeIsDefined(this._document);\n }\n if (this._checkIsEnabled('theme')) {\n _checkThemeIsPresent(this._document);\n }\n if (this._checkIsEnabled('version')) {\n _checkCdkVersionMatch();\n }\n }\n }\n }\n /** Gets whether a specific sanity check is enabled. */\n _checkIsEnabled(name) {\n if (_isTestEnvironment()) {\n return false;\n }\n if (typeof this._sanityChecks === 'boolean') {\n return this._sanityChecks;\n }\n return !!this._sanityChecks[name];\n }\n}\nMatCommonModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatCommonModule, deps: [{ token: i1.HighContrastModeDetector }, { token: MATERIAL_SANITY_CHECKS, optional: true }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.NgModule });\nMatCommonModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatCommonModule, imports: [BidiModule], exports: [BidiModule] });\nMatCommonModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatCommonModule, imports: [[BidiModule], BidiModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatCommonModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [BidiModule],\n exports: [BidiModule],\n }]\n }], ctorParameters: function () { return [{ type: i1.HighContrastModeDetector }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [MATERIAL_SANITY_CHECKS]\n }] }, { type: Document, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n/** Checks that the page has a doctype. */\nfunction _checkDoctypeIsDefined(doc) {\n if (!doc.doctype) {\n console.warn('Current document does not have a doctype. This may cause ' +\n 'some Angular Material components not to behave as expected.');\n }\n}\n/** Checks that a theme has been included. */\nfunction _checkThemeIsPresent(doc) {\n // We need to assert that the `body` is defined, because these checks run very early\n // and the `body` won't be defined if the consumer put their scripts in the `head`.\n if (!doc.body || typeof getComputedStyle !== 'function') {\n return;\n }\n const testElement = doc.createElement('div');\n testElement.classList.add('mat-theme-loaded-marker');\n doc.body.appendChild(testElement);\n const computedStyle = getComputedStyle(testElement);\n // In some situations the computed style of the test element can be null. For example in\n // Firefox, the computed style is null if an application is running inside of a hidden iframe.\n // See: https://bugzilla.mozilla.org/show_bug.cgi?id=548397\n if (computedStyle && computedStyle.display !== 'none') {\n console.warn('Could not find Angular Material core theme. Most Material ' +\n 'components may not work as expected. For more info refer ' +\n 'to the theming guide: https://material.angular.io/guide/theming');\n }\n testElement.remove();\n}\n/** Checks whether the Material version matches the CDK version. */\nfunction _checkCdkVersionMatch() {\n if (VERSION.full !== VERSION$1.full) {\n console.warn('The Angular Material version (' +\n VERSION.full +\n ') does not match ' +\n 'the Angular CDK version (' +\n VERSION$1.full +\n ').\\n' +\n 'Please ensure the versions of these two packages exactly match.');\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction mixinDisabled(base) {\n return class extends base {\n constructor(...args) {\n super(...args);\n this._disabled = false;\n }\n get disabled() {\n return this._disabled;\n }\n set disabled(value) {\n this._disabled = coerceBooleanProperty(value);\n }\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction mixinColor(base, defaultColor) {\n return class extends base {\n constructor(...args) {\n super(...args);\n this.defaultColor = defaultColor;\n // Set the default color that can be specified from the mixin.\n this.color = defaultColor;\n }\n get color() {\n return this._color;\n }\n set color(value) {\n const colorPalette = value || this.defaultColor;\n if (colorPalette !== this._color) {\n if (this._color) {\n this._elementRef.nativeElement.classList.remove(`mat-${this._color}`);\n }\n if (colorPalette) {\n this._elementRef.nativeElement.classList.add(`mat-${colorPalette}`);\n }\n this._color = colorPalette;\n }\n }\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction mixinDisableRipple(base) {\n return class extends base {\n constructor(...args) {\n super(...args);\n this._disableRipple = false;\n }\n /** Whether the ripple effect is disabled or not. */\n get disableRipple() {\n return this._disableRipple;\n }\n set disableRipple(value) {\n this._disableRipple = coerceBooleanProperty(value);\n }\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction mixinTabIndex(base, defaultTabIndex = 0) {\n return class extends base {\n constructor(...args) {\n super(...args);\n this._tabIndex = defaultTabIndex;\n this.defaultTabIndex = defaultTabIndex;\n }\n get tabIndex() {\n return this.disabled ? -1 : this._tabIndex;\n }\n set tabIndex(value) {\n // If the specified tabIndex value is null or undefined, fall back to the default value.\n this._tabIndex = value != null ? coerceNumberProperty(value) : this.defaultTabIndex;\n }\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction mixinErrorState(base) {\n return class extends base {\n constructor(...args) {\n super(...args);\n // This class member exists as an interop with `MatFormFieldControl` which expects\n // a public `stateChanges` observable to emit whenever the form field should be updated.\n // The description is not specifically mentioning the error state, as classes using this\n // mixin can/should emit an event in other cases too.\n /** Emits whenever the component state changes. */\n this.stateChanges = new Subject();\n /** Whether the component is in an error state. */\n this.errorState = false;\n }\n /** Updates the error state based on the provided error state matcher. */\n updateErrorState() {\n const oldState = this.errorState;\n const parent = this._parentFormGroup || this._parentForm;\n const matcher = this.errorStateMatcher || this._defaultErrorStateMatcher;\n const control = this.ngControl ? this.ngControl.control : null;\n const newState = matcher.isErrorState(control, parent);\n if (newState !== oldState) {\n this.errorState = newState;\n this.stateChanges.next();\n }\n }\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Mixin to augment a directive with an initialized property that will emits when ngOnInit ends. */\nfunction mixinInitialized(base) {\n return class extends base {\n constructor(...args) {\n super(...args);\n /** Whether this directive has been marked as initialized. */\n this._isInitialized = false;\n /**\n * List of subscribers that subscribed before the directive was initialized. Should be notified\n * during _markInitialized. Set to null after pending subscribers are notified, and should\n * not expect to be populated after.\n */\n this._pendingSubscribers = [];\n /**\n * Observable stream that emits when the directive initializes. If already initialized, the\n * subscriber is stored to be notified once _markInitialized is called.\n */\n this.initialized = new Observable(subscriber => {\n // If initialized, immediately notify the subscriber. Otherwise store the subscriber to notify\n // when _markInitialized is called.\n if (this._isInitialized) {\n this._notifySubscriber(subscriber);\n }\n else {\n this._pendingSubscribers.push(subscriber);\n }\n });\n }\n /**\n * Marks the state as initialized and notifies pending subscribers. Should be called at the end\n * of ngOnInit.\n * @docs-private\n */\n _markInitialized() {\n if (this._isInitialized && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('This directive has already been marked as initialized and ' +\n 'should not be called twice.');\n }\n this._isInitialized = true;\n this._pendingSubscribers.forEach(this._notifySubscriber);\n this._pendingSubscribers = null;\n }\n /** Emits and completes the subscriber stream (should only emit once). */\n _notifySubscriber(subscriber) {\n subscriber.next();\n subscriber.complete();\n }\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** InjectionToken for datepicker that can be used to override default locale code. */\nconst MAT_DATE_LOCALE = new InjectionToken('MAT_DATE_LOCALE', {\n providedIn: 'root',\n factory: MAT_DATE_LOCALE_FACTORY,\n});\n/** @docs-private */\nfunction MAT_DATE_LOCALE_FACTORY() {\n return inject(LOCALE_ID);\n}\n/** Adapts type `D` to be usable as a date by cdk-based components that work with dates. */\nclass DateAdapter {\n constructor() {\n this._localeChanges = new Subject();\n /** A stream that emits when the locale changes. */\n this.localeChanges = this._localeChanges;\n }\n /**\n * Given a potential date object, returns that same date object if it is\n * a valid date, or `null` if it's not a valid date.\n * @param obj The object to check.\n * @returns A date or `null`.\n */\n getValidDateOrNull(obj) {\n return this.isDateInstance(obj) && this.isValid(obj) ? obj : null;\n }\n /**\n * Attempts to deserialize a value to a valid date object. This is different from parsing in that\n * deserialize should only accept non-ambiguous, locale-independent formats (e.g. a ISO 8601\n * string). The default implementation does not allow any deserialization, it simply checks that\n * the given value is already a valid date object or null. The `` will call this\n * method on all of its `@Input()` properties that accept dates. It is therefore possible to\n * support passing values from your backend directly to these properties by overriding this method\n * to also deserialize the format used by your backend.\n * @param value The value to be deserialized into a date object.\n * @returns The deserialized date object, either a valid date, null if the value can be\n * deserialized into a null date (e.g. the empty string), or an invalid date.\n */\n deserialize(value) {\n if (value == null || (this.isDateInstance(value) && this.isValid(value))) {\n return value;\n }\n return this.invalid();\n }\n /**\n * Sets the locale used for all dates.\n * @param locale The new locale.\n */\n setLocale(locale) {\n this.locale = locale;\n this._localeChanges.next();\n }\n /**\n * Compares two dates.\n * @param first The first date to compare.\n * @param second The second date to compare.\n * @returns 0 if the dates are equal, a number less than 0 if the first date is earlier,\n * a number greater than 0 if the first date is later.\n */\n compareDate(first, second) {\n return (this.getYear(first) - this.getYear(second) ||\n this.getMonth(first) - this.getMonth(second) ||\n this.getDate(first) - this.getDate(second));\n }\n /**\n * Checks if two dates are equal.\n * @param first The first date to check.\n * @param second The second date to check.\n * @returns Whether the two dates are equal.\n * Null dates are considered equal to other null dates.\n */\n sameDate(first, second) {\n if (first && second) {\n let firstValid = this.isValid(first);\n let secondValid = this.isValid(second);\n if (firstValid && secondValid) {\n return !this.compareDate(first, second);\n }\n return firstValid == secondValid;\n }\n return first == second;\n }\n /**\n * Clamp the given date between min and max dates.\n * @param date The date to clamp.\n * @param min The minimum value to allow. If null or omitted no min is enforced.\n * @param max The maximum value to allow. If null or omitted no max is enforced.\n * @returns `min` if `date` is less than `min`, `max` if date is greater than `max`,\n * otherwise `date`.\n */\n clampDate(date, min, max) {\n if (min && this.compareDate(date, min) < 0) {\n return min;\n }\n if (max && this.compareDate(date, max) > 0) {\n return max;\n }\n return date;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst MAT_DATE_FORMATS = new InjectionToken('mat-date-formats');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Matches strings that have the form of a valid RFC 3339 string\n * (https://tools.ietf.org/html/rfc3339). Note that the string may not actually be a valid date\n * because the regex will match strings an with out of bounds month, date, etc.\n */\nconst ISO_8601_REGEX = /^\\d{4}-\\d{2}-\\d{2}(?:T\\d{2}:\\d{2}:\\d{2}(?:\\.\\d+)?(?:Z|(?:(?:\\+|-)\\d{2}:\\d{2}))?)?$/;\n/** Creates an array and fills it with values. */\nfunction range(length, valueFunction) {\n const valuesArray = Array(length);\n for (let i = 0; i < length; i++) {\n valuesArray[i] = valueFunction(i);\n }\n return valuesArray;\n}\n/** Adapts the native JS Date for use with cdk-based components that work with dates. */\nclass NativeDateAdapter extends DateAdapter {\n constructor(matDateLocale, \n /**\n * @deprecated No longer being used. To be removed.\n * @breaking-change 14.0.0\n */\n _platform) {\n super();\n /**\n * @deprecated No longer being used. To be removed.\n * @breaking-change 14.0.0\n */\n this.useUtcForDisplay = false;\n super.setLocale(matDateLocale);\n }\n getYear(date) {\n return date.getFullYear();\n }\n getMonth(date) {\n return date.getMonth();\n }\n getDate(date) {\n return date.getDate();\n }\n getDayOfWeek(date) {\n return date.getDay();\n }\n getMonthNames(style) {\n const dtf = new Intl.DateTimeFormat(this.locale, { month: style, timeZone: 'utc' });\n return range(12, i => this._format(dtf, new Date(2017, i, 1)));\n }\n getDateNames() {\n const dtf = new Intl.DateTimeFormat(this.locale, { day: 'numeric', timeZone: 'utc' });\n return range(31, i => this._format(dtf, new Date(2017, 0, i + 1)));\n }\n getDayOfWeekNames(style) {\n const dtf = new Intl.DateTimeFormat(this.locale, { weekday: style, timeZone: 'utc' });\n return range(7, i => this._format(dtf, new Date(2017, 0, i + 1)));\n }\n getYearName(date) {\n const dtf = new Intl.DateTimeFormat(this.locale, { year: 'numeric', timeZone: 'utc' });\n return this._format(dtf, date);\n }\n getFirstDayOfWeek() {\n // We can't tell using native JS Date what the first day of the week is, we default to Sunday.\n return 0;\n }\n getNumDaysInMonth(date) {\n return this.getDate(this._createDateWithOverflow(this.getYear(date), this.getMonth(date) + 1, 0));\n }\n clone(date) {\n return new Date(date.getTime());\n }\n createDate(year, month, date) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n // Check for invalid month and date (except upper bound on date which we have to check after\n // creating the Date).\n if (month < 0 || month > 11) {\n throw Error(`Invalid month index \"${month}\". Month index has to be between 0 and 11.`);\n }\n if (date < 1) {\n throw Error(`Invalid date \"${date}\". Date has to be greater than 0.`);\n }\n }\n let result = this._createDateWithOverflow(year, month, date);\n // Check that the date wasn't above the upper bound for the month, causing the month to overflow\n if (result.getMonth() != month && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error(`Invalid date \"${date}\" for month with index \"${month}\".`);\n }\n return result;\n }\n today() {\n return new Date();\n }\n parse(value) {\n // We have no way using the native JS Date to set the parse format or locale, so we ignore these\n // parameters.\n if (typeof value == 'number') {\n return new Date(value);\n }\n return value ? new Date(Date.parse(value)) : null;\n }\n format(date, displayFormat) {\n if (!this.isValid(date)) {\n throw Error('NativeDateAdapter: Cannot format invalid date.');\n }\n const dtf = new Intl.DateTimeFormat(this.locale, { ...displayFormat, timeZone: 'utc' });\n return this._format(dtf, date);\n }\n addCalendarYears(date, years) {\n return this.addCalendarMonths(date, years * 12);\n }\n addCalendarMonths(date, months) {\n let newDate = this._createDateWithOverflow(this.getYear(date), this.getMonth(date) + months, this.getDate(date));\n // It's possible to wind up in the wrong month if the original month has more days than the new\n // month. In this case we want to go to the last day of the desired month.\n // Note: the additional + 12 % 12 ensures we end up with a positive number, since JS % doesn't\n // guarantee this.\n if (this.getMonth(newDate) != (((this.getMonth(date) + months) % 12) + 12) % 12) {\n newDate = this._createDateWithOverflow(this.getYear(newDate), this.getMonth(newDate), 0);\n }\n return newDate;\n }\n addCalendarDays(date, days) {\n return this._createDateWithOverflow(this.getYear(date), this.getMonth(date), this.getDate(date) + days);\n }\n toIso8601(date) {\n return [\n date.getUTCFullYear(),\n this._2digit(date.getUTCMonth() + 1),\n this._2digit(date.getUTCDate()),\n ].join('-');\n }\n /**\n * Returns the given value if given a valid Date or null. Deserializes valid ISO 8601 strings\n * (https://www.ietf.org/rfc/rfc3339.txt) into valid Dates and empty string into null. Returns an\n * invalid date for all other values.\n */\n deserialize(value) {\n if (typeof value === 'string') {\n if (!value) {\n return null;\n }\n // The `Date` constructor accepts formats other than ISO 8601, so we need to make sure the\n // string is the right format first.\n if (ISO_8601_REGEX.test(value)) {\n let date = new Date(value);\n if (this.isValid(date)) {\n return date;\n }\n }\n }\n return super.deserialize(value);\n }\n isDateInstance(obj) {\n return obj instanceof Date;\n }\n isValid(date) {\n return !isNaN(date.getTime());\n }\n invalid() {\n return new Date(NaN);\n }\n /** Creates a date but allows the month and date to overflow. */\n _createDateWithOverflow(year, month, date) {\n // Passing the year to the constructor causes year numbers <100 to be converted to 19xx.\n // To work around this we use `setFullYear` and `setHours` instead.\n const d = new Date();\n d.setFullYear(year, month, date);\n d.setHours(0, 0, 0, 0);\n return d;\n }\n /**\n * Pads a number to make it two digits.\n * @param n The number to pad.\n * @returns The padded number.\n */\n _2digit(n) {\n return ('00' + n).slice(-2);\n }\n /**\n * When converting Date object to string, javascript built-in functions may return wrong\n * results because it applies its internal DST rules. The DST rules around the world change\n * very frequently, and the current valid rule is not always valid in previous years though.\n * We work around this problem building a new Date object which has its internal UTC\n * representation with the local date and time.\n * @param dtf Intl.DateTimeFormat object, containg the desired string format. It must have\n * timeZone set to 'utc' to work fine.\n * @param date Date from which we want to get the string representation according to dtf\n * @returns A Date object with its UTC representation based on the passed in date info\n */\n _format(dtf, date) {\n // Passing the year to the constructor causes year numbers <100 to be converted to 19xx.\n // To work around this we use `setUTCFullYear` and `setUTCHours` instead.\n const d = new Date();\n d.setUTCFullYear(date.getFullYear(), date.getMonth(), date.getDate());\n d.setUTCHours(date.getHours(), date.getMinutes(), date.getSeconds(), date.getMilliseconds());\n return dtf.format(d);\n }\n}\nNativeDateAdapter.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: NativeDateAdapter, deps: [{ token: MAT_DATE_LOCALE, optional: true }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nNativeDateAdapter.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: NativeDateAdapter });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: NativeDateAdapter, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [MAT_DATE_LOCALE]\n }] }, { type: i1$1.Platform }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst MAT_NATIVE_DATE_FORMATS = {\n parse: {\n dateInput: null,\n },\n display: {\n dateInput: { year: 'numeric', month: 'numeric', day: 'numeric' },\n monthYearLabel: { year: 'numeric', month: 'short' },\n dateA11yLabel: { year: 'numeric', month: 'long', day: 'numeric' },\n monthYearA11yLabel: { year: 'numeric', month: 'long' },\n },\n};\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass NativeDateModule {\n}\nNativeDateModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: NativeDateModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nNativeDateModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: NativeDateModule });\nNativeDateModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: NativeDateModule, providers: [{ provide: DateAdapter, useClass: NativeDateAdapter }] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: NativeDateModule, decorators: [{\n type: NgModule,\n args: [{\n providers: [{ provide: DateAdapter, useClass: NativeDateAdapter }],\n }]\n }] });\nclass MatNativeDateModule {\n}\nMatNativeDateModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatNativeDateModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nMatNativeDateModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatNativeDateModule, imports: [NativeDateModule] });\nMatNativeDateModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatNativeDateModule, providers: [{ provide: MAT_DATE_FORMATS, useValue: MAT_NATIVE_DATE_FORMATS }], imports: [[NativeDateModule]] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatNativeDateModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [NativeDateModule],\n providers: [{ provide: MAT_DATE_FORMATS, useValue: MAT_NATIVE_DATE_FORMATS }],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Error state matcher that matches when a control is invalid and dirty. */\nclass ShowOnDirtyErrorStateMatcher {\n isErrorState(control, form) {\n return !!(control && control.invalid && (control.dirty || (form && form.submitted)));\n }\n}\nShowOnDirtyErrorStateMatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ShowOnDirtyErrorStateMatcher, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nShowOnDirtyErrorStateMatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ShowOnDirtyErrorStateMatcher });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ShowOnDirtyErrorStateMatcher, decorators: [{\n type: Injectable\n }] });\n/** Provider that defines how form controls behave with regards to displaying error messages. */\nclass ErrorStateMatcher {\n isErrorState(control, form) {\n return !!(control && control.invalid && (control.touched || (form && form.submitted)));\n }\n}\nErrorStateMatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ErrorStateMatcher, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nErrorStateMatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ErrorStateMatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ErrorStateMatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Shared directive to count lines inside a text area, such as a list item.\n * Line elements can be extracted with a @ContentChildren(MatLine) query, then\n * counted by checking the query list's length.\n */\nclass MatLine {\n}\nMatLine.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatLine, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nMatLine.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: MatLine, selector: \"[mat-line], [matLine]\", host: { classAttribute: \"mat-line\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatLine, decorators: [{\n type: Directive,\n args: [{\n selector: '[mat-line], [matLine]',\n host: { 'class': 'mat-line' },\n }]\n }] });\n/**\n * Helper that takes a query list of lines and sets the correct class on the host.\n * @docs-private\n */\nfunction setLines(lines, element, prefix = 'mat') {\n // Note: doesn't need to unsubscribe, because `changes`\n // gets completed by Angular when the view is destroyed.\n lines.changes.pipe(startWith(lines)).subscribe(({ length }) => {\n setClass(element, `${prefix}-2-line`, false);\n setClass(element, `${prefix}-3-line`, false);\n setClass(element, `${prefix}-multi-line`, false);\n if (length === 2 || length === 3) {\n setClass(element, `${prefix}-${length}-line`, true);\n }\n else if (length > 3) {\n setClass(element, `${prefix}-multi-line`, true);\n }\n });\n}\n/** Adds or removes a class from an element. */\nfunction setClass(element, className, isAdd) {\n element.nativeElement.classList.toggle(className, isAdd);\n}\nclass MatLineModule {\n}\nMatLineModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatLineModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nMatLineModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatLineModule, declarations: [MatLine], imports: [MatCommonModule], exports: [MatLine, MatCommonModule] });\nMatLineModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatLineModule, imports: [[MatCommonModule], MatCommonModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatLineModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [MatCommonModule],\n exports: [MatLine, MatCommonModule],\n declarations: [MatLine],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Reference to a previously launched ripple element.\n */\nclass RippleRef {\n constructor(_renderer, \n /** Reference to the ripple HTML element. */\n element, \n /** Ripple configuration used for the ripple. */\n config) {\n this._renderer = _renderer;\n this.element = element;\n this.config = config;\n /** Current state of the ripple. */\n this.state = 3 /* HIDDEN */;\n }\n /** Fades out the ripple element. */\n fadeOut() {\n this._renderer.fadeOutRipple(this);\n }\n}\n\n// TODO: import these values from `@material/ripple` eventually.\n/**\n * Default ripple animation configuration for ripples without an explicit\n * animation config specified.\n */\nconst defaultRippleAnimationConfig = {\n enterDuration: 225,\n exitDuration: 150,\n};\n/**\n * Timeout for ignoring mouse events. Mouse events will be temporary ignored after touch\n * events to avoid synthetic mouse events.\n */\nconst ignoreMouseEventsTimeout = 800;\n/** Options that apply to all the event listeners that are bound by the ripple renderer. */\nconst passiveEventOptions = normalizePassiveListenerOptions({ passive: true });\n/** Events that signal that the pointer is down. */\nconst pointerDownEvents = ['mousedown', 'touchstart'];\n/** Events that signal that the pointer is up. */\nconst pointerUpEvents = ['mouseup', 'mouseleave', 'touchend', 'touchcancel'];\n/**\n * Helper service that performs DOM manipulations. Not intended to be used outside this module.\n * The constructor takes a reference to the ripple directive's host element and a map of DOM\n * event handlers to be installed on the element that triggers ripple animations.\n * This will eventually become a custom renderer once Angular support exists.\n * @docs-private\n */\nclass RippleRenderer {\n constructor(_target, _ngZone, elementOrElementRef, platform) {\n this._target = _target;\n this._ngZone = _ngZone;\n /** Whether the pointer is currently down or not. */\n this._isPointerDown = false;\n /** Set of currently active ripple references. */\n this._activeRipples = new Set();\n /** Whether pointer-up event listeners have been registered. */\n this._pointerUpEventsRegistered = false;\n // Only do anything if we're on the browser.\n if (platform.isBrowser) {\n this._containerElement = coerceElement(elementOrElementRef);\n }\n }\n /**\n * Fades in a ripple at the given coordinates.\n * @param x Coordinate within the element, along the X axis at which to start the ripple.\n * @param y Coordinate within the element, along the Y axis at which to start the ripple.\n * @param config Extra ripple options.\n */\n fadeInRipple(x, y, config = {}) {\n const containerRect = (this._containerRect =\n this._containerRect || this._containerElement.getBoundingClientRect());\n const animationConfig = { ...defaultRippleAnimationConfig, ...config.animation };\n if (config.centered) {\n x = containerRect.left + containerRect.width / 2;\n y = containerRect.top + containerRect.height / 2;\n }\n const radius = config.radius || distanceToFurthestCorner(x, y, containerRect);\n const offsetX = x - containerRect.left;\n const offsetY = y - containerRect.top;\n const duration = animationConfig.enterDuration;\n const ripple = document.createElement('div');\n ripple.classList.add('mat-ripple-element');\n ripple.style.left = `${offsetX - radius}px`;\n ripple.style.top = `${offsetY - radius}px`;\n ripple.style.height = `${radius * 2}px`;\n ripple.style.width = `${radius * 2}px`;\n // If a custom color has been specified, set it as inline style. If no color is\n // set, the default color will be applied through the ripple theme styles.\n if (config.color != null) {\n ripple.style.backgroundColor = config.color;\n }\n ripple.style.transitionDuration = `${duration}ms`;\n this._containerElement.appendChild(ripple);\n // By default the browser does not recalculate the styles of dynamically created\n // ripple elements. This is critical because then the `scale` would not animate properly.\n enforceStyleRecalculation(ripple);\n ripple.style.transform = 'scale(1)';\n // Exposed reference to the ripple that will be returned.\n const rippleRef = new RippleRef(this, ripple, config);\n rippleRef.state = 0 /* FADING_IN */;\n // Add the ripple reference to the list of all active ripples.\n this._activeRipples.add(rippleRef);\n if (!config.persistent) {\n this._mostRecentTransientRipple = rippleRef;\n }\n // Wait for the ripple element to be completely faded in.\n // Once it's faded in, the ripple can be hidden immediately if the mouse is released.\n this._runTimeoutOutsideZone(() => {\n const isMostRecentTransientRipple = rippleRef === this._mostRecentTransientRipple;\n rippleRef.state = 1 /* VISIBLE */;\n // When the timer runs out while the user has kept their pointer down, we want to\n // keep only the persistent ripples and the latest transient ripple. We do this,\n // because we don't want stacked transient ripples to appear after their enter\n // animation has finished.\n if (!config.persistent && (!isMostRecentTransientRipple || !this._isPointerDown)) {\n rippleRef.fadeOut();\n }\n }, duration);\n return rippleRef;\n }\n /** Fades out a ripple reference. */\n fadeOutRipple(rippleRef) {\n const wasActive = this._activeRipples.delete(rippleRef);\n if (rippleRef === this._mostRecentTransientRipple) {\n this._mostRecentTransientRipple = null;\n }\n // Clear out the cached bounding rect if we have no more ripples.\n if (!this._activeRipples.size) {\n this._containerRect = null;\n }\n // For ripples that are not active anymore, don't re-run the fade-out animation.\n if (!wasActive) {\n return;\n }\n const rippleEl = rippleRef.element;\n const animationConfig = { ...defaultRippleAnimationConfig, ...rippleRef.config.animation };\n rippleEl.style.transitionDuration = `${animationConfig.exitDuration}ms`;\n rippleEl.style.opacity = '0';\n rippleRef.state = 2 /* FADING_OUT */;\n // Once the ripple faded out, the ripple can be safely removed from the DOM.\n this._runTimeoutOutsideZone(() => {\n rippleRef.state = 3 /* HIDDEN */;\n rippleEl.remove();\n }, animationConfig.exitDuration);\n }\n /** Fades out all currently active ripples. */\n fadeOutAll() {\n this._activeRipples.forEach(ripple => ripple.fadeOut());\n }\n /** Fades out all currently active non-persistent ripples. */\n fadeOutAllNonPersistent() {\n this._activeRipples.forEach(ripple => {\n if (!ripple.config.persistent) {\n ripple.fadeOut();\n }\n });\n }\n /** Sets up the trigger event listeners */\n setupTriggerEvents(elementOrElementRef) {\n const element = coerceElement(elementOrElementRef);\n if (!element || element === this._triggerElement) {\n return;\n }\n // Remove all previously registered event listeners from the trigger element.\n this._removeTriggerEvents();\n this._triggerElement = element;\n this._registerEvents(pointerDownEvents);\n }\n /**\n * Handles all registered events.\n * @docs-private\n */\n handleEvent(event) {\n if (event.type === 'mousedown') {\n this._onMousedown(event);\n }\n else if (event.type === 'touchstart') {\n this._onTouchStart(event);\n }\n else {\n this._onPointerUp();\n }\n // If pointer-up events haven't been registered yet, do so now.\n // We do this on-demand in order to reduce the total number of event listeners\n // registered by the ripples, which speeds up the rendering time for large UIs.\n if (!this._pointerUpEventsRegistered) {\n this._registerEvents(pointerUpEvents);\n this._pointerUpEventsRegistered = true;\n }\n }\n /** Function being called whenever the trigger is being pressed using mouse. */\n _onMousedown(event) {\n // Screen readers will fire fake mouse events for space/enter. Skip launching a\n // ripple in this case for consistency with the non-screen-reader experience.\n const isFakeMousedown = isFakeMousedownFromScreenReader(event);\n const isSyntheticEvent = this._lastTouchStartEvent &&\n Date.now() < this._lastTouchStartEvent + ignoreMouseEventsTimeout;\n if (!this._target.rippleDisabled && !isFakeMousedown && !isSyntheticEvent) {\n this._isPointerDown = true;\n this.fadeInRipple(event.clientX, event.clientY, this._target.rippleConfig);\n }\n }\n /** Function being called whenever the trigger is being pressed using touch. */\n _onTouchStart(event) {\n if (!this._target.rippleDisabled && !isFakeTouchstartFromScreenReader(event)) {\n // Some browsers fire mouse events after a `touchstart` event. Those synthetic mouse\n // events will launch a second ripple if we don't ignore mouse events for a specific\n // time after a touchstart event.\n this._lastTouchStartEvent = Date.now();\n this._isPointerDown = true;\n // Use `changedTouches` so we skip any touches where the user put\n // their finger down, but used another finger to tap the element again.\n const touches = event.changedTouches;\n for (let i = 0; i < touches.length; i++) {\n this.fadeInRipple(touches[i].clientX, touches[i].clientY, this._target.rippleConfig);\n }\n }\n }\n /** Function being called whenever the trigger is being released. */\n _onPointerUp() {\n if (!this._isPointerDown) {\n return;\n }\n this._isPointerDown = false;\n // Fade-out all ripples that are visible and not persistent.\n this._activeRipples.forEach(ripple => {\n // By default, only ripples that are completely visible will fade out on pointer release.\n // If the `terminateOnPointerUp` option is set, ripples that still fade in will also fade out.\n const isVisible = ripple.state === 1 /* VISIBLE */ ||\n (ripple.config.terminateOnPointerUp && ripple.state === 0 /* FADING_IN */);\n if (!ripple.config.persistent && isVisible) {\n ripple.fadeOut();\n }\n });\n }\n /** Runs a timeout outside of the Angular zone to avoid triggering the change detection. */\n _runTimeoutOutsideZone(fn, delay = 0) {\n this._ngZone.runOutsideAngular(() => setTimeout(fn, delay));\n }\n /** Registers event listeners for a given list of events. */\n _registerEvents(eventTypes) {\n this._ngZone.runOutsideAngular(() => {\n eventTypes.forEach(type => {\n this._triggerElement.addEventListener(type, this, passiveEventOptions);\n });\n });\n }\n /** Removes previously registered event listeners from the trigger element. */\n _removeTriggerEvents() {\n if (this._triggerElement) {\n pointerDownEvents.forEach(type => {\n this._triggerElement.removeEventListener(type, this, passiveEventOptions);\n });\n if (this._pointerUpEventsRegistered) {\n pointerUpEvents.forEach(type => {\n this._triggerElement.removeEventListener(type, this, passiveEventOptions);\n });\n }\n }\n }\n}\n/** Enforces a style recalculation of a DOM element by computing its styles. */\nfunction enforceStyleRecalculation(element) {\n // Enforce a style recalculation by calling `getComputedStyle` and accessing any property.\n // Calling `getPropertyValue` is important to let optimizers know that this is not a noop.\n // See: https://gist.github.com/paulirish/5d52fb081b3570c81e3a\n window.getComputedStyle(element).getPropertyValue('opacity');\n}\n/**\n * Returns the distance from the point (x, y) to the furthest corner of a rectangle.\n */\nfunction distanceToFurthestCorner(x, y, rect) {\n const distX = Math.max(Math.abs(x - rect.left), Math.abs(x - rect.right));\n const distY = Math.max(Math.abs(y - rect.top), Math.abs(y - rect.bottom));\n return Math.sqrt(distX * distX + distY * distY);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Injection token that can be used to specify the global ripple options. */\nconst MAT_RIPPLE_GLOBAL_OPTIONS = new InjectionToken('mat-ripple-global-options');\nclass MatRipple {\n constructor(_elementRef, ngZone, platform, globalOptions, _animationMode) {\n this._elementRef = _elementRef;\n this._animationMode = _animationMode;\n /**\n * If set, the radius in pixels of foreground ripples when fully expanded. If unset, the radius\n * will be the distance from the center of the ripple to the furthest corner of the host element's\n * bounding rectangle.\n */\n this.radius = 0;\n this._disabled = false;\n /** Whether ripple directive is initialized and the input bindings are set. */\n this._isInitialized = false;\n this._globalOptions = globalOptions || {};\n this._rippleRenderer = new RippleRenderer(this, ngZone, _elementRef, platform);\n }\n /**\n * Whether click events will not trigger the ripple. Ripples can be still launched manually\n * by using the `launch()` method.\n */\n get disabled() {\n return this._disabled;\n }\n set disabled(value) {\n if (value) {\n this.fadeOutAllNonPersistent();\n }\n this._disabled = value;\n this._setupTriggerEventsIfEnabled();\n }\n /**\n * The element that triggers the ripple when click events are received.\n * Defaults to the directive's host element.\n */\n get trigger() {\n return this._trigger || this._elementRef.nativeElement;\n }\n set trigger(trigger) {\n this._trigger = trigger;\n this._setupTriggerEventsIfEnabled();\n }\n ngOnInit() {\n this._isInitialized = true;\n this._setupTriggerEventsIfEnabled();\n }\n ngOnDestroy() {\n this._rippleRenderer._removeTriggerEvents();\n }\n /** Fades out all currently showing ripple elements. */\n fadeOutAll() {\n this._rippleRenderer.fadeOutAll();\n }\n /** Fades out all currently showing non-persistent ripple elements. */\n fadeOutAllNonPersistent() {\n this._rippleRenderer.fadeOutAllNonPersistent();\n }\n /**\n * Ripple configuration from the directive's input values.\n * @docs-private Implemented as part of RippleTarget\n */\n get rippleConfig() {\n return {\n centered: this.centered,\n radius: this.radius,\n color: this.color,\n animation: {\n ...this._globalOptions.animation,\n ...(this._animationMode === 'NoopAnimations' ? { enterDuration: 0, exitDuration: 0 } : {}),\n ...this.animation,\n },\n terminateOnPointerUp: this._globalOptions.terminateOnPointerUp,\n };\n }\n /**\n * Whether ripples on pointer-down are disabled or not.\n * @docs-private Implemented as part of RippleTarget\n */\n get rippleDisabled() {\n return this.disabled || !!this._globalOptions.disabled;\n }\n /** Sets up the trigger event listeners if ripples are enabled. */\n _setupTriggerEventsIfEnabled() {\n if (!this.disabled && this._isInitialized) {\n this._rippleRenderer.setupTriggerEvents(this.trigger);\n }\n }\n /** Launches a manual ripple at the specified coordinated or just by the ripple config. */\n launch(configOrX, y = 0, config) {\n if (typeof configOrX === 'number') {\n return this._rippleRenderer.fadeInRipple(configOrX, y, { ...this.rippleConfig, ...config });\n }\n else {\n return this._rippleRenderer.fadeInRipple(0, 0, { ...this.rippleConfig, ...configOrX });\n }\n }\n}\nMatRipple.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatRipple, deps: [{ token: i0.ElementRef }, { token: i0.NgZone }, { token: i1$1.Platform }, { token: MAT_RIPPLE_GLOBAL_OPTIONS, optional: true }, { token: ANIMATION_MODULE_TYPE, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nMatRipple.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: MatRipple, selector: \"[mat-ripple], [matRipple]\", inputs: { color: [\"matRippleColor\", \"color\"], unbounded: [\"matRippleUnbounded\", \"unbounded\"], centered: [\"matRippleCentered\", \"centered\"], radius: [\"matRippleRadius\", \"radius\"], animation: [\"matRippleAnimation\", \"animation\"], disabled: [\"matRippleDisabled\", \"disabled\"], trigger: [\"matRippleTrigger\", \"trigger\"] }, host: { properties: { \"class.mat-ripple-unbounded\": \"unbounded\" }, classAttribute: \"mat-ripple\" }, exportAs: [\"matRipple\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatRipple, decorators: [{\n type: Directive,\n args: [{\n selector: '[mat-ripple], [matRipple]',\n exportAs: 'matRipple',\n host: {\n 'class': 'mat-ripple',\n '[class.mat-ripple-unbounded]': 'unbounded',\n },\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.NgZone }, { type: i1$1.Platform }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [MAT_RIPPLE_GLOBAL_OPTIONS]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [ANIMATION_MODULE_TYPE]\n }] }]; }, propDecorators: { color: [{\n type: Input,\n args: ['matRippleColor']\n }], unbounded: [{\n type: Input,\n args: ['matRippleUnbounded']\n }], centered: [{\n type: Input,\n args: ['matRippleCentered']\n }], radius: [{\n type: Input,\n args: ['matRippleRadius']\n }], animation: [{\n type: Input,\n args: ['matRippleAnimation']\n }], disabled: [{\n type: Input,\n args: ['matRippleDisabled']\n }], trigger: [{\n type: Input,\n args: ['matRippleTrigger']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass MatRippleModule {\n}\nMatRippleModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatRippleModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nMatRippleModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatRippleModule, declarations: [MatRipple], imports: [MatCommonModule], exports: [MatRipple, MatCommonModule] });\nMatRippleModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatRippleModule, imports: [[MatCommonModule], MatCommonModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatRippleModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [MatCommonModule],\n exports: [MatRipple, MatCommonModule],\n declarations: [MatRipple],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Component that shows a simplified checkbox without including any kind of \"real\" checkbox.\n * Meant to be used when the checkbox is purely decorative and a large number of them will be\n * included, such as for the options in a multi-select. Uses no SVGs or complex animations.\n * Note that theming is meant to be handled by the parent element, e.g.\n * `mat-primary .mat-pseudo-checkbox`.\n *\n * Note that this component will be completely invisible to screen-reader users. This is *not*\n * interchangeable with `` and should *not* be used if the user would directly\n * interact with the checkbox. The pseudo-checkbox should only be used as an implementation detail\n * of more complex components that appropriately handle selected / checked state.\n * @docs-private\n */\nclass MatPseudoCheckbox {\n constructor(_animationMode) {\n this._animationMode = _animationMode;\n /** Display state of the checkbox. */\n this.state = 'unchecked';\n /** Whether the checkbox is disabled. */\n this.disabled = false;\n }\n}\nMatPseudoCheckbox.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatPseudoCheckbox, deps: [{ token: ANIMATION_MODULE_TYPE, optional: true }], target: i0.ɵɵFactoryTarget.Component });\nMatPseudoCheckbox.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"12.0.0\", version: \"13.3.0\", type: MatPseudoCheckbox, selector: \"mat-pseudo-checkbox\", inputs: { state: \"state\", disabled: \"disabled\" }, host: { properties: { \"class.mat-pseudo-checkbox-indeterminate\": \"state === \\\"indeterminate\\\"\", \"class.mat-pseudo-checkbox-checked\": \"state === \\\"checked\\\"\", \"class.mat-pseudo-checkbox-disabled\": \"disabled\", \"class._mat-animation-noopable\": \"_animationMode === \\\"NoopAnimations\\\"\" }, classAttribute: \"mat-pseudo-checkbox\" }, ngImport: i0, template: '', isInline: true, styles: [\".mat-pseudo-checkbox{width:16px;height:16px;border:2px solid;border-radius:2px;cursor:pointer;display:inline-block;vertical-align:middle;box-sizing:border-box;position:relative;flex-shrink:0;transition:border-color 90ms cubic-bezier(0, 0, 0.2, 0.1),background-color 90ms cubic-bezier(0, 0, 0.2, 0.1)}.mat-pseudo-checkbox::after{position:absolute;opacity:0;content:\\\"\\\";border-bottom:2px solid currentColor;transition:opacity 90ms cubic-bezier(0, 0, 0.2, 0.1)}.mat-pseudo-checkbox.mat-pseudo-checkbox-checked,.mat-pseudo-checkbox.mat-pseudo-checkbox-indeterminate{border-color:transparent}._mat-animation-noopable.mat-pseudo-checkbox{transition:none;animation:none}._mat-animation-noopable.mat-pseudo-checkbox::after{transition:none}.mat-pseudo-checkbox-disabled{cursor:default}.mat-pseudo-checkbox-indeterminate::after{top:5px;left:1px;width:10px;opacity:1;border-radius:2px}.mat-pseudo-checkbox-checked::after{top:2.4px;left:1px;width:8px;height:3px;border-left:2px solid currentColor;transform:rotate(-45deg);opacity:1;box-sizing:content-box}\\n\"], changeDetection: i0.ChangeDetectionStrategy.OnPush, encapsulation: i0.ViewEncapsulation.None });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatPseudoCheckbox, decorators: [{\n type: Component,\n args: [{ encapsulation: ViewEncapsulation.None, changeDetection: ChangeDetectionStrategy.OnPush, selector: 'mat-pseudo-checkbox', template: '', host: {\n 'class': 'mat-pseudo-checkbox',\n '[class.mat-pseudo-checkbox-indeterminate]': 'state === \"indeterminate\"',\n '[class.mat-pseudo-checkbox-checked]': 'state === \"checked\"',\n '[class.mat-pseudo-checkbox-disabled]': 'disabled',\n '[class._mat-animation-noopable]': '_animationMode === \"NoopAnimations\"',\n }, styles: [\".mat-pseudo-checkbox{width:16px;height:16px;border:2px solid;border-radius:2px;cursor:pointer;display:inline-block;vertical-align:middle;box-sizing:border-box;position:relative;flex-shrink:0;transition:border-color 90ms cubic-bezier(0, 0, 0.2, 0.1),background-color 90ms cubic-bezier(0, 0, 0.2, 0.1)}.mat-pseudo-checkbox::after{position:absolute;opacity:0;content:\\\"\\\";border-bottom:2px solid currentColor;transition:opacity 90ms cubic-bezier(0, 0, 0.2, 0.1)}.mat-pseudo-checkbox.mat-pseudo-checkbox-checked,.mat-pseudo-checkbox.mat-pseudo-checkbox-indeterminate{border-color:transparent}._mat-animation-noopable.mat-pseudo-checkbox{transition:none;animation:none}._mat-animation-noopable.mat-pseudo-checkbox::after{transition:none}.mat-pseudo-checkbox-disabled{cursor:default}.mat-pseudo-checkbox-indeterminate::after{top:5px;left:1px;width:10px;opacity:1;border-radius:2px}.mat-pseudo-checkbox-checked::after{top:2.4px;left:1px;width:8px;height:3px;border-left:2px solid currentColor;transform:rotate(-45deg);opacity:1;box-sizing:content-box}\\n\"] }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [ANIMATION_MODULE_TYPE]\n }] }]; }, propDecorators: { state: [{\n type: Input\n }], disabled: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass MatPseudoCheckboxModule {\n}\nMatPseudoCheckboxModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatPseudoCheckboxModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nMatPseudoCheckboxModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatPseudoCheckboxModule, declarations: [MatPseudoCheckbox], imports: [MatCommonModule], exports: [MatPseudoCheckbox] });\nMatPseudoCheckboxModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatPseudoCheckboxModule, imports: [[MatCommonModule]] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatPseudoCheckboxModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [MatCommonModule],\n exports: [MatPseudoCheckbox],\n declarations: [MatPseudoCheckbox],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token used to provide the parent component to options.\n */\nconst MAT_OPTION_PARENT_COMPONENT = new InjectionToken('MAT_OPTION_PARENT_COMPONENT');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Notes on the accessibility pattern used for `mat-optgroup`.\n// The option group has two different \"modes\": regular and inert. The regular mode uses the\n// recommended a11y pattern which has `role=\"group\"` on the group element with `aria-labelledby`\n// pointing to the label. This works for `mat-select`, but it seems to hit a bug for autocomplete\n// under VoiceOver where the group doesn't get read out at all. The bug appears to be that if\n// there's __any__ a11y-related attribute on the group (e.g. `role` or `aria-labelledby`),\n// VoiceOver on Safari won't read it out.\n// We've introduced the `inert` mode as a workaround. Under this mode, all a11y attributes are\n// removed from the group, and we get the screen reader to read out the group label by mirroring it\n// inside an invisible element in the option. This is sub-optimal, because the screen reader will\n// repeat the group label on each navigation, whereas the default pattern only reads the group when\n// the user enters a new group. The following alternate approaches were considered:\n// 1. Reading out the group label using the `LiveAnnouncer` solves the problem, but we can't control\n// when the text will be read out so sometimes it comes in too late or never if the user\n// navigates quickly.\n// 2. `{{ label }} \\n\\n\", styles: [\".mat-optgroup-label{white-space:nowrap;overflow:hidden;text-overflow:ellipsis;display:block;line-height:48px;height:48px;padding:0 16px;text-align:left;text-decoration:none;max-width:100%;-webkit-user-select:none;user-select:none;cursor:default}.mat-optgroup-label[disabled]{cursor:default}[dir=rtl] .mat-optgroup-label{text-align:right}.mat-optgroup-label .mat-icon{margin-right:16px;vertical-align:middle}.mat-optgroup-label .mat-icon svg{vertical-align:top}[dir=rtl] .mat-optgroup-label .mat-icon{margin-left:16px;margin-right:0}\\n\"], changeDetection: i0.ChangeDetectionStrategy.OnPush, encapsulation: i0.ViewEncapsulation.None });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatOptgroup, decorators: [{\n type: Component,\n args: [{ selector: 'mat-optgroup', exportAs: 'matOptgroup', encapsulation: ViewEncapsulation.None, changeDetection: ChangeDetectionStrategy.OnPush, inputs: ['disabled'], host: {\n 'class': 'mat-optgroup',\n '[attr.role]': '_inert ? null : \"group\"',\n '[attr.aria-disabled]': '_inert ? null : disabled.toString()',\n '[attr.aria-labelledby]': '_inert ? null : _labelId',\n '[class.mat-optgroup-disabled]': 'disabled',\n }, providers: [{ provide: MAT_OPTGROUP, useExisting: MatOptgroup }], template: \"{{ label }} \\n\\n\", styles: [\".mat-optgroup-label{white-space:nowrap;overflow:hidden;text-overflow:ellipsis;display:block;line-height:48px;height:48px;padding:0 16px;text-align:left;text-decoration:none;max-width:100%;-webkit-user-select:none;user-select:none;cursor:default}.mat-optgroup-label[disabled]{cursor:default}[dir=rtl] .mat-optgroup-label{text-align:right}.mat-optgroup-label .mat-icon{margin-right:16px;vertical-align:middle}.mat-optgroup-label .mat-icon svg{vertical-align:top}[dir=rtl] .mat-optgroup-label .mat-icon{margin-left:16px;margin-right:0}\\n\"] }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Option IDs need to be unique across components, so this counter exists outside of\n * the component definition.\n */\nlet _uniqueIdCounter = 0;\n/** Event object emitted by MatOption when selected or deselected. */\nclass MatOptionSelectionChange {\n constructor(\n /** Reference to the option that emitted the event. */\n source, \n /** Whether the change in the option's value was a result of a user action. */\n isUserInput = false) {\n this.source = source;\n this.isUserInput = isUserInput;\n }\n}\nclass _MatOptionBase {\n constructor(_element, _changeDetectorRef, _parent, group) {\n this._element = _element;\n this._changeDetectorRef = _changeDetectorRef;\n this._parent = _parent;\n this.group = group;\n this._selected = false;\n this._active = false;\n this._disabled = false;\n this._mostRecentViewValue = '';\n /** The unique ID of the option. */\n this.id = `mat-option-${_uniqueIdCounter++}`;\n /** Event emitted when the option is selected or deselected. */\n // tslint:disable-next-line:no-output-on-prefix\n this.onSelectionChange = new EventEmitter();\n /** Emits when the state of the option changes and any parents have to be notified. */\n this._stateChanges = new Subject();\n }\n /** Whether the wrapping component is in multiple selection mode. */\n get multiple() {\n return this._parent && this._parent.multiple;\n }\n /** Whether or not the option is currently selected. */\n get selected() {\n return this._selected;\n }\n /** Whether the option is disabled. */\n get disabled() {\n return (this.group && this.group.disabled) || this._disabled;\n }\n set disabled(value) {\n this._disabled = coerceBooleanProperty(value);\n }\n /** Whether ripples for the option are disabled. */\n get disableRipple() {\n return !!(this._parent && this._parent.disableRipple);\n }\n /**\n * Whether or not the option is currently active and ready to be selected.\n * An active option displays styles as if it is focused, but the\n * focus is actually retained somewhere else. This comes in handy\n * for components like autocomplete where focus must remain on the input.\n */\n get active() {\n return this._active;\n }\n /**\n * The displayed value of the option. It is necessary to show the selected option in the\n * select's trigger.\n */\n get viewValue() {\n // TODO(kara): Add input property alternative for node envs.\n return (this._getHostElement().textContent || '').trim();\n }\n /** Selects the option. */\n select() {\n if (!this._selected) {\n this._selected = true;\n this._changeDetectorRef.markForCheck();\n this._emitSelectionChangeEvent();\n }\n }\n /** Deselects the option. */\n deselect() {\n if (this._selected) {\n this._selected = false;\n this._changeDetectorRef.markForCheck();\n this._emitSelectionChangeEvent();\n }\n }\n /** Sets focus onto this option. */\n focus(_origin, options) {\n // Note that we aren't using `_origin`, but we need to keep it because some internal consumers\n // use `MatOption` in a `FocusKeyManager` and we need it to match `FocusableOption`.\n const element = this._getHostElement();\n if (typeof element.focus === 'function') {\n element.focus(options);\n }\n }\n /**\n * This method sets display styles on the option to make it appear\n * active. This is used by the ActiveDescendantKeyManager so key\n * events will display the proper options as active on arrow key events.\n */\n setActiveStyles() {\n if (!this._active) {\n this._active = true;\n this._changeDetectorRef.markForCheck();\n }\n }\n /**\n * This method removes display styles on the option that made it appear\n * active. This is used by the ActiveDescendantKeyManager so key\n * events will display the proper options as active on arrow key events.\n */\n setInactiveStyles() {\n if (this._active) {\n this._active = false;\n this._changeDetectorRef.markForCheck();\n }\n }\n /** Gets the label to be used when determining whether the option should be focused. */\n getLabel() {\n return this.viewValue;\n }\n /** Ensures the option is selected when activated from the keyboard. */\n _handleKeydown(event) {\n if ((event.keyCode === ENTER || event.keyCode === SPACE) && !hasModifierKey(event)) {\n this._selectViaInteraction();\n // Prevent the page from scrolling down and form submits.\n event.preventDefault();\n }\n }\n /**\n * `Selects the option while indicating the selection came from the user. Used to\n * determine if the select's view -> model callback should be invoked.`\n */\n _selectViaInteraction() {\n if (!this.disabled) {\n this._selected = this.multiple ? !this._selected : true;\n this._changeDetectorRef.markForCheck();\n this._emitSelectionChangeEvent(true);\n }\n }\n /**\n * Gets the `aria-selected` value for the option. We explicitly omit the `aria-selected`\n * attribute from single-selection, unselected options. Including the `aria-selected=\"false\"`\n * attributes adds a significant amount of noise to screen-reader users without providing useful\n * information.\n */\n _getAriaSelected() {\n return this.selected || (this.multiple ? false : null);\n }\n /** Returns the correct tabindex for the option depending on disabled state. */\n _getTabIndex() {\n return this.disabled ? '-1' : '0';\n }\n /** Gets the host DOM element. */\n _getHostElement() {\n return this._element.nativeElement;\n }\n ngAfterViewChecked() {\n // Since parent components could be using the option's label to display the selected values\n // (e.g. `mat-select`) and they don't have a way of knowing if the option's label has changed\n // we have to check for changes in the DOM ourselves and dispatch an event. These checks are\n // relatively cheap, however we still limit them only to selected options in order to avoid\n // hitting the DOM too often.\n if (this._selected) {\n const viewValue = this.viewValue;\n if (viewValue !== this._mostRecentViewValue) {\n this._mostRecentViewValue = viewValue;\n this._stateChanges.next();\n }\n }\n }\n ngOnDestroy() {\n this._stateChanges.complete();\n }\n /** Emits the selection change event. */\n _emitSelectionChangeEvent(isUserInput = false) {\n this.onSelectionChange.emit(new MatOptionSelectionChange(this, isUserInput));\n }\n}\n_MatOptionBase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: _MatOptionBase, deps: \"invalid\", target: i0.ɵɵFactoryTarget.Directive });\n_MatOptionBase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: _MatOptionBase, inputs: { value: \"value\", id: \"id\", disabled: \"disabled\" }, outputs: { onSelectionChange: \"onSelectionChange\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: _MatOptionBase, decorators: [{\n type: Directive\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.ChangeDetectorRef }, { type: undefined }, { type: _MatOptgroupBase }]; }, propDecorators: { value: [{\n type: Input\n }], id: [{\n type: Input\n }], disabled: [{\n type: Input\n }], onSelectionChange: [{\n type: Output\n }] } });\n/**\n * Single option inside of a `` element.\n */\nclass MatOption extends _MatOptionBase {\n constructor(element, changeDetectorRef, parent, group) {\n super(element, changeDetectorRef, parent, group);\n }\n}\nMatOption.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: MatOption, deps: [{ token: i0.ElementRef }, { token: i0.ChangeDetectorRef }, { token: MAT_OPTION_PARENT_COMPONENT, optional: true }, { token: MAT_OPTGROUP, optional: true }], target: i0.ɵɵFactoryTarget.Component });\nMatOption.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"12.0.0\", version: \"13.3.0\", type: MatOption, selector: \"mat-option\", host: { attributes: { \"role\": \"option\" }, listeners: { \"click\": \"_selectViaInteraction()\", \"keydown\": \"_handleKeydown($event)\" }, properties: { \"attr.tabindex\": \"_getTabIndex()\", \"class.mat-selected\": \"selected\", \"class.mat-option-multiple\": \"multiple\", \"class.mat-active\": \"active\", \"id\": \"id\", \"attr.aria-selected\": \"_getAriaSelected()\", \"attr.aria-disabled\": \"disabled.toString()\", \"class.mat-option-disabled\": \"disabled\" }, classAttribute: \"mat-option mat-focus-indicator\" }, exportAs: [\"matOption\"], usesInheritance: true, ngImport: i0, template: \"\\n\\n\\n\\n\\n({{ group.label }})\\n\\n
\\n\", styles: [\":host.bs3.popover-top{margin-bottom:10px}:host.bs3.popover.top>.arrow{margin-left:-2px}:host.bs3.popover.top{margin-bottom:10px}:host.popover.bottom>.arrow{margin-left:-4px}:host.bs3.bs-popover-left{margin-right:.5rem}:host.bs3.bs-popover-right .arrow,:host.bs3.bs-popover-left .arrow{margin:.3rem 0}\\n\"] }]\n }], ctorParameters: function () { return [{ type: PopoverConfig }]; }, propDecorators: { placement: [{\n type: Input\n }], title: [{\n type: Input\n }] } });\n\nlet id = 0;\n/**\n * A lightweight, extensible directive for fancy popover creation.\n */\nclass PopoverDirective {\n constructor(_config, _elementRef, _renderer, _viewContainerRef, cis, _positionService) {\n this._elementRef = _elementRef;\n this._renderer = _renderer;\n this._positionService = _positionService;\n /** unique id popover - use for aria-describedby */\n this.popoverId = id++;\n /** sets disable adaptive position */\n this.adaptivePosition = true;\n /**\n * Placement of a popover. Accepts: \"top\", \"bottom\", \"left\", \"right\"\n */\n this.placement = 'top';\n /**\n * Close popover on outside click\n */\n this.outsideClick = false;\n /**\n * Specifies events that should trigger. Supports a space separated list of\n * event names.\n */\n this.triggers = 'click';\n /**\n * Css class for popover container\n */\n this.containerClass = '';\n /**\n * Delay before showing the tooltip\n */\n this.delay = 0;\n this._isInited = false;\n this._popover = cis\n .createLoader(_elementRef, _viewContainerRef, _renderer)\n .provide({ provide: PopoverConfig, useValue: _config });\n Object.assign(this, _config);\n this.onShown = this._popover.onShown;\n this.onHidden = this._popover.onHidden;\n // fix: no focus on button on Mac OS #1795\n if (typeof window !== 'undefined') {\n _elementRef.nativeElement.addEventListener('click', function () {\n try {\n _elementRef.nativeElement.focus();\n }\n catch (err) {\n return;\n }\n });\n }\n }\n /**\n * Returns whether or not the popover is currently being shown\n */\n get isOpen() {\n return this._popover.isShown;\n }\n set isOpen(value) {\n if (value) {\n this.show();\n }\n else {\n this.hide();\n }\n }\n /**\n * Set attribute aria-describedBy for element directive and\n * set id for the popover\n */\n setAriaDescribedBy() {\n this._ariaDescribedby = this.isOpen ? `ngx-popover-${this.popoverId}` : void 0;\n if (this._ariaDescribedby) {\n if (this._popover.instance) {\n this._popover.instance.popoverId = this._ariaDescribedby;\n }\n this._renderer.setAttribute(this._elementRef.nativeElement, 'aria-describedby', this._ariaDescribedby);\n }\n else {\n this._renderer.removeAttribute(this._elementRef.nativeElement, 'aria-describedby');\n }\n }\n /**\n * Opens an element’s popover. This is considered a “manual” triggering of\n * the popover.\n */\n show() {\n if (this._popover.isShown || !this.popover || this._delayTimeoutId) {\n return;\n }\n this._positionService.setOptions({\n modifiers: {\n flip: {\n enabled: this.adaptivePosition\n },\n preventOverflow: {\n enabled: this.adaptivePosition,\n boundariesElement: this.boundariesElement || 'scrollParent'\n }\n }\n });\n const showPopover = () => {\n if (this._delayTimeoutId) {\n this._delayTimeoutId = undefined;\n }\n this._popover\n .attach(PopoverContainerComponent)\n .to(this.container)\n .position({ attachment: this.placement })\n .show({\n content: this.popover,\n context: this.popoverContext,\n placement: this.placement,\n title: this.popoverTitle,\n containerClass: this.containerClass\n });\n if (!this.adaptivePosition && this._popover._componentRef) {\n this._positionService.calcPosition();\n this._positionService.deletePositionElement(this._popover._componentRef.location);\n }\n this.isOpen = true;\n this.setAriaDescribedBy();\n };\n const cancelDelayedTooltipShowing = () => {\n if (this._popoverCancelShowFn) {\n this._popoverCancelShowFn();\n }\n };\n if (this.delay) {\n const _timer = timer(this.delay).subscribe(() => {\n showPopover();\n cancelDelayedTooltipShowing();\n });\n if (this.triggers) {\n parseTriggers(this.triggers)\n .forEach((trigger) => {\n if (!trigger.close) {\n return;\n }\n this._popoverCancelShowFn = this._renderer.listen(this._elementRef.nativeElement, trigger.close, () => {\n _timer.unsubscribe();\n cancelDelayedTooltipShowing();\n });\n });\n }\n }\n else {\n showPopover();\n }\n }\n /**\n * Closes an element’s popover. This is considered a “manual” triggering of\n * the popover.\n */\n hide() {\n if (this._delayTimeoutId) {\n clearTimeout(this._delayTimeoutId);\n this._delayTimeoutId = undefined;\n }\n if (this.isOpen) {\n this._popover.hide();\n this.setAriaDescribedBy();\n this.isOpen = false;\n }\n }\n /**\n * Toggles an element’s popover. This is considered a “manual” triggering of\n * the popover.\n */\n toggle() {\n if (this.isOpen) {\n return this.hide();\n }\n this.show();\n }\n ngOnInit() {\n // fix: seems there are an issue with `routerLinkActive`\n // which result in duplicated call ngOnInit without call to ngOnDestroy\n // read more: https://github.com/valor-software/ngx-bootstrap/issues/1885\n if (this._isInited) {\n return;\n }\n this._isInited = true;\n this._popover.listen({\n triggers: this.triggers,\n outsideClick: this.outsideClick,\n show: () => this.show(),\n hide: () => this.hide()\n });\n }\n ngOnDestroy() {\n this._popover.dispose();\n }\n}\nPopoverDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.0.3\", ngImport: i0, type: PopoverDirective, deps: [{ token: PopoverConfig }, { token: i0.ElementRef }, { token: i0.Renderer2 }, { token: i0.ViewContainerRef }, { token: i2$1.ComponentLoaderFactory }, { token: i3.PositioningService }], target: i0.ɵɵFactoryTarget.Directive });\nPopoverDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.0.3\", type: PopoverDirective, selector: \"[popover]\", inputs: { adaptivePosition: \"adaptivePosition\", boundariesElement: \"boundariesElement\", popover: \"popover\", popoverContext: \"popoverContext\", popoverTitle: \"popoverTitle\", placement: \"placement\", outsideClick: \"outsideClick\", triggers: \"triggers\", container: \"container\", containerClass: \"containerClass\", isOpen: \"isOpen\", delay: \"delay\" }, outputs: { onShown: \"onShown\", onHidden: \"onHidden\" }, exportAs: [\"bs-popover\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.0.3\", ngImport: i0, type: PopoverDirective, decorators: [{\n type: Directive,\n args: [{ selector: '[popover]', exportAs: 'bs-popover' }]\n }], ctorParameters: function () { return [{ type: PopoverConfig }, { type: i0.ElementRef }, { type: i0.Renderer2 }, { type: i0.ViewContainerRef }, { type: i2$1.ComponentLoaderFactory }, { type: i3.PositioningService }]; }, propDecorators: { adaptivePosition: [{\n type: Input\n }], boundariesElement: [{\n type: Input\n }], popover: [{\n type: Input\n }], popoverContext: [{\n type: Input\n }], popoverTitle: [{\n type: Input\n }], placement: [{\n type: Input\n }], outsideClick: [{\n type: Input\n }], triggers: [{\n type: Input\n }], container: [{\n type: Input\n }], containerClass: [{\n type: Input\n }], isOpen: [{\n type: Input\n }], delay: [{\n type: Input\n }], onShown: [{\n type: Output\n }], onHidden: [{\n type: Output\n }] } });\n\nclass PopoverModule {\n static forRoot() {\n return {\n ngModule: PopoverModule,\n providers: [ComponentLoaderFactory, PositioningService]\n };\n }\n}\nPopoverModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.0.3\", ngImport: i0, type: PopoverModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nPopoverModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.0.3\", ngImport: i0, type: PopoverModule, declarations: [PopoverDirective, PopoverContainerComponent], imports: [CommonModule], exports: [PopoverDirective] });\nPopoverModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.0.3\", ngImport: i0, type: PopoverModule, imports: [CommonModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.0.3\", ngImport: i0, type: PopoverModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [CommonModule],\n declarations: [PopoverDirective, PopoverContainerComponent],\n exports: [PopoverDirective]\n }]\n }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { PopoverConfig, PopoverContainerComponent, PopoverDirective, PopoverModule };\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { environment } from 'src/environments/environment';\nimport { Observable } from 'rxjs';\nimport { Toy } from './toy';\n\n@Injectable({\n providedIn: 'root'\n})\nexport class SearchService {\n\n private apiUrl = environment.serviceURL + 'search'; \n\n constructor(private http: HttpClient) { }\n\n searchToys(query: string): Observable {\n return this.http.get(`${this.apiUrl}?q=${query}`);\n }\n\n getTopSearchKeywords(keyword: string): Observable {\n return this.http.get(`${this.apiUrl}/top-keywords?keyword=${keyword}`);\n }\n\n}","import * as noUiSlider from 'nouislider';\nimport * as i0 from '@angular/core';\nimport { EventEmitter, forwardRef, Component, Input, Output, NgModule } from '@angular/core';\nimport { NG_VALUE_ACCESSOR } from '@angular/forms';\n\nclass DefaultFormatter {\n to(value) {\n // formatting with http://stackoverflow.com/a/26463364/478584\n return String(parseFloat(parseFloat(String(value)).toFixed(2)));\n }\n from(value) {\n return parseFloat(value);\n }\n}\nclass NouisliderComponent {\n constructor(ngZone, el, renderer) {\n this.ngZone = ngZone;\n this.el = el;\n this.renderer = renderer;\n this.handles = [];\n this.config = {};\n this.change = new EventEmitter(true);\n this.update = new EventEmitter(true);\n this.slide = new EventEmitter(true);\n this.set = new EventEmitter(true);\n this.start = new EventEmitter(true);\n this.end = new EventEmitter(true);\n this.onChange = Function.prototype;\n this.cleanups = [];\n this.eventHandler = (emitter, values, handle, unencoded) => {\n let v = this.toValues(values);\n let emitEvents = false;\n if (this.value === undefined) {\n this.value = v;\n return;\n }\n if (Array.isArray(v) && this.value[handle] != v[handle]) {\n emitEvents = true;\n }\n if (!Array.isArray(v) && this.value != v) {\n emitEvents = true;\n }\n if (emitEvents) {\n this.ngZone.run(() => {\n if (emitter.observers.length > 0) {\n emitter.emit(v);\n }\n this.onChange(v);\n });\n }\n if (Array.isArray(v)) {\n this.value[handle] = v[handle];\n }\n else {\n this.value = v;\n }\n };\n this.defaultKeyHandler = (e) => {\n let stepSize = this.slider.steps();\n let index = parseInt(e.target.getAttribute('data-handle'));\n let sign = 1;\n let multiplier = 1;\n let step = 0;\n let delta = 0;\n switch (e.which) {\n case 34: // PageDown\n multiplier = this.config.pageSteps;\n break;\n case 40: // ArrowDown\n case 37: // ArrowLeft\n sign = -1;\n step = stepSize[index][0];\n e.preventDefault();\n break;\n case 33: // PageUp\n multiplier = this.config.pageSteps;\n break;\n case 38: // ArrowUp\n case 39: // ArrowRight\n step = stepSize[index][1];\n e.preventDefault();\n break;\n default:\n break;\n }\n delta = sign * multiplier * step;\n let newValue;\n if (Array.isArray(this.value)) {\n newValue = [...this.value];\n newValue[index] = newValue[index] + delta;\n }\n else {\n newValue = this.value + delta;\n }\n this.slider.set(newValue);\n };\n }\n ngOnChanges(changes) {\n if (this.slider &&\n (changes.min || changes.max || changes.step || changes.range)) {\n this.ngZone.runOutsideAngular(() => {\n setTimeout(() => {\n this.slider.updateOptions({\n range: Object.assign({}, {\n min: this.min,\n max: this.max,\n }, this.range || {}),\n step: this.step,\n });\n });\n });\n }\n }\n ngOnDestroy() {\n this.slider.destroy();\n while (this.cleanups.length) {\n this.cleanups.pop()?.();\n }\n }\n toValues(values) {\n let v = values.map(this.config.format.from);\n return v.length == 1 ? v[0] : v;\n }\n writeValue(value) {\n if (this.slider) {\n this.ngZone.runOutsideAngular(() => {\n setTimeout(() => {\n this.slider.set(value);\n });\n });\n }\n else if (value !== null) {\n this.value = value;\n this.createSlider(value);\n }\n }\n registerOnChange(fn) {\n this.onChange = fn;\n }\n registerOnTouched(fn) { }\n setDisabledState(isDisabled) {\n isDisabled\n ? this.renderer.setAttribute(this.el.nativeElement.childNodes[0], 'disabled', 'true')\n : this.renderer.removeAttribute(this.el.nativeElement.childNodes[0], 'disabled');\n }\n createSlider(initialValue) {\n let inputsConfig = JSON.parse(JSON.stringify({\n behaviour: this.behaviour,\n connect: this.connect,\n limit: this.limit,\n start: initialValue,\n step: this.step,\n pageSteps: this.pageSteps,\n keyboard: this.keyboard,\n onKeydown: this.onKeydown,\n range: this.range ||\n this.config.range || { min: this.min, max: this.max },\n tooltips: this.tooltips,\n snap: this.snap,\n animate: this.animate,\n }));\n inputsConfig.tooltips = this.tooltips || this.config.tooltips;\n inputsConfig.format =\n this.format || this.config.format || new DefaultFormatter();\n this.ngZone.runOutsideAngular(() => {\n this.slider = noUiSlider.create(this.el.nativeElement.querySelector('div'), Object.assign(this.config, inputsConfig));\n });\n this.handles = [].slice.call(this.el.nativeElement.querySelectorAll('.noUi-handle'));\n if (this.config.keyboard) {\n if (this.config.pageSteps === undefined) {\n this.config.pageSteps = 10;\n }\n for (const handle of this.handles) {\n handle.setAttribute('tabindex', 0);\n const onKeydown = this.config.onKeydown || this.defaultKeyHandler;\n this.ngZone.runOutsideAngular(() => {\n this.cleanups.push(this.renderer.listen(handle, 'keydown', onKeydown), this.renderer.listen(handle, 'click', () => {\n handle.focus();\n }));\n });\n }\n }\n this.slider.on('set', (values, handle, unencoded) => {\n this.eventHandler(this.set, values, handle, unencoded);\n });\n this.slider.on('update', (values, handle, unencoded) => {\n if (this.update.observers.length > 0) {\n this.ngZone.run(() => {\n this.update.emit(this.toValues(values));\n });\n }\n });\n this.slider.on('change', (values, handle, unencoded) => {\n if (this.change.observers.length > 0) {\n this.ngZone.run(() => {\n this.change.emit(this.toValues(values));\n });\n }\n });\n this.slider.on('slide', (values, handle, unencoded) => {\n this.eventHandler(this.slide, values, handle, unencoded);\n });\n this.slider.on('start', (values, handle, unencoded) => {\n if (this.start.observers.length > 0) {\n this.ngZone.run(() => {\n this.start.emit(this.toValues(values));\n });\n }\n });\n this.slider.on('end', (values, handle, unencoded) => {\n if (this.end.observers.length > 0) {\n this.ngZone.run(() => {\n this.end.emit(this.toValues(values));\n });\n }\n });\n }\n}\nNouisliderComponent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.3.0\", ngImport: i0, type: NouisliderComponent, deps: [{ token: i0.NgZone }, { token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Component });\nNouisliderComponent.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"14.3.0\", type: NouisliderComponent, isStandalone: true, selector: \"nouislider\", inputs: { disabled: \"disabled\", behaviour: \"behaviour\", connect: \"connect\", limit: \"limit\", min: \"min\", max: \"max\", snap: \"snap\", animate: \"animate\", range: \"range\", step: \"step\", format: \"format\", pageSteps: \"pageSteps\", config: \"config\", keyboard: \"keyboard\", onKeydown: \"onKeydown\", tooltips: \"tooltips\" }, outputs: { change: \"change\", update: \"update\", slide: \"slide\", set: \"set\", start: \"start\", end: \"end\" }, host: { properties: { \"class.ng2-nouislider\": \"true\" } }, providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => NouisliderComponent),\n multi: true,\n },\n ], usesOnChanges: true, ngImport: i0, template: '', isInline: true, styles: [\":host{display:block;margin-top:1rem;margin-bottom:1rem}\\n\"], preserveWhitespaces: true });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.3.0\", ngImport: i0, type: NouisliderComponent, decorators: [{\n type: Component,\n args: [{ selector: 'nouislider', host: {\n '[class.ng2-nouislider]': 'true',\n }, template: '', providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => NouisliderComponent),\n multi: true,\n },\n ], standalone: true, styles: [\":host{display:block;margin-top:1rem;margin-bottom:1rem}\\n\"] }]\n }], ctorParameters: function () { return [{ type: i0.NgZone }, { type: i0.ElementRef }, { type: i0.Renderer2 }]; }, propDecorators: { disabled: [{\n type: Input\n }], behaviour: [{\n type: Input\n }], connect: [{\n type: Input\n }], limit: [{\n type: Input\n }], min: [{\n type: Input\n }], max: [{\n type: Input\n }], snap: [{\n type: Input\n }], animate: [{\n type: Input\n }], range: [{\n type: Input\n }], step: [{\n type: Input\n }], format: [{\n type: Input\n }], pageSteps: [{\n type: Input\n }], config: [{\n type: Input\n }], keyboard: [{\n type: Input\n }], onKeydown: [{\n type: Input\n }], tooltips: [{\n type: Input\n }], change: [{\n type: Output\n }], update: [{\n type: Output\n }], slide: [{\n type: Output\n }], set: [{\n type: Output\n }], start: [{\n type: Output\n }], end: [{\n type: Output\n }] } });\n\nclass NouisliderModule {\n}\nNouisliderModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.3.0\", ngImport: i0, type: NouisliderModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nNouisliderModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"14.3.0\", ngImport: i0, type: NouisliderModule, imports: [NouisliderComponent], exports: [NouisliderComponent] });\nNouisliderModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"14.3.0\", ngImport: i0, type: NouisliderModule, imports: [NouisliderComponent] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.3.0\", ngImport: i0, type: NouisliderModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [NouisliderComponent],\n imports: [NouisliderComponent],\n }]\n }] });\n\n/*\n * Public API Surface of ng2-nouislider\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { DefaultFormatter, NouisliderComponent, NouisliderModule };\n","\r\nimport { NgModule } from \"@angular/core\";\r\nimport { LocationStrategy, PathLocationStrategy } from \"@angular/common\";\r\nimport { AppComponent } from \"./app.component\";\r\nimport { HTTP_INTERCEPTORS } from \"@angular/common/http\";\r\nimport { HeaderInterceptor } from './services/header-interceptor';\r\nimport { CacheInterceptor } from \"./services/cache-Interceptor\";\r\nimport { BackButtonModule } from \"./shared/back-button/back-button.module\";\r\nimport { ScrollTopButtonModule } from \"./shared/scroll-top-button/scroll-top-button.module\";\r\nimport { LoadingOverlayModule } from \"./shared/loading-overlay/loading-overlay.module\";\r\nimport { ToastModule } from \"./shared/toast/toast.module\";\r\nimport { NavbarModule } from \"./shared/nav-bar/nav-bar.module\";\r\nimport { FooterModule } from \"./shared/footer/footer.module\";\r\nimport { GoogleAnalyticsService } from \"angular-ga\";\r\nimport { AddressService } from \"./services/address.service\";\r\nimport { AuthenticationService } from \"./services/authentication.service\";\r\nimport { AwsImageService } from \"./services/aws-image.service\";\r\nimport { CartService } from \"./services/cart.service\";\r\nimport { CatalogService } from \"./services/catalog.service\";\r\nimport { CouponService } from \"./services/coupon.service\";\r\nimport { FeedbackService } from \"./services/feedback.service\";\r\nimport { LoadingOverlayService } from \"./services/loading-overlay.service\";\r\nimport { PaymentService } from \"./services/payment.service\";\r\nimport { RecommendationsTsService } from \"./services/recommendations.ts.service\";\r\nimport { SMSService } from \"./services/sms.service\";\r\nimport { ToasterService } from \"./services/toaster.service\";\r\nimport { UserService } from \"./services/user.service\";\r\nimport { BrowserModule } from \"@angular/platform-browser\";\r\nimport { AppRoutingModule } from \"./app-routing.module\";\r\nimport { TagInputModule } from \"ngx-chips\";\r\nimport { BrowserAnimationsModule } from \"@angular/platform-browser/animations\"; // this is needed!\r\nimport { FormsModule } from \"@angular/forms\";\r\nimport { Router, RouterModule } from \"@angular/router\";\r\nimport { CommonModule } from \"@angular/common\";\r\nimport { BsDropdownModule } from \"ngx-bootstrap/dropdown\";\r\nimport { ProgressbarModule } from \"ngx-bootstrap/progressbar\";\r\nimport { TooltipModule } from \"ngx-bootstrap/tooltip\";\r\nimport { CollapseModule } from \"ngx-bootstrap/collapse\";\r\nimport { TabsModule } from \"ngx-bootstrap/tabs\";\r\nimport { PaginationModule } from \"ngx-bootstrap/pagination\";\r\nimport { AlertModule } from \"ngx-bootstrap/alert\";\r\nimport { BsDatepickerModule } from \"ngx-bootstrap/datepicker\";\r\nimport { CarouselModule } from \"ngx-bootstrap/carousel\";\r\nimport { ModalModule } from \"ngx-bootstrap/modal\";\r\nimport { PopoverModule } from \"ngx-bootstrap/popover\";\r\nimport { TimepickerModule } from \"ngx-bootstrap/timepicker\";\r\nimport { HttpClientModule } from \"@angular/common/http\";\r\nimport { LandingModule } from \"./components/landing/landing.module\";\r\nimport { ScrollingModule } from '@angular/cdk/scrolling';\r\nimport { ToastComponent } from \"./shared/toast/toast.component\";\r\nimport { CategoryService } from \"./services/category.service\";\r\nimport { BlogDataService } from \"./services/blog-data.service\";\r\nimport { WhatsappWidgetComponent } from \"./components/whatsapp-widget/whatsapp-widget.component\";\r\nimport { AgeBasedCatalogModule } from './components/age-based-catalog/age-based-catalog.module';\r\nimport { UrlService } from \"./services/url.service\";\r\nimport { ConfigService } from \"./services/config.service\";\r\nimport { CarouselModule as OwlCarouselModule } from 'ngx-owl-carousel-o';\r\nimport { RatingService } from \"./services/rating-service.service\";\r\nimport { SearchService } from \"./services/search.service\";\r\nimport { NouisliderModule } from \"ng2-nouislider\";\r\nimport { SearchModule } from \"./services/search/search.module\";\r\nimport { NgbActiveModal } from \"@ng-bootstrap/ng-bootstrap\";\r\n@NgModule({\r\n declarations: [\r\n AppComponent,\r\n WhatsappWidgetComponent,\r\n ],\r\n imports: [\r\n BrowserModule,\r\n AppRoutingModule,\r\n BackButtonModule,\r\n ScrollingModule,\r\n ScrollTopButtonModule,\r\n LoadingOverlayModule,\r\n ToastModule,\r\n NavbarModule,\r\n FooterModule,\r\n CommonModule,\r\n FormsModule,\r\n RouterModule,\r\n BrowserAnimationsModule,\r\n BsDropdownModule.forRoot(),\r\n ProgressbarModule.forRoot(),\r\n TooltipModule.forRoot(),\r\n TimepickerModule.forRoot(),\r\n PopoverModule.forRoot(),\r\n CollapseModule.forRoot(),\r\n TagInputModule,\r\n TabsModule.forRoot(),\r\n PaginationModule.forRoot(),\r\n AlertModule.forRoot(),\r\n BsDatepickerModule.forRoot(),\r\n CarouselModule.forRoot(),\r\n ModalModule.forRoot(),\r\n HttpClientModule,\r\n LandingModule,\r\n AgeBasedCatalogModule,\r\n OwlCarouselModule, \r\n NouisliderModule, \r\n SearchModule,\r\n LoadingOverlayModule\r\n \r\n ],\r\n entryComponents: [ToastComponent],\r\n providers: [NgbActiveModal, RatingService, SearchService, GoogleAnalyticsService, BlogDataService, CategoryService, SMSService, AddressService, CatalogService, AuthenticationService, CartService, UserService, PaymentService, ToasterService, AwsImageService, LoadingOverlayService, RecommendationsTsService, FeedbackService, CouponService, UrlService, ConfigService,\r\n {\r\n provide: HTTP_INTERCEPTORS,\r\n useClass: HeaderInterceptor,\r\n multi: true\r\n },\r\n {\r\n provide: HTTP_INTERCEPTORS,\r\n useClass: CacheInterceptor,\r\n multi: true,\r\n },\r\n { provide: LocationStrategy, useClass: PathLocationStrategy}\r\n ],\r\n bootstrap: [AppComponent]\r\n})\r\nexport class AppModule {\r\n\r\n constructor(private router: Router) {\r\n // console.log(this.router.config);\r\n }\r\n\r\n\r\n}\r\n\r\n\r\n","/*!\n\n =========================================================\n * Argon Desing System PRO Angular - v1.3.0\n =========================================================\n\n * Product Page: https://www.creative-tim.com/product/argon-design-system-pro-angular\n * Copyright 2021 Creative Tim (http://www.creative-tim.com)\n\nCoded by www.creative-tim.com\n\n =========================================================\n\n * The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.\n\n */\nimport { enableProdMode } from \"@angular/core\";\nimport { platformBrowserDynamic } from \"@angular/platform-browser-dynamic\";\n\nimport { AppModule } from \"./app/app.module\";\nimport { environment } from \"./environments/environment\";\n\nif (environment.production) {\n enableProdMode();\n}\n\nplatformBrowserDynamic()\n .bootstrapModule(AppModule)\n .catch(err => console.error(err));\n",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./enc-base64\"), require(\"./md5\"), require(\"./evpkdf\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./enc-base64\", \"./md5\", \"./evpkdf\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var BlockCipher = C_lib.BlockCipher;\n\t var C_algo = C.algo;\n\n\t // Lookup tables\n\t var SBOX = [];\n\t var INV_SBOX = [];\n\t var SUB_MIX_0 = [];\n\t var SUB_MIX_1 = [];\n\t var SUB_MIX_2 = [];\n\t var SUB_MIX_3 = [];\n\t var INV_SUB_MIX_0 = [];\n\t var INV_SUB_MIX_1 = [];\n\t var INV_SUB_MIX_2 = [];\n\t var INV_SUB_MIX_3 = [];\n\n\t // Compute lookup tables\n\t (function () {\n\t // Compute double table\n\t var d = [];\n\t for (var i = 0; i < 256; i++) {\n\t if (i < 128) {\n\t d[i] = i << 1;\n\t } else {\n\t d[i] = (i << 1) ^ 0x11b;\n\t }\n\t }\n\n\t // Walk GF(2^8)\n\t var x = 0;\n\t var xi = 0;\n\t for (var i = 0; i < 256; i++) {\n\t // Compute sbox\n\t var sx = xi ^ (xi << 1) ^ (xi << 2) ^ (xi << 3) ^ (xi << 4);\n\t sx = (sx >>> 8) ^ (sx & 0xff) ^ 0x63;\n\t SBOX[x] = sx;\n\t INV_SBOX[sx] = x;\n\n\t // Compute multiplication\n\t var x2 = d[x];\n\t var x4 = d[x2];\n\t var x8 = d[x4];\n\n\t // Compute sub bytes, mix columns tables\n\t var t = (d[sx] * 0x101) ^ (sx * 0x1010100);\n\t SUB_MIX_0[x] = (t << 24) | (t >>> 8);\n\t SUB_MIX_1[x] = (t << 16) | (t >>> 16);\n\t SUB_MIX_2[x] = (t << 8) | (t >>> 24);\n\t SUB_MIX_3[x] = t;\n\n\t // Compute inv sub bytes, inv mix columns tables\n\t var t = (x8 * 0x1010101) ^ (x4 * 0x10001) ^ (x2 * 0x101) ^ (x * 0x1010100);\n\t INV_SUB_MIX_0[sx] = (t << 24) | (t >>> 8);\n\t INV_SUB_MIX_1[sx] = (t << 16) | (t >>> 16);\n\t INV_SUB_MIX_2[sx] = (t << 8) | (t >>> 24);\n\t INV_SUB_MIX_3[sx] = t;\n\n\t // Compute next counter\n\t if (!x) {\n\t x = xi = 1;\n\t } else {\n\t x = x2 ^ d[d[d[x8 ^ x2]]];\n\t xi ^= d[d[xi]];\n\t }\n\t }\n\t }());\n\n\t // Precomputed Rcon lookup\n\t var RCON = [0x00, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36];\n\n\t /**\n\t * AES block cipher algorithm.\n\t */\n\t var AES = C_algo.AES = BlockCipher.extend({\n\t _doReset: function () {\n\t var t;\n\n\t // Skip reset of nRounds has been set before and key did not change\n\t if (this._nRounds && this._keyPriorReset === this._key) {\n\t return;\n\t }\n\n\t // Shortcuts\n\t var key = this._keyPriorReset = this._key;\n\t var keyWords = key.words;\n\t var keySize = key.sigBytes / 4;\n\n\t // Compute number of rounds\n\t var nRounds = this._nRounds = keySize + 6;\n\n\t // Compute number of key schedule rows\n\t var ksRows = (nRounds + 1) * 4;\n\n\t // Compute key schedule\n\t var keySchedule = this._keySchedule = [];\n\t for (var ksRow = 0; ksRow < ksRows; ksRow++) {\n\t if (ksRow < keySize) {\n\t keySchedule[ksRow] = keyWords[ksRow];\n\t } else {\n\t t = keySchedule[ksRow - 1];\n\n\t if (!(ksRow % keySize)) {\n\t // Rot word\n\t t = (t << 8) | (t >>> 24);\n\n\t // Sub word\n\t t = (SBOX[t >>> 24] << 24) | (SBOX[(t >>> 16) & 0xff] << 16) | (SBOX[(t >>> 8) & 0xff] << 8) | SBOX[t & 0xff];\n\n\t // Mix Rcon\n\t t ^= RCON[(ksRow / keySize) | 0] << 24;\n\t } else if (keySize > 6 && ksRow % keySize == 4) {\n\t // Sub word\n\t t = (SBOX[t >>> 24] << 24) | (SBOX[(t >>> 16) & 0xff] << 16) | (SBOX[(t >>> 8) & 0xff] << 8) | SBOX[t & 0xff];\n\t }\n\n\t keySchedule[ksRow] = keySchedule[ksRow - keySize] ^ t;\n\t }\n\t }\n\n\t // Compute inv key schedule\n\t var invKeySchedule = this._invKeySchedule = [];\n\t for (var invKsRow = 0; invKsRow < ksRows; invKsRow++) {\n\t var ksRow = ksRows - invKsRow;\n\n\t if (invKsRow % 4) {\n\t var t = keySchedule[ksRow];\n\t } else {\n\t var t = keySchedule[ksRow - 4];\n\t }\n\n\t if (invKsRow < 4 || ksRow <= 4) {\n\t invKeySchedule[invKsRow] = t;\n\t } else {\n\t invKeySchedule[invKsRow] = INV_SUB_MIX_0[SBOX[t >>> 24]] ^ INV_SUB_MIX_1[SBOX[(t >>> 16) & 0xff]] ^\n\t INV_SUB_MIX_2[SBOX[(t >>> 8) & 0xff]] ^ INV_SUB_MIX_3[SBOX[t & 0xff]];\n\t }\n\t }\n\t },\n\n\t encryptBlock: function (M, offset) {\n\t this._doCryptBlock(M, offset, this._keySchedule, SUB_MIX_0, SUB_MIX_1, SUB_MIX_2, SUB_MIX_3, SBOX);\n\t },\n\n\t decryptBlock: function (M, offset) {\n\t // Swap 2nd and 4th rows\n\t var t = M[offset + 1];\n\t M[offset + 1] = M[offset + 3];\n\t M[offset + 3] = t;\n\n\t this._doCryptBlock(M, offset, this._invKeySchedule, INV_SUB_MIX_0, INV_SUB_MIX_1, INV_SUB_MIX_2, INV_SUB_MIX_3, INV_SBOX);\n\n\t // Inv swap 2nd and 4th rows\n\t var t = M[offset + 1];\n\t M[offset + 1] = M[offset + 3];\n\t M[offset + 3] = t;\n\t },\n\n\t _doCryptBlock: function (M, offset, keySchedule, SUB_MIX_0, SUB_MIX_1, SUB_MIX_2, SUB_MIX_3, SBOX) {\n\t // Shortcut\n\t var nRounds = this._nRounds;\n\n\t // Get input, add round key\n\t var s0 = M[offset] ^ keySchedule[0];\n\t var s1 = M[offset + 1] ^ keySchedule[1];\n\t var s2 = M[offset + 2] ^ keySchedule[2];\n\t var s3 = M[offset + 3] ^ keySchedule[3];\n\n\t // Key schedule row counter\n\t var ksRow = 4;\n\n\t // Rounds\n\t for (var round = 1; round < nRounds; round++) {\n\t // Shift rows, sub bytes, mix columns, add round key\n\t var t0 = SUB_MIX_0[s0 >>> 24] ^ SUB_MIX_1[(s1 >>> 16) & 0xff] ^ SUB_MIX_2[(s2 >>> 8) & 0xff] ^ SUB_MIX_3[s3 & 0xff] ^ keySchedule[ksRow++];\n\t var t1 = SUB_MIX_0[s1 >>> 24] ^ SUB_MIX_1[(s2 >>> 16) & 0xff] ^ SUB_MIX_2[(s3 >>> 8) & 0xff] ^ SUB_MIX_3[s0 & 0xff] ^ keySchedule[ksRow++];\n\t var t2 = SUB_MIX_0[s2 >>> 24] ^ SUB_MIX_1[(s3 >>> 16) & 0xff] ^ SUB_MIX_2[(s0 >>> 8) & 0xff] ^ SUB_MIX_3[s1 & 0xff] ^ keySchedule[ksRow++];\n\t var t3 = SUB_MIX_0[s3 >>> 24] ^ SUB_MIX_1[(s0 >>> 16) & 0xff] ^ SUB_MIX_2[(s1 >>> 8) & 0xff] ^ SUB_MIX_3[s2 & 0xff] ^ keySchedule[ksRow++];\n\n\t // Update state\n\t s0 = t0;\n\t s1 = t1;\n\t s2 = t2;\n\t s3 = t3;\n\t }\n\n\t // Shift rows, sub bytes, add round key\n\t var t0 = ((SBOX[s0 >>> 24] << 24) | (SBOX[(s1 >>> 16) & 0xff] << 16) | (SBOX[(s2 >>> 8) & 0xff] << 8) | SBOX[s3 & 0xff]) ^ keySchedule[ksRow++];\n\t var t1 = ((SBOX[s1 >>> 24] << 24) | (SBOX[(s2 >>> 16) & 0xff] << 16) | (SBOX[(s3 >>> 8) & 0xff] << 8) | SBOX[s0 & 0xff]) ^ keySchedule[ksRow++];\n\t var t2 = ((SBOX[s2 >>> 24] << 24) | (SBOX[(s3 >>> 16) & 0xff] << 16) | (SBOX[(s0 >>> 8) & 0xff] << 8) | SBOX[s1 & 0xff]) ^ keySchedule[ksRow++];\n\t var t3 = ((SBOX[s3 >>> 24] << 24) | (SBOX[(s0 >>> 16) & 0xff] << 16) | (SBOX[(s1 >>> 8) & 0xff] << 8) | SBOX[s2 & 0xff]) ^ keySchedule[ksRow++];\n\n\t // Set output\n\t M[offset] = t0;\n\t M[offset + 1] = t1;\n\t M[offset + 2] = t2;\n\t M[offset + 3] = t3;\n\t },\n\n\t keySize: 256/32\n\t });\n\n\t /**\n\t * Shortcut functions to the cipher's object interface.\n\t *\n\t * @example\n\t *\n\t * var ciphertext = CryptoJS.AES.encrypt(message, key, cfg);\n\t * var plaintext = CryptoJS.AES.decrypt(ciphertext, key, cfg);\n\t */\n\t C.AES = BlockCipher._createHelper(AES);\n\t}());\n\n\n\treturn CryptoJS.AES;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./evpkdf\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./evpkdf\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/**\n\t * Cipher core components.\n\t */\n\tCryptoJS.lib.Cipher || (function (undefined) {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var Base = C_lib.Base;\n\t var WordArray = C_lib.WordArray;\n\t var BufferedBlockAlgorithm = C_lib.BufferedBlockAlgorithm;\n\t var C_enc = C.enc;\n\t var Utf8 = C_enc.Utf8;\n\t var Base64 = C_enc.Base64;\n\t var C_algo = C.algo;\n\t var EvpKDF = C_algo.EvpKDF;\n\n\t /**\n\t * Abstract base cipher template.\n\t *\n\t * @property {number} keySize This cipher's key size. Default: 4 (128 bits)\n\t * @property {number} ivSize This cipher's IV size. Default: 4 (128 bits)\n\t * @property {number} _ENC_XFORM_MODE A constant representing encryption mode.\n\t * @property {number} _DEC_XFORM_MODE A constant representing decryption mode.\n\t */\n\t var Cipher = C_lib.Cipher = BufferedBlockAlgorithm.extend({\n\t /**\n\t * Configuration options.\n\t *\n\t * @property {WordArray} iv The IV to use for this operation.\n\t */\n\t cfg: Base.extend(),\n\n\t /**\n\t * Creates this cipher in encryption mode.\n\t *\n\t * @param {WordArray} key The key.\n\t * @param {Object} cfg (Optional) The configuration options to use for this operation.\n\t *\n\t * @return {Cipher} A cipher instance.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var cipher = CryptoJS.algo.AES.createEncryptor(keyWordArray, { iv: ivWordArray });\n\t */\n\t createEncryptor: function (key, cfg) {\n\t return this.create(this._ENC_XFORM_MODE, key, cfg);\n\t },\n\n\t /**\n\t * Creates this cipher in decryption mode.\n\t *\n\t * @param {WordArray} key The key.\n\t * @param {Object} cfg (Optional) The configuration options to use for this operation.\n\t *\n\t * @return {Cipher} A cipher instance.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var cipher = CryptoJS.algo.AES.createDecryptor(keyWordArray, { iv: ivWordArray });\n\t */\n\t createDecryptor: function (key, cfg) {\n\t return this.create(this._DEC_XFORM_MODE, key, cfg);\n\t },\n\n\t /**\n\t * Initializes a newly created cipher.\n\t *\n\t * @param {number} xformMode Either the encryption or decryption transormation mode constant.\n\t * @param {WordArray} key The key.\n\t * @param {Object} cfg (Optional) The configuration options to use for this operation.\n\t *\n\t * @example\n\t *\n\t * var cipher = CryptoJS.algo.AES.create(CryptoJS.algo.AES._ENC_XFORM_MODE, keyWordArray, { iv: ivWordArray });\n\t */\n\t init: function (xformMode, key, cfg) {\n\t // Apply config defaults\n\t this.cfg = this.cfg.extend(cfg);\n\n\t // Store transform mode and key\n\t this._xformMode = xformMode;\n\t this._key = key;\n\n\t // Set initial values\n\t this.reset();\n\t },\n\n\t /**\n\t * Resets this cipher to its initial state.\n\t *\n\t * @example\n\t *\n\t * cipher.reset();\n\t */\n\t reset: function () {\n\t // Reset data buffer\n\t BufferedBlockAlgorithm.reset.call(this);\n\n\t // Perform concrete-cipher logic\n\t this._doReset();\n\t },\n\n\t /**\n\t * Adds data to be encrypted or decrypted.\n\t *\n\t * @param {WordArray|string} dataUpdate The data to encrypt or decrypt.\n\t *\n\t * @return {WordArray} The data after processing.\n\t *\n\t * @example\n\t *\n\t * var encrypted = cipher.process('data');\n\t * var encrypted = cipher.process(wordArray);\n\t */\n\t process: function (dataUpdate) {\n\t // Append\n\t this._append(dataUpdate);\n\n\t // Process available blocks\n\t return this._process();\n\t },\n\n\t /**\n\t * Finalizes the encryption or decryption process.\n\t * Note that the finalize operation is effectively a destructive, read-once operation.\n\t *\n\t * @param {WordArray|string} dataUpdate The final data to encrypt or decrypt.\n\t *\n\t * @return {WordArray} The data after final processing.\n\t *\n\t * @example\n\t *\n\t * var encrypted = cipher.finalize();\n\t * var encrypted = cipher.finalize('data');\n\t * var encrypted = cipher.finalize(wordArray);\n\t */\n\t finalize: function (dataUpdate) {\n\t // Final data update\n\t if (dataUpdate) {\n\t this._append(dataUpdate);\n\t }\n\n\t // Perform concrete-cipher logic\n\t var finalProcessedData = this._doFinalize();\n\n\t return finalProcessedData;\n\t },\n\n\t keySize: 128/32,\n\n\t ivSize: 128/32,\n\n\t _ENC_XFORM_MODE: 1,\n\n\t _DEC_XFORM_MODE: 2,\n\n\t /**\n\t * Creates shortcut functions to a cipher's object interface.\n\t *\n\t * @param {Cipher} cipher The cipher to create a helper for.\n\t *\n\t * @return {Object} An object with encrypt and decrypt shortcut functions.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var AES = CryptoJS.lib.Cipher._createHelper(CryptoJS.algo.AES);\n\t */\n\t _createHelper: (function () {\n\t function selectCipherStrategy(key) {\n\t if (typeof key == 'string') {\n\t return PasswordBasedCipher;\n\t } else {\n\t return SerializableCipher;\n\t }\n\t }\n\n\t return function (cipher) {\n\t return {\n\t encrypt: function (message, key, cfg) {\n\t return selectCipherStrategy(key).encrypt(cipher, message, key, cfg);\n\t },\n\n\t decrypt: function (ciphertext, key, cfg) {\n\t return selectCipherStrategy(key).decrypt(cipher, ciphertext, key, cfg);\n\t }\n\t };\n\t };\n\t }())\n\t });\n\n\t /**\n\t * Abstract base stream cipher template.\n\t *\n\t * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 1 (32 bits)\n\t */\n\t var StreamCipher = C_lib.StreamCipher = Cipher.extend({\n\t _doFinalize: function () {\n\t // Process partial blocks\n\t var finalProcessedBlocks = this._process(!!'flush');\n\n\t return finalProcessedBlocks;\n\t },\n\n\t blockSize: 1\n\t });\n\n\t /**\n\t * Mode namespace.\n\t */\n\t var C_mode = C.mode = {};\n\n\t /**\n\t * Abstract base block cipher mode template.\n\t */\n\t var BlockCipherMode = C_lib.BlockCipherMode = Base.extend({\n\t /**\n\t * Creates this mode for encryption.\n\t *\n\t * @param {Cipher} cipher A block cipher instance.\n\t * @param {Array} iv The IV words.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var mode = CryptoJS.mode.CBC.createEncryptor(cipher, iv.words);\n\t */\n\t createEncryptor: function (cipher, iv) {\n\t return this.Encryptor.create(cipher, iv);\n\t },\n\n\t /**\n\t * Creates this mode for decryption.\n\t *\n\t * @param {Cipher} cipher A block cipher instance.\n\t * @param {Array} iv The IV words.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var mode = CryptoJS.mode.CBC.createDecryptor(cipher, iv.words);\n\t */\n\t createDecryptor: function (cipher, iv) {\n\t return this.Decryptor.create(cipher, iv);\n\t },\n\n\t /**\n\t * Initializes a newly created mode.\n\t *\n\t * @param {Cipher} cipher A block cipher instance.\n\t * @param {Array} iv The IV words.\n\t *\n\t * @example\n\t *\n\t * var mode = CryptoJS.mode.CBC.Encryptor.create(cipher, iv.words);\n\t */\n\t init: function (cipher, iv) {\n\t this._cipher = cipher;\n\t this._iv = iv;\n\t }\n\t });\n\n\t /**\n\t * Cipher Block Chaining mode.\n\t */\n\t var CBC = C_mode.CBC = (function () {\n\t /**\n\t * Abstract base CBC mode.\n\t */\n\t var CBC = BlockCipherMode.extend();\n\n\t /**\n\t * CBC encryptor.\n\t */\n\t CBC.Encryptor = CBC.extend({\n\t /**\n\t * Processes the data block at offset.\n\t *\n\t * @param {Array} words The data words to operate on.\n\t * @param {number} offset The offset where the block starts.\n\t *\n\t * @example\n\t *\n\t * mode.processBlock(data.words, offset);\n\t */\n\t processBlock: function (words, offset) {\n\t // Shortcuts\n\t var cipher = this._cipher;\n\t var blockSize = cipher.blockSize;\n\n\t // XOR and encrypt\n\t xorBlock.call(this, words, offset, blockSize);\n\t cipher.encryptBlock(words, offset);\n\n\t // Remember this block to use with next block\n\t this._prevBlock = words.slice(offset, offset + blockSize);\n\t }\n\t });\n\n\t /**\n\t * CBC decryptor.\n\t */\n\t CBC.Decryptor = CBC.extend({\n\t /**\n\t * Processes the data block at offset.\n\t *\n\t * @param {Array} words The data words to operate on.\n\t * @param {number} offset The offset where the block starts.\n\t *\n\t * @example\n\t *\n\t * mode.processBlock(data.words, offset);\n\t */\n\t processBlock: function (words, offset) {\n\t // Shortcuts\n\t var cipher = this._cipher;\n\t var blockSize = cipher.blockSize;\n\n\t // Remember this block to use with next block\n\t var thisBlock = words.slice(offset, offset + blockSize);\n\n\t // Decrypt and XOR\n\t cipher.decryptBlock(words, offset);\n\t xorBlock.call(this, words, offset, blockSize);\n\n\t // This block becomes the previous block\n\t this._prevBlock = thisBlock;\n\t }\n\t });\n\n\t function xorBlock(words, offset, blockSize) {\n\t var block;\n\n\t // Shortcut\n\t var iv = this._iv;\n\n\t // Choose mixing block\n\t if (iv) {\n\t block = iv;\n\n\t // Remove IV for subsequent blocks\n\t this._iv = undefined;\n\t } else {\n\t block = this._prevBlock;\n\t }\n\n\t // XOR blocks\n\t for (var i = 0; i < blockSize; i++) {\n\t words[offset + i] ^= block[i];\n\t }\n\t }\n\n\t return CBC;\n\t }());\n\n\t /**\n\t * Padding namespace.\n\t */\n\t var C_pad = C.pad = {};\n\n\t /**\n\t * PKCS #5/7 padding strategy.\n\t */\n\t var Pkcs7 = C_pad.Pkcs7 = {\n\t /**\n\t * Pads data using the algorithm defined in PKCS #5/7.\n\t *\n\t * @param {WordArray} data The data to pad.\n\t * @param {number} blockSize The multiple that the data should be padded to.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * CryptoJS.pad.Pkcs7.pad(wordArray, 4);\n\t */\n\t pad: function (data, blockSize) {\n\t // Shortcut\n\t var blockSizeBytes = blockSize * 4;\n\n\t // Count padding bytes\n\t var nPaddingBytes = blockSizeBytes - data.sigBytes % blockSizeBytes;\n\n\t // Create padding word\n\t var paddingWord = (nPaddingBytes << 24) | (nPaddingBytes << 16) | (nPaddingBytes << 8) | nPaddingBytes;\n\n\t // Create padding\n\t var paddingWords = [];\n\t for (var i = 0; i < nPaddingBytes; i += 4) {\n\t paddingWords.push(paddingWord);\n\t }\n\t var padding = WordArray.create(paddingWords, nPaddingBytes);\n\n\t // Add padding\n\t data.concat(padding);\n\t },\n\n\t /**\n\t * Unpads data that had been padded using the algorithm defined in PKCS #5/7.\n\t *\n\t * @param {WordArray} data The data to unpad.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * CryptoJS.pad.Pkcs7.unpad(wordArray);\n\t */\n\t unpad: function (data) {\n\t // Get number of padding bytes from last byte\n\t var nPaddingBytes = data.words[(data.sigBytes - 1) >>> 2] & 0xff;\n\n\t // Remove padding\n\t data.sigBytes -= nPaddingBytes;\n\t }\n\t };\n\n\t /**\n\t * Abstract base block cipher template.\n\t *\n\t * @property {number} blockSize The number of 32-bit words this cipher operates on. Default: 4 (128 bits)\n\t */\n\t var BlockCipher = C_lib.BlockCipher = Cipher.extend({\n\t /**\n\t * Configuration options.\n\t *\n\t * @property {Mode} mode The block mode to use. Default: CBC\n\t * @property {Padding} padding The padding strategy to use. Default: Pkcs7\n\t */\n\t cfg: Cipher.cfg.extend({\n\t mode: CBC,\n\t padding: Pkcs7\n\t }),\n\n\t reset: function () {\n\t var modeCreator;\n\n\t // Reset cipher\n\t Cipher.reset.call(this);\n\n\t // Shortcuts\n\t var cfg = this.cfg;\n\t var iv = cfg.iv;\n\t var mode = cfg.mode;\n\n\t // Reset block mode\n\t if (this._xformMode == this._ENC_XFORM_MODE) {\n\t modeCreator = mode.createEncryptor;\n\t } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ {\n\t modeCreator = mode.createDecryptor;\n\t // Keep at least one block in the buffer for unpadding\n\t this._minBufferSize = 1;\n\t }\n\n\t if (this._mode && this._mode.__creator == modeCreator) {\n\t this._mode.init(this, iv && iv.words);\n\t } else {\n\t this._mode = modeCreator.call(mode, this, iv && iv.words);\n\t this._mode.__creator = modeCreator;\n\t }\n\t },\n\n\t _doProcessBlock: function (words, offset) {\n\t this._mode.processBlock(words, offset);\n\t },\n\n\t _doFinalize: function () {\n\t var finalProcessedBlocks;\n\n\t // Shortcut\n\t var padding = this.cfg.padding;\n\n\t // Finalize\n\t if (this._xformMode == this._ENC_XFORM_MODE) {\n\t // Pad data\n\t padding.pad(this._data, this.blockSize);\n\n\t // Process final blocks\n\t finalProcessedBlocks = this._process(!!'flush');\n\t } else /* if (this._xformMode == this._DEC_XFORM_MODE) */ {\n\t // Process final blocks\n\t finalProcessedBlocks = this._process(!!'flush');\n\n\t // Unpad data\n\t padding.unpad(finalProcessedBlocks);\n\t }\n\n\t return finalProcessedBlocks;\n\t },\n\n\t blockSize: 128/32\n\t });\n\n\t /**\n\t * A collection of cipher parameters.\n\t *\n\t * @property {WordArray} ciphertext The raw ciphertext.\n\t * @property {WordArray} key The key to this ciphertext.\n\t * @property {WordArray} iv The IV used in the ciphering operation.\n\t * @property {WordArray} salt The salt used with a key derivation function.\n\t * @property {Cipher} algorithm The cipher algorithm.\n\t * @property {Mode} mode The block mode used in the ciphering operation.\n\t * @property {Padding} padding The padding scheme used in the ciphering operation.\n\t * @property {number} blockSize The block size of the cipher.\n\t * @property {Format} formatter The default formatting strategy to convert this cipher params object to a string.\n\t */\n\t var CipherParams = C_lib.CipherParams = Base.extend({\n\t /**\n\t * Initializes a newly created cipher params object.\n\t *\n\t * @param {Object} cipherParams An object with any of the possible cipher parameters.\n\t *\n\t * @example\n\t *\n\t * var cipherParams = CryptoJS.lib.CipherParams.create({\n\t * ciphertext: ciphertextWordArray,\n\t * key: keyWordArray,\n\t * iv: ivWordArray,\n\t * salt: saltWordArray,\n\t * algorithm: CryptoJS.algo.AES,\n\t * mode: CryptoJS.mode.CBC,\n\t * padding: CryptoJS.pad.PKCS7,\n\t * blockSize: 4,\n\t * formatter: CryptoJS.format.OpenSSL\n\t * });\n\t */\n\t init: function (cipherParams) {\n\t this.mixIn(cipherParams);\n\t },\n\n\t /**\n\t * Converts this cipher params object to a string.\n\t *\n\t * @param {Format} formatter (Optional) The formatting strategy to use.\n\t *\n\t * @return {string} The stringified cipher params.\n\t *\n\t * @throws Error If neither the formatter nor the default formatter is set.\n\t *\n\t * @example\n\t *\n\t * var string = cipherParams + '';\n\t * var string = cipherParams.toString();\n\t * var string = cipherParams.toString(CryptoJS.format.OpenSSL);\n\t */\n\t toString: function (formatter) {\n\t return (formatter || this.formatter).stringify(this);\n\t }\n\t });\n\n\t /**\n\t * Format namespace.\n\t */\n\t var C_format = C.format = {};\n\n\t /**\n\t * OpenSSL formatting strategy.\n\t */\n\t var OpenSSLFormatter = C_format.OpenSSL = {\n\t /**\n\t * Converts a cipher params object to an OpenSSL-compatible string.\n\t *\n\t * @param {CipherParams} cipherParams The cipher params object.\n\t *\n\t * @return {string} The OpenSSL-compatible string.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var openSSLString = CryptoJS.format.OpenSSL.stringify(cipherParams);\n\t */\n\t stringify: function (cipherParams) {\n\t var wordArray;\n\n\t // Shortcuts\n\t var ciphertext = cipherParams.ciphertext;\n\t var salt = cipherParams.salt;\n\n\t // Format\n\t if (salt) {\n\t wordArray = WordArray.create([0x53616c74, 0x65645f5f]).concat(salt).concat(ciphertext);\n\t } else {\n\t wordArray = ciphertext;\n\t }\n\n\t return wordArray.toString(Base64);\n\t },\n\n\t /**\n\t * Converts an OpenSSL-compatible string to a cipher params object.\n\t *\n\t * @param {string} openSSLStr The OpenSSL-compatible string.\n\t *\n\t * @return {CipherParams} The cipher params object.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var cipherParams = CryptoJS.format.OpenSSL.parse(openSSLString);\n\t */\n\t parse: function (openSSLStr) {\n\t var salt;\n\n\t // Parse base64\n\t var ciphertext = Base64.parse(openSSLStr);\n\n\t // Shortcut\n\t var ciphertextWords = ciphertext.words;\n\n\t // Test for salt\n\t if (ciphertextWords[0] == 0x53616c74 && ciphertextWords[1] == 0x65645f5f) {\n\t // Extract salt\n\t salt = WordArray.create(ciphertextWords.slice(2, 4));\n\n\t // Remove salt from ciphertext\n\t ciphertextWords.splice(0, 4);\n\t ciphertext.sigBytes -= 16;\n\t }\n\n\t return CipherParams.create({ ciphertext: ciphertext, salt: salt });\n\t }\n\t };\n\n\t /**\n\t * A cipher wrapper that returns ciphertext as a serializable cipher params object.\n\t */\n\t var SerializableCipher = C_lib.SerializableCipher = Base.extend({\n\t /**\n\t * Configuration options.\n\t *\n\t * @property {Formatter} format The formatting strategy to convert cipher param objects to and from a string. Default: OpenSSL\n\t */\n\t cfg: Base.extend({\n\t format: OpenSSLFormatter\n\t }),\n\n\t /**\n\t * Encrypts a message.\n\t *\n\t * @param {Cipher} cipher The cipher algorithm to use.\n\t * @param {WordArray|string} message The message to encrypt.\n\t * @param {WordArray} key The key.\n\t * @param {Object} cfg (Optional) The configuration options to use for this operation.\n\t *\n\t * @return {CipherParams} A cipher params object.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key);\n\t * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv });\n\t * var ciphertextParams = CryptoJS.lib.SerializableCipher.encrypt(CryptoJS.algo.AES, message, key, { iv: iv, format: CryptoJS.format.OpenSSL });\n\t */\n\t encrypt: function (cipher, message, key, cfg) {\n\t // Apply config defaults\n\t cfg = this.cfg.extend(cfg);\n\n\t // Encrypt\n\t var encryptor = cipher.createEncryptor(key, cfg);\n\t var ciphertext = encryptor.finalize(message);\n\n\t // Shortcut\n\t var cipherCfg = encryptor.cfg;\n\n\t // Create and return serializable cipher params\n\t return CipherParams.create({\n\t ciphertext: ciphertext,\n\t key: key,\n\t iv: cipherCfg.iv,\n\t algorithm: cipher,\n\t mode: cipherCfg.mode,\n\t padding: cipherCfg.padding,\n\t blockSize: cipher.blockSize,\n\t formatter: cfg.format\n\t });\n\t },\n\n\t /**\n\t * Decrypts serialized ciphertext.\n\t *\n\t * @param {Cipher} cipher The cipher algorithm to use.\n\t * @param {CipherParams|string} ciphertext The ciphertext to decrypt.\n\t * @param {WordArray} key The key.\n\t * @param {Object} cfg (Optional) The configuration options to use for this operation.\n\t *\n\t * @return {WordArray} The plaintext.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, key, { iv: iv, format: CryptoJS.format.OpenSSL });\n\t * var plaintext = CryptoJS.lib.SerializableCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, key, { iv: iv, format: CryptoJS.format.OpenSSL });\n\t */\n\t decrypt: function (cipher, ciphertext, key, cfg) {\n\t // Apply config defaults\n\t cfg = this.cfg.extend(cfg);\n\n\t // Convert string to CipherParams\n\t ciphertext = this._parse(ciphertext, cfg.format);\n\n\t // Decrypt\n\t var plaintext = cipher.createDecryptor(key, cfg).finalize(ciphertext.ciphertext);\n\n\t return plaintext;\n\t },\n\n\t /**\n\t * Converts serialized ciphertext to CipherParams,\n\t * else assumed CipherParams already and returns ciphertext unchanged.\n\t *\n\t * @param {CipherParams|string} ciphertext The ciphertext.\n\t * @param {Formatter} format The formatting strategy to use to parse serialized ciphertext.\n\t *\n\t * @return {CipherParams} The unserialized ciphertext.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var ciphertextParams = CryptoJS.lib.SerializableCipher._parse(ciphertextStringOrParams, format);\n\t */\n\t _parse: function (ciphertext, format) {\n\t if (typeof ciphertext == 'string') {\n\t return format.parse(ciphertext, this);\n\t } else {\n\t return ciphertext;\n\t }\n\t }\n\t });\n\n\t /**\n\t * Key derivation function namespace.\n\t */\n\t var C_kdf = C.kdf = {};\n\n\t /**\n\t * OpenSSL key derivation function.\n\t */\n\t var OpenSSLKdf = C_kdf.OpenSSL = {\n\t /**\n\t * Derives a key and IV from a password.\n\t *\n\t * @param {string} password The password to derive from.\n\t * @param {number} keySize The size in words of the key to generate.\n\t * @param {number} ivSize The size in words of the IV to generate.\n\t * @param {WordArray|string} salt (Optional) A 64-bit salt to use. If omitted, a salt will be generated randomly.\n\t *\n\t * @return {CipherParams} A cipher params object with the key, IV, and salt.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32);\n\t * var derivedParams = CryptoJS.kdf.OpenSSL.execute('Password', 256/32, 128/32, 'saltsalt');\n\t */\n\t execute: function (password, keySize, ivSize, salt) {\n\t // Generate random salt\n\t if (!salt) {\n\t salt = WordArray.random(64/8);\n\t }\n\n\t // Derive key and IV\n\t var key = EvpKDF.create({ keySize: keySize + ivSize }).compute(password, salt);\n\n\t // Separate key and IV\n\t var iv = WordArray.create(key.words.slice(keySize), ivSize * 4);\n\t key.sigBytes = keySize * 4;\n\n\t // Return params\n\t return CipherParams.create({ key: key, iv: iv, salt: salt });\n\t }\n\t };\n\n\t /**\n\t * A serializable cipher wrapper that derives the key from a password,\n\t * and returns ciphertext as a serializable cipher params object.\n\t */\n\t var PasswordBasedCipher = C_lib.PasswordBasedCipher = SerializableCipher.extend({\n\t /**\n\t * Configuration options.\n\t *\n\t * @property {KDF} kdf The key derivation function to use to generate a key and IV from a password. Default: OpenSSL\n\t */\n\t cfg: SerializableCipher.cfg.extend({\n\t kdf: OpenSSLKdf\n\t }),\n\n\t /**\n\t * Encrypts a message using a password.\n\t *\n\t * @param {Cipher} cipher The cipher algorithm to use.\n\t * @param {WordArray|string} message The message to encrypt.\n\t * @param {string} password The password.\n\t * @param {Object} cfg (Optional) The configuration options to use for this operation.\n\t *\n\t * @return {CipherParams} A cipher params object.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password');\n\t * var ciphertextParams = CryptoJS.lib.PasswordBasedCipher.encrypt(CryptoJS.algo.AES, message, 'password', { format: CryptoJS.format.OpenSSL });\n\t */\n\t encrypt: function (cipher, message, password, cfg) {\n\t // Apply config defaults\n\t cfg = this.cfg.extend(cfg);\n\n\t // Derive key and other params\n\t var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize);\n\n\t // Add IV to config\n\t cfg.iv = derivedParams.iv;\n\n\t // Encrypt\n\t var ciphertext = SerializableCipher.encrypt.call(this, cipher, message, derivedParams.key, cfg);\n\n\t // Mix in derived params\n\t ciphertext.mixIn(derivedParams);\n\n\t return ciphertext;\n\t },\n\n\t /**\n\t * Decrypts serialized ciphertext using a password.\n\t *\n\t * @param {Cipher} cipher The cipher algorithm to use.\n\t * @param {CipherParams|string} ciphertext The ciphertext to decrypt.\n\t * @param {string} password The password.\n\t * @param {Object} cfg (Optional) The configuration options to use for this operation.\n\t *\n\t * @return {WordArray} The plaintext.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, formattedCiphertext, 'password', { format: CryptoJS.format.OpenSSL });\n\t * var plaintext = CryptoJS.lib.PasswordBasedCipher.decrypt(CryptoJS.algo.AES, ciphertextParams, 'password', { format: CryptoJS.format.OpenSSL });\n\t */\n\t decrypt: function (cipher, ciphertext, password, cfg) {\n\t // Apply config defaults\n\t cfg = this.cfg.extend(cfg);\n\n\t // Convert string to CipherParams\n\t ciphertext = this._parse(ciphertext, cfg.format);\n\n\t // Derive key and other params\n\t var derivedParams = cfg.kdf.execute(password, cipher.keySize, cipher.ivSize, ciphertext.salt);\n\n\t // Add IV to config\n\t cfg.iv = derivedParams.iv;\n\n\t // Decrypt\n\t var plaintext = SerializableCipher.decrypt.call(this, cipher, ciphertext, derivedParams.key, cfg);\n\n\t return plaintext;\n\t }\n\t });\n\t}());\n\n\n}));",";(function (root, factory) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory();\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\troot.CryptoJS = factory();\n\t}\n}(this, function () {\n\n\t/*globals window, global, require*/\n\n\t/**\n\t * CryptoJS core components.\n\t */\n\tvar CryptoJS = CryptoJS || (function (Math, undefined) {\n\n\t var crypto;\n\n\t // Native crypto from window (Browser)\n\t if (typeof window !== 'undefined' && window.crypto) {\n\t crypto = window.crypto;\n\t }\n\n\t // Native crypto in web worker (Browser)\n\t if (typeof self !== 'undefined' && self.crypto) {\n\t crypto = self.crypto;\n\t }\n\n\t // Native crypto from worker\n\t if (typeof globalThis !== 'undefined' && globalThis.crypto) {\n\t crypto = globalThis.crypto;\n\t }\n\n\t // Native (experimental IE 11) crypto from window (Browser)\n\t if (!crypto && typeof window !== 'undefined' && window.msCrypto) {\n\t crypto = window.msCrypto;\n\t }\n\n\t // Native crypto from global (NodeJS)\n\t if (!crypto && typeof global !== 'undefined' && global.crypto) {\n\t crypto = global.crypto;\n\t }\n\n\t // Native crypto import via require (NodeJS)\n\t if (!crypto && typeof require === 'function') {\n\t try {\n\t crypto = require('crypto');\n\t } catch (err) {}\n\t }\n\n\t /*\n\t * Cryptographically secure pseudorandom number generator\n\t *\n\t * As Math.random() is cryptographically not safe to use\n\t */\n\t var cryptoSecureRandomInt = function () {\n\t if (crypto) {\n\t // Use getRandomValues method (Browser)\n\t if (typeof crypto.getRandomValues === 'function') {\n\t try {\n\t return crypto.getRandomValues(new Uint32Array(1))[0];\n\t } catch (err) {}\n\t }\n\n\t // Use randomBytes method (NodeJS)\n\t if (typeof crypto.randomBytes === 'function') {\n\t try {\n\t return crypto.randomBytes(4).readInt32LE();\n\t } catch (err) {}\n\t }\n\t }\n\n\t throw new Error('Native crypto module could not be used to get secure random number.');\n\t };\n\n\t /*\n\t * Local polyfill of Object.create\n\n\t */\n\t var create = Object.create || (function () {\n\t function F() {}\n\n\t return function (obj) {\n\t var subtype;\n\n\t F.prototype = obj;\n\n\t subtype = new F();\n\n\t F.prototype = null;\n\n\t return subtype;\n\t };\n\t }());\n\n\t /**\n\t * CryptoJS namespace.\n\t */\n\t var C = {};\n\n\t /**\n\t * Library namespace.\n\t */\n\t var C_lib = C.lib = {};\n\n\t /**\n\t * Base object for prototypal inheritance.\n\t */\n\t var Base = C_lib.Base = (function () {\n\n\n\t return {\n\t /**\n\t * Creates a new object that inherits from this object.\n\t *\n\t * @param {Object} overrides Properties to copy into the new object.\n\t *\n\t * @return {Object} The new object.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var MyType = CryptoJS.lib.Base.extend({\n\t * field: 'value',\n\t *\n\t * method: function () {\n\t * }\n\t * });\n\t */\n\t extend: function (overrides) {\n\t // Spawn\n\t var subtype = create(this);\n\n\t // Augment\n\t if (overrides) {\n\t subtype.mixIn(overrides);\n\t }\n\n\t // Create default initializer\n\t if (!subtype.hasOwnProperty('init') || this.init === subtype.init) {\n\t subtype.init = function () {\n\t subtype.$super.init.apply(this, arguments);\n\t };\n\t }\n\n\t // Initializer's prototype is the subtype object\n\t subtype.init.prototype = subtype;\n\n\t // Reference supertype\n\t subtype.$super = this;\n\n\t return subtype;\n\t },\n\n\t /**\n\t * Extends this object and runs the init method.\n\t * Arguments to create() will be passed to init().\n\t *\n\t * @return {Object} The new object.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var instance = MyType.create();\n\t */\n\t create: function () {\n\t var instance = this.extend();\n\t instance.init.apply(instance, arguments);\n\n\t return instance;\n\t },\n\n\t /**\n\t * Initializes a newly created object.\n\t * Override this method to add some logic when your objects are created.\n\t *\n\t * @example\n\t *\n\t * var MyType = CryptoJS.lib.Base.extend({\n\t * init: function () {\n\t * // ...\n\t * }\n\t * });\n\t */\n\t init: function () {\n\t },\n\n\t /**\n\t * Copies properties into this object.\n\t *\n\t * @param {Object} properties The properties to mix in.\n\t *\n\t * @example\n\t *\n\t * MyType.mixIn({\n\t * field: 'value'\n\t * });\n\t */\n\t mixIn: function (properties) {\n\t for (var propertyName in properties) {\n\t if (properties.hasOwnProperty(propertyName)) {\n\t this[propertyName] = properties[propertyName];\n\t }\n\t }\n\n\t // IE won't copy toString using the loop above\n\t if (properties.hasOwnProperty('toString')) {\n\t this.toString = properties.toString;\n\t }\n\t },\n\n\t /**\n\t * Creates a copy of this object.\n\t *\n\t * @return {Object} The clone.\n\t *\n\t * @example\n\t *\n\t * var clone = instance.clone();\n\t */\n\t clone: function () {\n\t return this.init.prototype.extend(this);\n\t }\n\t };\n\t }());\n\n\t /**\n\t * An array of 32-bit words.\n\t *\n\t * @property {Array} words The array of 32-bit words.\n\t * @property {number} sigBytes The number of significant bytes in this word array.\n\t */\n\t var WordArray = C_lib.WordArray = Base.extend({\n\t /**\n\t * Initializes a newly created word array.\n\t *\n\t * @param {Array} words (Optional) An array of 32-bit words.\n\t * @param {number} sigBytes (Optional) The number of significant bytes in the words.\n\t *\n\t * @example\n\t *\n\t * var wordArray = CryptoJS.lib.WordArray.create();\n\t * var wordArray = CryptoJS.lib.WordArray.create([0x00010203, 0x04050607]);\n\t * var wordArray = CryptoJS.lib.WordArray.create([0x00010203, 0x04050607], 6);\n\t */\n\t init: function (words, sigBytes) {\n\t words = this.words = words || [];\n\n\t if (sigBytes != undefined) {\n\t this.sigBytes = sigBytes;\n\t } else {\n\t this.sigBytes = words.length * 4;\n\t }\n\t },\n\n\t /**\n\t * Converts this word array to a string.\n\t *\n\t * @param {Encoder} encoder (Optional) The encoding strategy to use. Default: CryptoJS.enc.Hex\n\t *\n\t * @return {string} The stringified word array.\n\t *\n\t * @example\n\t *\n\t * var string = wordArray + '';\n\t * var string = wordArray.toString();\n\t * var string = wordArray.toString(CryptoJS.enc.Utf8);\n\t */\n\t toString: function (encoder) {\n\t return (encoder || Hex).stringify(this);\n\t },\n\n\t /**\n\t * Concatenates a word array to this word array.\n\t *\n\t * @param {WordArray} wordArray The word array to append.\n\t *\n\t * @return {WordArray} This word array.\n\t *\n\t * @example\n\t *\n\t * wordArray1.concat(wordArray2);\n\t */\n\t concat: function (wordArray) {\n\t // Shortcuts\n\t var thisWords = this.words;\n\t var thatWords = wordArray.words;\n\t var thisSigBytes = this.sigBytes;\n\t var thatSigBytes = wordArray.sigBytes;\n\n\t // Clamp excess bits\n\t this.clamp();\n\n\t // Concat\n\t if (thisSigBytes % 4) {\n\t // Copy one byte at a time\n\t for (var i = 0; i < thatSigBytes; i++) {\n\t var thatByte = (thatWords[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff;\n\t thisWords[(thisSigBytes + i) >>> 2] |= thatByte << (24 - ((thisSigBytes + i) % 4) * 8);\n\t }\n\t } else {\n\t // Copy one word at a time\n\t for (var j = 0; j < thatSigBytes; j += 4) {\n\t thisWords[(thisSigBytes + j) >>> 2] = thatWords[j >>> 2];\n\t }\n\t }\n\t this.sigBytes += thatSigBytes;\n\n\t // Chainable\n\t return this;\n\t },\n\n\t /**\n\t * Removes insignificant bits.\n\t *\n\t * @example\n\t *\n\t * wordArray.clamp();\n\t */\n\t clamp: function () {\n\t // Shortcuts\n\t var words = this.words;\n\t var sigBytes = this.sigBytes;\n\n\t // Clamp\n\t words[sigBytes >>> 2] &= 0xffffffff << (32 - (sigBytes % 4) * 8);\n\t words.length = Math.ceil(sigBytes / 4);\n\t },\n\n\t /**\n\t * Creates a copy of this word array.\n\t *\n\t * @return {WordArray} The clone.\n\t *\n\t * @example\n\t *\n\t * var clone = wordArray.clone();\n\t */\n\t clone: function () {\n\t var clone = Base.clone.call(this);\n\t clone.words = this.words.slice(0);\n\n\t return clone;\n\t },\n\n\t /**\n\t * Creates a word array filled with random bytes.\n\t *\n\t * @param {number} nBytes The number of random bytes to generate.\n\t *\n\t * @return {WordArray} The random word array.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var wordArray = CryptoJS.lib.WordArray.random(16);\n\t */\n\t random: function (nBytes) {\n\t var words = [];\n\n\t for (var i = 0; i < nBytes; i += 4) {\n\t words.push(cryptoSecureRandomInt());\n\t }\n\n\t return new WordArray.init(words, nBytes);\n\t }\n\t });\n\n\t /**\n\t * Encoder namespace.\n\t */\n\t var C_enc = C.enc = {};\n\n\t /**\n\t * Hex encoding strategy.\n\t */\n\t var Hex = C_enc.Hex = {\n\t /**\n\t * Converts a word array to a hex string.\n\t *\n\t * @param {WordArray} wordArray The word array.\n\t *\n\t * @return {string} The hex string.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hexString = CryptoJS.enc.Hex.stringify(wordArray);\n\t */\n\t stringify: function (wordArray) {\n\t // Shortcuts\n\t var words = wordArray.words;\n\t var sigBytes = wordArray.sigBytes;\n\n\t // Convert\n\t var hexChars = [];\n\t for (var i = 0; i < sigBytes; i++) {\n\t var bite = (words[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff;\n\t hexChars.push((bite >>> 4).toString(16));\n\t hexChars.push((bite & 0x0f).toString(16));\n\t }\n\n\t return hexChars.join('');\n\t },\n\n\t /**\n\t * Converts a hex string to a word array.\n\t *\n\t * @param {string} hexStr The hex string.\n\t *\n\t * @return {WordArray} The word array.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var wordArray = CryptoJS.enc.Hex.parse(hexString);\n\t */\n\t parse: function (hexStr) {\n\t // Shortcut\n\t var hexStrLength = hexStr.length;\n\n\t // Convert\n\t var words = [];\n\t for (var i = 0; i < hexStrLength; i += 2) {\n\t words[i >>> 3] |= parseInt(hexStr.substr(i, 2), 16) << (24 - (i % 8) * 4);\n\t }\n\n\t return new WordArray.init(words, hexStrLength / 2);\n\t }\n\t };\n\n\t /**\n\t * Latin1 encoding strategy.\n\t */\n\t var Latin1 = C_enc.Latin1 = {\n\t /**\n\t * Converts a word array to a Latin1 string.\n\t *\n\t * @param {WordArray} wordArray The word array.\n\t *\n\t * @return {string} The Latin1 string.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var latin1String = CryptoJS.enc.Latin1.stringify(wordArray);\n\t */\n\t stringify: function (wordArray) {\n\t // Shortcuts\n\t var words = wordArray.words;\n\t var sigBytes = wordArray.sigBytes;\n\n\t // Convert\n\t var latin1Chars = [];\n\t for (var i = 0; i < sigBytes; i++) {\n\t var bite = (words[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff;\n\t latin1Chars.push(String.fromCharCode(bite));\n\t }\n\n\t return latin1Chars.join('');\n\t },\n\n\t /**\n\t * Converts a Latin1 string to a word array.\n\t *\n\t * @param {string} latin1Str The Latin1 string.\n\t *\n\t * @return {WordArray} The word array.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var wordArray = CryptoJS.enc.Latin1.parse(latin1String);\n\t */\n\t parse: function (latin1Str) {\n\t // Shortcut\n\t var latin1StrLength = latin1Str.length;\n\n\t // Convert\n\t var words = [];\n\t for (var i = 0; i < latin1StrLength; i++) {\n\t words[i >>> 2] |= (latin1Str.charCodeAt(i) & 0xff) << (24 - (i % 4) * 8);\n\t }\n\n\t return new WordArray.init(words, latin1StrLength);\n\t }\n\t };\n\n\t /**\n\t * UTF-8 encoding strategy.\n\t */\n\t var Utf8 = C_enc.Utf8 = {\n\t /**\n\t * Converts a word array to a UTF-8 string.\n\t *\n\t * @param {WordArray} wordArray The word array.\n\t *\n\t * @return {string} The UTF-8 string.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var utf8String = CryptoJS.enc.Utf8.stringify(wordArray);\n\t */\n\t stringify: function (wordArray) {\n\t try {\n\t return decodeURIComponent(escape(Latin1.stringify(wordArray)));\n\t } catch (e) {\n\t throw new Error('Malformed UTF-8 data');\n\t }\n\t },\n\n\t /**\n\t * Converts a UTF-8 string to a word array.\n\t *\n\t * @param {string} utf8Str The UTF-8 string.\n\t *\n\t * @return {WordArray} The word array.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var wordArray = CryptoJS.enc.Utf8.parse(utf8String);\n\t */\n\t parse: function (utf8Str) {\n\t return Latin1.parse(unescape(encodeURIComponent(utf8Str)));\n\t }\n\t };\n\n\t /**\n\t * Abstract buffered block algorithm template.\n\t *\n\t * The property blockSize must be implemented in a concrete subtype.\n\t *\n\t * @property {number} _minBufferSize The number of blocks that should be kept unprocessed in the buffer. Default: 0\n\t */\n\t var BufferedBlockAlgorithm = C_lib.BufferedBlockAlgorithm = Base.extend({\n\t /**\n\t * Resets this block algorithm's data buffer to its initial state.\n\t *\n\t * @example\n\t *\n\t * bufferedBlockAlgorithm.reset();\n\t */\n\t reset: function () {\n\t // Initial values\n\t this._data = new WordArray.init();\n\t this._nDataBytes = 0;\n\t },\n\n\t /**\n\t * Adds new data to this block algorithm's buffer.\n\t *\n\t * @param {WordArray|string} data The data to append. Strings are converted to a WordArray using UTF-8.\n\t *\n\t * @example\n\t *\n\t * bufferedBlockAlgorithm._append('data');\n\t * bufferedBlockAlgorithm._append(wordArray);\n\t */\n\t _append: function (data) {\n\t // Convert string to WordArray, else assume WordArray already\n\t if (typeof data == 'string') {\n\t data = Utf8.parse(data);\n\t }\n\n\t // Append\n\t this._data.concat(data);\n\t this._nDataBytes += data.sigBytes;\n\t },\n\n\t /**\n\t * Processes available data blocks.\n\t *\n\t * This method invokes _doProcessBlock(offset), which must be implemented by a concrete subtype.\n\t *\n\t * @param {boolean} doFlush Whether all blocks and partial blocks should be processed.\n\t *\n\t * @return {WordArray} The processed data.\n\t *\n\t * @example\n\t *\n\t * var processedData = bufferedBlockAlgorithm._process();\n\t * var processedData = bufferedBlockAlgorithm._process(!!'flush');\n\t */\n\t _process: function (doFlush) {\n\t var processedWords;\n\n\t // Shortcuts\n\t var data = this._data;\n\t var dataWords = data.words;\n\t var dataSigBytes = data.sigBytes;\n\t var blockSize = this.blockSize;\n\t var blockSizeBytes = blockSize * 4;\n\n\t // Count blocks ready\n\t var nBlocksReady = dataSigBytes / blockSizeBytes;\n\t if (doFlush) {\n\t // Round up to include partial blocks\n\t nBlocksReady = Math.ceil(nBlocksReady);\n\t } else {\n\t // Round down to include only full blocks,\n\t // less the number of blocks that must remain in the buffer\n\t nBlocksReady = Math.max((nBlocksReady | 0) - this._minBufferSize, 0);\n\t }\n\n\t // Count words ready\n\t var nWordsReady = nBlocksReady * blockSize;\n\n\t // Count bytes ready\n\t var nBytesReady = Math.min(nWordsReady * 4, dataSigBytes);\n\n\t // Process blocks\n\t if (nWordsReady) {\n\t for (var offset = 0; offset < nWordsReady; offset += blockSize) {\n\t // Perform concrete-algorithm logic\n\t this._doProcessBlock(dataWords, offset);\n\t }\n\n\t // Remove processed words\n\t processedWords = dataWords.splice(0, nWordsReady);\n\t data.sigBytes -= nBytesReady;\n\t }\n\n\t // Return processed words\n\t return new WordArray.init(processedWords, nBytesReady);\n\t },\n\n\t /**\n\t * Creates a copy of this object.\n\t *\n\t * @return {Object} The clone.\n\t *\n\t * @example\n\t *\n\t * var clone = bufferedBlockAlgorithm.clone();\n\t */\n\t clone: function () {\n\t var clone = Base.clone.call(this);\n\t clone._data = this._data.clone();\n\n\t return clone;\n\t },\n\n\t _minBufferSize: 0\n\t });\n\n\t /**\n\t * Abstract hasher template.\n\t *\n\t * @property {number} blockSize The number of 32-bit words this hasher operates on. Default: 16 (512 bits)\n\t */\n\t var Hasher = C_lib.Hasher = BufferedBlockAlgorithm.extend({\n\t /**\n\t * Configuration options.\n\t */\n\t cfg: Base.extend(),\n\n\t /**\n\t * Initializes a newly created hasher.\n\t *\n\t * @param {Object} cfg (Optional) The configuration options to use for this hash computation.\n\t *\n\t * @example\n\t *\n\t * var hasher = CryptoJS.algo.SHA256.create();\n\t */\n\t init: function (cfg) {\n\t // Apply config defaults\n\t this.cfg = this.cfg.extend(cfg);\n\n\t // Set initial values\n\t this.reset();\n\t },\n\n\t /**\n\t * Resets this hasher to its initial state.\n\t *\n\t * @example\n\t *\n\t * hasher.reset();\n\t */\n\t reset: function () {\n\t // Reset data buffer\n\t BufferedBlockAlgorithm.reset.call(this);\n\n\t // Perform concrete-hasher logic\n\t this._doReset();\n\t },\n\n\t /**\n\t * Updates this hasher with a message.\n\t *\n\t * @param {WordArray|string} messageUpdate The message to append.\n\t *\n\t * @return {Hasher} This hasher.\n\t *\n\t * @example\n\t *\n\t * hasher.update('message');\n\t * hasher.update(wordArray);\n\t */\n\t update: function (messageUpdate) {\n\t // Append\n\t this._append(messageUpdate);\n\n\t // Update the hash\n\t this._process();\n\n\t // Chainable\n\t return this;\n\t },\n\n\t /**\n\t * Finalizes the hash computation.\n\t * Note that the finalize operation is effectively a destructive, read-once operation.\n\t *\n\t * @param {WordArray|string} messageUpdate (Optional) A final message update.\n\t *\n\t * @return {WordArray} The hash.\n\t *\n\t * @example\n\t *\n\t * var hash = hasher.finalize();\n\t * var hash = hasher.finalize('message');\n\t * var hash = hasher.finalize(wordArray);\n\t */\n\t finalize: function (messageUpdate) {\n\t // Final message update\n\t if (messageUpdate) {\n\t this._append(messageUpdate);\n\t }\n\n\t // Perform concrete-hasher logic\n\t var hash = this._doFinalize();\n\n\t return hash;\n\t },\n\n\t blockSize: 512/32,\n\n\t /**\n\t * Creates a shortcut function to a hasher's object interface.\n\t *\n\t * @param {Hasher} hasher The hasher to create a helper for.\n\t *\n\t * @return {Function} The shortcut function.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var SHA256 = CryptoJS.lib.Hasher._createHelper(CryptoJS.algo.SHA256);\n\t */\n\t _createHelper: function (hasher) {\n\t return function (message, cfg) {\n\t return new hasher.init(cfg).finalize(message);\n\t };\n\t },\n\n\t /**\n\t * Creates a shortcut function to the HMAC's object interface.\n\t *\n\t * @param {Hasher} hasher The hasher to use in this HMAC helper.\n\t *\n\t * @return {Function} The shortcut function.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var HmacSHA256 = CryptoJS.lib.Hasher._createHmacHelper(CryptoJS.algo.SHA256);\n\t */\n\t _createHmacHelper: function (hasher) {\n\t return function (message, key) {\n\t return new C_algo.HMAC.init(hasher, key).finalize(message);\n\t };\n\t }\n\t });\n\n\t /**\n\t * Algorithm namespace.\n\t */\n\t var C_algo = C.algo = {};\n\n\t return C;\n\t}(Math));\n\n\n\treturn CryptoJS;\n\n}));",";(function (root, factory) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var WordArray = C_lib.WordArray;\n\t var C_enc = C.enc;\n\n\t /**\n\t * Base64 encoding strategy.\n\t */\n\t var Base64 = C_enc.Base64 = {\n\t /**\n\t * Converts a word array to a Base64 string.\n\t *\n\t * @param {WordArray} wordArray The word array.\n\t *\n\t * @return {string} The Base64 string.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var base64String = CryptoJS.enc.Base64.stringify(wordArray);\n\t */\n\t stringify: function (wordArray) {\n\t // Shortcuts\n\t var words = wordArray.words;\n\t var sigBytes = wordArray.sigBytes;\n\t var map = this._map;\n\n\t // Clamp excess bits\n\t wordArray.clamp();\n\n\t // Convert\n\t var base64Chars = [];\n\t for (var i = 0; i < sigBytes; i += 3) {\n\t var byte1 = (words[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff;\n\t var byte2 = (words[(i + 1) >>> 2] >>> (24 - ((i + 1) % 4) * 8)) & 0xff;\n\t var byte3 = (words[(i + 2) >>> 2] >>> (24 - ((i + 2) % 4) * 8)) & 0xff;\n\n\t var triplet = (byte1 << 16) | (byte2 << 8) | byte3;\n\n\t for (var j = 0; (j < 4) && (i + j * 0.75 < sigBytes); j++) {\n\t base64Chars.push(map.charAt((triplet >>> (6 * (3 - j))) & 0x3f));\n\t }\n\t }\n\n\t // Add padding\n\t var paddingChar = map.charAt(64);\n\t if (paddingChar) {\n\t while (base64Chars.length % 4) {\n\t base64Chars.push(paddingChar);\n\t }\n\t }\n\n\t return base64Chars.join('');\n\t },\n\n\t /**\n\t * Converts a Base64 string to a word array.\n\t *\n\t * @param {string} base64Str The Base64 string.\n\t *\n\t * @return {WordArray} The word array.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var wordArray = CryptoJS.enc.Base64.parse(base64String);\n\t */\n\t parse: function (base64Str) {\n\t // Shortcuts\n\t var base64StrLength = base64Str.length;\n\t var map = this._map;\n\t var reverseMap = this._reverseMap;\n\n\t if (!reverseMap) {\n\t reverseMap = this._reverseMap = [];\n\t for (var j = 0; j < map.length; j++) {\n\t reverseMap[map.charCodeAt(j)] = j;\n\t }\n\t }\n\n\t // Ignore padding\n\t var paddingChar = map.charAt(64);\n\t if (paddingChar) {\n\t var paddingIndex = base64Str.indexOf(paddingChar);\n\t if (paddingIndex !== -1) {\n\t base64StrLength = paddingIndex;\n\t }\n\t }\n\n\t // Convert\n\t return parseLoop(base64Str, base64StrLength, reverseMap);\n\n\t },\n\n\t _map: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/='\n\t };\n\n\t function parseLoop(base64Str, base64StrLength, reverseMap) {\n\t var words = [];\n\t var nBytes = 0;\n\t for (var i = 0; i < base64StrLength; i++) {\n\t if (i % 4) {\n\t var bits1 = reverseMap[base64Str.charCodeAt(i - 1)] << ((i % 4) * 2);\n\t var bits2 = reverseMap[base64Str.charCodeAt(i)] >>> (6 - (i % 4) * 2);\n\t var bitsCombined = bits1 | bits2;\n\t words[nBytes >>> 2] |= bitsCombined << (24 - (nBytes % 4) * 8);\n\t nBytes++;\n\t }\n\t }\n\t return WordArray.create(words, nBytes);\n\t }\n\t}());\n\n\n\treturn CryptoJS.enc.Base64;\n\n}));",";(function (root, factory) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var WordArray = C_lib.WordArray;\n\t var C_enc = C.enc;\n\n\t /**\n\t * Base64url encoding strategy.\n\t */\n\t var Base64url = C_enc.Base64url = {\n\t /**\n\t * Converts a word array to a Base64url string.\n\t *\n\t * @param {WordArray} wordArray The word array.\n\t *\n\t * @param {boolean} urlSafe Whether to use url safe\n\t *\n\t * @return {string} The Base64url string.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var base64String = CryptoJS.enc.Base64url.stringify(wordArray);\n\t */\n\t stringify: function (wordArray, urlSafe=true) {\n\t // Shortcuts\n\t var words = wordArray.words;\n\t var sigBytes = wordArray.sigBytes;\n\t var map = urlSafe ? this._safe_map : this._map;\n\n\t // Clamp excess bits\n\t wordArray.clamp();\n\n\t // Convert\n\t var base64Chars = [];\n\t for (var i = 0; i < sigBytes; i += 3) {\n\t var byte1 = (words[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff;\n\t var byte2 = (words[(i + 1) >>> 2] >>> (24 - ((i + 1) % 4) * 8)) & 0xff;\n\t var byte3 = (words[(i + 2) >>> 2] >>> (24 - ((i + 2) % 4) * 8)) & 0xff;\n\n\t var triplet = (byte1 << 16) | (byte2 << 8) | byte3;\n\n\t for (var j = 0; (j < 4) && (i + j * 0.75 < sigBytes); j++) {\n\t base64Chars.push(map.charAt((triplet >>> (6 * (3 - j))) & 0x3f));\n\t }\n\t }\n\n\t // Add padding\n\t var paddingChar = map.charAt(64);\n\t if (paddingChar) {\n\t while (base64Chars.length % 4) {\n\t base64Chars.push(paddingChar);\n\t }\n\t }\n\n\t return base64Chars.join('');\n\t },\n\n\t /**\n\t * Converts a Base64url string to a word array.\n\t *\n\t * @param {string} base64Str The Base64url string.\n\t *\n\t * @param {boolean} urlSafe Whether to use url safe\n\t *\n\t * @return {WordArray} The word array.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var wordArray = CryptoJS.enc.Base64url.parse(base64String);\n\t */\n\t parse: function (base64Str, urlSafe=true) {\n\t // Shortcuts\n\t var base64StrLength = base64Str.length;\n\t var map = urlSafe ? this._safe_map : this._map;\n\t var reverseMap = this._reverseMap;\n\n\t if (!reverseMap) {\n\t reverseMap = this._reverseMap = [];\n\t for (var j = 0; j < map.length; j++) {\n\t reverseMap[map.charCodeAt(j)] = j;\n\t }\n\t }\n\n\t // Ignore padding\n\t var paddingChar = map.charAt(64);\n\t if (paddingChar) {\n\t var paddingIndex = base64Str.indexOf(paddingChar);\n\t if (paddingIndex !== -1) {\n\t base64StrLength = paddingIndex;\n\t }\n\t }\n\n\t // Convert\n\t return parseLoop(base64Str, base64StrLength, reverseMap);\n\n\t },\n\n\t _map: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=',\n\t _safe_map: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789-_',\n\t };\n\n\t function parseLoop(base64Str, base64StrLength, reverseMap) {\n\t var words = [];\n\t var nBytes = 0;\n\t for (var i = 0; i < base64StrLength; i++) {\n\t if (i % 4) {\n\t var bits1 = reverseMap[base64Str.charCodeAt(i - 1)] << ((i % 4) * 2);\n\t var bits2 = reverseMap[base64Str.charCodeAt(i)] >>> (6 - (i % 4) * 2);\n\t var bitsCombined = bits1 | bits2;\n\t words[nBytes >>> 2] |= bitsCombined << (24 - (nBytes % 4) * 8);\n\t nBytes++;\n\t }\n\t }\n\t return WordArray.create(words, nBytes);\n\t }\n\t}());\n\n\treturn CryptoJS.enc.Base64url;\n\n}));",";(function (root, factory) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var WordArray = C_lib.WordArray;\n\t var C_enc = C.enc;\n\n\t /**\n\t * UTF-16 BE encoding strategy.\n\t */\n\t var Utf16BE = C_enc.Utf16 = C_enc.Utf16BE = {\n\t /**\n\t * Converts a word array to a UTF-16 BE string.\n\t *\n\t * @param {WordArray} wordArray The word array.\n\t *\n\t * @return {string} The UTF-16 BE string.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var utf16String = CryptoJS.enc.Utf16.stringify(wordArray);\n\t */\n\t stringify: function (wordArray) {\n\t // Shortcuts\n\t var words = wordArray.words;\n\t var sigBytes = wordArray.sigBytes;\n\n\t // Convert\n\t var utf16Chars = [];\n\t for (var i = 0; i < sigBytes; i += 2) {\n\t var codePoint = (words[i >>> 2] >>> (16 - (i % 4) * 8)) & 0xffff;\n\t utf16Chars.push(String.fromCharCode(codePoint));\n\t }\n\n\t return utf16Chars.join('');\n\t },\n\n\t /**\n\t * Converts a UTF-16 BE string to a word array.\n\t *\n\t * @param {string} utf16Str The UTF-16 BE string.\n\t *\n\t * @return {WordArray} The word array.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var wordArray = CryptoJS.enc.Utf16.parse(utf16String);\n\t */\n\t parse: function (utf16Str) {\n\t // Shortcut\n\t var utf16StrLength = utf16Str.length;\n\n\t // Convert\n\t var words = [];\n\t for (var i = 0; i < utf16StrLength; i++) {\n\t words[i >>> 1] |= utf16Str.charCodeAt(i) << (16 - (i % 2) * 16);\n\t }\n\n\t return WordArray.create(words, utf16StrLength * 2);\n\t }\n\t };\n\n\t /**\n\t * UTF-16 LE encoding strategy.\n\t */\n\t C_enc.Utf16LE = {\n\t /**\n\t * Converts a word array to a UTF-16 LE string.\n\t *\n\t * @param {WordArray} wordArray The word array.\n\t *\n\t * @return {string} The UTF-16 LE string.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var utf16Str = CryptoJS.enc.Utf16LE.stringify(wordArray);\n\t */\n\t stringify: function (wordArray) {\n\t // Shortcuts\n\t var words = wordArray.words;\n\t var sigBytes = wordArray.sigBytes;\n\n\t // Convert\n\t var utf16Chars = [];\n\t for (var i = 0; i < sigBytes; i += 2) {\n\t var codePoint = swapEndian((words[i >>> 2] >>> (16 - (i % 4) * 8)) & 0xffff);\n\t utf16Chars.push(String.fromCharCode(codePoint));\n\t }\n\n\t return utf16Chars.join('');\n\t },\n\n\t /**\n\t * Converts a UTF-16 LE string to a word array.\n\t *\n\t * @param {string} utf16Str The UTF-16 LE string.\n\t *\n\t * @return {WordArray} The word array.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var wordArray = CryptoJS.enc.Utf16LE.parse(utf16Str);\n\t */\n\t parse: function (utf16Str) {\n\t // Shortcut\n\t var utf16StrLength = utf16Str.length;\n\n\t // Convert\n\t var words = [];\n\t for (var i = 0; i < utf16StrLength; i++) {\n\t words[i >>> 1] |= swapEndian(utf16Str.charCodeAt(i) << (16 - (i % 2) * 16));\n\t }\n\n\t return WordArray.create(words, utf16StrLength * 2);\n\t }\n\t };\n\n\t function swapEndian(word) {\n\t return ((word << 8) & 0xff00ff00) | ((word >>> 8) & 0x00ff00ff);\n\t }\n\t}());\n\n\n\treturn CryptoJS.enc.Utf16;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./sha1\"), require(\"./hmac\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./sha1\", \"./hmac\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var Base = C_lib.Base;\n\t var WordArray = C_lib.WordArray;\n\t var C_algo = C.algo;\n\t var MD5 = C_algo.MD5;\n\n\t /**\n\t * This key derivation function is meant to conform with EVP_BytesToKey.\n\t * www.openssl.org/docs/crypto/EVP_BytesToKey.html\n\t */\n\t var EvpKDF = C_algo.EvpKDF = Base.extend({\n\t /**\n\t * Configuration options.\n\t *\n\t * @property {number} keySize The key size in words to generate. Default: 4 (128 bits)\n\t * @property {Hasher} hasher The hash algorithm to use. Default: MD5\n\t * @property {number} iterations The number of iterations to perform. Default: 1\n\t */\n\t cfg: Base.extend({\n\t keySize: 128/32,\n\t hasher: MD5,\n\t iterations: 1\n\t }),\n\n\t /**\n\t * Initializes a newly created key derivation function.\n\t *\n\t * @param {Object} cfg (Optional) The configuration options to use for the derivation.\n\t *\n\t * @example\n\t *\n\t * var kdf = CryptoJS.algo.EvpKDF.create();\n\t * var kdf = CryptoJS.algo.EvpKDF.create({ keySize: 8 });\n\t * var kdf = CryptoJS.algo.EvpKDF.create({ keySize: 8, iterations: 1000 });\n\t */\n\t init: function (cfg) {\n\t this.cfg = this.cfg.extend(cfg);\n\t },\n\n\t /**\n\t * Derives a key from a password.\n\t *\n\t * @param {WordArray|string} password The password.\n\t * @param {WordArray|string} salt A salt.\n\t *\n\t * @return {WordArray} The derived key.\n\t *\n\t * @example\n\t *\n\t * var key = kdf.compute(password, salt);\n\t */\n\t compute: function (password, salt) {\n\t var block;\n\n\t // Shortcut\n\t var cfg = this.cfg;\n\n\t // Init hasher\n\t var hasher = cfg.hasher.create();\n\n\t // Initial values\n\t var derivedKey = WordArray.create();\n\n\t // Shortcuts\n\t var derivedKeyWords = derivedKey.words;\n\t var keySize = cfg.keySize;\n\t var iterations = cfg.iterations;\n\n\t // Generate key\n\t while (derivedKeyWords.length < keySize) {\n\t if (block) {\n\t hasher.update(block);\n\t }\n\t block = hasher.update(password).finalize(salt);\n\t hasher.reset();\n\n\t // Iterations\n\t for (var i = 1; i < iterations; i++) {\n\t block = hasher.finalize(block);\n\t hasher.reset();\n\t }\n\n\t derivedKey.concat(block);\n\t }\n\t derivedKey.sigBytes = keySize * 4;\n\n\t return derivedKey;\n\t }\n\t });\n\n\t /**\n\t * Derives a key from a password.\n\t *\n\t * @param {WordArray|string} password The password.\n\t * @param {WordArray|string} salt A salt.\n\t * @param {Object} cfg (Optional) The configuration options to use for this computation.\n\t *\n\t * @return {WordArray} The derived key.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var key = CryptoJS.EvpKDF(password, salt);\n\t * var key = CryptoJS.EvpKDF(password, salt, { keySize: 8 });\n\t * var key = CryptoJS.EvpKDF(password, salt, { keySize: 8, iterations: 1000 });\n\t */\n\t C.EvpKDF = function (password, salt, cfg) {\n\t return EvpKDF.create(cfg).compute(password, salt);\n\t };\n\t}());\n\n\n\treturn CryptoJS.EvpKDF;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function (undefined) {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var CipherParams = C_lib.CipherParams;\n\t var C_enc = C.enc;\n\t var Hex = C_enc.Hex;\n\t var C_format = C.format;\n\n\t var HexFormatter = C_format.Hex = {\n\t /**\n\t * Converts the ciphertext of a cipher params object to a hexadecimally encoded string.\n\t *\n\t * @param {CipherParams} cipherParams The cipher params object.\n\t *\n\t * @return {string} The hexadecimally encoded string.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hexString = CryptoJS.format.Hex.stringify(cipherParams);\n\t */\n\t stringify: function (cipherParams) {\n\t return cipherParams.ciphertext.toString(Hex);\n\t },\n\n\t /**\n\t * Converts a hexadecimally encoded ciphertext string to a cipher params object.\n\t *\n\t * @param {string} input The hexadecimally encoded string.\n\t *\n\t * @return {CipherParams} The cipher params object.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var cipherParams = CryptoJS.format.Hex.parse(hexString);\n\t */\n\t parse: function (input) {\n\t var ciphertext = Hex.parse(input);\n\t return CipherParams.create({ ciphertext: ciphertext });\n\t }\n\t };\n\t}());\n\n\n\treturn CryptoJS.format.Hex;\n\n}));",";(function (root, factory) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var Base = C_lib.Base;\n\t var C_enc = C.enc;\n\t var Utf8 = C_enc.Utf8;\n\t var C_algo = C.algo;\n\n\t /**\n\t * HMAC algorithm.\n\t */\n\t var HMAC = C_algo.HMAC = Base.extend({\n\t /**\n\t * Initializes a newly created HMAC.\n\t *\n\t * @param {Hasher} hasher The hash algorithm to use.\n\t * @param {WordArray|string} key The secret key.\n\t *\n\t * @example\n\t *\n\t * var hmacHasher = CryptoJS.algo.HMAC.create(CryptoJS.algo.SHA256, key);\n\t */\n\t init: function (hasher, key) {\n\t // Init hasher\n\t hasher = this._hasher = new hasher.init();\n\n\t // Convert string to WordArray, else assume WordArray already\n\t if (typeof key == 'string') {\n\t key = Utf8.parse(key);\n\t }\n\n\t // Shortcuts\n\t var hasherBlockSize = hasher.blockSize;\n\t var hasherBlockSizeBytes = hasherBlockSize * 4;\n\n\t // Allow arbitrary length keys\n\t if (key.sigBytes > hasherBlockSizeBytes) {\n\t key = hasher.finalize(key);\n\t }\n\n\t // Clamp excess bits\n\t key.clamp();\n\n\t // Clone key for inner and outer pads\n\t var oKey = this._oKey = key.clone();\n\t var iKey = this._iKey = key.clone();\n\n\t // Shortcuts\n\t var oKeyWords = oKey.words;\n\t var iKeyWords = iKey.words;\n\n\t // XOR keys with pad constants\n\t for (var i = 0; i < hasherBlockSize; i++) {\n\t oKeyWords[i] ^= 0x5c5c5c5c;\n\t iKeyWords[i] ^= 0x36363636;\n\t }\n\t oKey.sigBytes = iKey.sigBytes = hasherBlockSizeBytes;\n\n\t // Set initial values\n\t this.reset();\n\t },\n\n\t /**\n\t * Resets this HMAC to its initial state.\n\t *\n\t * @example\n\t *\n\t * hmacHasher.reset();\n\t */\n\t reset: function () {\n\t // Shortcut\n\t var hasher = this._hasher;\n\n\t // Reset\n\t hasher.reset();\n\t hasher.update(this._iKey);\n\t },\n\n\t /**\n\t * Updates this HMAC with a message.\n\t *\n\t * @param {WordArray|string} messageUpdate The message to append.\n\t *\n\t * @return {HMAC} This HMAC instance.\n\t *\n\t * @example\n\t *\n\t * hmacHasher.update('message');\n\t * hmacHasher.update(wordArray);\n\t */\n\t update: function (messageUpdate) {\n\t this._hasher.update(messageUpdate);\n\n\t // Chainable\n\t return this;\n\t },\n\n\t /**\n\t * Finalizes the HMAC computation.\n\t * Note that the finalize operation is effectively a destructive, read-once operation.\n\t *\n\t * @param {WordArray|string} messageUpdate (Optional) A final message update.\n\t *\n\t * @return {WordArray} The HMAC.\n\t *\n\t * @example\n\t *\n\t * var hmac = hmacHasher.finalize();\n\t * var hmac = hmacHasher.finalize('message');\n\t * var hmac = hmacHasher.finalize(wordArray);\n\t */\n\t finalize: function (messageUpdate) {\n\t // Shortcut\n\t var hasher = this._hasher;\n\n\t // Compute HMAC\n\t var innerHash = hasher.finalize(messageUpdate);\n\t hasher.reset();\n\t var hmac = hasher.finalize(this._oKey.clone().concat(innerHash));\n\n\t return hmac;\n\t }\n\t });\n\t}());\n\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./x64-core\"), require(\"./lib-typedarrays\"), require(\"./enc-utf16\"), require(\"./enc-base64\"), require(\"./enc-base64url\"), require(\"./md5\"), require(\"./sha1\"), require(\"./sha256\"), require(\"./sha224\"), require(\"./sha512\"), require(\"./sha384\"), require(\"./sha3\"), require(\"./ripemd160\"), require(\"./hmac\"), require(\"./pbkdf2\"), require(\"./evpkdf\"), require(\"./cipher-core\"), require(\"./mode-cfb\"), require(\"./mode-ctr\"), require(\"./mode-ctr-gladman\"), require(\"./mode-ofb\"), require(\"./mode-ecb\"), require(\"./pad-ansix923\"), require(\"./pad-iso10126\"), require(\"./pad-iso97971\"), require(\"./pad-zeropadding\"), require(\"./pad-nopadding\"), require(\"./format-hex\"), require(\"./aes\"), require(\"./tripledes\"), require(\"./rc4\"), require(\"./rabbit\"), require(\"./rabbit-legacy\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./x64-core\", \"./lib-typedarrays\", \"./enc-utf16\", \"./enc-base64\", \"./enc-base64url\", \"./md5\", \"./sha1\", \"./sha256\", \"./sha224\", \"./sha512\", \"./sha384\", \"./sha3\", \"./ripemd160\", \"./hmac\", \"./pbkdf2\", \"./evpkdf\", \"./cipher-core\", \"./mode-cfb\", \"./mode-ctr\", \"./mode-ctr-gladman\", \"./mode-ofb\", \"./mode-ecb\", \"./pad-ansix923\", \"./pad-iso10126\", \"./pad-iso97971\", \"./pad-zeropadding\", \"./pad-nopadding\", \"./format-hex\", \"./aes\", \"./tripledes\", \"./rc4\", \"./rabbit\", \"./rabbit-legacy\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\troot.CryptoJS = factory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\treturn CryptoJS;\n\n}));",";(function (root, factory) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Check if typed arrays are supported\n\t if (typeof ArrayBuffer != 'function') {\n\t return;\n\t }\n\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var WordArray = C_lib.WordArray;\n\n\t // Reference original init\n\t var superInit = WordArray.init;\n\n\t // Augment WordArray.init to handle typed arrays\n\t var subInit = WordArray.init = function (typedArray) {\n\t // Convert buffers to uint8\n\t if (typedArray instanceof ArrayBuffer) {\n\t typedArray = new Uint8Array(typedArray);\n\t }\n\n\t // Convert other array views to uint8\n\t if (\n\t typedArray instanceof Int8Array ||\n\t (typeof Uint8ClampedArray !== \"undefined\" && typedArray instanceof Uint8ClampedArray) ||\n\t typedArray instanceof Int16Array ||\n\t typedArray instanceof Uint16Array ||\n\t typedArray instanceof Int32Array ||\n\t typedArray instanceof Uint32Array ||\n\t typedArray instanceof Float32Array ||\n\t typedArray instanceof Float64Array\n\t ) {\n\t typedArray = new Uint8Array(typedArray.buffer, typedArray.byteOffset, typedArray.byteLength);\n\t }\n\n\t // Handle Uint8Array\n\t if (typedArray instanceof Uint8Array) {\n\t // Shortcut\n\t var typedArrayByteLength = typedArray.byteLength;\n\n\t // Extract bytes\n\t var words = [];\n\t for (var i = 0; i < typedArrayByteLength; i++) {\n\t words[i >>> 2] |= typedArray[i] << (24 - (i % 4) * 8);\n\t }\n\n\t // Initialize this word array\n\t superInit.call(this, words, typedArrayByteLength);\n\t } else {\n\t // Else call normal init\n\t superInit.apply(this, arguments);\n\t }\n\t };\n\n\t subInit.prototype = WordArray;\n\t}());\n\n\n\treturn CryptoJS.lib.WordArray;\n\n}));",";(function (root, factory) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function (Math) {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var WordArray = C_lib.WordArray;\n\t var Hasher = C_lib.Hasher;\n\t var C_algo = C.algo;\n\n\t // Constants table\n\t var T = [];\n\n\t // Compute constants\n\t (function () {\n\t for (var i = 0; i < 64; i++) {\n\t T[i] = (Math.abs(Math.sin(i + 1)) * 0x100000000) | 0;\n\t }\n\t }());\n\n\t /**\n\t * MD5 hash algorithm.\n\t */\n\t var MD5 = C_algo.MD5 = Hasher.extend({\n\t _doReset: function () {\n\t this._hash = new WordArray.init([\n\t 0x67452301, 0xefcdab89,\n\t 0x98badcfe, 0x10325476\n\t ]);\n\t },\n\n\t _doProcessBlock: function (M, offset) {\n\t // Swap endian\n\t for (var i = 0; i < 16; i++) {\n\t // Shortcuts\n\t var offset_i = offset + i;\n\t var M_offset_i = M[offset_i];\n\n\t M[offset_i] = (\n\t (((M_offset_i << 8) | (M_offset_i >>> 24)) & 0x00ff00ff) |\n\t (((M_offset_i << 24) | (M_offset_i >>> 8)) & 0xff00ff00)\n\t );\n\t }\n\n\t // Shortcuts\n\t var H = this._hash.words;\n\n\t var M_offset_0 = M[offset + 0];\n\t var M_offset_1 = M[offset + 1];\n\t var M_offset_2 = M[offset + 2];\n\t var M_offset_3 = M[offset + 3];\n\t var M_offset_4 = M[offset + 4];\n\t var M_offset_5 = M[offset + 5];\n\t var M_offset_6 = M[offset + 6];\n\t var M_offset_7 = M[offset + 7];\n\t var M_offset_8 = M[offset + 8];\n\t var M_offset_9 = M[offset + 9];\n\t var M_offset_10 = M[offset + 10];\n\t var M_offset_11 = M[offset + 11];\n\t var M_offset_12 = M[offset + 12];\n\t var M_offset_13 = M[offset + 13];\n\t var M_offset_14 = M[offset + 14];\n\t var M_offset_15 = M[offset + 15];\n\n\t // Working varialbes\n\t var a = H[0];\n\t var b = H[1];\n\t var c = H[2];\n\t var d = H[3];\n\n\t // Computation\n\t a = FF(a, b, c, d, M_offset_0, 7, T[0]);\n\t d = FF(d, a, b, c, M_offset_1, 12, T[1]);\n\t c = FF(c, d, a, b, M_offset_2, 17, T[2]);\n\t b = FF(b, c, d, a, M_offset_3, 22, T[3]);\n\t a = FF(a, b, c, d, M_offset_4, 7, T[4]);\n\t d = FF(d, a, b, c, M_offset_5, 12, T[5]);\n\t c = FF(c, d, a, b, M_offset_6, 17, T[6]);\n\t b = FF(b, c, d, a, M_offset_7, 22, T[7]);\n\t a = FF(a, b, c, d, M_offset_8, 7, T[8]);\n\t d = FF(d, a, b, c, M_offset_9, 12, T[9]);\n\t c = FF(c, d, a, b, M_offset_10, 17, T[10]);\n\t b = FF(b, c, d, a, M_offset_11, 22, T[11]);\n\t a = FF(a, b, c, d, M_offset_12, 7, T[12]);\n\t d = FF(d, a, b, c, M_offset_13, 12, T[13]);\n\t c = FF(c, d, a, b, M_offset_14, 17, T[14]);\n\t b = FF(b, c, d, a, M_offset_15, 22, T[15]);\n\n\t a = GG(a, b, c, d, M_offset_1, 5, T[16]);\n\t d = GG(d, a, b, c, M_offset_6, 9, T[17]);\n\t c = GG(c, d, a, b, M_offset_11, 14, T[18]);\n\t b = GG(b, c, d, a, M_offset_0, 20, T[19]);\n\t a = GG(a, b, c, d, M_offset_5, 5, T[20]);\n\t d = GG(d, a, b, c, M_offset_10, 9, T[21]);\n\t c = GG(c, d, a, b, M_offset_15, 14, T[22]);\n\t b = GG(b, c, d, a, M_offset_4, 20, T[23]);\n\t a = GG(a, b, c, d, M_offset_9, 5, T[24]);\n\t d = GG(d, a, b, c, M_offset_14, 9, T[25]);\n\t c = GG(c, d, a, b, M_offset_3, 14, T[26]);\n\t b = GG(b, c, d, a, M_offset_8, 20, T[27]);\n\t a = GG(a, b, c, d, M_offset_13, 5, T[28]);\n\t d = GG(d, a, b, c, M_offset_2, 9, T[29]);\n\t c = GG(c, d, a, b, M_offset_7, 14, T[30]);\n\t b = GG(b, c, d, a, M_offset_12, 20, T[31]);\n\n\t a = HH(a, b, c, d, M_offset_5, 4, T[32]);\n\t d = HH(d, a, b, c, M_offset_8, 11, T[33]);\n\t c = HH(c, d, a, b, M_offset_11, 16, T[34]);\n\t b = HH(b, c, d, a, M_offset_14, 23, T[35]);\n\t a = HH(a, b, c, d, M_offset_1, 4, T[36]);\n\t d = HH(d, a, b, c, M_offset_4, 11, T[37]);\n\t c = HH(c, d, a, b, M_offset_7, 16, T[38]);\n\t b = HH(b, c, d, a, M_offset_10, 23, T[39]);\n\t a = HH(a, b, c, d, M_offset_13, 4, T[40]);\n\t d = HH(d, a, b, c, M_offset_0, 11, T[41]);\n\t c = HH(c, d, a, b, M_offset_3, 16, T[42]);\n\t b = HH(b, c, d, a, M_offset_6, 23, T[43]);\n\t a = HH(a, b, c, d, M_offset_9, 4, T[44]);\n\t d = HH(d, a, b, c, M_offset_12, 11, T[45]);\n\t c = HH(c, d, a, b, M_offset_15, 16, T[46]);\n\t b = HH(b, c, d, a, M_offset_2, 23, T[47]);\n\n\t a = II(a, b, c, d, M_offset_0, 6, T[48]);\n\t d = II(d, a, b, c, M_offset_7, 10, T[49]);\n\t c = II(c, d, a, b, M_offset_14, 15, T[50]);\n\t b = II(b, c, d, a, M_offset_5, 21, T[51]);\n\t a = II(a, b, c, d, M_offset_12, 6, T[52]);\n\t d = II(d, a, b, c, M_offset_3, 10, T[53]);\n\t c = II(c, d, a, b, M_offset_10, 15, T[54]);\n\t b = II(b, c, d, a, M_offset_1, 21, T[55]);\n\t a = II(a, b, c, d, M_offset_8, 6, T[56]);\n\t d = II(d, a, b, c, M_offset_15, 10, T[57]);\n\t c = II(c, d, a, b, M_offset_6, 15, T[58]);\n\t b = II(b, c, d, a, M_offset_13, 21, T[59]);\n\t a = II(a, b, c, d, M_offset_4, 6, T[60]);\n\t d = II(d, a, b, c, M_offset_11, 10, T[61]);\n\t c = II(c, d, a, b, M_offset_2, 15, T[62]);\n\t b = II(b, c, d, a, M_offset_9, 21, T[63]);\n\n\t // Intermediate hash value\n\t H[0] = (H[0] + a) | 0;\n\t H[1] = (H[1] + b) | 0;\n\t H[2] = (H[2] + c) | 0;\n\t H[3] = (H[3] + d) | 0;\n\t },\n\n\t _doFinalize: function () {\n\t // Shortcuts\n\t var data = this._data;\n\t var dataWords = data.words;\n\n\t var nBitsTotal = this._nDataBytes * 8;\n\t var nBitsLeft = data.sigBytes * 8;\n\n\t // Add padding\n\t dataWords[nBitsLeft >>> 5] |= 0x80 << (24 - nBitsLeft % 32);\n\n\t var nBitsTotalH = Math.floor(nBitsTotal / 0x100000000);\n\t var nBitsTotalL = nBitsTotal;\n\t dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 15] = (\n\t (((nBitsTotalH << 8) | (nBitsTotalH >>> 24)) & 0x00ff00ff) |\n\t (((nBitsTotalH << 24) | (nBitsTotalH >>> 8)) & 0xff00ff00)\n\t );\n\t dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 14] = (\n\t (((nBitsTotalL << 8) | (nBitsTotalL >>> 24)) & 0x00ff00ff) |\n\t (((nBitsTotalL << 24) | (nBitsTotalL >>> 8)) & 0xff00ff00)\n\t );\n\n\t data.sigBytes = (dataWords.length + 1) * 4;\n\n\t // Hash final blocks\n\t this._process();\n\n\t // Shortcuts\n\t var hash = this._hash;\n\t var H = hash.words;\n\n\t // Swap endian\n\t for (var i = 0; i < 4; i++) {\n\t // Shortcut\n\t var H_i = H[i];\n\n\t H[i] = (((H_i << 8) | (H_i >>> 24)) & 0x00ff00ff) |\n\t (((H_i << 24) | (H_i >>> 8)) & 0xff00ff00);\n\t }\n\n\t // Return final computed hash\n\t return hash;\n\t },\n\n\t clone: function () {\n\t var clone = Hasher.clone.call(this);\n\t clone._hash = this._hash.clone();\n\n\t return clone;\n\t }\n\t });\n\n\t function FF(a, b, c, d, x, s, t) {\n\t var n = a + ((b & c) | (~b & d)) + x + t;\n\t return ((n << s) | (n >>> (32 - s))) + b;\n\t }\n\n\t function GG(a, b, c, d, x, s, t) {\n\t var n = a + ((b & d) | (c & ~d)) + x + t;\n\t return ((n << s) | (n >>> (32 - s))) + b;\n\t }\n\n\t function HH(a, b, c, d, x, s, t) {\n\t var n = a + (b ^ c ^ d) + x + t;\n\t return ((n << s) | (n >>> (32 - s))) + b;\n\t }\n\n\t function II(a, b, c, d, x, s, t) {\n\t var n = a + (c ^ (b | ~d)) + x + t;\n\t return ((n << s) | (n >>> (32 - s))) + b;\n\t }\n\n\t /**\n\t * Shortcut function to the hasher's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t *\n\t * @return {WordArray} The hash.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hash = CryptoJS.MD5('message');\n\t * var hash = CryptoJS.MD5(wordArray);\n\t */\n\t C.MD5 = Hasher._createHelper(MD5);\n\n\t /**\n\t * Shortcut function to the HMAC's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t * @param {WordArray|string} key The secret key.\n\t *\n\t * @return {WordArray} The HMAC.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hmac = CryptoJS.HmacMD5(message, key);\n\t */\n\t C.HmacMD5 = Hasher._createHmacHelper(MD5);\n\t}(Math));\n\n\n\treturn CryptoJS.MD5;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/**\n\t * Cipher Feedback block mode.\n\t */\n\tCryptoJS.mode.CFB = (function () {\n\t var CFB = CryptoJS.lib.BlockCipherMode.extend();\n\n\t CFB.Encryptor = CFB.extend({\n\t processBlock: function (words, offset) {\n\t // Shortcuts\n\t var cipher = this._cipher;\n\t var blockSize = cipher.blockSize;\n\n\t generateKeystreamAndEncrypt.call(this, words, offset, blockSize, cipher);\n\n\t // Remember this block to use with next block\n\t this._prevBlock = words.slice(offset, offset + blockSize);\n\t }\n\t });\n\n\t CFB.Decryptor = CFB.extend({\n\t processBlock: function (words, offset) {\n\t // Shortcuts\n\t var cipher = this._cipher;\n\t var blockSize = cipher.blockSize;\n\n\t // Remember this block to use with next block\n\t var thisBlock = words.slice(offset, offset + blockSize);\n\n\t generateKeystreamAndEncrypt.call(this, words, offset, blockSize, cipher);\n\n\t // This block becomes the previous block\n\t this._prevBlock = thisBlock;\n\t }\n\t });\n\n\t function generateKeystreamAndEncrypt(words, offset, blockSize, cipher) {\n\t var keystream;\n\n\t // Shortcut\n\t var iv = this._iv;\n\n\t // Generate keystream\n\t if (iv) {\n\t keystream = iv.slice(0);\n\n\t // Remove IV for subsequent blocks\n\t this._iv = undefined;\n\t } else {\n\t keystream = this._prevBlock;\n\t }\n\t cipher.encryptBlock(keystream, 0);\n\n\t // Encrypt\n\t for (var i = 0; i < blockSize; i++) {\n\t words[offset + i] ^= keystream[i];\n\t }\n\t }\n\n\t return CFB;\n\t}());\n\n\n\treturn CryptoJS.mode.CFB;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/** @preserve\n\t * Counter block mode compatible with Dr Brian Gladman fileenc.c\n\t * derived from CryptoJS.mode.CTR\n\t * Jan Hruby jhruby.web@gmail.com\n\t */\n\tCryptoJS.mode.CTRGladman = (function () {\n\t var CTRGladman = CryptoJS.lib.BlockCipherMode.extend();\n\n\t\tfunction incWord(word)\n\t\t{\n\t\t\tif (((word >> 24) & 0xff) === 0xff) { //overflow\n\t\t\tvar b1 = (word >> 16)&0xff;\n\t\t\tvar b2 = (word >> 8)&0xff;\n\t\t\tvar b3 = word & 0xff;\n\n\t\t\tif (b1 === 0xff) // overflow b1\n\t\t\t{\n\t\t\tb1 = 0;\n\t\t\tif (b2 === 0xff)\n\t\t\t{\n\t\t\t\tb2 = 0;\n\t\t\t\tif (b3 === 0xff)\n\t\t\t\t{\n\t\t\t\t\tb3 = 0;\n\t\t\t\t}\n\t\t\t\telse\n\t\t\t\t{\n\t\t\t\t\t++b3;\n\t\t\t\t}\n\t\t\t}\n\t\t\telse\n\t\t\t{\n\t\t\t\t++b2;\n\t\t\t}\n\t\t\t}\n\t\t\telse\n\t\t\t{\n\t\t\t++b1;\n\t\t\t}\n\n\t\t\tword = 0;\n\t\t\tword += (b1 << 16);\n\t\t\tword += (b2 << 8);\n\t\t\tword += b3;\n\t\t\t}\n\t\t\telse\n\t\t\t{\n\t\t\tword += (0x01 << 24);\n\t\t\t}\n\t\t\treturn word;\n\t\t}\n\n\t\tfunction incCounter(counter)\n\t\t{\n\t\t\tif ((counter[0] = incWord(counter[0])) === 0)\n\t\t\t{\n\t\t\t\t// encr_data in fileenc.c from Dr Brian Gladman's counts only with DWORD j < 8\n\t\t\t\tcounter[1] = incWord(counter[1]);\n\t\t\t}\n\t\t\treturn counter;\n\t\t}\n\n\t var Encryptor = CTRGladman.Encryptor = CTRGladman.extend({\n\t processBlock: function (words, offset) {\n\t // Shortcuts\n\t var cipher = this._cipher\n\t var blockSize = cipher.blockSize;\n\t var iv = this._iv;\n\t var counter = this._counter;\n\n\t // Generate keystream\n\t if (iv) {\n\t counter = this._counter = iv.slice(0);\n\n\t // Remove IV for subsequent blocks\n\t this._iv = undefined;\n\t }\n\n\t\t\t\tincCounter(counter);\n\n\t\t\t\tvar keystream = counter.slice(0);\n\t cipher.encryptBlock(keystream, 0);\n\n\t // Encrypt\n\t for (var i = 0; i < blockSize; i++) {\n\t words[offset + i] ^= keystream[i];\n\t }\n\t }\n\t });\n\n\t CTRGladman.Decryptor = Encryptor;\n\n\t return CTRGladman;\n\t}());\n\n\n\n\n\treturn CryptoJS.mode.CTRGladman;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/**\n\t * Counter block mode.\n\t */\n\tCryptoJS.mode.CTR = (function () {\n\t var CTR = CryptoJS.lib.BlockCipherMode.extend();\n\n\t var Encryptor = CTR.Encryptor = CTR.extend({\n\t processBlock: function (words, offset) {\n\t // Shortcuts\n\t var cipher = this._cipher\n\t var blockSize = cipher.blockSize;\n\t var iv = this._iv;\n\t var counter = this._counter;\n\n\t // Generate keystream\n\t if (iv) {\n\t counter = this._counter = iv.slice(0);\n\n\t // Remove IV for subsequent blocks\n\t this._iv = undefined;\n\t }\n\t var keystream = counter.slice(0);\n\t cipher.encryptBlock(keystream, 0);\n\n\t // Increment counter\n\t counter[blockSize - 1] = (counter[blockSize - 1] + 1) | 0\n\n\t // Encrypt\n\t for (var i = 0; i < blockSize; i++) {\n\t words[offset + i] ^= keystream[i];\n\t }\n\t }\n\t });\n\n\t CTR.Decryptor = Encryptor;\n\n\t return CTR;\n\t}());\n\n\n\treturn CryptoJS.mode.CTR;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/**\n\t * Electronic Codebook block mode.\n\t */\n\tCryptoJS.mode.ECB = (function () {\n\t var ECB = CryptoJS.lib.BlockCipherMode.extend();\n\n\t ECB.Encryptor = ECB.extend({\n\t processBlock: function (words, offset) {\n\t this._cipher.encryptBlock(words, offset);\n\t }\n\t });\n\n\t ECB.Decryptor = ECB.extend({\n\t processBlock: function (words, offset) {\n\t this._cipher.decryptBlock(words, offset);\n\t }\n\t });\n\n\t return ECB;\n\t}());\n\n\n\treturn CryptoJS.mode.ECB;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/**\n\t * Output Feedback block mode.\n\t */\n\tCryptoJS.mode.OFB = (function () {\n\t var OFB = CryptoJS.lib.BlockCipherMode.extend();\n\n\t var Encryptor = OFB.Encryptor = OFB.extend({\n\t processBlock: function (words, offset) {\n\t // Shortcuts\n\t var cipher = this._cipher\n\t var blockSize = cipher.blockSize;\n\t var iv = this._iv;\n\t var keystream = this._keystream;\n\n\t // Generate keystream\n\t if (iv) {\n\t keystream = this._keystream = iv.slice(0);\n\n\t // Remove IV for subsequent blocks\n\t this._iv = undefined;\n\t }\n\t cipher.encryptBlock(keystream, 0);\n\n\t // Encrypt\n\t for (var i = 0; i < blockSize; i++) {\n\t words[offset + i] ^= keystream[i];\n\t }\n\t }\n\t });\n\n\t OFB.Decryptor = Encryptor;\n\n\t return OFB;\n\t}());\n\n\n\treturn CryptoJS.mode.OFB;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/**\n\t * ANSI X.923 padding strategy.\n\t */\n\tCryptoJS.pad.AnsiX923 = {\n\t pad: function (data, blockSize) {\n\t // Shortcuts\n\t var dataSigBytes = data.sigBytes;\n\t var blockSizeBytes = blockSize * 4;\n\n\t // Count padding bytes\n\t var nPaddingBytes = blockSizeBytes - dataSigBytes % blockSizeBytes;\n\n\t // Compute last byte position\n\t var lastBytePos = dataSigBytes + nPaddingBytes - 1;\n\n\t // Pad\n\t data.clamp();\n\t data.words[lastBytePos >>> 2] |= nPaddingBytes << (24 - (lastBytePos % 4) * 8);\n\t data.sigBytes += nPaddingBytes;\n\t },\n\n\t unpad: function (data) {\n\t // Get number of padding bytes from last byte\n\t var nPaddingBytes = data.words[(data.sigBytes - 1) >>> 2] & 0xff;\n\n\t // Remove padding\n\t data.sigBytes -= nPaddingBytes;\n\t }\n\t};\n\n\n\treturn CryptoJS.pad.Ansix923;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/**\n\t * ISO 10126 padding strategy.\n\t */\n\tCryptoJS.pad.Iso10126 = {\n\t pad: function (data, blockSize) {\n\t // Shortcut\n\t var blockSizeBytes = blockSize * 4;\n\n\t // Count padding bytes\n\t var nPaddingBytes = blockSizeBytes - data.sigBytes % blockSizeBytes;\n\n\t // Pad\n\t data.concat(CryptoJS.lib.WordArray.random(nPaddingBytes - 1)).\n\t concat(CryptoJS.lib.WordArray.create([nPaddingBytes << 24], 1));\n\t },\n\n\t unpad: function (data) {\n\t // Get number of padding bytes from last byte\n\t var nPaddingBytes = data.words[(data.sigBytes - 1) >>> 2] & 0xff;\n\n\t // Remove padding\n\t data.sigBytes -= nPaddingBytes;\n\t }\n\t};\n\n\n\treturn CryptoJS.pad.Iso10126;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/**\n\t * ISO/IEC 9797-1 Padding Method 2.\n\t */\n\tCryptoJS.pad.Iso97971 = {\n\t pad: function (data, blockSize) {\n\t // Add 0x80 byte\n\t data.concat(CryptoJS.lib.WordArray.create([0x80000000], 1));\n\n\t // Zero pad the rest\n\t CryptoJS.pad.ZeroPadding.pad(data, blockSize);\n\t },\n\n\t unpad: function (data) {\n\t // Remove zero padding\n\t CryptoJS.pad.ZeroPadding.unpad(data);\n\n\t // Remove one more byte -- the 0x80 byte\n\t data.sigBytes--;\n\t }\n\t};\n\n\n\treturn CryptoJS.pad.Iso97971;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/**\n\t * A noop padding strategy.\n\t */\n\tCryptoJS.pad.NoPadding = {\n\t pad: function () {\n\t },\n\n\t unpad: function () {\n\t }\n\t};\n\n\n\treturn CryptoJS.pad.NoPadding;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/**\n\t * Zero padding strategy.\n\t */\n\tCryptoJS.pad.ZeroPadding = {\n\t pad: function (data, blockSize) {\n\t // Shortcut\n\t var blockSizeBytes = blockSize * 4;\n\n\t // Pad\n\t data.clamp();\n\t data.sigBytes += blockSizeBytes - ((data.sigBytes % blockSizeBytes) || blockSizeBytes);\n\t },\n\n\t unpad: function (data) {\n\t // Shortcut\n\t var dataWords = data.words;\n\n\t // Unpad\n\t var i = data.sigBytes - 1;\n\t for (var i = data.sigBytes - 1; i >= 0; i--) {\n\t if (((dataWords[i >>> 2] >>> (24 - (i % 4) * 8)) & 0xff)) {\n\t data.sigBytes = i + 1;\n\t break;\n\t }\n\t }\n\t }\n\t};\n\n\n\treturn CryptoJS.pad.ZeroPadding;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./sha1\"), require(\"./hmac\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./sha1\", \"./hmac\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var Base = C_lib.Base;\n\t var WordArray = C_lib.WordArray;\n\t var C_algo = C.algo;\n\t var SHA1 = C_algo.SHA1;\n\t var HMAC = C_algo.HMAC;\n\n\t /**\n\t * Password-Based Key Derivation Function 2 algorithm.\n\t */\n\t var PBKDF2 = C_algo.PBKDF2 = Base.extend({\n\t /**\n\t * Configuration options.\n\t *\n\t * @property {number} keySize The key size in words to generate. Default: 4 (128 bits)\n\t * @property {Hasher} hasher The hasher to use. Default: SHA1\n\t * @property {number} iterations The number of iterations to perform. Default: 1\n\t */\n\t cfg: Base.extend({\n\t keySize: 128/32,\n\t hasher: SHA1,\n\t iterations: 1\n\t }),\n\n\t /**\n\t * Initializes a newly created key derivation function.\n\t *\n\t * @param {Object} cfg (Optional) The configuration options to use for the derivation.\n\t *\n\t * @example\n\t *\n\t * var kdf = CryptoJS.algo.PBKDF2.create();\n\t * var kdf = CryptoJS.algo.PBKDF2.create({ keySize: 8 });\n\t * var kdf = CryptoJS.algo.PBKDF2.create({ keySize: 8, iterations: 1000 });\n\t */\n\t init: function (cfg) {\n\t this.cfg = this.cfg.extend(cfg);\n\t },\n\n\t /**\n\t * Computes the Password-Based Key Derivation Function 2.\n\t *\n\t * @param {WordArray|string} password The password.\n\t * @param {WordArray|string} salt A salt.\n\t *\n\t * @return {WordArray} The derived key.\n\t *\n\t * @example\n\t *\n\t * var key = kdf.compute(password, salt);\n\t */\n\t compute: function (password, salt) {\n\t // Shortcut\n\t var cfg = this.cfg;\n\n\t // Init HMAC\n\t var hmac = HMAC.create(cfg.hasher, password);\n\n\t // Initial values\n\t var derivedKey = WordArray.create();\n\t var blockIndex = WordArray.create([0x00000001]);\n\n\t // Shortcuts\n\t var derivedKeyWords = derivedKey.words;\n\t var blockIndexWords = blockIndex.words;\n\t var keySize = cfg.keySize;\n\t var iterations = cfg.iterations;\n\n\t // Generate key\n\t while (derivedKeyWords.length < keySize) {\n\t var block = hmac.update(salt).finalize(blockIndex);\n\t hmac.reset();\n\n\t // Shortcuts\n\t var blockWords = block.words;\n\t var blockWordsLength = blockWords.length;\n\n\t // Iterations\n\t var intermediate = block;\n\t for (var i = 1; i < iterations; i++) {\n\t intermediate = hmac.finalize(intermediate);\n\t hmac.reset();\n\n\t // Shortcut\n\t var intermediateWords = intermediate.words;\n\n\t // XOR intermediate with block\n\t for (var j = 0; j < blockWordsLength; j++) {\n\t blockWords[j] ^= intermediateWords[j];\n\t }\n\t }\n\n\t derivedKey.concat(block);\n\t blockIndexWords[0]++;\n\t }\n\t derivedKey.sigBytes = keySize * 4;\n\n\t return derivedKey;\n\t }\n\t });\n\n\t /**\n\t * Computes the Password-Based Key Derivation Function 2.\n\t *\n\t * @param {WordArray|string} password The password.\n\t * @param {WordArray|string} salt A salt.\n\t * @param {Object} cfg (Optional) The configuration options to use for this computation.\n\t *\n\t * @return {WordArray} The derived key.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var key = CryptoJS.PBKDF2(password, salt);\n\t * var key = CryptoJS.PBKDF2(password, salt, { keySize: 8 });\n\t * var key = CryptoJS.PBKDF2(password, salt, { keySize: 8, iterations: 1000 });\n\t */\n\t C.PBKDF2 = function (password, salt, cfg) {\n\t return PBKDF2.create(cfg).compute(password, salt);\n\t };\n\t}());\n\n\n\treturn CryptoJS.PBKDF2;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./enc-base64\"), require(\"./md5\"), require(\"./evpkdf\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./enc-base64\", \"./md5\", \"./evpkdf\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var StreamCipher = C_lib.StreamCipher;\n\t var C_algo = C.algo;\n\n\t // Reusable objects\n\t var S = [];\n\t var C_ = [];\n\t var G = [];\n\n\t /**\n\t * Rabbit stream cipher algorithm.\n\t *\n\t * This is a legacy version that neglected to convert the key to little-endian.\n\t * This error doesn't affect the cipher's security,\n\t * but it does affect its compatibility with other implementations.\n\t */\n\t var RabbitLegacy = C_algo.RabbitLegacy = StreamCipher.extend({\n\t _doReset: function () {\n\t // Shortcuts\n\t var K = this._key.words;\n\t var iv = this.cfg.iv;\n\n\t // Generate initial state values\n\t var X = this._X = [\n\t K[0], (K[3] << 16) | (K[2] >>> 16),\n\t K[1], (K[0] << 16) | (K[3] >>> 16),\n\t K[2], (K[1] << 16) | (K[0] >>> 16),\n\t K[3], (K[2] << 16) | (K[1] >>> 16)\n\t ];\n\n\t // Generate initial counter values\n\t var C = this._C = [\n\t (K[2] << 16) | (K[2] >>> 16), (K[0] & 0xffff0000) | (K[1] & 0x0000ffff),\n\t (K[3] << 16) | (K[3] >>> 16), (K[1] & 0xffff0000) | (K[2] & 0x0000ffff),\n\t (K[0] << 16) | (K[0] >>> 16), (K[2] & 0xffff0000) | (K[3] & 0x0000ffff),\n\t (K[1] << 16) | (K[1] >>> 16), (K[3] & 0xffff0000) | (K[0] & 0x0000ffff)\n\t ];\n\n\t // Carry bit\n\t this._b = 0;\n\n\t // Iterate the system four times\n\t for (var i = 0; i < 4; i++) {\n\t nextState.call(this);\n\t }\n\n\t // Modify the counters\n\t for (var i = 0; i < 8; i++) {\n\t C[i] ^= X[(i + 4) & 7];\n\t }\n\n\t // IV setup\n\t if (iv) {\n\t // Shortcuts\n\t var IV = iv.words;\n\t var IV_0 = IV[0];\n\t var IV_1 = IV[1];\n\n\t // Generate four subvectors\n\t var i0 = (((IV_0 << 8) | (IV_0 >>> 24)) & 0x00ff00ff) | (((IV_0 << 24) | (IV_0 >>> 8)) & 0xff00ff00);\n\t var i2 = (((IV_1 << 8) | (IV_1 >>> 24)) & 0x00ff00ff) | (((IV_1 << 24) | (IV_1 >>> 8)) & 0xff00ff00);\n\t var i1 = (i0 >>> 16) | (i2 & 0xffff0000);\n\t var i3 = (i2 << 16) | (i0 & 0x0000ffff);\n\n\t // Modify counter values\n\t C[0] ^= i0;\n\t C[1] ^= i1;\n\t C[2] ^= i2;\n\t C[3] ^= i3;\n\t C[4] ^= i0;\n\t C[5] ^= i1;\n\t C[6] ^= i2;\n\t C[7] ^= i3;\n\n\t // Iterate the system four times\n\t for (var i = 0; i < 4; i++) {\n\t nextState.call(this);\n\t }\n\t }\n\t },\n\n\t _doProcessBlock: function (M, offset) {\n\t // Shortcut\n\t var X = this._X;\n\n\t // Iterate the system\n\t nextState.call(this);\n\n\t // Generate four keystream words\n\t S[0] = X[0] ^ (X[5] >>> 16) ^ (X[3] << 16);\n\t S[1] = X[2] ^ (X[7] >>> 16) ^ (X[5] << 16);\n\t S[2] = X[4] ^ (X[1] >>> 16) ^ (X[7] << 16);\n\t S[3] = X[6] ^ (X[3] >>> 16) ^ (X[1] << 16);\n\n\t for (var i = 0; i < 4; i++) {\n\t // Swap endian\n\t S[i] = (((S[i] << 8) | (S[i] >>> 24)) & 0x00ff00ff) |\n\t (((S[i] << 24) | (S[i] >>> 8)) & 0xff00ff00);\n\n\t // Encrypt\n\t M[offset + i] ^= S[i];\n\t }\n\t },\n\n\t blockSize: 128/32,\n\n\t ivSize: 64/32\n\t });\n\n\t function nextState() {\n\t // Shortcuts\n\t var X = this._X;\n\t var C = this._C;\n\n\t // Save old counter values\n\t for (var i = 0; i < 8; i++) {\n\t C_[i] = C[i];\n\t }\n\n\t // Calculate new counter values\n\t C[0] = (C[0] + 0x4d34d34d + this._b) | 0;\n\t C[1] = (C[1] + 0xd34d34d3 + ((C[0] >>> 0) < (C_[0] >>> 0) ? 1 : 0)) | 0;\n\t C[2] = (C[2] + 0x34d34d34 + ((C[1] >>> 0) < (C_[1] >>> 0) ? 1 : 0)) | 0;\n\t C[3] = (C[3] + 0x4d34d34d + ((C[2] >>> 0) < (C_[2] >>> 0) ? 1 : 0)) | 0;\n\t C[4] = (C[4] + 0xd34d34d3 + ((C[3] >>> 0) < (C_[3] >>> 0) ? 1 : 0)) | 0;\n\t C[5] = (C[5] + 0x34d34d34 + ((C[4] >>> 0) < (C_[4] >>> 0) ? 1 : 0)) | 0;\n\t C[6] = (C[6] + 0x4d34d34d + ((C[5] >>> 0) < (C_[5] >>> 0) ? 1 : 0)) | 0;\n\t C[7] = (C[7] + 0xd34d34d3 + ((C[6] >>> 0) < (C_[6] >>> 0) ? 1 : 0)) | 0;\n\t this._b = (C[7] >>> 0) < (C_[7] >>> 0) ? 1 : 0;\n\n\t // Calculate the g-values\n\t for (var i = 0; i < 8; i++) {\n\t var gx = X[i] + C[i];\n\n\t // Construct high and low argument for squaring\n\t var ga = gx & 0xffff;\n\t var gb = gx >>> 16;\n\n\t // Calculate high and low result of squaring\n\t var gh = ((((ga * ga) >>> 17) + ga * gb) >>> 15) + gb * gb;\n\t var gl = (((gx & 0xffff0000) * gx) | 0) + (((gx & 0x0000ffff) * gx) | 0);\n\n\t // High XOR low\n\t G[i] = gh ^ gl;\n\t }\n\n\t // Calculate new state values\n\t X[0] = (G[0] + ((G[7] << 16) | (G[7] >>> 16)) + ((G[6] << 16) | (G[6] >>> 16))) | 0;\n\t X[1] = (G[1] + ((G[0] << 8) | (G[0] >>> 24)) + G[7]) | 0;\n\t X[2] = (G[2] + ((G[1] << 16) | (G[1] >>> 16)) + ((G[0] << 16) | (G[0] >>> 16))) | 0;\n\t X[3] = (G[3] + ((G[2] << 8) | (G[2] >>> 24)) + G[1]) | 0;\n\t X[4] = (G[4] + ((G[3] << 16) | (G[3] >>> 16)) + ((G[2] << 16) | (G[2] >>> 16))) | 0;\n\t X[5] = (G[5] + ((G[4] << 8) | (G[4] >>> 24)) + G[3]) | 0;\n\t X[6] = (G[6] + ((G[5] << 16) | (G[5] >>> 16)) + ((G[4] << 16) | (G[4] >>> 16))) | 0;\n\t X[7] = (G[7] + ((G[6] << 8) | (G[6] >>> 24)) + G[5]) | 0;\n\t }\n\n\t /**\n\t * Shortcut functions to the cipher's object interface.\n\t *\n\t * @example\n\t *\n\t * var ciphertext = CryptoJS.RabbitLegacy.encrypt(message, key, cfg);\n\t * var plaintext = CryptoJS.RabbitLegacy.decrypt(ciphertext, key, cfg);\n\t */\n\t C.RabbitLegacy = StreamCipher._createHelper(RabbitLegacy);\n\t}());\n\n\n\treturn CryptoJS.RabbitLegacy;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./enc-base64\"), require(\"./md5\"), require(\"./evpkdf\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./enc-base64\", \"./md5\", \"./evpkdf\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var StreamCipher = C_lib.StreamCipher;\n\t var C_algo = C.algo;\n\n\t // Reusable objects\n\t var S = [];\n\t var C_ = [];\n\t var G = [];\n\n\t /**\n\t * Rabbit stream cipher algorithm\n\t */\n\t var Rabbit = C_algo.Rabbit = StreamCipher.extend({\n\t _doReset: function () {\n\t // Shortcuts\n\t var K = this._key.words;\n\t var iv = this.cfg.iv;\n\n\t // Swap endian\n\t for (var i = 0; i < 4; i++) {\n\t K[i] = (((K[i] << 8) | (K[i] >>> 24)) & 0x00ff00ff) |\n\t (((K[i] << 24) | (K[i] >>> 8)) & 0xff00ff00);\n\t }\n\n\t // Generate initial state values\n\t var X = this._X = [\n\t K[0], (K[3] << 16) | (K[2] >>> 16),\n\t K[1], (K[0] << 16) | (K[3] >>> 16),\n\t K[2], (K[1] << 16) | (K[0] >>> 16),\n\t K[3], (K[2] << 16) | (K[1] >>> 16)\n\t ];\n\n\t // Generate initial counter values\n\t var C = this._C = [\n\t (K[2] << 16) | (K[2] >>> 16), (K[0] & 0xffff0000) | (K[1] & 0x0000ffff),\n\t (K[3] << 16) | (K[3] >>> 16), (K[1] & 0xffff0000) | (K[2] & 0x0000ffff),\n\t (K[0] << 16) | (K[0] >>> 16), (K[2] & 0xffff0000) | (K[3] & 0x0000ffff),\n\t (K[1] << 16) | (K[1] >>> 16), (K[3] & 0xffff0000) | (K[0] & 0x0000ffff)\n\t ];\n\n\t // Carry bit\n\t this._b = 0;\n\n\t // Iterate the system four times\n\t for (var i = 0; i < 4; i++) {\n\t nextState.call(this);\n\t }\n\n\t // Modify the counters\n\t for (var i = 0; i < 8; i++) {\n\t C[i] ^= X[(i + 4) & 7];\n\t }\n\n\t // IV setup\n\t if (iv) {\n\t // Shortcuts\n\t var IV = iv.words;\n\t var IV_0 = IV[0];\n\t var IV_1 = IV[1];\n\n\t // Generate four subvectors\n\t var i0 = (((IV_0 << 8) | (IV_0 >>> 24)) & 0x00ff00ff) | (((IV_0 << 24) | (IV_0 >>> 8)) & 0xff00ff00);\n\t var i2 = (((IV_1 << 8) | (IV_1 >>> 24)) & 0x00ff00ff) | (((IV_1 << 24) | (IV_1 >>> 8)) & 0xff00ff00);\n\t var i1 = (i0 >>> 16) | (i2 & 0xffff0000);\n\t var i3 = (i2 << 16) | (i0 & 0x0000ffff);\n\n\t // Modify counter values\n\t C[0] ^= i0;\n\t C[1] ^= i1;\n\t C[2] ^= i2;\n\t C[3] ^= i3;\n\t C[4] ^= i0;\n\t C[5] ^= i1;\n\t C[6] ^= i2;\n\t C[7] ^= i3;\n\n\t // Iterate the system four times\n\t for (var i = 0; i < 4; i++) {\n\t nextState.call(this);\n\t }\n\t }\n\t },\n\n\t _doProcessBlock: function (M, offset) {\n\t // Shortcut\n\t var X = this._X;\n\n\t // Iterate the system\n\t nextState.call(this);\n\n\t // Generate four keystream words\n\t S[0] = X[0] ^ (X[5] >>> 16) ^ (X[3] << 16);\n\t S[1] = X[2] ^ (X[7] >>> 16) ^ (X[5] << 16);\n\t S[2] = X[4] ^ (X[1] >>> 16) ^ (X[7] << 16);\n\t S[3] = X[6] ^ (X[3] >>> 16) ^ (X[1] << 16);\n\n\t for (var i = 0; i < 4; i++) {\n\t // Swap endian\n\t S[i] = (((S[i] << 8) | (S[i] >>> 24)) & 0x00ff00ff) |\n\t (((S[i] << 24) | (S[i] >>> 8)) & 0xff00ff00);\n\n\t // Encrypt\n\t M[offset + i] ^= S[i];\n\t }\n\t },\n\n\t blockSize: 128/32,\n\n\t ivSize: 64/32\n\t });\n\n\t function nextState() {\n\t // Shortcuts\n\t var X = this._X;\n\t var C = this._C;\n\n\t // Save old counter values\n\t for (var i = 0; i < 8; i++) {\n\t C_[i] = C[i];\n\t }\n\n\t // Calculate new counter values\n\t C[0] = (C[0] + 0x4d34d34d + this._b) | 0;\n\t C[1] = (C[1] + 0xd34d34d3 + ((C[0] >>> 0) < (C_[0] >>> 0) ? 1 : 0)) | 0;\n\t C[2] = (C[2] + 0x34d34d34 + ((C[1] >>> 0) < (C_[1] >>> 0) ? 1 : 0)) | 0;\n\t C[3] = (C[3] + 0x4d34d34d + ((C[2] >>> 0) < (C_[2] >>> 0) ? 1 : 0)) | 0;\n\t C[4] = (C[4] + 0xd34d34d3 + ((C[3] >>> 0) < (C_[3] >>> 0) ? 1 : 0)) | 0;\n\t C[5] = (C[5] + 0x34d34d34 + ((C[4] >>> 0) < (C_[4] >>> 0) ? 1 : 0)) | 0;\n\t C[6] = (C[6] + 0x4d34d34d + ((C[5] >>> 0) < (C_[5] >>> 0) ? 1 : 0)) | 0;\n\t C[7] = (C[7] + 0xd34d34d3 + ((C[6] >>> 0) < (C_[6] >>> 0) ? 1 : 0)) | 0;\n\t this._b = (C[7] >>> 0) < (C_[7] >>> 0) ? 1 : 0;\n\n\t // Calculate the g-values\n\t for (var i = 0; i < 8; i++) {\n\t var gx = X[i] + C[i];\n\n\t // Construct high and low argument for squaring\n\t var ga = gx & 0xffff;\n\t var gb = gx >>> 16;\n\n\t // Calculate high and low result of squaring\n\t var gh = ((((ga * ga) >>> 17) + ga * gb) >>> 15) + gb * gb;\n\t var gl = (((gx & 0xffff0000) * gx) | 0) + (((gx & 0x0000ffff) * gx) | 0);\n\n\t // High XOR low\n\t G[i] = gh ^ gl;\n\t }\n\n\t // Calculate new state values\n\t X[0] = (G[0] + ((G[7] << 16) | (G[7] >>> 16)) + ((G[6] << 16) | (G[6] >>> 16))) | 0;\n\t X[1] = (G[1] + ((G[0] << 8) | (G[0] >>> 24)) + G[7]) | 0;\n\t X[2] = (G[2] + ((G[1] << 16) | (G[1] >>> 16)) + ((G[0] << 16) | (G[0] >>> 16))) | 0;\n\t X[3] = (G[3] + ((G[2] << 8) | (G[2] >>> 24)) + G[1]) | 0;\n\t X[4] = (G[4] + ((G[3] << 16) | (G[3] >>> 16)) + ((G[2] << 16) | (G[2] >>> 16))) | 0;\n\t X[5] = (G[5] + ((G[4] << 8) | (G[4] >>> 24)) + G[3]) | 0;\n\t X[6] = (G[6] + ((G[5] << 16) | (G[5] >>> 16)) + ((G[4] << 16) | (G[4] >>> 16))) | 0;\n\t X[7] = (G[7] + ((G[6] << 8) | (G[6] >>> 24)) + G[5]) | 0;\n\t }\n\n\t /**\n\t * Shortcut functions to the cipher's object interface.\n\t *\n\t * @example\n\t *\n\t * var ciphertext = CryptoJS.Rabbit.encrypt(message, key, cfg);\n\t * var plaintext = CryptoJS.Rabbit.decrypt(ciphertext, key, cfg);\n\t */\n\t C.Rabbit = StreamCipher._createHelper(Rabbit);\n\t}());\n\n\n\treturn CryptoJS.Rabbit;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./enc-base64\"), require(\"./md5\"), require(\"./evpkdf\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./enc-base64\", \"./md5\", \"./evpkdf\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var StreamCipher = C_lib.StreamCipher;\n\t var C_algo = C.algo;\n\n\t /**\n\t * RC4 stream cipher algorithm.\n\t */\n\t var RC4 = C_algo.RC4 = StreamCipher.extend({\n\t _doReset: function () {\n\t // Shortcuts\n\t var key = this._key;\n\t var keyWords = key.words;\n\t var keySigBytes = key.sigBytes;\n\n\t // Init sbox\n\t var S = this._S = [];\n\t for (var i = 0; i < 256; i++) {\n\t S[i] = i;\n\t }\n\n\t // Key setup\n\t for (var i = 0, j = 0; i < 256; i++) {\n\t var keyByteIndex = i % keySigBytes;\n\t var keyByte = (keyWords[keyByteIndex >>> 2] >>> (24 - (keyByteIndex % 4) * 8)) & 0xff;\n\n\t j = (j + S[i] + keyByte) % 256;\n\n\t // Swap\n\t var t = S[i];\n\t S[i] = S[j];\n\t S[j] = t;\n\t }\n\n\t // Counters\n\t this._i = this._j = 0;\n\t },\n\n\t _doProcessBlock: function (M, offset) {\n\t M[offset] ^= generateKeystreamWord.call(this);\n\t },\n\n\t keySize: 256/32,\n\n\t ivSize: 0\n\t });\n\n\t function generateKeystreamWord() {\n\t // Shortcuts\n\t var S = this._S;\n\t var i = this._i;\n\t var j = this._j;\n\n\t // Generate keystream word\n\t var keystreamWord = 0;\n\t for (var n = 0; n < 4; n++) {\n\t i = (i + 1) % 256;\n\t j = (j + S[i]) % 256;\n\n\t // Swap\n\t var t = S[i];\n\t S[i] = S[j];\n\t S[j] = t;\n\n\t keystreamWord |= S[(S[i] + S[j]) % 256] << (24 - n * 8);\n\t }\n\n\t // Update counters\n\t this._i = i;\n\t this._j = j;\n\n\t return keystreamWord;\n\t }\n\n\t /**\n\t * Shortcut functions to the cipher's object interface.\n\t *\n\t * @example\n\t *\n\t * var ciphertext = CryptoJS.RC4.encrypt(message, key, cfg);\n\t * var plaintext = CryptoJS.RC4.decrypt(ciphertext, key, cfg);\n\t */\n\t C.RC4 = StreamCipher._createHelper(RC4);\n\n\t /**\n\t * Modified RC4 stream cipher algorithm.\n\t */\n\t var RC4Drop = C_algo.RC4Drop = RC4.extend({\n\t /**\n\t * Configuration options.\n\t *\n\t * @property {number} drop The number of keystream words to drop. Default 192\n\t */\n\t cfg: RC4.cfg.extend({\n\t drop: 192\n\t }),\n\n\t _doReset: function () {\n\t RC4._doReset.call(this);\n\n\t // Drop\n\t for (var i = this.cfg.drop; i > 0; i--) {\n\t generateKeystreamWord.call(this);\n\t }\n\t }\n\t });\n\n\t /**\n\t * Shortcut functions to the cipher's object interface.\n\t *\n\t * @example\n\t *\n\t * var ciphertext = CryptoJS.RC4Drop.encrypt(message, key, cfg);\n\t * var plaintext = CryptoJS.RC4Drop.decrypt(ciphertext, key, cfg);\n\t */\n\t C.RC4Drop = StreamCipher._createHelper(RC4Drop);\n\t}());\n\n\n\treturn CryptoJS.RC4;\n\n}));",";(function (root, factory) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t/** @preserve\n\t(c) 2012 by Cédric Mesnil. All rights reserved.\n\n\tRedistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met:\n\n\t - Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer.\n\t - Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution.\n\n\tTHIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n\t*/\n\n\t(function (Math) {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var WordArray = C_lib.WordArray;\n\t var Hasher = C_lib.Hasher;\n\t var C_algo = C.algo;\n\n\t // Constants table\n\t var _zl = WordArray.create([\n\t 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15,\n\t 7, 4, 13, 1, 10, 6, 15, 3, 12, 0, 9, 5, 2, 14, 11, 8,\n\t 3, 10, 14, 4, 9, 15, 8, 1, 2, 7, 0, 6, 13, 11, 5, 12,\n\t 1, 9, 11, 10, 0, 8, 12, 4, 13, 3, 7, 15, 14, 5, 6, 2,\n\t 4, 0, 5, 9, 7, 12, 2, 10, 14, 1, 3, 8, 11, 6, 15, 13]);\n\t var _zr = WordArray.create([\n\t 5, 14, 7, 0, 9, 2, 11, 4, 13, 6, 15, 8, 1, 10, 3, 12,\n\t 6, 11, 3, 7, 0, 13, 5, 10, 14, 15, 8, 12, 4, 9, 1, 2,\n\t 15, 5, 1, 3, 7, 14, 6, 9, 11, 8, 12, 2, 10, 0, 4, 13,\n\t 8, 6, 4, 1, 3, 11, 15, 0, 5, 12, 2, 13, 9, 7, 10, 14,\n\t 12, 15, 10, 4, 1, 5, 8, 7, 6, 2, 13, 14, 0, 3, 9, 11]);\n\t var _sl = WordArray.create([\n\t 11, 14, 15, 12, 5, 8, 7, 9, 11, 13, 14, 15, 6, 7, 9, 8,\n\t 7, 6, 8, 13, 11, 9, 7, 15, 7, 12, 15, 9, 11, 7, 13, 12,\n\t 11, 13, 6, 7, 14, 9, 13, 15, 14, 8, 13, 6, 5, 12, 7, 5,\n\t 11, 12, 14, 15, 14, 15, 9, 8, 9, 14, 5, 6, 8, 6, 5, 12,\n\t 9, 15, 5, 11, 6, 8, 13, 12, 5, 12, 13, 14, 11, 8, 5, 6 ]);\n\t var _sr = WordArray.create([\n\t 8, 9, 9, 11, 13, 15, 15, 5, 7, 7, 8, 11, 14, 14, 12, 6,\n\t 9, 13, 15, 7, 12, 8, 9, 11, 7, 7, 12, 7, 6, 15, 13, 11,\n\t 9, 7, 15, 11, 8, 6, 6, 14, 12, 13, 5, 14, 13, 13, 7, 5,\n\t 15, 5, 8, 11, 14, 14, 6, 14, 6, 9, 12, 9, 12, 5, 15, 8,\n\t 8, 5, 12, 9, 12, 5, 14, 6, 8, 13, 6, 5, 15, 13, 11, 11 ]);\n\n\t var _hl = WordArray.create([ 0x00000000, 0x5A827999, 0x6ED9EBA1, 0x8F1BBCDC, 0xA953FD4E]);\n\t var _hr = WordArray.create([ 0x50A28BE6, 0x5C4DD124, 0x6D703EF3, 0x7A6D76E9, 0x00000000]);\n\n\t /**\n\t * RIPEMD160 hash algorithm.\n\t */\n\t var RIPEMD160 = C_algo.RIPEMD160 = Hasher.extend({\n\t _doReset: function () {\n\t this._hash = WordArray.create([0x67452301, 0xEFCDAB89, 0x98BADCFE, 0x10325476, 0xC3D2E1F0]);\n\t },\n\n\t _doProcessBlock: function (M, offset) {\n\n\t // Swap endian\n\t for (var i = 0; i < 16; i++) {\n\t // Shortcuts\n\t var offset_i = offset + i;\n\t var M_offset_i = M[offset_i];\n\n\t // Swap\n\t M[offset_i] = (\n\t (((M_offset_i << 8) | (M_offset_i >>> 24)) & 0x00ff00ff) |\n\t (((M_offset_i << 24) | (M_offset_i >>> 8)) & 0xff00ff00)\n\t );\n\t }\n\t // Shortcut\n\t var H = this._hash.words;\n\t var hl = _hl.words;\n\t var hr = _hr.words;\n\t var zl = _zl.words;\n\t var zr = _zr.words;\n\t var sl = _sl.words;\n\t var sr = _sr.words;\n\n\t // Working variables\n\t var al, bl, cl, dl, el;\n\t var ar, br, cr, dr, er;\n\n\t ar = al = H[0];\n\t br = bl = H[1];\n\t cr = cl = H[2];\n\t dr = dl = H[3];\n\t er = el = H[4];\n\t // Computation\n\t var t;\n\t for (var i = 0; i < 80; i += 1) {\n\t t = (al + M[offset+zl[i]])|0;\n\t if (i<16){\n\t\t t += f1(bl,cl,dl) + hl[0];\n\t } else if (i<32) {\n\t\t t += f2(bl,cl,dl) + hl[1];\n\t } else if (i<48) {\n\t\t t += f3(bl,cl,dl) + hl[2];\n\t } else if (i<64) {\n\t\t t += f4(bl,cl,dl) + hl[3];\n\t } else {// if (i<80) {\n\t\t t += f5(bl,cl,dl) + hl[4];\n\t }\n\t t = t|0;\n\t t = rotl(t,sl[i]);\n\t t = (t+el)|0;\n\t al = el;\n\t el = dl;\n\t dl = rotl(cl, 10);\n\t cl = bl;\n\t bl = t;\n\n\t t = (ar + M[offset+zr[i]])|0;\n\t if (i<16){\n\t\t t += f5(br,cr,dr) + hr[0];\n\t } else if (i<32) {\n\t\t t += f4(br,cr,dr) + hr[1];\n\t } else if (i<48) {\n\t\t t += f3(br,cr,dr) + hr[2];\n\t } else if (i<64) {\n\t\t t += f2(br,cr,dr) + hr[3];\n\t } else {// if (i<80) {\n\t\t t += f1(br,cr,dr) + hr[4];\n\t }\n\t t = t|0;\n\t t = rotl(t,sr[i]) ;\n\t t = (t+er)|0;\n\t ar = er;\n\t er = dr;\n\t dr = rotl(cr, 10);\n\t cr = br;\n\t br = t;\n\t }\n\t // Intermediate hash value\n\t t = (H[1] + cl + dr)|0;\n\t H[1] = (H[2] + dl + er)|0;\n\t H[2] = (H[3] + el + ar)|0;\n\t H[3] = (H[4] + al + br)|0;\n\t H[4] = (H[0] + bl + cr)|0;\n\t H[0] = t;\n\t },\n\n\t _doFinalize: function () {\n\t // Shortcuts\n\t var data = this._data;\n\t var dataWords = data.words;\n\n\t var nBitsTotal = this._nDataBytes * 8;\n\t var nBitsLeft = data.sigBytes * 8;\n\n\t // Add padding\n\t dataWords[nBitsLeft >>> 5] |= 0x80 << (24 - nBitsLeft % 32);\n\t dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 14] = (\n\t (((nBitsTotal << 8) | (nBitsTotal >>> 24)) & 0x00ff00ff) |\n\t (((nBitsTotal << 24) | (nBitsTotal >>> 8)) & 0xff00ff00)\n\t );\n\t data.sigBytes = (dataWords.length + 1) * 4;\n\n\t // Hash final blocks\n\t this._process();\n\n\t // Shortcuts\n\t var hash = this._hash;\n\t var H = hash.words;\n\n\t // Swap endian\n\t for (var i = 0; i < 5; i++) {\n\t // Shortcut\n\t var H_i = H[i];\n\n\t // Swap\n\t H[i] = (((H_i << 8) | (H_i >>> 24)) & 0x00ff00ff) |\n\t (((H_i << 24) | (H_i >>> 8)) & 0xff00ff00);\n\t }\n\n\t // Return final computed hash\n\t return hash;\n\t },\n\n\t clone: function () {\n\t var clone = Hasher.clone.call(this);\n\t clone._hash = this._hash.clone();\n\n\t return clone;\n\t }\n\t });\n\n\n\t function f1(x, y, z) {\n\t return ((x) ^ (y) ^ (z));\n\n\t }\n\n\t function f2(x, y, z) {\n\t return (((x)&(y)) | ((~x)&(z)));\n\t }\n\n\t function f3(x, y, z) {\n\t return (((x) | (~(y))) ^ (z));\n\t }\n\n\t function f4(x, y, z) {\n\t return (((x) & (z)) | ((y)&(~(z))));\n\t }\n\n\t function f5(x, y, z) {\n\t return ((x) ^ ((y) |(~(z))));\n\n\t }\n\n\t function rotl(x,n) {\n\t return (x<>>(32-n));\n\t }\n\n\n\t /**\n\t * Shortcut function to the hasher's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t *\n\t * @return {WordArray} The hash.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hash = CryptoJS.RIPEMD160('message');\n\t * var hash = CryptoJS.RIPEMD160(wordArray);\n\t */\n\t C.RIPEMD160 = Hasher._createHelper(RIPEMD160);\n\n\t /**\n\t * Shortcut function to the HMAC's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t * @param {WordArray|string} key The secret key.\n\t *\n\t * @return {WordArray} The HMAC.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hmac = CryptoJS.HmacRIPEMD160(message, key);\n\t */\n\t C.HmacRIPEMD160 = Hasher._createHmacHelper(RIPEMD160);\n\t}(Math));\n\n\n\treturn CryptoJS.RIPEMD160;\n\n}));",";(function (root, factory) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var WordArray = C_lib.WordArray;\n\t var Hasher = C_lib.Hasher;\n\t var C_algo = C.algo;\n\n\t // Reusable object\n\t var W = [];\n\n\t /**\n\t * SHA-1 hash algorithm.\n\t */\n\t var SHA1 = C_algo.SHA1 = Hasher.extend({\n\t _doReset: function () {\n\t this._hash = new WordArray.init([\n\t 0x67452301, 0xefcdab89,\n\t 0x98badcfe, 0x10325476,\n\t 0xc3d2e1f0\n\t ]);\n\t },\n\n\t _doProcessBlock: function (M, offset) {\n\t // Shortcut\n\t var H = this._hash.words;\n\n\t // Working variables\n\t var a = H[0];\n\t var b = H[1];\n\t var c = H[2];\n\t var d = H[3];\n\t var e = H[4];\n\n\t // Computation\n\t for (var i = 0; i < 80; i++) {\n\t if (i < 16) {\n\t W[i] = M[offset + i] | 0;\n\t } else {\n\t var n = W[i - 3] ^ W[i - 8] ^ W[i - 14] ^ W[i - 16];\n\t W[i] = (n << 1) | (n >>> 31);\n\t }\n\n\t var t = ((a << 5) | (a >>> 27)) + e + W[i];\n\t if (i < 20) {\n\t t += ((b & c) | (~b & d)) + 0x5a827999;\n\t } else if (i < 40) {\n\t t += (b ^ c ^ d) + 0x6ed9eba1;\n\t } else if (i < 60) {\n\t t += ((b & c) | (b & d) | (c & d)) - 0x70e44324;\n\t } else /* if (i < 80) */ {\n\t t += (b ^ c ^ d) - 0x359d3e2a;\n\t }\n\n\t e = d;\n\t d = c;\n\t c = (b << 30) | (b >>> 2);\n\t b = a;\n\t a = t;\n\t }\n\n\t // Intermediate hash value\n\t H[0] = (H[0] + a) | 0;\n\t H[1] = (H[1] + b) | 0;\n\t H[2] = (H[2] + c) | 0;\n\t H[3] = (H[3] + d) | 0;\n\t H[4] = (H[4] + e) | 0;\n\t },\n\n\t _doFinalize: function () {\n\t // Shortcuts\n\t var data = this._data;\n\t var dataWords = data.words;\n\n\t var nBitsTotal = this._nDataBytes * 8;\n\t var nBitsLeft = data.sigBytes * 8;\n\n\t // Add padding\n\t dataWords[nBitsLeft >>> 5] |= 0x80 << (24 - nBitsLeft % 32);\n\t dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 14] = Math.floor(nBitsTotal / 0x100000000);\n\t dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 15] = nBitsTotal;\n\t data.sigBytes = dataWords.length * 4;\n\n\t // Hash final blocks\n\t this._process();\n\n\t // Return final computed hash\n\t return this._hash;\n\t },\n\n\t clone: function () {\n\t var clone = Hasher.clone.call(this);\n\t clone._hash = this._hash.clone();\n\n\t return clone;\n\t }\n\t });\n\n\t /**\n\t * Shortcut function to the hasher's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t *\n\t * @return {WordArray} The hash.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hash = CryptoJS.SHA1('message');\n\t * var hash = CryptoJS.SHA1(wordArray);\n\t */\n\t C.SHA1 = Hasher._createHelper(SHA1);\n\n\t /**\n\t * Shortcut function to the HMAC's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t * @param {WordArray|string} key The secret key.\n\t *\n\t * @return {WordArray} The HMAC.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hmac = CryptoJS.HmacSHA1(message, key);\n\t */\n\t C.HmacSHA1 = Hasher._createHmacHelper(SHA1);\n\t}());\n\n\n\treturn CryptoJS.SHA1;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./sha256\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./sha256\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var WordArray = C_lib.WordArray;\n\t var C_algo = C.algo;\n\t var SHA256 = C_algo.SHA256;\n\n\t /**\n\t * SHA-224 hash algorithm.\n\t */\n\t var SHA224 = C_algo.SHA224 = SHA256.extend({\n\t _doReset: function () {\n\t this._hash = new WordArray.init([\n\t 0xc1059ed8, 0x367cd507, 0x3070dd17, 0xf70e5939,\n\t 0xffc00b31, 0x68581511, 0x64f98fa7, 0xbefa4fa4\n\t ]);\n\t },\n\n\t _doFinalize: function () {\n\t var hash = SHA256._doFinalize.call(this);\n\n\t hash.sigBytes -= 4;\n\n\t return hash;\n\t }\n\t });\n\n\t /**\n\t * Shortcut function to the hasher's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t *\n\t * @return {WordArray} The hash.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hash = CryptoJS.SHA224('message');\n\t * var hash = CryptoJS.SHA224(wordArray);\n\t */\n\t C.SHA224 = SHA256._createHelper(SHA224);\n\n\t /**\n\t * Shortcut function to the HMAC's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t * @param {WordArray|string} key The secret key.\n\t *\n\t * @return {WordArray} The HMAC.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hmac = CryptoJS.HmacSHA224(message, key);\n\t */\n\t C.HmacSHA224 = SHA256._createHmacHelper(SHA224);\n\t}());\n\n\n\treturn CryptoJS.SHA224;\n\n}));",";(function (root, factory) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function (Math) {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var WordArray = C_lib.WordArray;\n\t var Hasher = C_lib.Hasher;\n\t var C_algo = C.algo;\n\n\t // Initialization and round constants tables\n\t var H = [];\n\t var K = [];\n\n\t // Compute constants\n\t (function () {\n\t function isPrime(n) {\n\t var sqrtN = Math.sqrt(n);\n\t for (var factor = 2; factor <= sqrtN; factor++) {\n\t if (!(n % factor)) {\n\t return false;\n\t }\n\t }\n\n\t return true;\n\t }\n\n\t function getFractionalBits(n) {\n\t return ((n - (n | 0)) * 0x100000000) | 0;\n\t }\n\n\t var n = 2;\n\t var nPrime = 0;\n\t while (nPrime < 64) {\n\t if (isPrime(n)) {\n\t if (nPrime < 8) {\n\t H[nPrime] = getFractionalBits(Math.pow(n, 1 / 2));\n\t }\n\t K[nPrime] = getFractionalBits(Math.pow(n, 1 / 3));\n\n\t nPrime++;\n\t }\n\n\t n++;\n\t }\n\t }());\n\n\t // Reusable object\n\t var W = [];\n\n\t /**\n\t * SHA-256 hash algorithm.\n\t */\n\t var SHA256 = C_algo.SHA256 = Hasher.extend({\n\t _doReset: function () {\n\t this._hash = new WordArray.init(H.slice(0));\n\t },\n\n\t _doProcessBlock: function (M, offset) {\n\t // Shortcut\n\t var H = this._hash.words;\n\n\t // Working variables\n\t var a = H[0];\n\t var b = H[1];\n\t var c = H[2];\n\t var d = H[3];\n\t var e = H[4];\n\t var f = H[5];\n\t var g = H[6];\n\t var h = H[7];\n\n\t // Computation\n\t for (var i = 0; i < 64; i++) {\n\t if (i < 16) {\n\t W[i] = M[offset + i] | 0;\n\t } else {\n\t var gamma0x = W[i - 15];\n\t var gamma0 = ((gamma0x << 25) | (gamma0x >>> 7)) ^\n\t ((gamma0x << 14) | (gamma0x >>> 18)) ^\n\t (gamma0x >>> 3);\n\n\t var gamma1x = W[i - 2];\n\t var gamma1 = ((gamma1x << 15) | (gamma1x >>> 17)) ^\n\t ((gamma1x << 13) | (gamma1x >>> 19)) ^\n\t (gamma1x >>> 10);\n\n\t W[i] = gamma0 + W[i - 7] + gamma1 + W[i - 16];\n\t }\n\n\t var ch = (e & f) ^ (~e & g);\n\t var maj = (a & b) ^ (a & c) ^ (b & c);\n\n\t var sigma0 = ((a << 30) | (a >>> 2)) ^ ((a << 19) | (a >>> 13)) ^ ((a << 10) | (a >>> 22));\n\t var sigma1 = ((e << 26) | (e >>> 6)) ^ ((e << 21) | (e >>> 11)) ^ ((e << 7) | (e >>> 25));\n\n\t var t1 = h + sigma1 + ch + K[i] + W[i];\n\t var t2 = sigma0 + maj;\n\n\t h = g;\n\t g = f;\n\t f = e;\n\t e = (d + t1) | 0;\n\t d = c;\n\t c = b;\n\t b = a;\n\t a = (t1 + t2) | 0;\n\t }\n\n\t // Intermediate hash value\n\t H[0] = (H[0] + a) | 0;\n\t H[1] = (H[1] + b) | 0;\n\t H[2] = (H[2] + c) | 0;\n\t H[3] = (H[3] + d) | 0;\n\t H[4] = (H[4] + e) | 0;\n\t H[5] = (H[5] + f) | 0;\n\t H[6] = (H[6] + g) | 0;\n\t H[7] = (H[7] + h) | 0;\n\t },\n\n\t _doFinalize: function () {\n\t // Shortcuts\n\t var data = this._data;\n\t var dataWords = data.words;\n\n\t var nBitsTotal = this._nDataBytes * 8;\n\t var nBitsLeft = data.sigBytes * 8;\n\n\t // Add padding\n\t dataWords[nBitsLeft >>> 5] |= 0x80 << (24 - nBitsLeft % 32);\n\t dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 14] = Math.floor(nBitsTotal / 0x100000000);\n\t dataWords[(((nBitsLeft + 64) >>> 9) << 4) + 15] = nBitsTotal;\n\t data.sigBytes = dataWords.length * 4;\n\n\t // Hash final blocks\n\t this._process();\n\n\t // Return final computed hash\n\t return this._hash;\n\t },\n\n\t clone: function () {\n\t var clone = Hasher.clone.call(this);\n\t clone._hash = this._hash.clone();\n\n\t return clone;\n\t }\n\t });\n\n\t /**\n\t * Shortcut function to the hasher's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t *\n\t * @return {WordArray} The hash.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hash = CryptoJS.SHA256('message');\n\t * var hash = CryptoJS.SHA256(wordArray);\n\t */\n\t C.SHA256 = Hasher._createHelper(SHA256);\n\n\t /**\n\t * Shortcut function to the HMAC's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t * @param {WordArray|string} key The secret key.\n\t *\n\t * @return {WordArray} The HMAC.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hmac = CryptoJS.HmacSHA256(message, key);\n\t */\n\t C.HmacSHA256 = Hasher._createHmacHelper(SHA256);\n\t}(Math));\n\n\n\treturn CryptoJS.SHA256;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./x64-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./x64-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function (Math) {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var WordArray = C_lib.WordArray;\n\t var Hasher = C_lib.Hasher;\n\t var C_x64 = C.x64;\n\t var X64Word = C_x64.Word;\n\t var C_algo = C.algo;\n\n\t // Constants tables\n\t var RHO_OFFSETS = [];\n\t var PI_INDEXES = [];\n\t var ROUND_CONSTANTS = [];\n\n\t // Compute Constants\n\t (function () {\n\t // Compute rho offset constants\n\t var x = 1, y = 0;\n\t for (var t = 0; t < 24; t++) {\n\t RHO_OFFSETS[x + 5 * y] = ((t + 1) * (t + 2) / 2) % 64;\n\n\t var newX = y % 5;\n\t var newY = (2 * x + 3 * y) % 5;\n\t x = newX;\n\t y = newY;\n\t }\n\n\t // Compute pi index constants\n\t for (var x = 0; x < 5; x++) {\n\t for (var y = 0; y < 5; y++) {\n\t PI_INDEXES[x + 5 * y] = y + ((2 * x + 3 * y) % 5) * 5;\n\t }\n\t }\n\n\t // Compute round constants\n\t var LFSR = 0x01;\n\t for (var i = 0; i < 24; i++) {\n\t var roundConstantMsw = 0;\n\t var roundConstantLsw = 0;\n\n\t for (var j = 0; j < 7; j++) {\n\t if (LFSR & 0x01) {\n\t var bitPosition = (1 << j) - 1;\n\t if (bitPosition < 32) {\n\t roundConstantLsw ^= 1 << bitPosition;\n\t } else /* if (bitPosition >= 32) */ {\n\t roundConstantMsw ^= 1 << (bitPosition - 32);\n\t }\n\t }\n\n\t // Compute next LFSR\n\t if (LFSR & 0x80) {\n\t // Primitive polynomial over GF(2): x^8 + x^6 + x^5 + x^4 + 1\n\t LFSR = (LFSR << 1) ^ 0x71;\n\t } else {\n\t LFSR <<= 1;\n\t }\n\t }\n\n\t ROUND_CONSTANTS[i] = X64Word.create(roundConstantMsw, roundConstantLsw);\n\t }\n\t }());\n\n\t // Reusable objects for temporary values\n\t var T = [];\n\t (function () {\n\t for (var i = 0; i < 25; i++) {\n\t T[i] = X64Word.create();\n\t }\n\t }());\n\n\t /**\n\t * SHA-3 hash algorithm.\n\t */\n\t var SHA3 = C_algo.SHA3 = Hasher.extend({\n\t /**\n\t * Configuration options.\n\t *\n\t * @property {number} outputLength\n\t * The desired number of bits in the output hash.\n\t * Only values permitted are: 224, 256, 384, 512.\n\t * Default: 512\n\t */\n\t cfg: Hasher.cfg.extend({\n\t outputLength: 512\n\t }),\n\n\t _doReset: function () {\n\t var state = this._state = []\n\t for (var i = 0; i < 25; i++) {\n\t state[i] = new X64Word.init();\n\t }\n\n\t this.blockSize = (1600 - 2 * this.cfg.outputLength) / 32;\n\t },\n\n\t _doProcessBlock: function (M, offset) {\n\t // Shortcuts\n\t var state = this._state;\n\t var nBlockSizeLanes = this.blockSize / 2;\n\n\t // Absorb\n\t for (var i = 0; i < nBlockSizeLanes; i++) {\n\t // Shortcuts\n\t var M2i = M[offset + 2 * i];\n\t var M2i1 = M[offset + 2 * i + 1];\n\n\t // Swap endian\n\t M2i = (\n\t (((M2i << 8) | (M2i >>> 24)) & 0x00ff00ff) |\n\t (((M2i << 24) | (M2i >>> 8)) & 0xff00ff00)\n\t );\n\t M2i1 = (\n\t (((M2i1 << 8) | (M2i1 >>> 24)) & 0x00ff00ff) |\n\t (((M2i1 << 24) | (M2i1 >>> 8)) & 0xff00ff00)\n\t );\n\n\t // Absorb message into state\n\t var lane = state[i];\n\t lane.high ^= M2i1;\n\t lane.low ^= M2i;\n\t }\n\n\t // Rounds\n\t for (var round = 0; round < 24; round++) {\n\t // Theta\n\t for (var x = 0; x < 5; x++) {\n\t // Mix column lanes\n\t var tMsw = 0, tLsw = 0;\n\t for (var y = 0; y < 5; y++) {\n\t var lane = state[x + 5 * y];\n\t tMsw ^= lane.high;\n\t tLsw ^= lane.low;\n\t }\n\n\t // Temporary values\n\t var Tx = T[x];\n\t Tx.high = tMsw;\n\t Tx.low = tLsw;\n\t }\n\t for (var x = 0; x < 5; x++) {\n\t // Shortcuts\n\t var Tx4 = T[(x + 4) % 5];\n\t var Tx1 = T[(x + 1) % 5];\n\t var Tx1Msw = Tx1.high;\n\t var Tx1Lsw = Tx1.low;\n\n\t // Mix surrounding columns\n\t var tMsw = Tx4.high ^ ((Tx1Msw << 1) | (Tx1Lsw >>> 31));\n\t var tLsw = Tx4.low ^ ((Tx1Lsw << 1) | (Tx1Msw >>> 31));\n\t for (var y = 0; y < 5; y++) {\n\t var lane = state[x + 5 * y];\n\t lane.high ^= tMsw;\n\t lane.low ^= tLsw;\n\t }\n\t }\n\n\t // Rho Pi\n\t for (var laneIndex = 1; laneIndex < 25; laneIndex++) {\n\t var tMsw;\n\t var tLsw;\n\n\t // Shortcuts\n\t var lane = state[laneIndex];\n\t var laneMsw = lane.high;\n\t var laneLsw = lane.low;\n\t var rhoOffset = RHO_OFFSETS[laneIndex];\n\n\t // Rotate lanes\n\t if (rhoOffset < 32) {\n\t tMsw = (laneMsw << rhoOffset) | (laneLsw >>> (32 - rhoOffset));\n\t tLsw = (laneLsw << rhoOffset) | (laneMsw >>> (32 - rhoOffset));\n\t } else /* if (rhoOffset >= 32) */ {\n\t tMsw = (laneLsw << (rhoOffset - 32)) | (laneMsw >>> (64 - rhoOffset));\n\t tLsw = (laneMsw << (rhoOffset - 32)) | (laneLsw >>> (64 - rhoOffset));\n\t }\n\n\t // Transpose lanes\n\t var TPiLane = T[PI_INDEXES[laneIndex]];\n\t TPiLane.high = tMsw;\n\t TPiLane.low = tLsw;\n\t }\n\n\t // Rho pi at x = y = 0\n\t var T0 = T[0];\n\t var state0 = state[0];\n\t T0.high = state0.high;\n\t T0.low = state0.low;\n\n\t // Chi\n\t for (var x = 0; x < 5; x++) {\n\t for (var y = 0; y < 5; y++) {\n\t // Shortcuts\n\t var laneIndex = x + 5 * y;\n\t var lane = state[laneIndex];\n\t var TLane = T[laneIndex];\n\t var Tx1Lane = T[((x + 1) % 5) + 5 * y];\n\t var Tx2Lane = T[((x + 2) % 5) + 5 * y];\n\n\t // Mix rows\n\t lane.high = TLane.high ^ (~Tx1Lane.high & Tx2Lane.high);\n\t lane.low = TLane.low ^ (~Tx1Lane.low & Tx2Lane.low);\n\t }\n\t }\n\n\t // Iota\n\t var lane = state[0];\n\t var roundConstant = ROUND_CONSTANTS[round];\n\t lane.high ^= roundConstant.high;\n\t lane.low ^= roundConstant.low;\n\t }\n\t },\n\n\t _doFinalize: function () {\n\t // Shortcuts\n\t var data = this._data;\n\t var dataWords = data.words;\n\t var nBitsTotal = this._nDataBytes * 8;\n\t var nBitsLeft = data.sigBytes * 8;\n\t var blockSizeBits = this.blockSize * 32;\n\n\t // Add padding\n\t dataWords[nBitsLeft >>> 5] |= 0x1 << (24 - nBitsLeft % 32);\n\t dataWords[((Math.ceil((nBitsLeft + 1) / blockSizeBits) * blockSizeBits) >>> 5) - 1] |= 0x80;\n\t data.sigBytes = dataWords.length * 4;\n\n\t // Hash final blocks\n\t this._process();\n\n\t // Shortcuts\n\t var state = this._state;\n\t var outputLengthBytes = this.cfg.outputLength / 8;\n\t var outputLengthLanes = outputLengthBytes / 8;\n\n\t // Squeeze\n\t var hashWords = [];\n\t for (var i = 0; i < outputLengthLanes; i++) {\n\t // Shortcuts\n\t var lane = state[i];\n\t var laneMsw = lane.high;\n\t var laneLsw = lane.low;\n\n\t // Swap endian\n\t laneMsw = (\n\t (((laneMsw << 8) | (laneMsw >>> 24)) & 0x00ff00ff) |\n\t (((laneMsw << 24) | (laneMsw >>> 8)) & 0xff00ff00)\n\t );\n\t laneLsw = (\n\t (((laneLsw << 8) | (laneLsw >>> 24)) & 0x00ff00ff) |\n\t (((laneLsw << 24) | (laneLsw >>> 8)) & 0xff00ff00)\n\t );\n\n\t // Squeeze state to retrieve hash\n\t hashWords.push(laneLsw);\n\t hashWords.push(laneMsw);\n\t }\n\n\t // Return final computed hash\n\t return new WordArray.init(hashWords, outputLengthBytes);\n\t },\n\n\t clone: function () {\n\t var clone = Hasher.clone.call(this);\n\n\t var state = clone._state = this._state.slice(0);\n\t for (var i = 0; i < 25; i++) {\n\t state[i] = state[i].clone();\n\t }\n\n\t return clone;\n\t }\n\t });\n\n\t /**\n\t * Shortcut function to the hasher's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t *\n\t * @return {WordArray} The hash.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hash = CryptoJS.SHA3('message');\n\t * var hash = CryptoJS.SHA3(wordArray);\n\t */\n\t C.SHA3 = Hasher._createHelper(SHA3);\n\n\t /**\n\t * Shortcut function to the HMAC's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t * @param {WordArray|string} key The secret key.\n\t *\n\t * @return {WordArray} The HMAC.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hmac = CryptoJS.HmacSHA3(message, key);\n\t */\n\t C.HmacSHA3 = Hasher._createHmacHelper(SHA3);\n\t}(Math));\n\n\n\treturn CryptoJS.SHA3;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./x64-core\"), require(\"./sha512\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./x64-core\", \"./sha512\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_x64 = C.x64;\n\t var X64Word = C_x64.Word;\n\t var X64WordArray = C_x64.WordArray;\n\t var C_algo = C.algo;\n\t var SHA512 = C_algo.SHA512;\n\n\t /**\n\t * SHA-384 hash algorithm.\n\t */\n\t var SHA384 = C_algo.SHA384 = SHA512.extend({\n\t _doReset: function () {\n\t this._hash = new X64WordArray.init([\n\t new X64Word.init(0xcbbb9d5d, 0xc1059ed8), new X64Word.init(0x629a292a, 0x367cd507),\n\t new X64Word.init(0x9159015a, 0x3070dd17), new X64Word.init(0x152fecd8, 0xf70e5939),\n\t new X64Word.init(0x67332667, 0xffc00b31), new X64Word.init(0x8eb44a87, 0x68581511),\n\t new X64Word.init(0xdb0c2e0d, 0x64f98fa7), new X64Word.init(0x47b5481d, 0xbefa4fa4)\n\t ]);\n\t },\n\n\t _doFinalize: function () {\n\t var hash = SHA512._doFinalize.call(this);\n\n\t hash.sigBytes -= 16;\n\n\t return hash;\n\t }\n\t });\n\n\t /**\n\t * Shortcut function to the hasher's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t *\n\t * @return {WordArray} The hash.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hash = CryptoJS.SHA384('message');\n\t * var hash = CryptoJS.SHA384(wordArray);\n\t */\n\t C.SHA384 = SHA512._createHelper(SHA384);\n\n\t /**\n\t * Shortcut function to the HMAC's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t * @param {WordArray|string} key The secret key.\n\t *\n\t * @return {WordArray} The HMAC.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hmac = CryptoJS.HmacSHA384(message, key);\n\t */\n\t C.HmacSHA384 = SHA512._createHmacHelper(SHA384);\n\t}());\n\n\n\treturn CryptoJS.SHA384;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./x64-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./x64-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var Hasher = C_lib.Hasher;\n\t var C_x64 = C.x64;\n\t var X64Word = C_x64.Word;\n\t var X64WordArray = C_x64.WordArray;\n\t var C_algo = C.algo;\n\n\t function X64Word_create() {\n\t return X64Word.create.apply(X64Word, arguments);\n\t }\n\n\t // Constants\n\t var K = [\n\t X64Word_create(0x428a2f98, 0xd728ae22), X64Word_create(0x71374491, 0x23ef65cd),\n\t X64Word_create(0xb5c0fbcf, 0xec4d3b2f), X64Word_create(0xe9b5dba5, 0x8189dbbc),\n\t X64Word_create(0x3956c25b, 0xf348b538), X64Word_create(0x59f111f1, 0xb605d019),\n\t X64Word_create(0x923f82a4, 0xaf194f9b), X64Word_create(0xab1c5ed5, 0xda6d8118),\n\t X64Word_create(0xd807aa98, 0xa3030242), X64Word_create(0x12835b01, 0x45706fbe),\n\t X64Word_create(0x243185be, 0x4ee4b28c), X64Word_create(0x550c7dc3, 0xd5ffb4e2),\n\t X64Word_create(0x72be5d74, 0xf27b896f), X64Word_create(0x80deb1fe, 0x3b1696b1),\n\t X64Word_create(0x9bdc06a7, 0x25c71235), X64Word_create(0xc19bf174, 0xcf692694),\n\t X64Word_create(0xe49b69c1, 0x9ef14ad2), X64Word_create(0xefbe4786, 0x384f25e3),\n\t X64Word_create(0x0fc19dc6, 0x8b8cd5b5), X64Word_create(0x240ca1cc, 0x77ac9c65),\n\t X64Word_create(0x2de92c6f, 0x592b0275), X64Word_create(0x4a7484aa, 0x6ea6e483),\n\t X64Word_create(0x5cb0a9dc, 0xbd41fbd4), X64Word_create(0x76f988da, 0x831153b5),\n\t X64Word_create(0x983e5152, 0xee66dfab), X64Word_create(0xa831c66d, 0x2db43210),\n\t X64Word_create(0xb00327c8, 0x98fb213f), X64Word_create(0xbf597fc7, 0xbeef0ee4),\n\t X64Word_create(0xc6e00bf3, 0x3da88fc2), X64Word_create(0xd5a79147, 0x930aa725),\n\t X64Word_create(0x06ca6351, 0xe003826f), X64Word_create(0x14292967, 0x0a0e6e70),\n\t X64Word_create(0x27b70a85, 0x46d22ffc), X64Word_create(0x2e1b2138, 0x5c26c926),\n\t X64Word_create(0x4d2c6dfc, 0x5ac42aed), X64Word_create(0x53380d13, 0x9d95b3df),\n\t X64Word_create(0x650a7354, 0x8baf63de), X64Word_create(0x766a0abb, 0x3c77b2a8),\n\t X64Word_create(0x81c2c92e, 0x47edaee6), X64Word_create(0x92722c85, 0x1482353b),\n\t X64Word_create(0xa2bfe8a1, 0x4cf10364), X64Word_create(0xa81a664b, 0xbc423001),\n\t X64Word_create(0xc24b8b70, 0xd0f89791), X64Word_create(0xc76c51a3, 0x0654be30),\n\t X64Word_create(0xd192e819, 0xd6ef5218), X64Word_create(0xd6990624, 0x5565a910),\n\t X64Word_create(0xf40e3585, 0x5771202a), X64Word_create(0x106aa070, 0x32bbd1b8),\n\t X64Word_create(0x19a4c116, 0xb8d2d0c8), X64Word_create(0x1e376c08, 0x5141ab53),\n\t X64Word_create(0x2748774c, 0xdf8eeb99), X64Word_create(0x34b0bcb5, 0xe19b48a8),\n\t X64Word_create(0x391c0cb3, 0xc5c95a63), X64Word_create(0x4ed8aa4a, 0xe3418acb),\n\t X64Word_create(0x5b9cca4f, 0x7763e373), X64Word_create(0x682e6ff3, 0xd6b2b8a3),\n\t X64Word_create(0x748f82ee, 0x5defb2fc), X64Word_create(0x78a5636f, 0x43172f60),\n\t X64Word_create(0x84c87814, 0xa1f0ab72), X64Word_create(0x8cc70208, 0x1a6439ec),\n\t X64Word_create(0x90befffa, 0x23631e28), X64Word_create(0xa4506ceb, 0xde82bde9),\n\t X64Word_create(0xbef9a3f7, 0xb2c67915), X64Word_create(0xc67178f2, 0xe372532b),\n\t X64Word_create(0xca273ece, 0xea26619c), X64Word_create(0xd186b8c7, 0x21c0c207),\n\t X64Word_create(0xeada7dd6, 0xcde0eb1e), X64Word_create(0xf57d4f7f, 0xee6ed178),\n\t X64Word_create(0x06f067aa, 0x72176fba), X64Word_create(0x0a637dc5, 0xa2c898a6),\n\t X64Word_create(0x113f9804, 0xbef90dae), X64Word_create(0x1b710b35, 0x131c471b),\n\t X64Word_create(0x28db77f5, 0x23047d84), X64Word_create(0x32caab7b, 0x40c72493),\n\t X64Word_create(0x3c9ebe0a, 0x15c9bebc), X64Word_create(0x431d67c4, 0x9c100d4c),\n\t X64Word_create(0x4cc5d4be, 0xcb3e42b6), X64Word_create(0x597f299c, 0xfc657e2a),\n\t X64Word_create(0x5fcb6fab, 0x3ad6faec), X64Word_create(0x6c44198c, 0x4a475817)\n\t ];\n\n\t // Reusable objects\n\t var W = [];\n\t (function () {\n\t for (var i = 0; i < 80; i++) {\n\t W[i] = X64Word_create();\n\t }\n\t }());\n\n\t /**\n\t * SHA-512 hash algorithm.\n\t */\n\t var SHA512 = C_algo.SHA512 = Hasher.extend({\n\t _doReset: function () {\n\t this._hash = new X64WordArray.init([\n\t new X64Word.init(0x6a09e667, 0xf3bcc908), new X64Word.init(0xbb67ae85, 0x84caa73b),\n\t new X64Word.init(0x3c6ef372, 0xfe94f82b), new X64Word.init(0xa54ff53a, 0x5f1d36f1),\n\t new X64Word.init(0x510e527f, 0xade682d1), new X64Word.init(0x9b05688c, 0x2b3e6c1f),\n\t new X64Word.init(0x1f83d9ab, 0xfb41bd6b), new X64Word.init(0x5be0cd19, 0x137e2179)\n\t ]);\n\t },\n\n\t _doProcessBlock: function (M, offset) {\n\t // Shortcuts\n\t var H = this._hash.words;\n\n\t var H0 = H[0];\n\t var H1 = H[1];\n\t var H2 = H[2];\n\t var H3 = H[3];\n\t var H4 = H[4];\n\t var H5 = H[5];\n\t var H6 = H[6];\n\t var H7 = H[7];\n\n\t var H0h = H0.high;\n\t var H0l = H0.low;\n\t var H1h = H1.high;\n\t var H1l = H1.low;\n\t var H2h = H2.high;\n\t var H2l = H2.low;\n\t var H3h = H3.high;\n\t var H3l = H3.low;\n\t var H4h = H4.high;\n\t var H4l = H4.low;\n\t var H5h = H5.high;\n\t var H5l = H5.low;\n\t var H6h = H6.high;\n\t var H6l = H6.low;\n\t var H7h = H7.high;\n\t var H7l = H7.low;\n\n\t // Working variables\n\t var ah = H0h;\n\t var al = H0l;\n\t var bh = H1h;\n\t var bl = H1l;\n\t var ch = H2h;\n\t var cl = H2l;\n\t var dh = H3h;\n\t var dl = H3l;\n\t var eh = H4h;\n\t var el = H4l;\n\t var fh = H5h;\n\t var fl = H5l;\n\t var gh = H6h;\n\t var gl = H6l;\n\t var hh = H7h;\n\t var hl = H7l;\n\n\t // Rounds\n\t for (var i = 0; i < 80; i++) {\n\t var Wil;\n\t var Wih;\n\n\t // Shortcut\n\t var Wi = W[i];\n\n\t // Extend message\n\t if (i < 16) {\n\t Wih = Wi.high = M[offset + i * 2] | 0;\n\t Wil = Wi.low = M[offset + i * 2 + 1] | 0;\n\t } else {\n\t // Gamma0\n\t var gamma0x = W[i - 15];\n\t var gamma0xh = gamma0x.high;\n\t var gamma0xl = gamma0x.low;\n\t var gamma0h = ((gamma0xh >>> 1) | (gamma0xl << 31)) ^ ((gamma0xh >>> 8) | (gamma0xl << 24)) ^ (gamma0xh >>> 7);\n\t var gamma0l = ((gamma0xl >>> 1) | (gamma0xh << 31)) ^ ((gamma0xl >>> 8) | (gamma0xh << 24)) ^ ((gamma0xl >>> 7) | (gamma0xh << 25));\n\n\t // Gamma1\n\t var gamma1x = W[i - 2];\n\t var gamma1xh = gamma1x.high;\n\t var gamma1xl = gamma1x.low;\n\t var gamma1h = ((gamma1xh >>> 19) | (gamma1xl << 13)) ^ ((gamma1xh << 3) | (gamma1xl >>> 29)) ^ (gamma1xh >>> 6);\n\t var gamma1l = ((gamma1xl >>> 19) | (gamma1xh << 13)) ^ ((gamma1xl << 3) | (gamma1xh >>> 29)) ^ ((gamma1xl >>> 6) | (gamma1xh << 26));\n\n\t // W[i] = gamma0 + W[i - 7] + gamma1 + W[i - 16]\n\t var Wi7 = W[i - 7];\n\t var Wi7h = Wi7.high;\n\t var Wi7l = Wi7.low;\n\n\t var Wi16 = W[i - 16];\n\t var Wi16h = Wi16.high;\n\t var Wi16l = Wi16.low;\n\n\t Wil = gamma0l + Wi7l;\n\t Wih = gamma0h + Wi7h + ((Wil >>> 0) < (gamma0l >>> 0) ? 1 : 0);\n\t Wil = Wil + gamma1l;\n\t Wih = Wih + gamma1h + ((Wil >>> 0) < (gamma1l >>> 0) ? 1 : 0);\n\t Wil = Wil + Wi16l;\n\t Wih = Wih + Wi16h + ((Wil >>> 0) < (Wi16l >>> 0) ? 1 : 0);\n\n\t Wi.high = Wih;\n\t Wi.low = Wil;\n\t }\n\n\t var chh = (eh & fh) ^ (~eh & gh);\n\t var chl = (el & fl) ^ (~el & gl);\n\t var majh = (ah & bh) ^ (ah & ch) ^ (bh & ch);\n\t var majl = (al & bl) ^ (al & cl) ^ (bl & cl);\n\n\t var sigma0h = ((ah >>> 28) | (al << 4)) ^ ((ah << 30) | (al >>> 2)) ^ ((ah << 25) | (al >>> 7));\n\t var sigma0l = ((al >>> 28) | (ah << 4)) ^ ((al << 30) | (ah >>> 2)) ^ ((al << 25) | (ah >>> 7));\n\t var sigma1h = ((eh >>> 14) | (el << 18)) ^ ((eh >>> 18) | (el << 14)) ^ ((eh << 23) | (el >>> 9));\n\t var sigma1l = ((el >>> 14) | (eh << 18)) ^ ((el >>> 18) | (eh << 14)) ^ ((el << 23) | (eh >>> 9));\n\n\t // t1 = h + sigma1 + ch + K[i] + W[i]\n\t var Ki = K[i];\n\t var Kih = Ki.high;\n\t var Kil = Ki.low;\n\n\t var t1l = hl + sigma1l;\n\t var t1h = hh + sigma1h + ((t1l >>> 0) < (hl >>> 0) ? 1 : 0);\n\t var t1l = t1l + chl;\n\t var t1h = t1h + chh + ((t1l >>> 0) < (chl >>> 0) ? 1 : 0);\n\t var t1l = t1l + Kil;\n\t var t1h = t1h + Kih + ((t1l >>> 0) < (Kil >>> 0) ? 1 : 0);\n\t var t1l = t1l + Wil;\n\t var t1h = t1h + Wih + ((t1l >>> 0) < (Wil >>> 0) ? 1 : 0);\n\n\t // t2 = sigma0 + maj\n\t var t2l = sigma0l + majl;\n\t var t2h = sigma0h + majh + ((t2l >>> 0) < (sigma0l >>> 0) ? 1 : 0);\n\n\t // Update working variables\n\t hh = gh;\n\t hl = gl;\n\t gh = fh;\n\t gl = fl;\n\t fh = eh;\n\t fl = el;\n\t el = (dl + t1l) | 0;\n\t eh = (dh + t1h + ((el >>> 0) < (dl >>> 0) ? 1 : 0)) | 0;\n\t dh = ch;\n\t dl = cl;\n\t ch = bh;\n\t cl = bl;\n\t bh = ah;\n\t bl = al;\n\t al = (t1l + t2l) | 0;\n\t ah = (t1h + t2h + ((al >>> 0) < (t1l >>> 0) ? 1 : 0)) | 0;\n\t }\n\n\t // Intermediate hash value\n\t H0l = H0.low = (H0l + al);\n\t H0.high = (H0h + ah + ((H0l >>> 0) < (al >>> 0) ? 1 : 0));\n\t H1l = H1.low = (H1l + bl);\n\t H1.high = (H1h + bh + ((H1l >>> 0) < (bl >>> 0) ? 1 : 0));\n\t H2l = H2.low = (H2l + cl);\n\t H2.high = (H2h + ch + ((H2l >>> 0) < (cl >>> 0) ? 1 : 0));\n\t H3l = H3.low = (H3l + dl);\n\t H3.high = (H3h + dh + ((H3l >>> 0) < (dl >>> 0) ? 1 : 0));\n\t H4l = H4.low = (H4l + el);\n\t H4.high = (H4h + eh + ((H4l >>> 0) < (el >>> 0) ? 1 : 0));\n\t H5l = H5.low = (H5l + fl);\n\t H5.high = (H5h + fh + ((H5l >>> 0) < (fl >>> 0) ? 1 : 0));\n\t H6l = H6.low = (H6l + gl);\n\t H6.high = (H6h + gh + ((H6l >>> 0) < (gl >>> 0) ? 1 : 0));\n\t H7l = H7.low = (H7l + hl);\n\t H7.high = (H7h + hh + ((H7l >>> 0) < (hl >>> 0) ? 1 : 0));\n\t },\n\n\t _doFinalize: function () {\n\t // Shortcuts\n\t var data = this._data;\n\t var dataWords = data.words;\n\n\t var nBitsTotal = this._nDataBytes * 8;\n\t var nBitsLeft = data.sigBytes * 8;\n\n\t // Add padding\n\t dataWords[nBitsLeft >>> 5] |= 0x80 << (24 - nBitsLeft % 32);\n\t dataWords[(((nBitsLeft + 128) >>> 10) << 5) + 30] = Math.floor(nBitsTotal / 0x100000000);\n\t dataWords[(((nBitsLeft + 128) >>> 10) << 5) + 31] = nBitsTotal;\n\t data.sigBytes = dataWords.length * 4;\n\n\t // Hash final blocks\n\t this._process();\n\n\t // Convert hash to 32-bit word array before returning\n\t var hash = this._hash.toX32();\n\n\t // Return final computed hash\n\t return hash;\n\t },\n\n\t clone: function () {\n\t var clone = Hasher.clone.call(this);\n\t clone._hash = this._hash.clone();\n\n\t return clone;\n\t },\n\n\t blockSize: 1024/32\n\t });\n\n\t /**\n\t * Shortcut function to the hasher's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t *\n\t * @return {WordArray} The hash.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hash = CryptoJS.SHA512('message');\n\t * var hash = CryptoJS.SHA512(wordArray);\n\t */\n\t C.SHA512 = Hasher._createHelper(SHA512);\n\n\t /**\n\t * Shortcut function to the HMAC's object interface.\n\t *\n\t * @param {WordArray|string} message The message to hash.\n\t * @param {WordArray|string} key The secret key.\n\t *\n\t * @return {WordArray} The HMAC.\n\t *\n\t * @static\n\t *\n\t * @example\n\t *\n\t * var hmac = CryptoJS.HmacSHA512(message, key);\n\t */\n\t C.HmacSHA512 = Hasher._createHmacHelper(SHA512);\n\t}());\n\n\n\treturn CryptoJS.SHA512;\n\n}));",";(function (root, factory, undef) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"), require(\"./enc-base64\"), require(\"./md5\"), require(\"./evpkdf\"), require(\"./cipher-core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\", \"./enc-base64\", \"./md5\", \"./evpkdf\", \"./cipher-core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function () {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var WordArray = C_lib.WordArray;\n\t var BlockCipher = C_lib.BlockCipher;\n\t var C_algo = C.algo;\n\n\t // Permuted Choice 1 constants\n\t var PC1 = [\n\t 57, 49, 41, 33, 25, 17, 9, 1,\n\t 58, 50, 42, 34, 26, 18, 10, 2,\n\t 59, 51, 43, 35, 27, 19, 11, 3,\n\t 60, 52, 44, 36, 63, 55, 47, 39,\n\t 31, 23, 15, 7, 62, 54, 46, 38,\n\t 30, 22, 14, 6, 61, 53, 45, 37,\n\t 29, 21, 13, 5, 28, 20, 12, 4\n\t ];\n\n\t // Permuted Choice 2 constants\n\t var PC2 = [\n\t 14, 17, 11, 24, 1, 5,\n\t 3, 28, 15, 6, 21, 10,\n\t 23, 19, 12, 4, 26, 8,\n\t 16, 7, 27, 20, 13, 2,\n\t 41, 52, 31, 37, 47, 55,\n\t 30, 40, 51, 45, 33, 48,\n\t 44, 49, 39, 56, 34, 53,\n\t 46, 42, 50, 36, 29, 32\n\t ];\n\n\t // Cumulative bit shift constants\n\t var BIT_SHIFTS = [1, 2, 4, 6, 8, 10, 12, 14, 15, 17, 19, 21, 23, 25, 27, 28];\n\n\t // SBOXes and round permutation constants\n\t var SBOX_P = [\n\t {\n\t 0x0: 0x808200,\n\t 0x10000000: 0x8000,\n\t 0x20000000: 0x808002,\n\t 0x30000000: 0x2,\n\t 0x40000000: 0x200,\n\t 0x50000000: 0x808202,\n\t 0x60000000: 0x800202,\n\t 0x70000000: 0x800000,\n\t 0x80000000: 0x202,\n\t 0x90000000: 0x800200,\n\t 0xa0000000: 0x8200,\n\t 0xb0000000: 0x808000,\n\t 0xc0000000: 0x8002,\n\t 0xd0000000: 0x800002,\n\t 0xe0000000: 0x0,\n\t 0xf0000000: 0x8202,\n\t 0x8000000: 0x0,\n\t 0x18000000: 0x808202,\n\t 0x28000000: 0x8202,\n\t 0x38000000: 0x8000,\n\t 0x48000000: 0x808200,\n\t 0x58000000: 0x200,\n\t 0x68000000: 0x808002,\n\t 0x78000000: 0x2,\n\t 0x88000000: 0x800200,\n\t 0x98000000: 0x8200,\n\t 0xa8000000: 0x808000,\n\t 0xb8000000: 0x800202,\n\t 0xc8000000: 0x800002,\n\t 0xd8000000: 0x8002,\n\t 0xe8000000: 0x202,\n\t 0xf8000000: 0x800000,\n\t 0x1: 0x8000,\n\t 0x10000001: 0x2,\n\t 0x20000001: 0x808200,\n\t 0x30000001: 0x800000,\n\t 0x40000001: 0x808002,\n\t 0x50000001: 0x8200,\n\t 0x60000001: 0x200,\n\t 0x70000001: 0x800202,\n\t 0x80000001: 0x808202,\n\t 0x90000001: 0x808000,\n\t 0xa0000001: 0x800002,\n\t 0xb0000001: 0x8202,\n\t 0xc0000001: 0x202,\n\t 0xd0000001: 0x800200,\n\t 0xe0000001: 0x8002,\n\t 0xf0000001: 0x0,\n\t 0x8000001: 0x808202,\n\t 0x18000001: 0x808000,\n\t 0x28000001: 0x800000,\n\t 0x38000001: 0x200,\n\t 0x48000001: 0x8000,\n\t 0x58000001: 0x800002,\n\t 0x68000001: 0x2,\n\t 0x78000001: 0x8202,\n\t 0x88000001: 0x8002,\n\t 0x98000001: 0x800202,\n\t 0xa8000001: 0x202,\n\t 0xb8000001: 0x808200,\n\t 0xc8000001: 0x800200,\n\t 0xd8000001: 0x0,\n\t 0xe8000001: 0x8200,\n\t 0xf8000001: 0x808002\n\t },\n\t {\n\t 0x0: 0x40084010,\n\t 0x1000000: 0x4000,\n\t 0x2000000: 0x80000,\n\t 0x3000000: 0x40080010,\n\t 0x4000000: 0x40000010,\n\t 0x5000000: 0x40084000,\n\t 0x6000000: 0x40004000,\n\t 0x7000000: 0x10,\n\t 0x8000000: 0x84000,\n\t 0x9000000: 0x40004010,\n\t 0xa000000: 0x40000000,\n\t 0xb000000: 0x84010,\n\t 0xc000000: 0x80010,\n\t 0xd000000: 0x0,\n\t 0xe000000: 0x4010,\n\t 0xf000000: 0x40080000,\n\t 0x800000: 0x40004000,\n\t 0x1800000: 0x84010,\n\t 0x2800000: 0x10,\n\t 0x3800000: 0x40004010,\n\t 0x4800000: 0x40084010,\n\t 0x5800000: 0x40000000,\n\t 0x6800000: 0x80000,\n\t 0x7800000: 0x40080010,\n\t 0x8800000: 0x80010,\n\t 0x9800000: 0x0,\n\t 0xa800000: 0x4000,\n\t 0xb800000: 0x40080000,\n\t 0xc800000: 0x40000010,\n\t 0xd800000: 0x84000,\n\t 0xe800000: 0x40084000,\n\t 0xf800000: 0x4010,\n\t 0x10000000: 0x0,\n\t 0x11000000: 0x40080010,\n\t 0x12000000: 0x40004010,\n\t 0x13000000: 0x40084000,\n\t 0x14000000: 0x40080000,\n\t 0x15000000: 0x10,\n\t 0x16000000: 0x84010,\n\t 0x17000000: 0x4000,\n\t 0x18000000: 0x4010,\n\t 0x19000000: 0x80000,\n\t 0x1a000000: 0x80010,\n\t 0x1b000000: 0x40000010,\n\t 0x1c000000: 0x84000,\n\t 0x1d000000: 0x40004000,\n\t 0x1e000000: 0x40000000,\n\t 0x1f000000: 0x40084010,\n\t 0x10800000: 0x84010,\n\t 0x11800000: 0x80000,\n\t 0x12800000: 0x40080000,\n\t 0x13800000: 0x4000,\n\t 0x14800000: 0x40004000,\n\t 0x15800000: 0x40084010,\n\t 0x16800000: 0x10,\n\t 0x17800000: 0x40000000,\n\t 0x18800000: 0x40084000,\n\t 0x19800000: 0x40000010,\n\t 0x1a800000: 0x40004010,\n\t 0x1b800000: 0x80010,\n\t 0x1c800000: 0x0,\n\t 0x1d800000: 0x4010,\n\t 0x1e800000: 0x40080010,\n\t 0x1f800000: 0x84000\n\t },\n\t {\n\t 0x0: 0x104,\n\t 0x100000: 0x0,\n\t 0x200000: 0x4000100,\n\t 0x300000: 0x10104,\n\t 0x400000: 0x10004,\n\t 0x500000: 0x4000004,\n\t 0x600000: 0x4010104,\n\t 0x700000: 0x4010000,\n\t 0x800000: 0x4000000,\n\t 0x900000: 0x4010100,\n\t 0xa00000: 0x10100,\n\t 0xb00000: 0x4010004,\n\t 0xc00000: 0x4000104,\n\t 0xd00000: 0x10000,\n\t 0xe00000: 0x4,\n\t 0xf00000: 0x100,\n\t 0x80000: 0x4010100,\n\t 0x180000: 0x4010004,\n\t 0x280000: 0x0,\n\t 0x380000: 0x4000100,\n\t 0x480000: 0x4000004,\n\t 0x580000: 0x10000,\n\t 0x680000: 0x10004,\n\t 0x780000: 0x104,\n\t 0x880000: 0x4,\n\t 0x980000: 0x100,\n\t 0xa80000: 0x4010000,\n\t 0xb80000: 0x10104,\n\t 0xc80000: 0x10100,\n\t 0xd80000: 0x4000104,\n\t 0xe80000: 0x4010104,\n\t 0xf80000: 0x4000000,\n\t 0x1000000: 0x4010100,\n\t 0x1100000: 0x10004,\n\t 0x1200000: 0x10000,\n\t 0x1300000: 0x4000100,\n\t 0x1400000: 0x100,\n\t 0x1500000: 0x4010104,\n\t 0x1600000: 0x4000004,\n\t 0x1700000: 0x0,\n\t 0x1800000: 0x4000104,\n\t 0x1900000: 0x4000000,\n\t 0x1a00000: 0x4,\n\t 0x1b00000: 0x10100,\n\t 0x1c00000: 0x4010000,\n\t 0x1d00000: 0x104,\n\t 0x1e00000: 0x10104,\n\t 0x1f00000: 0x4010004,\n\t 0x1080000: 0x4000000,\n\t 0x1180000: 0x104,\n\t 0x1280000: 0x4010100,\n\t 0x1380000: 0x0,\n\t 0x1480000: 0x10004,\n\t 0x1580000: 0x4000100,\n\t 0x1680000: 0x100,\n\t 0x1780000: 0x4010004,\n\t 0x1880000: 0x10000,\n\t 0x1980000: 0x4010104,\n\t 0x1a80000: 0x10104,\n\t 0x1b80000: 0x4000004,\n\t 0x1c80000: 0x4000104,\n\t 0x1d80000: 0x4010000,\n\t 0x1e80000: 0x4,\n\t 0x1f80000: 0x10100\n\t },\n\t {\n\t 0x0: 0x80401000,\n\t 0x10000: 0x80001040,\n\t 0x20000: 0x401040,\n\t 0x30000: 0x80400000,\n\t 0x40000: 0x0,\n\t 0x50000: 0x401000,\n\t 0x60000: 0x80000040,\n\t 0x70000: 0x400040,\n\t 0x80000: 0x80000000,\n\t 0x90000: 0x400000,\n\t 0xa0000: 0x40,\n\t 0xb0000: 0x80001000,\n\t 0xc0000: 0x80400040,\n\t 0xd0000: 0x1040,\n\t 0xe0000: 0x1000,\n\t 0xf0000: 0x80401040,\n\t 0x8000: 0x80001040,\n\t 0x18000: 0x40,\n\t 0x28000: 0x80400040,\n\t 0x38000: 0x80001000,\n\t 0x48000: 0x401000,\n\t 0x58000: 0x80401040,\n\t 0x68000: 0x0,\n\t 0x78000: 0x80400000,\n\t 0x88000: 0x1000,\n\t 0x98000: 0x80401000,\n\t 0xa8000: 0x400000,\n\t 0xb8000: 0x1040,\n\t 0xc8000: 0x80000000,\n\t 0xd8000: 0x400040,\n\t 0xe8000: 0x401040,\n\t 0xf8000: 0x80000040,\n\t 0x100000: 0x400040,\n\t 0x110000: 0x401000,\n\t 0x120000: 0x80000040,\n\t 0x130000: 0x0,\n\t 0x140000: 0x1040,\n\t 0x150000: 0x80400040,\n\t 0x160000: 0x80401000,\n\t 0x170000: 0x80001040,\n\t 0x180000: 0x80401040,\n\t 0x190000: 0x80000000,\n\t 0x1a0000: 0x80400000,\n\t 0x1b0000: 0x401040,\n\t 0x1c0000: 0x80001000,\n\t 0x1d0000: 0x400000,\n\t 0x1e0000: 0x40,\n\t 0x1f0000: 0x1000,\n\t 0x108000: 0x80400000,\n\t 0x118000: 0x80401040,\n\t 0x128000: 0x0,\n\t 0x138000: 0x401000,\n\t 0x148000: 0x400040,\n\t 0x158000: 0x80000000,\n\t 0x168000: 0x80001040,\n\t 0x178000: 0x40,\n\t 0x188000: 0x80000040,\n\t 0x198000: 0x1000,\n\t 0x1a8000: 0x80001000,\n\t 0x1b8000: 0x80400040,\n\t 0x1c8000: 0x1040,\n\t 0x1d8000: 0x80401000,\n\t 0x1e8000: 0x400000,\n\t 0x1f8000: 0x401040\n\t },\n\t {\n\t 0x0: 0x80,\n\t 0x1000: 0x1040000,\n\t 0x2000: 0x40000,\n\t 0x3000: 0x20000000,\n\t 0x4000: 0x20040080,\n\t 0x5000: 0x1000080,\n\t 0x6000: 0x21000080,\n\t 0x7000: 0x40080,\n\t 0x8000: 0x1000000,\n\t 0x9000: 0x20040000,\n\t 0xa000: 0x20000080,\n\t 0xb000: 0x21040080,\n\t 0xc000: 0x21040000,\n\t 0xd000: 0x0,\n\t 0xe000: 0x1040080,\n\t 0xf000: 0x21000000,\n\t 0x800: 0x1040080,\n\t 0x1800: 0x21000080,\n\t 0x2800: 0x80,\n\t 0x3800: 0x1040000,\n\t 0x4800: 0x40000,\n\t 0x5800: 0x20040080,\n\t 0x6800: 0x21040000,\n\t 0x7800: 0x20000000,\n\t 0x8800: 0x20040000,\n\t 0x9800: 0x0,\n\t 0xa800: 0x21040080,\n\t 0xb800: 0x1000080,\n\t 0xc800: 0x20000080,\n\t 0xd800: 0x21000000,\n\t 0xe800: 0x1000000,\n\t 0xf800: 0x40080,\n\t 0x10000: 0x40000,\n\t 0x11000: 0x80,\n\t 0x12000: 0x20000000,\n\t 0x13000: 0x21000080,\n\t 0x14000: 0x1000080,\n\t 0x15000: 0x21040000,\n\t 0x16000: 0x20040080,\n\t 0x17000: 0x1000000,\n\t 0x18000: 0x21040080,\n\t 0x19000: 0x21000000,\n\t 0x1a000: 0x1040000,\n\t 0x1b000: 0x20040000,\n\t 0x1c000: 0x40080,\n\t 0x1d000: 0x20000080,\n\t 0x1e000: 0x0,\n\t 0x1f000: 0x1040080,\n\t 0x10800: 0x21000080,\n\t 0x11800: 0x1000000,\n\t 0x12800: 0x1040000,\n\t 0x13800: 0x20040080,\n\t 0x14800: 0x20000000,\n\t 0x15800: 0x1040080,\n\t 0x16800: 0x80,\n\t 0x17800: 0x21040000,\n\t 0x18800: 0x40080,\n\t 0x19800: 0x21040080,\n\t 0x1a800: 0x0,\n\t 0x1b800: 0x21000000,\n\t 0x1c800: 0x1000080,\n\t 0x1d800: 0x40000,\n\t 0x1e800: 0x20040000,\n\t 0x1f800: 0x20000080\n\t },\n\t {\n\t 0x0: 0x10000008,\n\t 0x100: 0x2000,\n\t 0x200: 0x10200000,\n\t 0x300: 0x10202008,\n\t 0x400: 0x10002000,\n\t 0x500: 0x200000,\n\t 0x600: 0x200008,\n\t 0x700: 0x10000000,\n\t 0x800: 0x0,\n\t 0x900: 0x10002008,\n\t 0xa00: 0x202000,\n\t 0xb00: 0x8,\n\t 0xc00: 0x10200008,\n\t 0xd00: 0x202008,\n\t 0xe00: 0x2008,\n\t 0xf00: 0x10202000,\n\t 0x80: 0x10200000,\n\t 0x180: 0x10202008,\n\t 0x280: 0x8,\n\t 0x380: 0x200000,\n\t 0x480: 0x202008,\n\t 0x580: 0x10000008,\n\t 0x680: 0x10002000,\n\t 0x780: 0x2008,\n\t 0x880: 0x200008,\n\t 0x980: 0x2000,\n\t 0xa80: 0x10002008,\n\t 0xb80: 0x10200008,\n\t 0xc80: 0x0,\n\t 0xd80: 0x10202000,\n\t 0xe80: 0x202000,\n\t 0xf80: 0x10000000,\n\t 0x1000: 0x10002000,\n\t 0x1100: 0x10200008,\n\t 0x1200: 0x10202008,\n\t 0x1300: 0x2008,\n\t 0x1400: 0x200000,\n\t 0x1500: 0x10000000,\n\t 0x1600: 0x10000008,\n\t 0x1700: 0x202000,\n\t 0x1800: 0x202008,\n\t 0x1900: 0x0,\n\t 0x1a00: 0x8,\n\t 0x1b00: 0x10200000,\n\t 0x1c00: 0x2000,\n\t 0x1d00: 0x10002008,\n\t 0x1e00: 0x10202000,\n\t 0x1f00: 0x200008,\n\t 0x1080: 0x8,\n\t 0x1180: 0x202000,\n\t 0x1280: 0x200000,\n\t 0x1380: 0x10000008,\n\t 0x1480: 0x10002000,\n\t 0x1580: 0x2008,\n\t 0x1680: 0x10202008,\n\t 0x1780: 0x10200000,\n\t 0x1880: 0x10202000,\n\t 0x1980: 0x10200008,\n\t 0x1a80: 0x2000,\n\t 0x1b80: 0x202008,\n\t 0x1c80: 0x200008,\n\t 0x1d80: 0x0,\n\t 0x1e80: 0x10000000,\n\t 0x1f80: 0x10002008\n\t },\n\t {\n\t 0x0: 0x100000,\n\t 0x10: 0x2000401,\n\t 0x20: 0x400,\n\t 0x30: 0x100401,\n\t 0x40: 0x2100401,\n\t 0x50: 0x0,\n\t 0x60: 0x1,\n\t 0x70: 0x2100001,\n\t 0x80: 0x2000400,\n\t 0x90: 0x100001,\n\t 0xa0: 0x2000001,\n\t 0xb0: 0x2100400,\n\t 0xc0: 0x2100000,\n\t 0xd0: 0x401,\n\t 0xe0: 0x100400,\n\t 0xf0: 0x2000000,\n\t 0x8: 0x2100001,\n\t 0x18: 0x0,\n\t 0x28: 0x2000401,\n\t 0x38: 0x2100400,\n\t 0x48: 0x100000,\n\t 0x58: 0x2000001,\n\t 0x68: 0x2000000,\n\t 0x78: 0x401,\n\t 0x88: 0x100401,\n\t 0x98: 0x2000400,\n\t 0xa8: 0x2100000,\n\t 0xb8: 0x100001,\n\t 0xc8: 0x400,\n\t 0xd8: 0x2100401,\n\t 0xe8: 0x1,\n\t 0xf8: 0x100400,\n\t 0x100: 0x2000000,\n\t 0x110: 0x100000,\n\t 0x120: 0x2000401,\n\t 0x130: 0x2100001,\n\t 0x140: 0x100001,\n\t 0x150: 0x2000400,\n\t 0x160: 0x2100400,\n\t 0x170: 0x100401,\n\t 0x180: 0x401,\n\t 0x190: 0x2100401,\n\t 0x1a0: 0x100400,\n\t 0x1b0: 0x1,\n\t 0x1c0: 0x0,\n\t 0x1d0: 0x2100000,\n\t 0x1e0: 0x2000001,\n\t 0x1f0: 0x400,\n\t 0x108: 0x100400,\n\t 0x118: 0x2000401,\n\t 0x128: 0x2100001,\n\t 0x138: 0x1,\n\t 0x148: 0x2000000,\n\t 0x158: 0x100000,\n\t 0x168: 0x401,\n\t 0x178: 0x2100400,\n\t 0x188: 0x2000001,\n\t 0x198: 0x2100000,\n\t 0x1a8: 0x0,\n\t 0x1b8: 0x2100401,\n\t 0x1c8: 0x100401,\n\t 0x1d8: 0x400,\n\t 0x1e8: 0x2000400,\n\t 0x1f8: 0x100001\n\t },\n\t {\n\t 0x0: 0x8000820,\n\t 0x1: 0x20000,\n\t 0x2: 0x8000000,\n\t 0x3: 0x20,\n\t 0x4: 0x20020,\n\t 0x5: 0x8020820,\n\t 0x6: 0x8020800,\n\t 0x7: 0x800,\n\t 0x8: 0x8020000,\n\t 0x9: 0x8000800,\n\t 0xa: 0x20800,\n\t 0xb: 0x8020020,\n\t 0xc: 0x820,\n\t 0xd: 0x0,\n\t 0xe: 0x8000020,\n\t 0xf: 0x20820,\n\t 0x80000000: 0x800,\n\t 0x80000001: 0x8020820,\n\t 0x80000002: 0x8000820,\n\t 0x80000003: 0x8000000,\n\t 0x80000004: 0x8020000,\n\t 0x80000005: 0x20800,\n\t 0x80000006: 0x20820,\n\t 0x80000007: 0x20,\n\t 0x80000008: 0x8000020,\n\t 0x80000009: 0x820,\n\t 0x8000000a: 0x20020,\n\t 0x8000000b: 0x8020800,\n\t 0x8000000c: 0x0,\n\t 0x8000000d: 0x8020020,\n\t 0x8000000e: 0x8000800,\n\t 0x8000000f: 0x20000,\n\t 0x10: 0x20820,\n\t 0x11: 0x8020800,\n\t 0x12: 0x20,\n\t 0x13: 0x800,\n\t 0x14: 0x8000800,\n\t 0x15: 0x8000020,\n\t 0x16: 0x8020020,\n\t 0x17: 0x20000,\n\t 0x18: 0x0,\n\t 0x19: 0x20020,\n\t 0x1a: 0x8020000,\n\t 0x1b: 0x8000820,\n\t 0x1c: 0x8020820,\n\t 0x1d: 0x20800,\n\t 0x1e: 0x820,\n\t 0x1f: 0x8000000,\n\t 0x80000010: 0x20000,\n\t 0x80000011: 0x800,\n\t 0x80000012: 0x8020020,\n\t 0x80000013: 0x20820,\n\t 0x80000014: 0x20,\n\t 0x80000015: 0x8020000,\n\t 0x80000016: 0x8000000,\n\t 0x80000017: 0x8000820,\n\t 0x80000018: 0x8020820,\n\t 0x80000019: 0x8000020,\n\t 0x8000001a: 0x8000800,\n\t 0x8000001b: 0x0,\n\t 0x8000001c: 0x20800,\n\t 0x8000001d: 0x820,\n\t 0x8000001e: 0x20020,\n\t 0x8000001f: 0x8020800\n\t }\n\t ];\n\n\t // Masks that select the SBOX input\n\t var SBOX_MASK = [\n\t 0xf8000001, 0x1f800000, 0x01f80000, 0x001f8000,\n\t 0x0001f800, 0x00001f80, 0x000001f8, 0x8000001f\n\t ];\n\n\t /**\n\t * DES block cipher algorithm.\n\t */\n\t var DES = C_algo.DES = BlockCipher.extend({\n\t _doReset: function () {\n\t // Shortcuts\n\t var key = this._key;\n\t var keyWords = key.words;\n\n\t // Select 56 bits according to PC1\n\t var keyBits = [];\n\t for (var i = 0; i < 56; i++) {\n\t var keyBitPos = PC1[i] - 1;\n\t keyBits[i] = (keyWords[keyBitPos >>> 5] >>> (31 - keyBitPos % 32)) & 1;\n\t }\n\n\t // Assemble 16 subkeys\n\t var subKeys = this._subKeys = [];\n\t for (var nSubKey = 0; nSubKey < 16; nSubKey++) {\n\t // Create subkey\n\t var subKey = subKeys[nSubKey] = [];\n\n\t // Shortcut\n\t var bitShift = BIT_SHIFTS[nSubKey];\n\n\t // Select 48 bits according to PC2\n\t for (var i = 0; i < 24; i++) {\n\t // Select from the left 28 key bits\n\t subKey[(i / 6) | 0] |= keyBits[((PC2[i] - 1) + bitShift) % 28] << (31 - i % 6);\n\n\t // Select from the right 28 key bits\n\t subKey[4 + ((i / 6) | 0)] |= keyBits[28 + (((PC2[i + 24] - 1) + bitShift) % 28)] << (31 - i % 6);\n\t }\n\n\t // Since each subkey is applied to an expanded 32-bit input,\n\t // the subkey can be broken into 8 values scaled to 32-bits,\n\t // which allows the key to be used without expansion\n\t subKey[0] = (subKey[0] << 1) | (subKey[0] >>> 31);\n\t for (var i = 1; i < 7; i++) {\n\t subKey[i] = subKey[i] >>> ((i - 1) * 4 + 3);\n\t }\n\t subKey[7] = (subKey[7] << 5) | (subKey[7] >>> 27);\n\t }\n\n\t // Compute inverse subkeys\n\t var invSubKeys = this._invSubKeys = [];\n\t for (var i = 0; i < 16; i++) {\n\t invSubKeys[i] = subKeys[15 - i];\n\t }\n\t },\n\n\t encryptBlock: function (M, offset) {\n\t this._doCryptBlock(M, offset, this._subKeys);\n\t },\n\n\t decryptBlock: function (M, offset) {\n\t this._doCryptBlock(M, offset, this._invSubKeys);\n\t },\n\n\t _doCryptBlock: function (M, offset, subKeys) {\n\t // Get input\n\t this._lBlock = M[offset];\n\t this._rBlock = M[offset + 1];\n\n\t // Initial permutation\n\t exchangeLR.call(this, 4, 0x0f0f0f0f);\n\t exchangeLR.call(this, 16, 0x0000ffff);\n\t exchangeRL.call(this, 2, 0x33333333);\n\t exchangeRL.call(this, 8, 0x00ff00ff);\n\t exchangeLR.call(this, 1, 0x55555555);\n\n\t // Rounds\n\t for (var round = 0; round < 16; round++) {\n\t // Shortcuts\n\t var subKey = subKeys[round];\n\t var lBlock = this._lBlock;\n\t var rBlock = this._rBlock;\n\n\t // Feistel function\n\t var f = 0;\n\t for (var i = 0; i < 8; i++) {\n\t f |= SBOX_P[i][((rBlock ^ subKey[i]) & SBOX_MASK[i]) >>> 0];\n\t }\n\t this._lBlock = rBlock;\n\t this._rBlock = lBlock ^ f;\n\t }\n\n\t // Undo swap from last round\n\t var t = this._lBlock;\n\t this._lBlock = this._rBlock;\n\t this._rBlock = t;\n\n\t // Final permutation\n\t exchangeLR.call(this, 1, 0x55555555);\n\t exchangeRL.call(this, 8, 0x00ff00ff);\n\t exchangeRL.call(this, 2, 0x33333333);\n\t exchangeLR.call(this, 16, 0x0000ffff);\n\t exchangeLR.call(this, 4, 0x0f0f0f0f);\n\n\t // Set output\n\t M[offset] = this._lBlock;\n\t M[offset + 1] = this._rBlock;\n\t },\n\n\t keySize: 64/32,\n\n\t ivSize: 64/32,\n\n\t blockSize: 64/32\n\t });\n\n\t // Swap bits across the left and right words\n\t function exchangeLR(offset, mask) {\n\t var t = ((this._lBlock >>> offset) ^ this._rBlock) & mask;\n\t this._rBlock ^= t;\n\t this._lBlock ^= t << offset;\n\t }\n\n\t function exchangeRL(offset, mask) {\n\t var t = ((this._rBlock >>> offset) ^ this._lBlock) & mask;\n\t this._lBlock ^= t;\n\t this._rBlock ^= t << offset;\n\t }\n\n\t /**\n\t * Shortcut functions to the cipher's object interface.\n\t *\n\t * @example\n\t *\n\t * var ciphertext = CryptoJS.DES.encrypt(message, key, cfg);\n\t * var plaintext = CryptoJS.DES.decrypt(ciphertext, key, cfg);\n\t */\n\t C.DES = BlockCipher._createHelper(DES);\n\n\t /**\n\t * Triple-DES block cipher algorithm.\n\t */\n\t var TripleDES = C_algo.TripleDES = BlockCipher.extend({\n\t _doReset: function () {\n\t // Shortcuts\n\t var key = this._key;\n\t var keyWords = key.words;\n\t // Make sure the key length is valid (64, 128 or >= 192 bit)\n\t if (keyWords.length !== 2 && keyWords.length !== 4 && keyWords.length < 6) {\n\t throw new Error('Invalid key length - 3DES requires the key length to be 64, 128, 192 or >192.');\n\t }\n\n\t // Extend the key according to the keying options defined in 3DES standard\n\t var key1 = keyWords.slice(0, 2);\n\t var key2 = keyWords.length < 4 ? keyWords.slice(0, 2) : keyWords.slice(2, 4);\n\t var key3 = keyWords.length < 6 ? keyWords.slice(0, 2) : keyWords.slice(4, 6);\n\n\t // Create DES instances\n\t this._des1 = DES.createEncryptor(WordArray.create(key1));\n\t this._des2 = DES.createEncryptor(WordArray.create(key2));\n\t this._des3 = DES.createEncryptor(WordArray.create(key3));\n\t },\n\n\t encryptBlock: function (M, offset) {\n\t this._des1.encryptBlock(M, offset);\n\t this._des2.decryptBlock(M, offset);\n\t this._des3.encryptBlock(M, offset);\n\t },\n\n\t decryptBlock: function (M, offset) {\n\t this._des3.decryptBlock(M, offset);\n\t this._des2.encryptBlock(M, offset);\n\t this._des1.decryptBlock(M, offset);\n\t },\n\n\t keySize: 192/32,\n\n\t ivSize: 64/32,\n\n\t blockSize: 64/32\n\t });\n\n\t /**\n\t * Shortcut functions to the cipher's object interface.\n\t *\n\t * @example\n\t *\n\t * var ciphertext = CryptoJS.TripleDES.encrypt(message, key, cfg);\n\t * var plaintext = CryptoJS.TripleDES.decrypt(ciphertext, key, cfg);\n\t */\n\t C.TripleDES = BlockCipher._createHelper(TripleDES);\n\t}());\n\n\n\treturn CryptoJS.TripleDES;\n\n}));",";(function (root, factory) {\n\tif (typeof exports === \"object\") {\n\t\t// CommonJS\n\t\tmodule.exports = exports = factory(require(\"./core\"));\n\t}\n\telse if (typeof define === \"function\" && define.amd) {\n\t\t// AMD\n\t\tdefine([\"./core\"], factory);\n\t}\n\telse {\n\t\t// Global (browser)\n\t\tfactory(root.CryptoJS);\n\t}\n}(this, function (CryptoJS) {\n\n\t(function (undefined) {\n\t // Shortcuts\n\t var C = CryptoJS;\n\t var C_lib = C.lib;\n\t var Base = C_lib.Base;\n\t var X32WordArray = C_lib.WordArray;\n\n\t /**\n\t * x64 namespace.\n\t */\n\t var C_x64 = C.x64 = {};\n\n\t /**\n\t * A 64-bit word.\n\t */\n\t var X64Word = C_x64.Word = Base.extend({\n\t /**\n\t * Initializes a newly created 64-bit word.\n\t *\n\t * @param {number} high The high 32 bits.\n\t * @param {number} low The low 32 bits.\n\t *\n\t * @example\n\t *\n\t * var x64Word = CryptoJS.x64.Word.create(0x00010203, 0x04050607);\n\t */\n\t init: function (high, low) {\n\t this.high = high;\n\t this.low = low;\n\t }\n\n\t /**\n\t * Bitwise NOTs this word.\n\t *\n\t * @return {X64Word} A new x64-Word object after negating.\n\t *\n\t * @example\n\t *\n\t * var negated = x64Word.not();\n\t */\n\t // not: function () {\n\t // var high = ~this.high;\n\t // var low = ~this.low;\n\n\t // return X64Word.create(high, low);\n\t // },\n\n\t /**\n\t * Bitwise ANDs this word with the passed word.\n\t *\n\t * @param {X64Word} word The x64-Word to AND with this word.\n\t *\n\t * @return {X64Word} A new x64-Word object after ANDing.\n\t *\n\t * @example\n\t *\n\t * var anded = x64Word.and(anotherX64Word);\n\t */\n\t // and: function (word) {\n\t // var high = this.high & word.high;\n\t // var low = this.low & word.low;\n\n\t // return X64Word.create(high, low);\n\t // },\n\n\t /**\n\t * Bitwise ORs this word with the passed word.\n\t *\n\t * @param {X64Word} word The x64-Word to OR with this word.\n\t *\n\t * @return {X64Word} A new x64-Word object after ORing.\n\t *\n\t * @example\n\t *\n\t * var ored = x64Word.or(anotherX64Word);\n\t */\n\t // or: function (word) {\n\t // var high = this.high | word.high;\n\t // var low = this.low | word.low;\n\n\t // return X64Word.create(high, low);\n\t // },\n\n\t /**\n\t * Bitwise XORs this word with the passed word.\n\t *\n\t * @param {X64Word} word The x64-Word to XOR with this word.\n\t *\n\t * @return {X64Word} A new x64-Word object after XORing.\n\t *\n\t * @example\n\t *\n\t * var xored = x64Word.xor(anotherX64Word);\n\t */\n\t // xor: function (word) {\n\t // var high = this.high ^ word.high;\n\t // var low = this.low ^ word.low;\n\n\t // return X64Word.create(high, low);\n\t // },\n\n\t /**\n\t * Shifts this word n bits to the left.\n\t *\n\t * @param {number} n The number of bits to shift.\n\t *\n\t * @return {X64Word} A new x64-Word object after shifting.\n\t *\n\t * @example\n\t *\n\t * var shifted = x64Word.shiftL(25);\n\t */\n\t // shiftL: function (n) {\n\t // if (n < 32) {\n\t // var high = (this.high << n) | (this.low >>> (32 - n));\n\t // var low = this.low << n;\n\t // } else {\n\t // var high = this.low << (n - 32);\n\t // var low = 0;\n\t // }\n\n\t // return X64Word.create(high, low);\n\t // },\n\n\t /**\n\t * Shifts this word n bits to the right.\n\t *\n\t * @param {number} n The number of bits to shift.\n\t *\n\t * @return {X64Word} A new x64-Word object after shifting.\n\t *\n\t * @example\n\t *\n\t * var shifted = x64Word.shiftR(7);\n\t */\n\t // shiftR: function (n) {\n\t // if (n < 32) {\n\t // var low = (this.low >>> n) | (this.high << (32 - n));\n\t // var high = this.high >>> n;\n\t // } else {\n\t // var low = this.high >>> (n - 32);\n\t // var high = 0;\n\t // }\n\n\t // return X64Word.create(high, low);\n\t // },\n\n\t /**\n\t * Rotates this word n bits to the left.\n\t *\n\t * @param {number} n The number of bits to rotate.\n\t *\n\t * @return {X64Word} A new x64-Word object after rotating.\n\t *\n\t * @example\n\t *\n\t * var rotated = x64Word.rotL(25);\n\t */\n\t // rotL: function (n) {\n\t // return this.shiftL(n).or(this.shiftR(64 - n));\n\t // },\n\n\t /**\n\t * Rotates this word n bits to the right.\n\t *\n\t * @param {number} n The number of bits to rotate.\n\t *\n\t * @return {X64Word} A new x64-Word object after rotating.\n\t *\n\t * @example\n\t *\n\t * var rotated = x64Word.rotR(7);\n\t */\n\t // rotR: function (n) {\n\t // return this.shiftR(n).or(this.shiftL(64 - n));\n\t // },\n\n\t /**\n\t * Adds this word with the passed word.\n\t *\n\t * @param {X64Word} word The x64-Word to add with this word.\n\t *\n\t * @return {X64Word} A new x64-Word object after adding.\n\t *\n\t * @example\n\t *\n\t * var added = x64Word.add(anotherX64Word);\n\t */\n\t // add: function (word) {\n\t // var low = (this.low + word.low) | 0;\n\t // var carry = (low >>> 0) < (this.low >>> 0) ? 1 : 0;\n\t // var high = (this.high + word.high + carry) | 0;\n\n\t // return X64Word.create(high, low);\n\t // }\n\t });\n\n\t /**\n\t * An array of 64-bit words.\n\t *\n\t * @property {Array} words The array of CryptoJS.x64.Word objects.\n\t * @property {number} sigBytes The number of significant bytes in this word array.\n\t */\n\t var X64WordArray = C_x64.WordArray = Base.extend({\n\t /**\n\t * Initializes a newly created word array.\n\t *\n\t * @param {Array} words (Optional) An array of CryptoJS.x64.Word objects.\n\t * @param {number} sigBytes (Optional) The number of significant bytes in the words.\n\t *\n\t * @example\n\t *\n\t * var wordArray = CryptoJS.x64.WordArray.create();\n\t *\n\t * var wordArray = CryptoJS.x64.WordArray.create([\n\t * CryptoJS.x64.Word.create(0x00010203, 0x04050607),\n\t * CryptoJS.x64.Word.create(0x18191a1b, 0x1c1d1e1f)\n\t * ]);\n\t *\n\t * var wordArray = CryptoJS.x64.WordArray.create([\n\t * CryptoJS.x64.Word.create(0x00010203, 0x04050607),\n\t * CryptoJS.x64.Word.create(0x18191a1b, 0x1c1d1e1f)\n\t * ], 10);\n\t */\n\t init: function (words, sigBytes) {\n\t words = this.words = words || [];\n\n\t if (sigBytes != undefined) {\n\t this.sigBytes = sigBytes;\n\t } else {\n\t this.sigBytes = words.length * 8;\n\t }\n\t },\n\n\t /**\n\t * Converts this 64-bit word array to a 32-bit word array.\n\t *\n\t * @return {CryptoJS.lib.WordArray} This word array's data as a 32-bit word array.\n\t *\n\t * @example\n\t *\n\t * var x32WordArray = x64WordArray.toX32();\n\t */\n\t toX32: function () {\n\t // Shortcuts\n\t var x64Words = this.words;\n\t var x64WordsLength = x64Words.length;\n\n\t // Convert\n\t var x32Words = [];\n\t for (var i = 0; i < x64WordsLength; i++) {\n\t var x64Word = x64Words[i];\n\t x32Words.push(x64Word.high);\n\t x32Words.push(x64Word.low);\n\t }\n\n\t return X32WordArray.create(x32Words, this.sigBytes);\n\t },\n\n\t /**\n\t * Creates a copy of this word array.\n\t *\n\t * @return {X64WordArray} The clone.\n\t *\n\t * @example\n\t *\n\t * var clone = x64WordArray.clone();\n\t */\n\t clone: function () {\n\t var clone = Base.clone.call(this);\n\n\t // Clone \"words\" array\n\t var words = clone.words = this.words.slice(0);\n\n\t // Clone each X64Word object\n\t var wordsLength = words.length;\n\t for (var i = 0; i < wordsLength; i++) {\n\t words[i] = words[i].clone();\n\t }\n\n\t return clone;\n\t }\n\t });\n\t}());\n\n\n\treturn CryptoJS;\n\n}));","/*! nouislider - 14.6.3 - 11/19/2020 */\n(function(factory) {\n if (typeof define === \"function\" && define.amd) {\n // AMD. Register as an anonymous module.\n define([], factory);\n } else if (typeof exports === \"object\") {\n // Node/CommonJS\n module.exports = factory();\n } else {\n // Browser globals\n window.noUiSlider = factory();\n }\n})(function() {\n \"use strict\";\n\n var VERSION = \"14.6.3\";\n\n //region Helper Methods\n\n function isValidFormatter(entry) {\n return typeof entry === \"object\" && typeof entry.to === \"function\" && typeof entry.from === \"function\";\n }\n\n function removeElement(el) {\n el.parentElement.removeChild(el);\n }\n\n function isSet(value) {\n return value !== null && value !== undefined;\n }\n\n // Bindable version\n function preventDefault(e) {\n e.preventDefault();\n }\n\n // Removes duplicates from an array.\n function unique(array) {\n return array.filter(function(a) {\n return !this[a] ? (this[a] = true) : false;\n }, {});\n }\n\n // Round a value to the closest 'to'.\n function closest(value, to) {\n return Math.round(value / to) * to;\n }\n\n // Current position of an element relative to the document.\n function offset(elem, orientation) {\n var rect = elem.getBoundingClientRect();\n var doc = elem.ownerDocument;\n var docElem = doc.documentElement;\n var pageOffset = getPageOffset(doc);\n\n // getBoundingClientRect contains left scroll in Chrome on Android.\n // I haven't found a feature detection that proves this. Worst case\n // scenario on mis-match: the 'tap' feature on horizontal sliders breaks.\n if (/webkit.*Chrome.*Mobile/i.test(navigator.userAgent)) {\n pageOffset.x = 0;\n }\n\n return orientation\n ? rect.top + pageOffset.y - docElem.clientTop\n : rect.left + pageOffset.x - docElem.clientLeft;\n }\n\n // Checks whether a value is numerical.\n function isNumeric(a) {\n return typeof a === \"number\" && !isNaN(a) && isFinite(a);\n }\n\n // Sets a class and removes it after [duration] ms.\n function addClassFor(element, className, duration) {\n if (duration > 0) {\n addClass(element, className);\n setTimeout(function() {\n removeClass(element, className);\n }, duration);\n }\n }\n\n // Limits a value to 0 - 100\n function limit(a) {\n return Math.max(Math.min(a, 100), 0);\n }\n\n // Wraps a variable as an array, if it isn't one yet.\n // Note that an input array is returned by reference!\n function asArray(a) {\n return Array.isArray(a) ? a : [a];\n }\n\n // Counts decimals\n function countDecimals(numStr) {\n numStr = String(numStr);\n var pieces = numStr.split(\".\");\n return pieces.length > 1 ? pieces[1].length : 0;\n }\n\n // http://youmightnotneedjquery.com/#add_class\n function addClass(el, className) {\n if (el.classList && !/\\s/.test(className)) {\n el.classList.add(className);\n } else {\n el.className += \" \" + className;\n }\n }\n\n // http://youmightnotneedjquery.com/#remove_class\n function removeClass(el, className) {\n if (el.classList && !/\\s/.test(className)) {\n el.classList.remove(className);\n } else {\n el.className = el.className.replace(\n new RegExp(\"(^|\\\\b)\" + className.split(\" \").join(\"|\") + \"(\\\\b|$)\", \"gi\"),\n \" \"\n );\n }\n }\n\n // https://plainjs.com/javascript/attributes/adding-removing-and-testing-for-classes-9/\n function hasClass(el, className) {\n return el.classList\n ? el.classList.contains(className)\n : new RegExp(\"\\\\b\" + className + \"\\\\b\").test(el.className);\n }\n\n // https://developer.mozilla.org/en-US/docs/Web/API/Window/scrollY#Notes\n function getPageOffset(doc) {\n var supportPageOffset = window.pageXOffset !== undefined;\n var isCSS1Compat = (doc.compatMode || \"\") === \"CSS1Compat\";\n var x = supportPageOffset\n ? window.pageXOffset\n : isCSS1Compat\n ? doc.documentElement.scrollLeft\n : doc.body.scrollLeft;\n var y = supportPageOffset\n ? window.pageYOffset\n : isCSS1Compat\n ? doc.documentElement.scrollTop\n : doc.body.scrollTop;\n\n return {\n x: x,\n y: y\n };\n }\n\n // we provide a function to compute constants instead\n // of accessing window.* as soon as the module needs it\n // so that we do not compute anything if not needed\n function getActions() {\n // Determine the events to bind. IE11 implements pointerEvents without\n // a prefix, which breaks compatibility with the IE10 implementation.\n return window.navigator.pointerEnabled\n ? {\n start: \"pointerdown\",\n move: \"pointermove\",\n end: \"pointerup\"\n }\n : window.navigator.msPointerEnabled\n ? {\n start: \"MSPointerDown\",\n move: \"MSPointerMove\",\n end: \"MSPointerUp\"\n }\n : {\n start: \"mousedown touchstart\",\n move: \"mousemove touchmove\",\n end: \"mouseup touchend\"\n };\n }\n\n // https://github.com/WICG/EventListenerOptions/blob/gh-pages/explainer.md\n // Issue #785\n function getSupportsPassive() {\n var supportsPassive = false;\n\n /* eslint-disable */\n try {\n var opts = Object.defineProperty({}, \"passive\", {\n get: function() {\n supportsPassive = true;\n }\n });\n\n window.addEventListener(\"test\", null, opts);\n } catch (e) {}\n /* eslint-enable */\n\n return supportsPassive;\n }\n\n function getSupportsTouchActionNone() {\n return window.CSS && CSS.supports && CSS.supports(\"touch-action\", \"none\");\n }\n\n //endregion\n\n //region Range Calculation\n\n // Determine the size of a sub-range in relation to a full range.\n function subRangeRatio(pa, pb) {\n return 100 / (pb - pa);\n }\n\n // (percentage) How many percent is this value of this range?\n function fromPercentage(range, value, startRange) {\n return (value * 100) / (range[startRange + 1] - range[startRange]);\n }\n\n // (percentage) Where is this value on this range?\n function toPercentage(range, value) {\n return fromPercentage(range, range[0] < 0 ? value + Math.abs(range[0]) : value - range[0], 0);\n }\n\n // (value) How much is this percentage on this range?\n function isPercentage(range, value) {\n return (value * (range[1] - range[0])) / 100 + range[0];\n }\n\n function getJ(value, arr) {\n var j = 1;\n\n while (value >= arr[j]) {\n j += 1;\n }\n\n return j;\n }\n\n // (percentage) Input a value, find where, on a scale of 0-100, it applies.\n function toStepping(xVal, xPct, value) {\n if (value >= xVal.slice(-1)[0]) {\n return 100;\n }\n\n var j = getJ(value, xVal);\n var va = xVal[j - 1];\n var vb = xVal[j];\n var pa = xPct[j - 1];\n var pb = xPct[j];\n\n return pa + toPercentage([va, vb], value) / subRangeRatio(pa, pb);\n }\n\n // (value) Input a percentage, find where it is on the specified range.\n function fromStepping(xVal, xPct, value) {\n // There is no range group that fits 100\n if (value >= 100) {\n return xVal.slice(-1)[0];\n }\n\n var j = getJ(value, xPct);\n var va = xVal[j - 1];\n var vb = xVal[j];\n var pa = xPct[j - 1];\n var pb = xPct[j];\n\n return isPercentage([va, vb], (value - pa) * subRangeRatio(pa, pb));\n }\n\n // (percentage) Get the step that applies at a certain value.\n function getStep(xPct, xSteps, snap, value) {\n if (value === 100) {\n return value;\n }\n\n var j = getJ(value, xPct);\n var a = xPct[j - 1];\n var b = xPct[j];\n\n // If 'snap' is set, steps are used as fixed points on the slider.\n if (snap) {\n // Find the closest position, a or b.\n if (value - a > (b - a) / 2) {\n return b;\n }\n\n return a;\n }\n\n if (!xSteps[j - 1]) {\n return value;\n }\n\n return xPct[j - 1] + closest(value - xPct[j - 1], xSteps[j - 1]);\n }\n\n function handleEntryPoint(index, value, that) {\n var percentage;\n\n // Wrap numerical input in an array.\n if (typeof value === \"number\") {\n value = [value];\n }\n\n // Reject any invalid input, by testing whether value is an array.\n if (!Array.isArray(value)) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'range' contains invalid value.\");\n }\n\n // Covert min/max syntax to 0 and 100.\n if (index === \"min\") {\n percentage = 0;\n } else if (index === \"max\") {\n percentage = 100;\n } else {\n percentage = parseFloat(index);\n }\n\n // Check for correct input.\n if (!isNumeric(percentage) || !isNumeric(value[0])) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'range' value isn't numeric.\");\n }\n\n // Store values.\n that.xPct.push(percentage);\n that.xVal.push(value[0]);\n\n // NaN will evaluate to false too, but to keep\n // logging clear, set step explicitly. Make sure\n // not to override the 'step' setting with false.\n if (!percentage) {\n if (!isNaN(value[1])) {\n that.xSteps[0] = value[1];\n }\n } else {\n that.xSteps.push(isNaN(value[1]) ? false : value[1]);\n }\n\n that.xHighestCompleteStep.push(0);\n }\n\n function handleStepPoint(i, n, that) {\n // Ignore 'false' stepping.\n if (!n) {\n return;\n }\n\n // Step over zero-length ranges (#948);\n if (that.xVal[i] === that.xVal[i + 1]) {\n that.xSteps[i] = that.xHighestCompleteStep[i] = that.xVal[i];\n\n return;\n }\n\n // Factor to range ratio\n that.xSteps[i] =\n fromPercentage([that.xVal[i], that.xVal[i + 1]], n, 0) / subRangeRatio(that.xPct[i], that.xPct[i + 1]);\n\n var totalSteps = (that.xVal[i + 1] - that.xVal[i]) / that.xNumSteps[i];\n var highestStep = Math.ceil(Number(totalSteps.toFixed(3)) - 1);\n var step = that.xVal[i] + that.xNumSteps[i] * highestStep;\n\n that.xHighestCompleteStep[i] = step;\n }\n\n //endregion\n\n //region Spectrum\n\n function Spectrum(entry, snap, singleStep) {\n this.xPct = [];\n this.xVal = [];\n this.xSteps = [singleStep || false];\n this.xNumSteps = [false];\n this.xHighestCompleteStep = [];\n\n this.snap = snap;\n\n var index;\n var ordered = []; // [0, 'min'], [1, '50%'], [2, 'max']\n\n // Map the object keys to an array.\n for (index in entry) {\n if (entry.hasOwnProperty(index)) {\n ordered.push([entry[index], index]);\n }\n }\n\n // Sort all entries by value (numeric sort).\n if (ordered.length && typeof ordered[0][0] === \"object\") {\n ordered.sort(function(a, b) {\n return a[0][0] - b[0][0];\n });\n } else {\n ordered.sort(function(a, b) {\n return a[0] - b[0];\n });\n }\n\n // Convert all entries to subranges.\n for (index = 0; index < ordered.length; index++) {\n handleEntryPoint(ordered[index][1], ordered[index][0], this);\n }\n\n // Store the actual step values.\n // xSteps is sorted in the same order as xPct and xVal.\n this.xNumSteps = this.xSteps.slice(0);\n\n // Convert all numeric steps to the percentage of the subrange they represent.\n for (index = 0; index < this.xNumSteps.length; index++) {\n handleStepPoint(index, this.xNumSteps[index], this);\n }\n }\n\n Spectrum.prototype.getDistance = function(value) {\n var index;\n var distances = [];\n\n for (index = 0; index < this.xNumSteps.length - 1; index++) {\n // last \"range\" can't contain step size as it is purely an endpoint.\n var step = this.xNumSteps[index];\n\n if (step && (value / step) % 1 !== 0) {\n throw new Error(\n \"noUiSlider (\" +\n VERSION +\n \"): 'limit', 'margin' and 'padding' of \" +\n this.xPct[index] +\n \"% range must be divisible by step.\"\n );\n }\n\n // Calculate percentual distance in current range of limit, margin or padding\n distances[index] = fromPercentage(this.xVal, value, index);\n }\n\n return distances;\n };\n\n // Calculate the percentual distance over the whole scale of ranges.\n // direction: 0 = backwards / 1 = forwards\n Spectrum.prototype.getAbsoluteDistance = function(value, distances, direction) {\n var xPct_index = 0;\n\n // Calculate range where to start calculation\n if (value < this.xPct[this.xPct.length - 1]) {\n while (value > this.xPct[xPct_index + 1]) {\n xPct_index++;\n }\n } else if (value === this.xPct[this.xPct.length - 1]) {\n xPct_index = this.xPct.length - 2;\n }\n\n // If looking backwards and the value is exactly at a range separator then look one range further\n if (!direction && value === this.xPct[xPct_index + 1]) {\n xPct_index++;\n }\n\n var start_factor;\n var rest_factor = 1;\n\n var rest_rel_distance = distances[xPct_index];\n\n var range_pct = 0;\n\n var rel_range_distance = 0;\n var abs_distance_counter = 0;\n var range_counter = 0;\n\n // Calculate what part of the start range the value is\n if (direction) {\n start_factor = (value - this.xPct[xPct_index]) / (this.xPct[xPct_index + 1] - this.xPct[xPct_index]);\n } else {\n start_factor = (this.xPct[xPct_index + 1] - value) / (this.xPct[xPct_index + 1] - this.xPct[xPct_index]);\n }\n\n // Do until the complete distance across ranges is calculated\n while (rest_rel_distance > 0) {\n // Calculate the percentage of total range\n range_pct = this.xPct[xPct_index + 1 + range_counter] - this.xPct[xPct_index + range_counter];\n\n // Detect if the margin, padding or limit is larger then the current range and calculate\n if (distances[xPct_index + range_counter] * rest_factor + 100 - start_factor * 100 > 100) {\n // If larger then take the percentual distance of the whole range\n rel_range_distance = range_pct * start_factor;\n // Rest factor of relative percentual distance still to be calculated\n rest_factor = (rest_rel_distance - 100 * start_factor) / distances[xPct_index + range_counter];\n // Set start factor to 1 as for next range it does not apply.\n start_factor = 1;\n } else {\n // If smaller or equal then take the percentual distance of the calculate percentual part of that range\n rel_range_distance = ((distances[xPct_index + range_counter] * range_pct) / 100) * rest_factor;\n // No rest left as the rest fits in current range\n rest_factor = 0;\n }\n\n if (direction) {\n abs_distance_counter = abs_distance_counter - rel_range_distance;\n // Limit range to first range when distance becomes outside of minimum range\n if (this.xPct.length + range_counter >= 1) {\n range_counter--;\n }\n } else {\n abs_distance_counter = abs_distance_counter + rel_range_distance;\n // Limit range to last range when distance becomes outside of maximum range\n if (this.xPct.length - range_counter >= 1) {\n range_counter++;\n }\n }\n\n // Rest of relative percentual distance still to be calculated\n rest_rel_distance = distances[xPct_index + range_counter] * rest_factor;\n }\n\n return value + abs_distance_counter;\n };\n\n Spectrum.prototype.toStepping = function(value) {\n value = toStepping(this.xVal, this.xPct, value);\n\n return value;\n };\n\n Spectrum.prototype.fromStepping = function(value) {\n return fromStepping(this.xVal, this.xPct, value);\n };\n\n Spectrum.prototype.getStep = function(value) {\n value = getStep(this.xPct, this.xSteps, this.snap, value);\n\n return value;\n };\n\n Spectrum.prototype.getDefaultStep = function(value, isDown, size) {\n var j = getJ(value, this.xPct);\n\n // When at the top or stepping down, look at the previous sub-range\n if (value === 100 || (isDown && value === this.xPct[j - 1])) {\n j = Math.max(j - 1, 1);\n }\n\n return (this.xVal[j] - this.xVal[j - 1]) / size;\n };\n\n Spectrum.prototype.getNearbySteps = function(value) {\n var j = getJ(value, this.xPct);\n\n return {\n stepBefore: {\n startValue: this.xVal[j - 2],\n step: this.xNumSteps[j - 2],\n highestStep: this.xHighestCompleteStep[j - 2]\n },\n thisStep: {\n startValue: this.xVal[j - 1],\n step: this.xNumSteps[j - 1],\n highestStep: this.xHighestCompleteStep[j - 1]\n },\n stepAfter: {\n startValue: this.xVal[j],\n step: this.xNumSteps[j],\n highestStep: this.xHighestCompleteStep[j]\n }\n };\n };\n\n Spectrum.prototype.countStepDecimals = function() {\n var stepDecimals = this.xNumSteps.map(countDecimals);\n return Math.max.apply(null, stepDecimals);\n };\n\n // Outside testing\n Spectrum.prototype.convert = function(value) {\n return this.getStep(this.toStepping(value));\n };\n\n //endregion\n\n //region Options\n\n /*\tEvery input option is tested and parsed. This'll prevent\n endless validation in internal methods. These tests are\n structured with an item for every option available. An\n option can be marked as required by setting the 'r' flag.\n The testing function is provided with three arguments:\n - The provided value for the option;\n - A reference to the options object;\n - The name for the option;\n\n The testing function returns false when an error is detected,\n or true when everything is OK. It can also modify the option\n object, to make sure all values can be correctly looped elsewhere. */\n\n //region Defaults\n\n var defaultFormatter = {\n to: function(value) {\n return value !== undefined && value.toFixed(2);\n },\n from: Number\n };\n\n var cssClasses = {\n target: \"target\",\n base: \"base\",\n origin: \"origin\",\n handle: \"handle\",\n handleLower: \"handle-lower\",\n handleUpper: \"handle-upper\",\n touchArea: \"touch-area\",\n horizontal: \"horizontal\",\n vertical: \"vertical\",\n background: \"background\",\n connect: \"connect\",\n connects: \"connects\",\n ltr: \"ltr\",\n rtl: \"rtl\",\n textDirectionLtr: \"txt-dir-ltr\",\n textDirectionRtl: \"txt-dir-rtl\",\n draggable: \"draggable\",\n drag: \"state-drag\",\n tap: \"state-tap\",\n active: \"active\",\n tooltip: \"tooltip\",\n pips: \"pips\",\n pipsHorizontal: \"pips-horizontal\",\n pipsVertical: \"pips-vertical\",\n marker: \"marker\",\n markerHorizontal: \"marker-horizontal\",\n markerVertical: \"marker-vertical\",\n markerNormal: \"marker-normal\",\n markerLarge: \"marker-large\",\n markerSub: \"marker-sub\",\n value: \"value\",\n valueHorizontal: \"value-horizontal\",\n valueVertical: \"value-vertical\",\n valueNormal: \"value-normal\",\n valueLarge: \"value-large\",\n valueSub: \"value-sub\"\n };\n\n // Namespaces of internal event listeners\n var INTERNAL_EVENT_NS = {\n tooltips: \".__tooltips\",\n aria: \".__aria\"\n };\n\n //endregion\n\n function validateFormat(entry) {\n // Any object with a to and from method is supported.\n if (isValidFormatter(entry)) {\n return true;\n }\n\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'format' requires 'to' and 'from' methods.\");\n }\n\n function testStep(parsed, entry) {\n if (!isNumeric(entry)) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'step' is not numeric.\");\n }\n\n // The step option can still be used to set stepping\n // for linear sliders. Overwritten if set in 'range'.\n parsed.singleStep = entry;\n }\n\n function testKeyboardPageMultiplier(parsed, entry) {\n if (!isNumeric(entry)) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'keyboardPageMultiplier' is not numeric.\");\n }\n\n parsed.keyboardPageMultiplier = entry;\n }\n\n function testKeyboardDefaultStep(parsed, entry) {\n if (!isNumeric(entry)) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'keyboardDefaultStep' is not numeric.\");\n }\n\n parsed.keyboardDefaultStep = entry;\n }\n\n function testRange(parsed, entry) {\n // Filter incorrect input.\n if (typeof entry !== \"object\" || Array.isArray(entry)) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'range' is not an object.\");\n }\n\n // Catch missing start or end.\n if (entry.min === undefined || entry.max === undefined) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): Missing 'min' or 'max' in 'range'.\");\n }\n\n // Catch equal start or end.\n if (entry.min === entry.max) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'range' 'min' and 'max' cannot be equal.\");\n }\n\n parsed.spectrum = new Spectrum(entry, parsed.snap, parsed.singleStep);\n }\n\n function testStart(parsed, entry) {\n entry = asArray(entry);\n\n // Validate input. Values aren't tested, as the public .val method\n // will always provide a valid location.\n if (!Array.isArray(entry) || !entry.length) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'start' option is incorrect.\");\n }\n\n // Store the number of handles.\n parsed.handles = entry.length;\n\n // When the slider is initialized, the .val method will\n // be called with the start options.\n parsed.start = entry;\n }\n\n function testSnap(parsed, entry) {\n // Enforce 100% stepping within subranges.\n parsed.snap = entry;\n\n if (typeof entry !== \"boolean\") {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'snap' option must be a boolean.\");\n }\n }\n\n function testAnimate(parsed, entry) {\n // Enforce 100% stepping within subranges.\n parsed.animate = entry;\n\n if (typeof entry !== \"boolean\") {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'animate' option must be a boolean.\");\n }\n }\n\n function testAnimationDuration(parsed, entry) {\n parsed.animationDuration = entry;\n\n if (typeof entry !== \"number\") {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'animationDuration' option must be a number.\");\n }\n }\n\n function testConnect(parsed, entry) {\n var connect = [false];\n var i;\n\n // Map legacy options\n if (entry === \"lower\") {\n entry = [true, false];\n } else if (entry === \"upper\") {\n entry = [false, true];\n }\n\n // Handle boolean options\n if (entry === true || entry === false) {\n for (i = 1; i < parsed.handles; i++) {\n connect.push(entry);\n }\n\n connect.push(false);\n }\n\n // Reject invalid input\n else if (!Array.isArray(entry) || !entry.length || entry.length !== parsed.handles + 1) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'connect' option doesn't match handle count.\");\n } else {\n connect = entry;\n }\n\n parsed.connect = connect;\n }\n\n function testOrientation(parsed, entry) {\n // Set orientation to an a numerical value for easy\n // array selection.\n switch (entry) {\n case \"horizontal\":\n parsed.ort = 0;\n break;\n case \"vertical\":\n parsed.ort = 1;\n break;\n default:\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'orientation' option is invalid.\");\n }\n }\n\n function testMargin(parsed, entry) {\n if (!isNumeric(entry)) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'margin' option must be numeric.\");\n }\n\n // Issue #582\n if (entry === 0) {\n return;\n }\n\n parsed.margin = parsed.spectrum.getDistance(entry);\n }\n\n function testLimit(parsed, entry) {\n if (!isNumeric(entry)) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'limit' option must be numeric.\");\n }\n\n parsed.limit = parsed.spectrum.getDistance(entry);\n\n if (!parsed.limit || parsed.handles < 2) {\n throw new Error(\n \"noUiSlider (\" +\n VERSION +\n \"): 'limit' option is only supported on linear sliders with 2 or more handles.\"\n );\n }\n }\n\n function testPadding(parsed, entry) {\n var index;\n\n if (!isNumeric(entry) && !Array.isArray(entry)) {\n throw new Error(\n \"noUiSlider (\" + VERSION + \"): 'padding' option must be numeric or array of exactly 2 numbers.\"\n );\n }\n\n if (Array.isArray(entry) && !(entry.length === 2 || isNumeric(entry[0]) || isNumeric(entry[1]))) {\n throw new Error(\n \"noUiSlider (\" + VERSION + \"): 'padding' option must be numeric or array of exactly 2 numbers.\"\n );\n }\n\n if (entry === 0) {\n return;\n }\n\n if (!Array.isArray(entry)) {\n entry = [entry, entry];\n }\n\n // 'getDistance' returns false for invalid values.\n parsed.padding = [parsed.spectrum.getDistance(entry[0]), parsed.spectrum.getDistance(entry[1])];\n\n for (index = 0; index < parsed.spectrum.xNumSteps.length - 1; index++) {\n // last \"range\" can't contain step size as it is purely an endpoint.\n if (parsed.padding[0][index] < 0 || parsed.padding[1][index] < 0) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'padding' option must be a positive number(s).\");\n }\n }\n\n var totalPadding = entry[0] + entry[1];\n var firstValue = parsed.spectrum.xVal[0];\n var lastValue = parsed.spectrum.xVal[parsed.spectrum.xVal.length - 1];\n\n if (totalPadding / (lastValue - firstValue) > 1) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'padding' option must not exceed 100% of the range.\");\n }\n }\n\n function testDirection(parsed, entry) {\n // Set direction as a numerical value for easy parsing.\n // Invert connection for RTL sliders, so that the proper\n // handles get the connect/background classes.\n switch (entry) {\n case \"ltr\":\n parsed.dir = 0;\n break;\n case \"rtl\":\n parsed.dir = 1;\n break;\n default:\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'direction' option was not recognized.\");\n }\n }\n\n function testBehaviour(parsed, entry) {\n // Make sure the input is a string.\n if (typeof entry !== \"string\") {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'behaviour' must be a string containing options.\");\n }\n\n // Check if the string contains any keywords.\n // None are required.\n var tap = entry.indexOf(\"tap\") >= 0;\n var drag = entry.indexOf(\"drag\") >= 0;\n var fixed = entry.indexOf(\"fixed\") >= 0;\n var snap = entry.indexOf(\"snap\") >= 0;\n var hover = entry.indexOf(\"hover\") >= 0;\n var unconstrained = entry.indexOf(\"unconstrained\") >= 0;\n\n if (fixed) {\n if (parsed.handles !== 2) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'fixed' behaviour must be used with 2 handles\");\n }\n\n // Use margin to enforce fixed state\n testMargin(parsed, parsed.start[1] - parsed.start[0]);\n }\n\n if (unconstrained && (parsed.margin || parsed.limit)) {\n throw new Error(\n \"noUiSlider (\" + VERSION + \"): 'unconstrained' behaviour cannot be used with margin or limit\"\n );\n }\n\n parsed.events = {\n tap: tap || snap,\n drag: drag,\n fixed: fixed,\n snap: snap,\n hover: hover,\n unconstrained: unconstrained\n };\n }\n\n function testTooltips(parsed, entry) {\n if (entry === false) {\n return;\n }\n\n if (entry === true) {\n parsed.tooltips = [];\n\n for (var i = 0; i < parsed.handles; i++) {\n parsed.tooltips.push(true);\n }\n } else {\n parsed.tooltips = asArray(entry);\n\n if (parsed.tooltips.length !== parsed.handles) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): must pass a formatter for all handles.\");\n }\n\n parsed.tooltips.forEach(function(formatter) {\n if (\n typeof formatter !== \"boolean\" &&\n (typeof formatter !== \"object\" || typeof formatter.to !== \"function\")\n ) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'tooltips' must be passed a formatter or 'false'.\");\n }\n });\n }\n }\n\n function testAriaFormat(parsed, entry) {\n parsed.ariaFormat = entry;\n validateFormat(entry);\n }\n\n function testFormat(parsed, entry) {\n parsed.format = entry;\n validateFormat(entry);\n }\n\n function testKeyboardSupport(parsed, entry) {\n parsed.keyboardSupport = entry;\n\n if (typeof entry !== \"boolean\") {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'keyboardSupport' option must be a boolean.\");\n }\n }\n\n function testDocumentElement(parsed, entry) {\n // This is an advanced option. Passed values are used without validation.\n parsed.documentElement = entry;\n }\n\n function testCssPrefix(parsed, entry) {\n if (typeof entry !== \"string\" && entry !== false) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'cssPrefix' must be a string or `false`.\");\n }\n\n parsed.cssPrefix = entry;\n }\n\n function testCssClasses(parsed, entry) {\n if (typeof entry !== \"object\") {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'cssClasses' must be an object.\");\n }\n\n if (typeof parsed.cssPrefix === \"string\") {\n parsed.cssClasses = {};\n\n for (var key in entry) {\n if (!entry.hasOwnProperty(key)) {\n continue;\n }\n\n parsed.cssClasses[key] = parsed.cssPrefix + entry[key];\n }\n } else {\n parsed.cssClasses = entry;\n }\n }\n\n // Test all developer settings and parse to assumption-safe values.\n function testOptions(options) {\n // To prove a fix for #537, freeze options here.\n // If the object is modified, an error will be thrown.\n // Object.freeze(options);\n\n var parsed = {\n margin: 0,\n limit: 0,\n padding: 0,\n animate: true,\n animationDuration: 300,\n ariaFormat: defaultFormatter,\n format: defaultFormatter\n };\n\n // Tests are executed in the order they are presented here.\n var tests = {\n step: { r: false, t: testStep },\n keyboardPageMultiplier: { r: false, t: testKeyboardPageMultiplier },\n keyboardDefaultStep: { r: false, t: testKeyboardDefaultStep },\n start: { r: true, t: testStart },\n connect: { r: true, t: testConnect },\n direction: { r: true, t: testDirection },\n snap: { r: false, t: testSnap },\n animate: { r: false, t: testAnimate },\n animationDuration: { r: false, t: testAnimationDuration },\n range: { r: true, t: testRange },\n orientation: { r: false, t: testOrientation },\n margin: { r: false, t: testMargin },\n limit: { r: false, t: testLimit },\n padding: { r: false, t: testPadding },\n behaviour: { r: true, t: testBehaviour },\n ariaFormat: { r: false, t: testAriaFormat },\n format: { r: false, t: testFormat },\n tooltips: { r: false, t: testTooltips },\n keyboardSupport: { r: true, t: testKeyboardSupport },\n documentElement: { r: false, t: testDocumentElement },\n cssPrefix: { r: true, t: testCssPrefix },\n cssClasses: { r: true, t: testCssClasses }\n };\n\n var defaults = {\n connect: false,\n direction: \"ltr\",\n behaviour: \"tap\",\n orientation: \"horizontal\",\n keyboardSupport: true,\n cssPrefix: \"noUi-\",\n cssClasses: cssClasses,\n keyboardPageMultiplier: 5,\n keyboardDefaultStep: 10\n };\n\n // AriaFormat defaults to regular format, if any.\n if (options.format && !options.ariaFormat) {\n options.ariaFormat = options.format;\n }\n\n // Run all options through a testing mechanism to ensure correct\n // input. It should be noted that options might get modified to\n // be handled properly. E.g. wrapping integers in arrays.\n Object.keys(tests).forEach(function(name) {\n // If the option isn't set, but it is required, throw an error.\n if (!isSet(options[name]) && defaults[name] === undefined) {\n if (tests[name].r) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): '\" + name + \"' is required.\");\n }\n\n return true;\n }\n\n tests[name].t(parsed, !isSet(options[name]) ? defaults[name] : options[name]);\n });\n\n // Forward pips options\n parsed.pips = options.pips;\n\n // All recent browsers accept unprefixed transform.\n // We need -ms- for IE9 and -webkit- for older Android;\n // Assume use of -webkit- if unprefixed and -ms- are not supported.\n // https://caniuse.com/#feat=transforms2d\n var d = document.createElement(\"div\");\n var msPrefix = d.style.msTransform !== undefined;\n var noPrefix = d.style.transform !== undefined;\n\n parsed.transformRule = noPrefix ? \"transform\" : msPrefix ? \"msTransform\" : \"webkitTransform\";\n\n // Pips don't move, so we can place them using left/top.\n var styles = [[\"left\", \"top\"], [\"right\", \"bottom\"]];\n\n parsed.style = styles[parsed.dir][parsed.ort];\n\n return parsed;\n }\n\n //endregion\n\n function scope(target, options, originalOptions) {\n var actions = getActions();\n var supportsTouchActionNone = getSupportsTouchActionNone();\n var supportsPassive = supportsTouchActionNone && getSupportsPassive();\n\n // All variables local to 'scope' are prefixed with 'scope_'\n\n // Slider DOM Nodes\n var scope_Target = target;\n var scope_Base;\n var scope_Handles;\n var scope_Connects;\n var scope_Pips;\n var scope_Tooltips;\n\n // Slider state values\n var scope_Spectrum = options.spectrum;\n var scope_Values = [];\n var scope_Locations = [];\n var scope_HandleNumbers = [];\n var scope_ActiveHandlesCount = 0;\n var scope_Events = {};\n\n // Exposed API\n var scope_Self;\n\n // Document Nodes\n var scope_Document = target.ownerDocument;\n var scope_DocumentElement = options.documentElement || scope_Document.documentElement;\n var scope_Body = scope_Document.body;\n\n // Pips constants\n var PIPS_NONE = -1;\n var PIPS_NO_VALUE = 0;\n var PIPS_LARGE_VALUE = 1;\n var PIPS_SMALL_VALUE = 2;\n\n // For horizontal sliders in standard ltr documents,\n // make .noUi-origin overflow to the left so the document doesn't scroll.\n var scope_DirOffset = scope_Document.dir === \"rtl\" || options.ort === 1 ? 0 : 100;\n\n // Creates a node, adds it to target, returns the new node.\n function addNodeTo(addTarget, className) {\n var div = scope_Document.createElement(\"div\");\n\n if (className) {\n addClass(div, className);\n }\n\n addTarget.appendChild(div);\n\n return div;\n }\n\n // Append a origin to the base\n function addOrigin(base, handleNumber) {\n var origin = addNodeTo(base, options.cssClasses.origin);\n var handle = addNodeTo(origin, options.cssClasses.handle);\n\n addNodeTo(handle, options.cssClasses.touchArea);\n\n handle.setAttribute(\"data-handle\", handleNumber);\n\n if (options.keyboardSupport) {\n // https://developer.mozilla.org/en-US/docs/Web/HTML/Global_attributes/tabindex\n // 0 = focusable and reachable\n handle.setAttribute(\"tabindex\", \"0\");\n handle.addEventListener(\"keydown\", function(event) {\n return eventKeydown(event, handleNumber);\n });\n }\n\n handle.setAttribute(\"role\", \"slider\");\n handle.setAttribute(\"aria-orientation\", options.ort ? \"vertical\" : \"horizontal\");\n\n if (handleNumber === 0) {\n addClass(handle, options.cssClasses.handleLower);\n } else if (handleNumber === options.handles - 1) {\n addClass(handle, options.cssClasses.handleUpper);\n }\n\n return origin;\n }\n\n // Insert nodes for connect elements\n function addConnect(base, add) {\n if (!add) {\n return false;\n }\n\n return addNodeTo(base, options.cssClasses.connect);\n }\n\n // Add handles to the slider base.\n function addElements(connectOptions, base) {\n var connectBase = addNodeTo(base, options.cssClasses.connects);\n\n scope_Handles = [];\n scope_Connects = [];\n\n scope_Connects.push(addConnect(connectBase, connectOptions[0]));\n\n // [::::O====O====O====]\n // connectOptions = [0, 1, 1, 1]\n\n for (var i = 0; i < options.handles; i++) {\n // Keep a list of all added handles.\n scope_Handles.push(addOrigin(base, i));\n scope_HandleNumbers[i] = i;\n scope_Connects.push(addConnect(connectBase, connectOptions[i + 1]));\n }\n }\n\n // Initialize a single slider.\n function addSlider(addTarget) {\n // Apply classes and data to the target.\n addClass(addTarget, options.cssClasses.target);\n\n if (options.dir === 0) {\n addClass(addTarget, options.cssClasses.ltr);\n } else {\n addClass(addTarget, options.cssClasses.rtl);\n }\n\n if (options.ort === 0) {\n addClass(addTarget, options.cssClasses.horizontal);\n } else {\n addClass(addTarget, options.cssClasses.vertical);\n }\n\n var textDirection = getComputedStyle(addTarget).direction;\n\n if (textDirection === \"rtl\") {\n addClass(addTarget, options.cssClasses.textDirectionRtl);\n } else {\n addClass(addTarget, options.cssClasses.textDirectionLtr);\n }\n\n return addNodeTo(addTarget, options.cssClasses.base);\n }\n\n function addTooltip(handle, handleNumber) {\n if (!options.tooltips[handleNumber]) {\n return false;\n }\n\n return addNodeTo(handle.firstChild, options.cssClasses.tooltip);\n }\n\n function isSliderDisabled() {\n return scope_Target.hasAttribute(\"disabled\");\n }\n\n // Disable the slider dragging if any handle is disabled\n function isHandleDisabled(handleNumber) {\n var handleOrigin = scope_Handles[handleNumber];\n return handleOrigin.hasAttribute(\"disabled\");\n }\n\n function removeTooltips() {\n if (scope_Tooltips) {\n removeEvent(\"update\" + INTERNAL_EVENT_NS.tooltips);\n scope_Tooltips.forEach(function(tooltip) {\n if (tooltip) {\n removeElement(tooltip);\n }\n });\n scope_Tooltips = null;\n }\n }\n\n // The tooltips option is a shorthand for using the 'update' event.\n function tooltips() {\n removeTooltips();\n\n // Tooltips are added with options.tooltips in original order.\n scope_Tooltips = scope_Handles.map(addTooltip);\n\n bindEvent(\"update\" + INTERNAL_EVENT_NS.tooltips, function(values, handleNumber, unencoded) {\n if (!scope_Tooltips[handleNumber]) {\n return;\n }\n\n var formattedValue = values[handleNumber];\n\n if (options.tooltips[handleNumber] !== true) {\n formattedValue = options.tooltips[handleNumber].to(unencoded[handleNumber]);\n }\n\n scope_Tooltips[handleNumber].innerHTML = formattedValue;\n });\n }\n\n function aria() {\n removeEvent(\"update\" + INTERNAL_EVENT_NS.aria);\n bindEvent(\"update\" + INTERNAL_EVENT_NS.aria, function(values, handleNumber, unencoded, tap, positions) {\n // Update Aria Values for all handles, as a change in one changes min and max values for the next.\n scope_HandleNumbers.forEach(function(index) {\n var handle = scope_Handles[index];\n\n var min = checkHandlePosition(scope_Locations, index, 0, true, true, true);\n var max = checkHandlePosition(scope_Locations, index, 100, true, true, true);\n\n var now = positions[index];\n\n // Formatted value for display\n var text = options.ariaFormat.to(unencoded[index]);\n\n // Map to slider range values\n min = scope_Spectrum.fromStepping(min).toFixed(1);\n max = scope_Spectrum.fromStepping(max).toFixed(1);\n now = scope_Spectrum.fromStepping(now).toFixed(1);\n\n handle.children[0].setAttribute(\"aria-valuemin\", min);\n handle.children[0].setAttribute(\"aria-valuemax\", max);\n handle.children[0].setAttribute(\"aria-valuenow\", now);\n handle.children[0].setAttribute(\"aria-valuetext\", text);\n });\n });\n }\n\n function getGroup(mode, values, stepped) {\n // Use the range.\n if (mode === \"range\" || mode === \"steps\") {\n return scope_Spectrum.xVal;\n }\n\n if (mode === \"count\") {\n if (values < 2) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): 'values' (>= 2) required for mode 'count'.\");\n }\n\n // Divide 0 - 100 in 'count' parts.\n var interval = values - 1;\n var spread = 100 / interval;\n\n values = [];\n\n // List these parts and have them handled as 'positions'.\n while (interval--) {\n values[interval] = interval * spread;\n }\n\n values.push(100);\n\n mode = \"positions\";\n }\n\n if (mode === \"positions\") {\n // Map all percentages to on-range values.\n return values.map(function(value) {\n return scope_Spectrum.fromStepping(stepped ? scope_Spectrum.getStep(value) : value);\n });\n }\n\n if (mode === \"values\") {\n // If the value must be stepped, it needs to be converted to a percentage first.\n if (stepped) {\n return values.map(function(value) {\n // Convert to percentage, apply step, return to value.\n return scope_Spectrum.fromStepping(scope_Spectrum.getStep(scope_Spectrum.toStepping(value)));\n });\n }\n\n // Otherwise, we can simply use the values.\n return values;\n }\n }\n\n function generateSpread(density, mode, group) {\n function safeIncrement(value, increment) {\n // Avoid floating point variance by dropping the smallest decimal places.\n return (value + increment).toFixed(7) / 1;\n }\n\n var indexes = {};\n var firstInRange = scope_Spectrum.xVal[0];\n var lastInRange = scope_Spectrum.xVal[scope_Spectrum.xVal.length - 1];\n var ignoreFirst = false;\n var ignoreLast = false;\n var prevPct = 0;\n\n // Create a copy of the group, sort it and filter away all duplicates.\n group = unique(\n group.slice().sort(function(a, b) {\n return a - b;\n })\n );\n\n // Make sure the range starts with the first element.\n if (group[0] !== firstInRange) {\n group.unshift(firstInRange);\n ignoreFirst = true;\n }\n\n // Likewise for the last one.\n if (group[group.length - 1] !== lastInRange) {\n group.push(lastInRange);\n ignoreLast = true;\n }\n\n group.forEach(function(current, index) {\n // Get the current step and the lower + upper positions.\n var step;\n var i;\n var q;\n var low = current;\n var high = group[index + 1];\n var newPct;\n var pctDifference;\n var pctPos;\n var type;\n var steps;\n var realSteps;\n var stepSize;\n var isSteps = mode === \"steps\";\n\n // When using 'steps' mode, use the provided steps.\n // Otherwise, we'll step on to the next subrange.\n if (isSteps) {\n step = scope_Spectrum.xNumSteps[index];\n }\n\n // Default to a 'full' step.\n if (!step) {\n step = high - low;\n }\n\n // Low can be 0, so test for false. Index 0 is already handled.\n if (low === false) {\n return;\n }\n\n // If high is undefined we are at the last subrange. Make sure it iterates once (#1088)\n if (high === undefined) {\n high = low;\n }\n\n // Make sure step isn't 0, which would cause an infinite loop (#654)\n step = Math.max(step, 0.0000001);\n\n // Find all steps in the subrange.\n for (i = low; i <= high; i = safeIncrement(i, step)) {\n // Get the percentage value for the current step,\n // calculate the size for the subrange.\n newPct = scope_Spectrum.toStepping(i);\n pctDifference = newPct - prevPct;\n\n steps = pctDifference / density;\n realSteps = Math.round(steps);\n\n // This ratio represents the amount of percentage-space a point indicates.\n // For a density 1 the points/percentage = 1. For density 2, that percentage needs to be re-divided.\n // Round the percentage offset to an even number, then divide by two\n // to spread the offset on both sides of the range.\n stepSize = pctDifference / realSteps;\n\n // Divide all points evenly, adding the correct number to this subrange.\n // Run up to <= so that 100% gets a point, event if ignoreLast is set.\n for (q = 1; q <= realSteps; q += 1) {\n // The ratio between the rounded value and the actual size might be ~1% off.\n // Correct the percentage offset by the number of points\n // per subrange. density = 1 will result in 100 points on the\n // full range, 2 for 50, 4 for 25, etc.\n pctPos = prevPct + q * stepSize;\n indexes[pctPos.toFixed(5)] = [scope_Spectrum.fromStepping(pctPos), 0];\n }\n\n // Determine the point type.\n type = group.indexOf(i) > -1 ? PIPS_LARGE_VALUE : isSteps ? PIPS_SMALL_VALUE : PIPS_NO_VALUE;\n\n // Enforce the 'ignoreFirst' option by overwriting the type for 0.\n if (!index && ignoreFirst && i !== high) {\n type = 0;\n }\n\n if (!(i === high && ignoreLast)) {\n // Mark the 'type' of this point. 0 = plain, 1 = real value, 2 = step value.\n indexes[newPct.toFixed(5)] = [i, type];\n }\n\n // Update the percentage count.\n prevPct = newPct;\n }\n });\n\n return indexes;\n }\n\n function addMarking(spread, filterFunc, formatter) {\n var element = scope_Document.createElement(\"div\");\n\n var valueSizeClasses = [];\n valueSizeClasses[PIPS_NO_VALUE] = options.cssClasses.valueNormal;\n valueSizeClasses[PIPS_LARGE_VALUE] = options.cssClasses.valueLarge;\n valueSizeClasses[PIPS_SMALL_VALUE] = options.cssClasses.valueSub;\n\n var markerSizeClasses = [];\n markerSizeClasses[PIPS_NO_VALUE] = options.cssClasses.markerNormal;\n markerSizeClasses[PIPS_LARGE_VALUE] = options.cssClasses.markerLarge;\n markerSizeClasses[PIPS_SMALL_VALUE] = options.cssClasses.markerSub;\n\n var valueOrientationClasses = [options.cssClasses.valueHorizontal, options.cssClasses.valueVertical];\n var markerOrientationClasses = [options.cssClasses.markerHorizontal, options.cssClasses.markerVertical];\n\n addClass(element, options.cssClasses.pips);\n addClass(element, options.ort === 0 ? options.cssClasses.pipsHorizontal : options.cssClasses.pipsVertical);\n\n function getClasses(type, source) {\n var a = source === options.cssClasses.value;\n var orientationClasses = a ? valueOrientationClasses : markerOrientationClasses;\n var sizeClasses = a ? valueSizeClasses : markerSizeClasses;\n\n return source + \" \" + orientationClasses[options.ort] + \" \" + sizeClasses[type];\n }\n\n function addSpread(offset, value, type) {\n // Apply the filter function, if it is set.\n type = filterFunc ? filterFunc(value, type) : type;\n\n if (type === PIPS_NONE) {\n return;\n }\n\n // Add a marker for every point\n var node = addNodeTo(element, false);\n node.className = getClasses(type, options.cssClasses.marker);\n node.style[options.style] = offset + \"%\";\n\n // Values are only appended for points marked '1' or '2'.\n if (type > PIPS_NO_VALUE) {\n node = addNodeTo(element, false);\n node.className = getClasses(type, options.cssClasses.value);\n node.setAttribute(\"data-value\", value);\n node.style[options.style] = offset + \"%\";\n node.innerHTML = formatter.to(value);\n }\n }\n\n // Append all points.\n Object.keys(spread).forEach(function(offset) {\n addSpread(offset, spread[offset][0], spread[offset][1]);\n });\n\n return element;\n }\n\n function removePips() {\n if (scope_Pips) {\n removeElement(scope_Pips);\n scope_Pips = null;\n }\n }\n\n function pips(grid) {\n // Fix #669\n removePips();\n\n var mode = grid.mode;\n var density = grid.density || 1;\n var filter = grid.filter || false;\n var values = grid.values || false;\n var stepped = grid.stepped || false;\n var group = getGroup(mode, values, stepped);\n var spread = generateSpread(density, mode, group);\n var format = grid.format || {\n to: Math.round\n };\n\n scope_Pips = scope_Target.appendChild(addMarking(spread, filter, format));\n\n return scope_Pips;\n }\n\n // Shorthand for base dimensions.\n function baseSize() {\n var rect = scope_Base.getBoundingClientRect();\n var alt = \"offset\" + [\"Width\", \"Height\"][options.ort];\n return options.ort === 0 ? rect.width || scope_Base[alt] : rect.height || scope_Base[alt];\n }\n\n // Handler for attaching events trough a proxy.\n function attachEvent(events, element, callback, data) {\n // This function can be used to 'filter' events to the slider.\n // element is a node, not a nodeList\n\n var method = function(e) {\n e = fixEvent(e, data.pageOffset, data.target || element);\n\n // fixEvent returns false if this event has a different target\n // when handling (multi-) touch events;\n if (!e) {\n return false;\n }\n\n // doNotReject is passed by all end events to make sure released touches\n // are not rejected, leaving the slider \"stuck\" to the cursor;\n if (isSliderDisabled() && !data.doNotReject) {\n return false;\n }\n\n // Stop if an active 'tap' transition is taking place.\n if (hasClass(scope_Target, options.cssClasses.tap) && !data.doNotReject) {\n return false;\n }\n\n // Ignore right or middle clicks on start #454\n if (events === actions.start && e.buttons !== undefined && e.buttons > 1) {\n return false;\n }\n\n // Ignore right or middle clicks on start #454\n if (data.hover && e.buttons) {\n return false;\n }\n\n // 'supportsPassive' is only true if a browser also supports touch-action: none in CSS.\n // iOS safari does not, so it doesn't get to benefit from passive scrolling. iOS does support\n // touch-action: manipulation, but that allows panning, which breaks\n // sliders after zooming/on non-responsive pages.\n // See: https://bugs.webkit.org/show_bug.cgi?id=133112\n if (!supportsPassive) {\n e.preventDefault();\n }\n\n e.calcPoint = e.points[options.ort];\n\n // Call the event handler with the event [ and additional data ].\n callback(e, data);\n };\n\n var methods = [];\n\n // Bind a closure on the target for every event type.\n events.split(\" \").forEach(function(eventName) {\n element.addEventListener(eventName, method, supportsPassive ? { passive: true } : false);\n methods.push([eventName, method]);\n });\n\n return methods;\n }\n\n // Provide a clean event with standardized offset values.\n function fixEvent(e, pageOffset, eventTarget) {\n // Filter the event to register the type, which can be\n // touch, mouse or pointer. Offset changes need to be\n // made on an event specific basis.\n var touch = e.type.indexOf(\"touch\") === 0;\n var mouse = e.type.indexOf(\"mouse\") === 0;\n var pointer = e.type.indexOf(\"pointer\") === 0;\n\n var x;\n var y;\n\n // IE10 implemented pointer events with a prefix;\n if (e.type.indexOf(\"MSPointer\") === 0) {\n pointer = true;\n }\n\n // Erroneous events seem to be passed in occasionally on iOS/iPadOS after user finishes interacting with\n // the slider. They appear to be of type MouseEvent, yet they don't have usual properties set. Ignore\n // events that have no touches or buttons associated with them. (#1057, #1079, #1095)\n if (e.type === \"mousedown\" && !e.buttons && !e.touches) {\n return false;\n }\n\n // The only thing one handle should be concerned about is the touches that originated on top of it.\n if (touch) {\n // Returns true if a touch originated on the target.\n var isTouchOnTarget = function(checkTouch) {\n return (\n checkTouch.target === eventTarget ||\n eventTarget.contains(checkTouch.target) ||\n (checkTouch.target.shadowRoot && checkTouch.target.shadowRoot.contains(eventTarget))\n );\n };\n\n // In the case of touchstart events, we need to make sure there is still no more than one\n // touch on the target so we look amongst all touches.\n if (e.type === \"touchstart\") {\n var targetTouches = Array.prototype.filter.call(e.touches, isTouchOnTarget);\n\n // Do not support more than one touch per handle.\n if (targetTouches.length > 1) {\n return false;\n }\n\n x = targetTouches[0].pageX;\n y = targetTouches[0].pageY;\n } else {\n // In the other cases, find on changedTouches is enough.\n var targetTouch = Array.prototype.find.call(e.changedTouches, isTouchOnTarget);\n\n // Cancel if the target touch has not moved.\n if (!targetTouch) {\n return false;\n }\n\n x = targetTouch.pageX;\n y = targetTouch.pageY;\n }\n }\n\n pageOffset = pageOffset || getPageOffset(scope_Document);\n\n if (mouse || pointer) {\n x = e.clientX + pageOffset.x;\n y = e.clientY + pageOffset.y;\n }\n\n e.pageOffset = pageOffset;\n e.points = [x, y];\n e.cursor = mouse || pointer; // Fix #435\n\n return e;\n }\n\n // Translate a coordinate in the document to a percentage on the slider\n function calcPointToPercentage(calcPoint) {\n var location = calcPoint - offset(scope_Base, options.ort);\n var proposal = (location * 100) / baseSize();\n\n // Clamp proposal between 0% and 100%\n // Out-of-bound coordinates may occur when .noUi-base pseudo-elements\n // are used (e.g. contained handles feature)\n proposal = limit(proposal);\n\n return options.dir ? 100 - proposal : proposal;\n }\n\n // Find handle closest to a certain percentage on the slider\n function getClosestHandle(clickedPosition) {\n var smallestDifference = 100;\n var handleNumber = false;\n\n scope_Handles.forEach(function(handle, index) {\n // Disabled handles are ignored\n if (isHandleDisabled(index)) {\n return;\n }\n\n var handlePosition = scope_Locations[index];\n var differenceWithThisHandle = Math.abs(handlePosition - clickedPosition);\n\n // Initial state\n var clickAtEdge = differenceWithThisHandle === 100 && smallestDifference === 100;\n\n // Difference with this handle is smaller than the previously checked handle\n var isCloser = differenceWithThisHandle < smallestDifference;\n var isCloserAfter = differenceWithThisHandle <= smallestDifference && clickedPosition > handlePosition;\n\n if (isCloser || isCloserAfter || clickAtEdge) {\n handleNumber = index;\n smallestDifference = differenceWithThisHandle;\n }\n });\n\n return handleNumber;\n }\n\n // Fire 'end' when a mouse or pen leaves the document.\n function documentLeave(event, data) {\n if (event.type === \"mouseout\" && event.target.nodeName === \"HTML\" && event.relatedTarget === null) {\n eventEnd(event, data);\n }\n }\n\n // Handle movement on document for handle and range drag.\n function eventMove(event, data) {\n // Fix #498\n // Check value of .buttons in 'start' to work around a bug in IE10 mobile (data.buttonsProperty).\n // https://connect.microsoft.com/IE/feedback/details/927005/mobile-ie10-windows-phone-buttons-property-of-pointermove-event-always-zero\n // IE9 has .buttons and .which zero on mousemove.\n // Firefox breaks the spec MDN defines.\n if (navigator.appVersion.indexOf(\"MSIE 9\") === -1 && event.buttons === 0 && data.buttonsProperty !== 0) {\n return eventEnd(event, data);\n }\n\n // Check if we are moving up or down\n var movement = (options.dir ? -1 : 1) * (event.calcPoint - data.startCalcPoint);\n\n // Convert the movement into a percentage of the slider width/height\n var proposal = (movement * 100) / data.baseSize;\n\n moveHandles(movement > 0, proposal, data.locations, data.handleNumbers);\n }\n\n // Unbind move events on document, call callbacks.\n function eventEnd(event, data) {\n // The handle is no longer active, so remove the class.\n if (data.handle) {\n removeClass(data.handle, options.cssClasses.active);\n scope_ActiveHandlesCount -= 1;\n }\n\n // Unbind the move and end events, which are added on 'start'.\n data.listeners.forEach(function(c) {\n scope_DocumentElement.removeEventListener(c[0], c[1]);\n });\n\n if (scope_ActiveHandlesCount === 0) {\n // Remove dragging class.\n removeClass(scope_Target, options.cssClasses.drag);\n setZindex();\n\n // Remove cursor styles and text-selection events bound to the body.\n if (event.cursor) {\n scope_Body.style.cursor = \"\";\n scope_Body.removeEventListener(\"selectstart\", preventDefault);\n }\n }\n\n data.handleNumbers.forEach(function(handleNumber) {\n fireEvent(\"change\", handleNumber);\n fireEvent(\"set\", handleNumber);\n fireEvent(\"end\", handleNumber);\n });\n }\n\n // Bind move events on document.\n function eventStart(event, data) {\n // Ignore event if any handle is disabled\n if (data.handleNumbers.some(isHandleDisabled)) {\n return false;\n }\n\n var handle;\n\n if (data.handleNumbers.length === 1) {\n var handleOrigin = scope_Handles[data.handleNumbers[0]];\n\n handle = handleOrigin.children[0];\n scope_ActiveHandlesCount += 1;\n\n // Mark the handle as 'active' so it can be styled.\n addClass(handle, options.cssClasses.active);\n }\n\n // A drag should never propagate up to the 'tap' event.\n event.stopPropagation();\n\n // Record the event listeners.\n var listeners = [];\n\n // Attach the move and end events.\n var moveEvent = attachEvent(actions.move, scope_DocumentElement, eventMove, {\n // The event target has changed so we need to propagate the original one so that we keep\n // relying on it to extract target touches.\n target: event.target,\n handle: handle,\n listeners: listeners,\n startCalcPoint: event.calcPoint,\n baseSize: baseSize(),\n pageOffset: event.pageOffset,\n handleNumbers: data.handleNumbers,\n buttonsProperty: event.buttons,\n locations: scope_Locations.slice()\n });\n\n var endEvent = attachEvent(actions.end, scope_DocumentElement, eventEnd, {\n target: event.target,\n handle: handle,\n listeners: listeners,\n doNotReject: true,\n handleNumbers: data.handleNumbers\n });\n\n var outEvent = attachEvent(\"mouseout\", scope_DocumentElement, documentLeave, {\n target: event.target,\n handle: handle,\n listeners: listeners,\n doNotReject: true,\n handleNumbers: data.handleNumbers\n });\n\n // We want to make sure we pushed the listeners in the listener list rather than creating\n // a new one as it has already been passed to the event handlers.\n listeners.push.apply(listeners, moveEvent.concat(endEvent, outEvent));\n\n // Text selection isn't an issue on touch devices,\n // so adding cursor styles can be skipped.\n if (event.cursor) {\n // Prevent the 'I' cursor and extend the range-drag cursor.\n scope_Body.style.cursor = getComputedStyle(event.target).cursor;\n\n // Mark the target with a dragging state.\n if (scope_Handles.length > 1) {\n addClass(scope_Target, options.cssClasses.drag);\n }\n\n // Prevent text selection when dragging the handles.\n // In noUiSlider <= 9.2.0, this was handled by calling preventDefault on mouse/touch start/move,\n // which is scroll blocking. The selectstart event is supported by FireFox starting from version 52,\n // meaning the only holdout is iOS Safari. This doesn't matter: text selection isn't triggered there.\n // The 'cursor' flag is false.\n // See: http://caniuse.com/#search=selectstart\n scope_Body.addEventListener(\"selectstart\", preventDefault, false);\n }\n\n data.handleNumbers.forEach(function(handleNumber) {\n fireEvent(\"start\", handleNumber);\n });\n }\n\n // Move closest handle to tapped location.\n function eventTap(event) {\n // The tap event shouldn't propagate up\n event.stopPropagation();\n\n var proposal = calcPointToPercentage(event.calcPoint);\n var handleNumber = getClosestHandle(proposal);\n\n // Tackle the case that all handles are 'disabled'.\n if (handleNumber === false) {\n return false;\n }\n\n // Flag the slider as it is now in a transitional state.\n // Transition takes a configurable amount of ms (default 300). Re-enable the slider after that.\n if (!options.events.snap) {\n addClassFor(scope_Target, options.cssClasses.tap, options.animationDuration);\n }\n\n setHandle(handleNumber, proposal, true, true);\n\n setZindex();\n\n fireEvent(\"slide\", handleNumber, true);\n fireEvent(\"update\", handleNumber, true);\n fireEvent(\"change\", handleNumber, true);\n fireEvent(\"set\", handleNumber, true);\n\n if (options.events.snap) {\n eventStart(event, { handleNumbers: [handleNumber] });\n }\n }\n\n // Fires a 'hover' event for a hovered mouse/pen position.\n function eventHover(event) {\n var proposal = calcPointToPercentage(event.calcPoint);\n\n var to = scope_Spectrum.getStep(proposal);\n var value = scope_Spectrum.fromStepping(to);\n\n Object.keys(scope_Events).forEach(function(targetEvent) {\n if (\"hover\" === targetEvent.split(\".\")[0]) {\n scope_Events[targetEvent].forEach(function(callback) {\n callback.call(scope_Self, value);\n });\n }\n });\n }\n\n // Handles keydown on focused handles\n // Don't move the document when pressing arrow keys on focused handles\n function eventKeydown(event, handleNumber) {\n if (isSliderDisabled() || isHandleDisabled(handleNumber)) {\n return false;\n }\n\n var horizontalKeys = [\"Left\", \"Right\"];\n var verticalKeys = [\"Down\", \"Up\"];\n var largeStepKeys = [\"PageDown\", \"PageUp\"];\n var edgeKeys = [\"Home\", \"End\"];\n\n if (options.dir && !options.ort) {\n // On an right-to-left slider, the left and right keys act inverted\n horizontalKeys.reverse();\n } else if (options.ort && !options.dir) {\n // On a top-to-bottom slider, the up and down keys act inverted\n verticalKeys.reverse();\n largeStepKeys.reverse();\n }\n\n // Strip \"Arrow\" for IE compatibility. https://developer.mozilla.org/en-US/docs/Web/API/KeyboardEvent/key\n var key = event.key.replace(\"Arrow\", \"\");\n\n var isLargeDown = key === largeStepKeys[0];\n var isLargeUp = key === largeStepKeys[1];\n var isDown = key === verticalKeys[0] || key === horizontalKeys[0] || isLargeDown;\n var isUp = key === verticalKeys[1] || key === horizontalKeys[1] || isLargeUp;\n var isMin = key === edgeKeys[0];\n var isMax = key === edgeKeys[1];\n\n if (!isDown && !isUp && !isMin && !isMax) {\n return true;\n }\n\n event.preventDefault();\n\n var to;\n\n if (isUp || isDown) {\n var multiplier = options.keyboardPageMultiplier;\n var direction = isDown ? 0 : 1;\n var steps = getNextStepsForHandle(handleNumber);\n var step = steps[direction];\n\n // At the edge of a slider, do nothing\n if (step === null) {\n return false;\n }\n\n // No step set, use the default of 10% of the sub-range\n if (step === false) {\n step = scope_Spectrum.getDefaultStep(\n scope_Locations[handleNumber],\n isDown,\n options.keyboardDefaultStep\n );\n }\n\n if (isLargeUp || isLargeDown) {\n step *= multiplier;\n }\n\n // Step over zero-length ranges (#948);\n step = Math.max(step, 0.0000001);\n\n // Decrement for down steps\n step = (isDown ? -1 : 1) * step;\n\n to = scope_Values[handleNumber] + step;\n } else if (isMax) {\n // End key\n to = options.spectrum.xVal[options.spectrum.xVal.length - 1];\n } else {\n // Home key\n to = options.spectrum.xVal[0];\n }\n\n setHandle(handleNumber, scope_Spectrum.toStepping(to), true, true);\n\n fireEvent(\"slide\", handleNumber);\n fireEvent(\"update\", handleNumber);\n fireEvent(\"change\", handleNumber);\n fireEvent(\"set\", handleNumber);\n\n return false;\n }\n\n // Attach events to several slider parts.\n function bindSliderEvents(behaviour) {\n // Attach the standard drag event to the handles.\n if (!behaviour.fixed) {\n scope_Handles.forEach(function(handle, index) {\n // These events are only bound to the visual handle\n // element, not the 'real' origin element.\n attachEvent(actions.start, handle.children[0], eventStart, {\n handleNumbers: [index]\n });\n });\n }\n\n // Attach the tap event to the slider base.\n if (behaviour.tap) {\n attachEvent(actions.start, scope_Base, eventTap, {});\n }\n\n // Fire hover events\n if (behaviour.hover) {\n attachEvent(actions.move, scope_Base, eventHover, {\n hover: true\n });\n }\n\n // Make the range draggable.\n if (behaviour.drag) {\n scope_Connects.forEach(function(connect, index) {\n if (connect === false || index === 0 || index === scope_Connects.length - 1) {\n return;\n }\n\n var handleBefore = scope_Handles[index - 1];\n var handleAfter = scope_Handles[index];\n var eventHolders = [connect];\n\n addClass(connect, options.cssClasses.draggable);\n\n // When the range is fixed, the entire range can\n // be dragged by the handles. The handle in the first\n // origin will propagate the start event upward,\n // but it needs to be bound manually on the other.\n if (behaviour.fixed) {\n eventHolders.push(handleBefore.children[0]);\n eventHolders.push(handleAfter.children[0]);\n }\n\n eventHolders.forEach(function(eventHolder) {\n attachEvent(actions.start, eventHolder, eventStart, {\n handles: [handleBefore, handleAfter],\n handleNumbers: [index - 1, index]\n });\n });\n });\n }\n }\n\n // Attach an event to this slider, possibly including a namespace\n function bindEvent(namespacedEvent, callback) {\n scope_Events[namespacedEvent] = scope_Events[namespacedEvent] || [];\n scope_Events[namespacedEvent].push(callback);\n\n // If the event bound is 'update,' fire it immediately for all handles.\n if (namespacedEvent.split(\".\")[0] === \"update\") {\n scope_Handles.forEach(function(a, index) {\n fireEvent(\"update\", index);\n });\n }\n }\n\n function isInternalNamespace(namespace) {\n return namespace === INTERNAL_EVENT_NS.aria || namespace === INTERNAL_EVENT_NS.tooltips;\n }\n\n // Undo attachment of event\n function removeEvent(namespacedEvent) {\n var event = namespacedEvent && namespacedEvent.split(\".\")[0];\n var namespace = event ? namespacedEvent.substring(event.length) : namespacedEvent;\n\n Object.keys(scope_Events).forEach(function(bind) {\n var tEvent = bind.split(\".\")[0];\n var tNamespace = bind.substring(tEvent.length);\n if ((!event || event === tEvent) && (!namespace || namespace === tNamespace)) {\n // only delete protected internal event if intentional\n if (!isInternalNamespace(tNamespace) || namespace === tNamespace) {\n delete scope_Events[bind];\n }\n }\n });\n }\n\n // External event handling\n function fireEvent(eventName, handleNumber, tap) {\n Object.keys(scope_Events).forEach(function(targetEvent) {\n var eventType = targetEvent.split(\".\")[0];\n\n if (eventName === eventType) {\n scope_Events[targetEvent].forEach(function(callback) {\n callback.call(\n // Use the slider public API as the scope ('this')\n scope_Self,\n // Return values as array, so arg_1[arg_2] is always valid.\n scope_Values.map(options.format.to),\n // Handle index, 0 or 1\n handleNumber,\n // Un-formatted slider values\n scope_Values.slice(),\n // Event is fired by tap, true or false\n tap || false,\n // Left offset of the handle, in relation to the slider\n scope_Locations.slice(),\n // add the slider public API to an accessible parameter when this is unavailable\n scope_Self\n );\n });\n }\n });\n }\n\n // Split out the handle positioning logic so the Move event can use it, too\n function checkHandlePosition(reference, handleNumber, to, lookBackward, lookForward, getValue) {\n var distance;\n\n // For sliders with multiple handles, limit movement to the other handle.\n // Apply the margin option by adding it to the handle positions.\n if (scope_Handles.length > 1 && !options.events.unconstrained) {\n if (lookBackward && handleNumber > 0) {\n distance = scope_Spectrum.getAbsoluteDistance(reference[handleNumber - 1], options.margin, 0);\n to = Math.max(to, distance);\n }\n\n if (lookForward && handleNumber < scope_Handles.length - 1) {\n distance = scope_Spectrum.getAbsoluteDistance(reference[handleNumber + 1], options.margin, 1);\n to = Math.min(to, distance);\n }\n }\n\n // The limit option has the opposite effect, limiting handles to a\n // maximum distance from another. Limit must be > 0, as otherwise\n // handles would be unmovable.\n if (scope_Handles.length > 1 && options.limit) {\n if (lookBackward && handleNumber > 0) {\n distance = scope_Spectrum.getAbsoluteDistance(reference[handleNumber - 1], options.limit, 0);\n to = Math.min(to, distance);\n }\n\n if (lookForward && handleNumber < scope_Handles.length - 1) {\n distance = scope_Spectrum.getAbsoluteDistance(reference[handleNumber + 1], options.limit, 1);\n to = Math.max(to, distance);\n }\n }\n\n // The padding option keeps the handles a certain distance from the\n // edges of the slider. Padding must be > 0.\n if (options.padding) {\n if (handleNumber === 0) {\n distance = scope_Spectrum.getAbsoluteDistance(0, options.padding[0], 0);\n to = Math.max(to, distance);\n }\n\n if (handleNumber === scope_Handles.length - 1) {\n distance = scope_Spectrum.getAbsoluteDistance(100, options.padding[1], 1);\n to = Math.min(to, distance);\n }\n }\n\n to = scope_Spectrum.getStep(to);\n\n // Limit percentage to the 0 - 100 range\n to = limit(to);\n\n // Return false if handle can't move\n if (to === reference[handleNumber] && !getValue) {\n return false;\n }\n\n return to;\n }\n\n // Uses slider orientation to create CSS rules. a = base value;\n function inRuleOrder(v, a) {\n var o = options.ort;\n return (o ? a : v) + \", \" + (o ? v : a);\n }\n\n // Moves handle(s) by a percentage\n // (bool, % to move, [% where handle started, ...], [index in scope_Handles, ...])\n function moveHandles(upward, proposal, locations, handleNumbers) {\n var proposals = locations.slice();\n\n var b = [!upward, upward];\n var f = [upward, !upward];\n\n // Copy handleNumbers so we don't change the dataset\n handleNumbers = handleNumbers.slice();\n\n // Check to see which handle is 'leading'.\n // If that one can't move the second can't either.\n if (upward) {\n handleNumbers.reverse();\n }\n\n // Step 1: get the maximum percentage that any of the handles can move\n if (handleNumbers.length > 1) {\n handleNumbers.forEach(function(handleNumber, o) {\n var to = checkHandlePosition(\n proposals,\n handleNumber,\n proposals[handleNumber] + proposal,\n b[o],\n f[o],\n false\n );\n\n // Stop if one of the handles can't move.\n if (to === false) {\n proposal = 0;\n } else {\n proposal = to - proposals[handleNumber];\n proposals[handleNumber] = to;\n }\n });\n }\n\n // If using one handle, check backward AND forward\n else {\n b = f = [true];\n }\n\n var state = false;\n\n // Step 2: Try to set the handles with the found percentage\n handleNumbers.forEach(function(handleNumber, o) {\n state = setHandle(handleNumber, locations[handleNumber] + proposal, b[o], f[o]) || state;\n });\n\n // Step 3: If a handle moved, fire events\n if (state) {\n handleNumbers.forEach(function(handleNumber) {\n fireEvent(\"update\", handleNumber);\n fireEvent(\"slide\", handleNumber);\n });\n }\n }\n\n // Takes a base value and an offset. This offset is used for the connect bar size.\n // In the initial design for this feature, the origin element was 1% wide.\n // Unfortunately, a rounding bug in Chrome makes it impossible to implement this feature\n // in this manner: https://bugs.chromium.org/p/chromium/issues/detail?id=798223\n function transformDirection(a, b) {\n return options.dir ? 100 - a - b : a;\n }\n\n // Updates scope_Locations and scope_Values, updates visual state\n function updateHandlePosition(handleNumber, to) {\n // Update locations.\n scope_Locations[handleNumber] = to;\n\n // Convert the value to the slider stepping/range.\n scope_Values[handleNumber] = scope_Spectrum.fromStepping(to);\n\n var translation = 10 * (transformDirection(to, 0) - scope_DirOffset);\n var translateRule = \"translate(\" + inRuleOrder(translation + \"%\", \"0\") + \")\";\n\n scope_Handles[handleNumber].style[options.transformRule] = translateRule;\n\n updateConnect(handleNumber);\n updateConnect(handleNumber + 1);\n }\n\n // Handles before the slider middle are stacked later = higher,\n // Handles after the middle later is lower\n // [[7] [8] .......... | .......... [5] [4]\n function setZindex() {\n scope_HandleNumbers.forEach(function(handleNumber) {\n var dir = scope_Locations[handleNumber] > 50 ? -1 : 1;\n var zIndex = 3 + (scope_Handles.length + dir * handleNumber);\n scope_Handles[handleNumber].style.zIndex = zIndex;\n });\n }\n\n // Test suggested values and apply margin, step.\n // if exactInput is true, don't run checkHandlePosition, then the handle can be placed in between steps (#436)\n function setHandle(handleNumber, to, lookBackward, lookForward, exactInput) {\n if (!exactInput) {\n to = checkHandlePosition(scope_Locations, handleNumber, to, lookBackward, lookForward, false);\n }\n\n if (to === false) {\n return false;\n }\n\n updateHandlePosition(handleNumber, to);\n\n return true;\n }\n\n // Updates style attribute for connect nodes\n function updateConnect(index) {\n // Skip connects set to false\n if (!scope_Connects[index]) {\n return;\n }\n\n var l = 0;\n var h = 100;\n\n if (index !== 0) {\n l = scope_Locations[index - 1];\n }\n\n if (index !== scope_Connects.length - 1) {\n h = scope_Locations[index];\n }\n\n // We use two rules:\n // 'translate' to change the left/top offset;\n // 'scale' to change the width of the element;\n // As the element has a width of 100%, a translation of 100% is equal to 100% of the parent (.noUi-base)\n var connectWidth = h - l;\n var translateRule = \"translate(\" + inRuleOrder(transformDirection(l, connectWidth) + \"%\", \"0\") + \")\";\n var scaleRule = \"scale(\" + inRuleOrder(connectWidth / 100, \"1\") + \")\";\n\n scope_Connects[index].style[options.transformRule] = translateRule + \" \" + scaleRule;\n }\n\n // Parses value passed to .set method. Returns current value if not parse-able.\n function resolveToValue(to, handleNumber) {\n // Setting with null indicates an 'ignore'.\n // Inputting 'false' is invalid.\n if (to === null || to === false || to === undefined) {\n return scope_Locations[handleNumber];\n }\n\n // If a formatted number was passed, attempt to decode it.\n if (typeof to === \"number\") {\n to = String(to);\n }\n\n to = options.format.from(to);\n to = scope_Spectrum.toStepping(to);\n\n // If parsing the number failed, use the current value.\n if (to === false || isNaN(to)) {\n return scope_Locations[handleNumber];\n }\n\n return to;\n }\n\n // Set the slider value.\n function valueSet(input, fireSetEvent, exactInput) {\n var values = asArray(input);\n var isInit = scope_Locations[0] === undefined;\n\n // Event fires by default\n fireSetEvent = fireSetEvent === undefined ? true : !!fireSetEvent;\n\n // Animation is optional.\n // Make sure the initial values were set before using animated placement.\n if (options.animate && !isInit) {\n addClassFor(scope_Target, options.cssClasses.tap, options.animationDuration);\n }\n\n // First pass, without lookAhead but with lookBackward. Values are set from left to right.\n scope_HandleNumbers.forEach(function(handleNumber) {\n setHandle(handleNumber, resolveToValue(values[handleNumber], handleNumber), true, false, exactInput);\n });\n\n var i = scope_HandleNumbers.length === 1 ? 0 : 1;\n\n // Secondary passes. Now that all base values are set, apply constraints.\n // Iterate all handles to ensure constraints are applied for the entire slider (Issue #1009)\n for (; i < scope_HandleNumbers.length; ++i) {\n scope_HandleNumbers.forEach(function(handleNumber) {\n setHandle(handleNumber, scope_Locations[handleNumber], true, true, exactInput);\n });\n }\n\n setZindex();\n\n scope_HandleNumbers.forEach(function(handleNumber) {\n fireEvent(\"update\", handleNumber);\n\n // Fire the event only for handles that received a new value, as per #579\n if (values[handleNumber] !== null && fireSetEvent) {\n fireEvent(\"set\", handleNumber);\n }\n });\n }\n\n // Reset slider to initial values\n function valueReset(fireSetEvent) {\n valueSet(options.start, fireSetEvent);\n }\n\n // Set value for a single handle\n function valueSetHandle(handleNumber, value, fireSetEvent, exactInput) {\n // Ensure numeric input\n handleNumber = Number(handleNumber);\n\n if (!(handleNumber >= 0 && handleNumber < scope_HandleNumbers.length)) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): invalid handle number, got: \" + handleNumber);\n }\n\n // Look both backward and forward, since we don't want this handle to \"push\" other handles (#960);\n // The exactInput argument can be used to ignore slider stepping (#436)\n setHandle(handleNumber, resolveToValue(value, handleNumber), true, true, exactInput);\n\n fireEvent(\"update\", handleNumber);\n\n if (fireSetEvent) {\n fireEvent(\"set\", handleNumber);\n }\n }\n\n // Get the slider value.\n function valueGet() {\n var values = scope_Values.map(options.format.to);\n\n // If only one handle is used, return a single value.\n if (values.length === 1) {\n return values[0];\n }\n\n return values;\n }\n\n // Removes classes from the root and empties it.\n function destroy() {\n // remove protected internal listeners\n removeEvent(INTERNAL_EVENT_NS.aria);\n removeEvent(INTERNAL_EVENT_NS.tooltips);\n\n for (var key in options.cssClasses) {\n if (!options.cssClasses.hasOwnProperty(key)) {\n continue;\n }\n removeClass(scope_Target, options.cssClasses[key]);\n }\n\n while (scope_Target.firstChild) {\n scope_Target.removeChild(scope_Target.firstChild);\n }\n\n delete scope_Target.noUiSlider;\n }\n\n function getNextStepsForHandle(handleNumber) {\n var location = scope_Locations[handleNumber];\n var nearbySteps = scope_Spectrum.getNearbySteps(location);\n var value = scope_Values[handleNumber];\n var increment = nearbySteps.thisStep.step;\n var decrement = null;\n\n // If snapped, directly use defined step value\n if (options.snap) {\n return [\n value - nearbySteps.stepBefore.startValue || null,\n nearbySteps.stepAfter.startValue - value || null\n ];\n }\n\n // If the next value in this step moves into the next step,\n // the increment is the start of the next step - the current value\n if (increment !== false) {\n if (value + increment > nearbySteps.stepAfter.startValue) {\n increment = nearbySteps.stepAfter.startValue - value;\n }\n }\n\n // If the value is beyond the starting point\n if (value > nearbySteps.thisStep.startValue) {\n decrement = nearbySteps.thisStep.step;\n } else if (nearbySteps.stepBefore.step === false) {\n decrement = false;\n }\n\n // If a handle is at the start of a step, it always steps back into the previous step first\n else {\n decrement = value - nearbySteps.stepBefore.highestStep;\n }\n\n // Now, if at the slider edges, there is no in/decrement\n if (location === 100) {\n increment = null;\n } else if (location === 0) {\n decrement = null;\n }\n\n // As per #391, the comparison for the decrement step can have some rounding issues.\n var stepDecimals = scope_Spectrum.countStepDecimals();\n\n // Round per #391\n if (increment !== null && increment !== false) {\n increment = Number(increment.toFixed(stepDecimals));\n }\n\n if (decrement !== null && decrement !== false) {\n decrement = Number(decrement.toFixed(stepDecimals));\n }\n\n return [decrement, increment];\n }\n\n // Get the current step size for the slider.\n function getNextSteps() {\n return scope_HandleNumbers.map(getNextStepsForHandle);\n }\n\n // Updateable: margin, limit, padding, step, range, animate, snap\n function updateOptions(optionsToUpdate, fireSetEvent) {\n // Spectrum is created using the range, snap, direction and step options.\n // 'snap' and 'step' can be updated.\n // If 'snap' and 'step' are not passed, they should remain unchanged.\n var v = valueGet();\n\n var updateAble = [\n \"margin\",\n \"limit\",\n \"padding\",\n \"range\",\n \"animate\",\n \"snap\",\n \"step\",\n \"format\",\n \"pips\",\n \"tooltips\"\n ];\n\n // Only change options that we're actually passed to update.\n updateAble.forEach(function(name) {\n // Check for undefined. null removes the value.\n if (optionsToUpdate[name] !== undefined) {\n originalOptions[name] = optionsToUpdate[name];\n }\n });\n\n var newOptions = testOptions(originalOptions);\n\n // Load new options into the slider state\n updateAble.forEach(function(name) {\n if (optionsToUpdate[name] !== undefined) {\n options[name] = newOptions[name];\n }\n });\n\n scope_Spectrum = newOptions.spectrum;\n\n // Limit, margin and padding depend on the spectrum but are stored outside of it. (#677)\n options.margin = newOptions.margin;\n options.limit = newOptions.limit;\n options.padding = newOptions.padding;\n\n // Update pips, removes existing.\n if (options.pips) {\n pips(options.pips);\n } else {\n removePips();\n }\n\n // Update tooltips, removes existing.\n if (options.tooltips) {\n tooltips();\n } else {\n removeTooltips();\n }\n\n // Invalidate the current positioning so valueSet forces an update.\n scope_Locations = [];\n valueSet(optionsToUpdate.start || v, fireSetEvent);\n }\n\n // Initialization steps\n function setupSlider() {\n // Create the base element, initialize HTML and set classes.\n // Add handles and connect elements.\n scope_Base = addSlider(scope_Target);\n\n addElements(options.connect, scope_Base);\n\n // Attach user events.\n bindSliderEvents(options.events);\n\n // Use the public value method to set the start values.\n valueSet(options.start);\n\n if (options.pips) {\n pips(options.pips);\n }\n\n if (options.tooltips) {\n tooltips();\n }\n\n aria();\n }\n\n setupSlider();\n\n // noinspection JSUnusedGlobalSymbols\n scope_Self = {\n destroy: destroy,\n steps: getNextSteps,\n on: bindEvent,\n off: removeEvent,\n get: valueGet,\n set: valueSet,\n setHandle: valueSetHandle,\n reset: valueReset,\n // Exposed for unit testing, don't use this in your application.\n __moveHandles: function(a, b, c) {\n moveHandles(a, b, scope_Locations, c);\n },\n options: originalOptions, // Issue #600, #678\n updateOptions: updateOptions,\n target: scope_Target, // Issue #597\n removePips: removePips,\n removeTooltips: removeTooltips,\n getTooltips: function() {\n return scope_Tooltips;\n },\n getOrigins: function() {\n return scope_Handles;\n },\n pips: pips // Issue #594\n };\n\n return scope_Self;\n }\n\n // Run the standard initializer\n function initialize(target, originalOptions) {\n if (!target || !target.nodeName) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): create requires a single element, got: \" + target);\n }\n\n // Throw an error if the slider was already initialized.\n if (target.noUiSlider) {\n throw new Error(\"noUiSlider (\" + VERSION + \"): Slider was already initialized.\");\n }\n\n // Test the options and create the slider environment;\n var options = testOptions(originalOptions, target);\n var api = scope(target, options, originalOptions);\n\n target.noUiSlider = api;\n\n return api;\n }\n\n // Use an object instead of a function for future expandability;\n return {\n // Exposed for unit testing, don't use this in your application.\n __spectrum: Spectrum,\n version: VERSION,\n // A reference to the default classes, allows global changes.\n // Use the cssClasses option for changes to one slider.\n cssClasses: cssClasses,\n create: initialize\n };\n});\n","import { Subject } from './Subject';\nexport class BehaviorSubject extends Subject {\n constructor(_value) {\n super();\n this._value = _value;\n }\n get value() {\n return this.getValue();\n }\n _subscribe(subscriber) {\n const subscription = super._subscribe(subscriber);\n !subscription.closed && subscriber.next(this._value);\n return subscription;\n }\n getValue() {\n const { hasError, thrownError, _value } = this;\n if (hasError) {\n throw thrownError;\n }\n this._throwIfClosed();\n return _value;\n }\n next(value) {\n super.next((this._value = value));\n }\n}\n","import { SafeSubscriber, Subscriber } from './Subscriber';\nimport { isSubscription } from './Subscription';\nimport { observable as Symbol_observable } from './symbol/observable';\nimport { pipeFromArray } from './util/pipe';\nimport { config } from './config';\nimport { isFunction } from './util/isFunction';\nimport { errorContext } from './util/errorContext';\nexport class Observable {\n constructor(subscribe) {\n if (subscribe) {\n this._subscribe = subscribe;\n }\n }\n lift(operator) {\n const observable = new Observable();\n observable.source = this;\n observable.operator = operator;\n return observable;\n }\n subscribe(observerOrNext, error, complete) {\n const subscriber = isSubscriber(observerOrNext) ? observerOrNext : new SafeSubscriber(observerOrNext, error, complete);\n errorContext(() => {\n const { operator, source } = this;\n subscriber.add(operator\n ?\n operator.call(subscriber, source)\n : source\n ?\n this._subscribe(subscriber)\n :\n this._trySubscribe(subscriber));\n });\n return subscriber;\n }\n _trySubscribe(sink) {\n try {\n return this._subscribe(sink);\n }\n catch (err) {\n sink.error(err);\n }\n }\n forEach(next, promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n const subscriber = new SafeSubscriber({\n next: (value) => {\n try {\n next(value);\n }\n catch (err) {\n reject(err);\n subscriber.unsubscribe();\n }\n },\n error: reject,\n complete: resolve,\n });\n this.subscribe(subscriber);\n });\n }\n _subscribe(subscriber) {\n var _a;\n return (_a = this.source) === null || _a === void 0 ? void 0 : _a.subscribe(subscriber);\n }\n [Symbol_observable]() {\n return this;\n }\n pipe(...operations) {\n return pipeFromArray(operations)(this);\n }\n toPromise(promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let value;\n this.subscribe((x) => (value = x), (err) => reject(err), () => resolve(value));\n });\n }\n}\nObservable.create = (subscribe) => {\n return new Observable(subscribe);\n};\nfunction getPromiseCtor(promiseCtor) {\n var _a;\n return (_a = promiseCtor !== null && promiseCtor !== void 0 ? promiseCtor : config.Promise) !== null && _a !== void 0 ? _a : Promise;\n}\nfunction isObserver(value) {\n return value && isFunction(value.next) && isFunction(value.error) && isFunction(value.complete);\n}\nfunction isSubscriber(value) {\n return (value && value instanceof Subscriber) || (isObserver(value) && isSubscription(value));\n}\n","import { createErrorClass } from './createErrorClass';\nexport const ObjectUnsubscribedError = createErrorClass((_super) => function ObjectUnsubscribedErrorImpl() {\n _super(this);\n this.name = 'ObjectUnsubscribedError';\n this.message = 'object unsubscribed';\n});\n","import { Observable } from './Observable';\nimport { Subscription, EMPTY_SUBSCRIPTION } from './Subscription';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nimport { arrRemove } from './util/arrRemove';\nimport { errorContext } from './util/errorContext';\nexport class Subject extends Observable {\n constructor() {\n super();\n this.closed = false;\n this.currentObservers = null;\n this.observers = [];\n this.isStopped = false;\n this.hasError = false;\n this.thrownError = null;\n }\n lift(operator) {\n const subject = new AnonymousSubject(this, this);\n subject.operator = operator;\n return subject;\n }\n _throwIfClosed() {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n }\n next(value) {\n errorContext(() => {\n this._throwIfClosed();\n if (!this.isStopped) {\n if (!this.currentObservers) {\n this.currentObservers = Array.from(this.observers);\n }\n for (const observer of this.currentObservers) {\n observer.next(value);\n }\n }\n });\n }\n error(err) {\n errorContext(() => {\n this._throwIfClosed();\n if (!this.isStopped) {\n this.hasError = this.isStopped = true;\n this.thrownError = err;\n const { observers } = this;\n while (observers.length) {\n observers.shift().error(err);\n }\n }\n });\n }\n complete() {\n errorContext(() => {\n this._throwIfClosed();\n if (!this.isStopped) {\n this.isStopped = true;\n const { observers } = this;\n while (observers.length) {\n observers.shift().complete();\n }\n }\n });\n }\n unsubscribe() {\n this.isStopped = this.closed = true;\n this.observers = this.currentObservers = null;\n }\n get observed() {\n var _a;\n return ((_a = this.observers) === null || _a === void 0 ? void 0 : _a.length) > 0;\n }\n _trySubscribe(subscriber) {\n this._throwIfClosed();\n return super._trySubscribe(subscriber);\n }\n _subscribe(subscriber) {\n this._throwIfClosed();\n this._checkFinalizedStatuses(subscriber);\n return this._innerSubscribe(subscriber);\n }\n _innerSubscribe(subscriber) {\n const { hasError, isStopped, observers } = this;\n if (hasError || isStopped) {\n return EMPTY_SUBSCRIPTION;\n }\n this.currentObservers = null;\n observers.push(subscriber);\n return new Subscription(() => {\n this.currentObservers = null;\n arrRemove(observers, subscriber);\n });\n }\n _checkFinalizedStatuses(subscriber) {\n const { hasError, thrownError, isStopped } = this;\n if (hasError) {\n subscriber.error(thrownError);\n }\n else if (isStopped) {\n subscriber.complete();\n }\n }\n asObservable() {\n const observable = new Observable();\n observable.source = this;\n return observable;\n }\n}\nSubject.create = (destination, source) => {\n return new AnonymousSubject(destination, source);\n};\nexport class AnonymousSubject extends Subject {\n constructor(destination, source) {\n super();\n this.destination = destination;\n this.source = source;\n }\n next(value) {\n var _a, _b;\n (_b = (_a = this.destination) === null || _a === void 0 ? void 0 : _a.next) === null || _b === void 0 ? void 0 : _b.call(_a, value);\n }\n error(err) {\n var _a, _b;\n (_b = (_a = this.destination) === null || _a === void 0 ? void 0 : _a.error) === null || _b === void 0 ? void 0 : _b.call(_a, err);\n }\n complete() {\n var _a, _b;\n (_b = (_a = this.destination) === null || _a === void 0 ? void 0 : _a.complete) === null || _b === void 0 ? void 0 : _b.call(_a);\n }\n _subscribe(subscriber) {\n var _a, _b;\n return (_b = (_a = this.source) === null || _a === void 0 ? void 0 : _a.subscribe(subscriber)) !== null && _b !== void 0 ? _b : EMPTY_SUBSCRIPTION;\n }\n}\n","export const COMPLETE_NOTIFICATION = (() => createNotification('C', undefined, undefined))();\nexport function errorNotification(error) {\n return createNotification('E', undefined, error);\n}\nexport function nextNotification(value) {\n return createNotification('N', value, undefined);\n}\nexport function createNotification(kind, value, error) {\n return {\n kind,\n value,\n error,\n };\n}\n","import { isFunction } from './util/isFunction';\nimport { isSubscription, Subscription } from './Subscription';\nimport { config } from './config';\nimport { reportUnhandledError } from './util/reportUnhandledError';\nimport { noop } from './util/noop';\nimport { nextNotification, errorNotification, COMPLETE_NOTIFICATION } from './NotificationFactories';\nimport { timeoutProvider } from './scheduler/timeoutProvider';\nimport { captureError } from './util/errorContext';\nexport class Subscriber extends Subscription {\n constructor(destination) {\n super();\n this.isStopped = false;\n if (destination) {\n this.destination = destination;\n if (isSubscription(destination)) {\n destination.add(this);\n }\n }\n else {\n this.destination = EMPTY_OBSERVER;\n }\n }\n static create(next, error, complete) {\n return new SafeSubscriber(next, error, complete);\n }\n next(value) {\n if (this.isStopped) {\n handleStoppedNotification(nextNotification(value), this);\n }\n else {\n this._next(value);\n }\n }\n error(err) {\n if (this.isStopped) {\n handleStoppedNotification(errorNotification(err), this);\n }\n else {\n this.isStopped = true;\n this._error(err);\n }\n }\n complete() {\n if (this.isStopped) {\n handleStoppedNotification(COMPLETE_NOTIFICATION, this);\n }\n else {\n this.isStopped = true;\n this._complete();\n }\n }\n unsubscribe() {\n if (!this.closed) {\n this.isStopped = true;\n super.unsubscribe();\n this.destination = null;\n }\n }\n _next(value) {\n this.destination.next(value);\n }\n _error(err) {\n try {\n this.destination.error(err);\n }\n finally {\n this.unsubscribe();\n }\n }\n _complete() {\n try {\n this.destination.complete();\n }\n finally {\n this.unsubscribe();\n }\n }\n}\nconst _bind = Function.prototype.bind;\nfunction bind(fn, thisArg) {\n return _bind.call(fn, thisArg);\n}\nclass ConsumerObserver {\n constructor(partialObserver) {\n this.partialObserver = partialObserver;\n }\n next(value) {\n const { partialObserver } = this;\n if (partialObserver.next) {\n try {\n partialObserver.next(value);\n }\n catch (error) {\n handleUnhandledError(error);\n }\n }\n }\n error(err) {\n const { partialObserver } = this;\n if (partialObserver.error) {\n try {\n partialObserver.error(err);\n }\n catch (error) {\n handleUnhandledError(error);\n }\n }\n else {\n handleUnhandledError(err);\n }\n }\n complete() {\n const { partialObserver } = this;\n if (partialObserver.complete) {\n try {\n partialObserver.complete();\n }\n catch (error) {\n handleUnhandledError(error);\n }\n }\n }\n}\nexport class SafeSubscriber extends Subscriber {\n constructor(observerOrNext, error, complete) {\n super();\n let partialObserver;\n if (isFunction(observerOrNext) || !observerOrNext) {\n partialObserver = {\n next: (observerOrNext !== null && observerOrNext !== void 0 ? observerOrNext : undefined),\n error: error !== null && error !== void 0 ? error : undefined,\n complete: complete !== null && complete !== void 0 ? complete : undefined,\n };\n }\n else {\n let context;\n if (this && config.useDeprecatedNextContext) {\n context = Object.create(observerOrNext);\n context.unsubscribe = () => this.unsubscribe();\n partialObserver = {\n next: observerOrNext.next && bind(observerOrNext.next, context),\n error: observerOrNext.error && bind(observerOrNext.error, context),\n complete: observerOrNext.complete && bind(observerOrNext.complete, context),\n };\n }\n else {\n partialObserver = observerOrNext;\n }\n }\n this.destination = new ConsumerObserver(partialObserver);\n }\n}\nfunction handleUnhandledError(error) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n captureError(error);\n }\n else {\n reportUnhandledError(error);\n }\n}\nfunction defaultErrorHandler(err) {\n throw err;\n}\nfunction handleStoppedNotification(notification, subscriber) {\n const { onStoppedNotification } = config;\n onStoppedNotification && timeoutProvider.setTimeout(() => onStoppedNotification(notification, subscriber));\n}\nexport const EMPTY_OBSERVER = {\n closed: true,\n next: noop,\n error: defaultErrorHandler,\n complete: noop,\n};\n","import { createErrorClass } from './createErrorClass';\nexport const UnsubscriptionError = createErrorClass((_super) => function UnsubscriptionErrorImpl(errors) {\n _super(this);\n this.message = errors\n ? `${errors.length} errors occurred during unsubscription:\n${errors.map((err, i) => `${i + 1}) ${err.toString()}`).join('\\n ')}`\n : '';\n this.name = 'UnsubscriptionError';\n this.errors = errors;\n});\n","import { isFunction } from './util/isFunction';\nimport { UnsubscriptionError } from './util/UnsubscriptionError';\nimport { arrRemove } from './util/arrRemove';\nexport class Subscription {\n constructor(initialTeardown) {\n this.initialTeardown = initialTeardown;\n this.closed = false;\n this._parentage = null;\n this._finalizers = null;\n }\n unsubscribe() {\n let errors;\n if (!this.closed) {\n this.closed = true;\n const { _parentage } = this;\n if (_parentage) {\n this._parentage = null;\n if (Array.isArray(_parentage)) {\n for (const parent of _parentage) {\n parent.remove(this);\n }\n }\n else {\n _parentage.remove(this);\n }\n }\n const { initialTeardown: initialFinalizer } = this;\n if (isFunction(initialFinalizer)) {\n try {\n initialFinalizer();\n }\n catch (e) {\n errors = e instanceof UnsubscriptionError ? e.errors : [e];\n }\n }\n const { _finalizers } = this;\n if (_finalizers) {\n this._finalizers = null;\n for (const finalizer of _finalizers) {\n try {\n execFinalizer(finalizer);\n }\n catch (err) {\n errors = errors !== null && errors !== void 0 ? errors : [];\n if (err instanceof UnsubscriptionError) {\n errors = [...errors, ...err.errors];\n }\n else {\n errors.push(err);\n }\n }\n }\n }\n if (errors) {\n throw new UnsubscriptionError(errors);\n }\n }\n }\n add(teardown) {\n var _a;\n if (teardown && teardown !== this) {\n if (this.closed) {\n execFinalizer(teardown);\n }\n else {\n if (teardown instanceof Subscription) {\n if (teardown.closed || teardown._hasParent(this)) {\n return;\n }\n teardown._addParent(this);\n }\n (this._finalizers = (_a = this._finalizers) !== null && _a !== void 0 ? _a : []).push(teardown);\n }\n }\n }\n _hasParent(parent) {\n const { _parentage } = this;\n return _parentage === parent || (Array.isArray(_parentage) && _parentage.includes(parent));\n }\n _addParent(parent) {\n const { _parentage } = this;\n this._parentage = Array.isArray(_parentage) ? (_parentage.push(parent), _parentage) : _parentage ? [_parentage, parent] : parent;\n }\n _removeParent(parent) {\n const { _parentage } = this;\n if (_parentage === parent) {\n this._parentage = null;\n }\n else if (Array.isArray(_parentage)) {\n arrRemove(_parentage, parent);\n }\n }\n remove(teardown) {\n const { _finalizers } = this;\n _finalizers && arrRemove(_finalizers, teardown);\n if (teardown instanceof Subscription) {\n teardown._removeParent(this);\n }\n }\n}\nSubscription.EMPTY = (() => {\n const empty = new Subscription();\n empty.closed = true;\n return empty;\n})();\nexport const EMPTY_SUBSCRIPTION = Subscription.EMPTY;\nexport function isSubscription(value) {\n return (value instanceof Subscription ||\n (value && 'closed' in value && isFunction(value.remove) && isFunction(value.add) && isFunction(value.unsubscribe)));\n}\nfunction execFinalizer(finalizer) {\n if (isFunction(finalizer)) {\n finalizer();\n }\n else {\n finalizer.unsubscribe();\n }\n}\n","export const config = {\n onUnhandledError: null,\n onStoppedNotification: null,\n Promise: undefined,\n useDeprecatedSynchronousErrorHandling: false,\n useDeprecatedNextContext: false,\n};\n","import { Observable } from '../Observable';\nimport { argsArgArrayOrObject } from '../util/argsArgArrayOrObject';\nimport { from } from './from';\nimport { identity } from '../util/identity';\nimport { mapOneOrManyArgs } from '../util/mapOneOrManyArgs';\nimport { popResultSelector, popScheduler } from '../util/args';\nimport { createObject } from '../util/createObject';\nimport { createOperatorSubscriber } from '../operators/OperatorSubscriber';\nimport { executeSchedule } from '../util/executeSchedule';\nexport function combineLatest(...args) {\n const scheduler = popScheduler(args);\n const resultSelector = popResultSelector(args);\n const { args: observables, keys } = argsArgArrayOrObject(args);\n if (observables.length === 0) {\n return from([], scheduler);\n }\n const result = new Observable(combineLatestInit(observables, scheduler, keys\n ?\n (values) => createObject(keys, values)\n :\n identity));\n return resultSelector ? result.pipe(mapOneOrManyArgs(resultSelector)) : result;\n}\nexport function combineLatestInit(observables, scheduler, valueTransform = identity) {\n return (subscriber) => {\n maybeSchedule(scheduler, () => {\n const { length } = observables;\n const values = new Array(length);\n let active = length;\n let remainingFirstValues = length;\n for (let i = 0; i < length; i++) {\n maybeSchedule(scheduler, () => {\n const source = from(observables[i], scheduler);\n let hasFirstValue = false;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n values[i] = value;\n if (!hasFirstValue) {\n hasFirstValue = true;\n remainingFirstValues--;\n }\n if (!remainingFirstValues) {\n subscriber.next(valueTransform(values.slice()));\n }\n }, () => {\n if (!--active) {\n subscriber.complete();\n }\n }));\n }, subscriber);\n }\n }, subscriber);\n };\n}\nfunction maybeSchedule(scheduler, execute, subscription) {\n if (scheduler) {\n executeSchedule(subscription, scheduler, execute);\n }\n else {\n execute();\n }\n}\n","import { concatAll } from '../operators/concatAll';\nimport { popScheduler } from '../util/args';\nimport { from } from './from';\nexport function concat(...args) {\n return concatAll()(from(args, popScheduler(args)));\n}\n","import { mergeAll } from './mergeAll';\nexport function concatAll() {\n return mergeAll(1);\n}\n","import { Observable } from '../Observable';\nimport { innerFrom } from './innerFrom';\nexport function defer(observableFactory) {\n return new Observable((subscriber) => {\n innerFrom(observableFactory()).subscribe(subscriber);\n });\n}\n","import { Observable } from '../Observable';\nexport const EMPTY = new Observable((subscriber) => subscriber.complete());\nexport function empty(scheduler) {\n return scheduler ? emptyScheduled(scheduler) : EMPTY;\n}\nfunction emptyScheduled(scheduler) {\n return new Observable((subscriber) => scheduler.schedule(() => subscriber.complete()));\n}\n","import { operate } from '../util/lift';\nexport function subscribeOn(scheduler, delay = 0) {\n return operate((source, subscriber) => {\n subscriber.add(scheduler.schedule(() => source.subscribe(subscriber), delay));\n });\n}\n","import { Observable } from '../Observable';\nimport { executeSchedule } from '../util/executeSchedule';\nexport function scheduleAsyncIterable(input, scheduler) {\n if (!input) {\n throw new Error('Iterable cannot be null');\n }\n return new Observable((subscriber) => {\n executeSchedule(subscriber, scheduler, () => {\n const iterator = input[Symbol.asyncIterator]();\n executeSchedule(subscriber, scheduler, () => {\n iterator.next().then((result) => {\n if (result.done) {\n subscriber.complete();\n }\n else {\n subscriber.next(result.value);\n }\n });\n }, 0, true);\n });\n });\n}\n","import { scheduled } from '../scheduled/scheduled';\nimport { innerFrom } from './innerFrom';\nexport function from(input, scheduler) {\n return scheduler ? scheduled(input, scheduler) : innerFrom(input);\n}\n","import { scheduleObservable } from './scheduleObservable';\nimport { schedulePromise } from './schedulePromise';\nimport { scheduleArray } from './scheduleArray';\nimport { scheduleIterable } from './scheduleIterable';\nimport { scheduleAsyncIterable } from './scheduleAsyncIterable';\nimport { isInteropObservable } from '../util/isInteropObservable';\nimport { isPromise } from '../util/isPromise';\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isIterable } from '../util/isIterable';\nimport { isAsyncIterable } from '../util/isAsyncIterable';\nimport { createInvalidObservableTypeError } from '../util/throwUnobservableError';\nimport { isReadableStreamLike } from '../util/isReadableStreamLike';\nimport { scheduleReadableStreamLike } from './scheduleReadableStreamLike';\nexport function scheduled(input, scheduler) {\n if (input != null) {\n if (isInteropObservable(input)) {\n return scheduleObservable(input, scheduler);\n }\n if (isArrayLike(input)) {\n return scheduleArray(input, scheduler);\n }\n if (isPromise(input)) {\n return schedulePromise(input, scheduler);\n }\n if (isAsyncIterable(input)) {\n return scheduleAsyncIterable(input, scheduler);\n }\n if (isIterable(input)) {\n return scheduleIterable(input, scheduler);\n }\n if (isReadableStreamLike(input)) {\n return scheduleReadableStreamLike(input, scheduler);\n }\n }\n throw createInvalidObservableTypeError(input);\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { observeOn } from '../operators/observeOn';\nimport { subscribeOn } from '../operators/subscribeOn';\nexport function scheduleObservable(input, scheduler) {\n return innerFrom(input).pipe(subscribeOn(scheduler), observeOn(scheduler));\n}\n","import { Observable } from '../Observable';\nexport function scheduleArray(input, scheduler) {\n return new Observable((subscriber) => {\n let i = 0;\n return scheduler.schedule(function () {\n if (i === input.length) {\n subscriber.complete();\n }\n else {\n subscriber.next(input[i++]);\n if (!subscriber.closed) {\n this.schedule();\n }\n }\n });\n });\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { observeOn } from '../operators/observeOn';\nimport { subscribeOn } from '../operators/subscribeOn';\nexport function schedulePromise(input, scheduler) {\n return innerFrom(input).pipe(subscribeOn(scheduler), observeOn(scheduler));\n}\n","import { Observable } from '../Observable';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nimport { isFunction } from '../util/isFunction';\nimport { executeSchedule } from '../util/executeSchedule';\nexport function scheduleIterable(input, scheduler) {\n return new Observable((subscriber) => {\n let iterator;\n executeSchedule(subscriber, scheduler, () => {\n iterator = input[Symbol_iterator]();\n executeSchedule(subscriber, scheduler, () => {\n let value;\n let done;\n try {\n ({ value, done } = iterator.next());\n }\n catch (err) {\n subscriber.error(err);\n return;\n }\n if (done) {\n subscriber.complete();\n }\n else {\n subscriber.next(value);\n }\n }, 0, true);\n });\n return () => isFunction(iterator === null || iterator === void 0 ? void 0 : iterator.return) && iterator.return();\n });\n}\n","import { scheduleAsyncIterable } from './scheduleAsyncIterable';\nimport { readableStreamLikeToAsyncGenerator } from '../util/isReadableStreamLike';\nexport function scheduleReadableStreamLike(input, scheduler) {\n return scheduleAsyncIterable(readableStreamLikeToAsyncGenerator(input), scheduler);\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { Observable } from '../Observable';\nimport { mergeMap } from '../operators/mergeMap';\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isFunction } from '../util/isFunction';\nimport { mapOneOrManyArgs } from '../util/mapOneOrManyArgs';\nconst nodeEventEmitterMethods = ['addListener', 'removeListener'];\nconst eventTargetMethods = ['addEventListener', 'removeEventListener'];\nconst jqueryMethods = ['on', 'off'];\nexport function fromEvent(target, eventName, options, resultSelector) {\n if (isFunction(options)) {\n resultSelector = options;\n options = undefined;\n }\n if (resultSelector) {\n return fromEvent(target, eventName, options).pipe(mapOneOrManyArgs(resultSelector));\n }\n const [add, remove] = isEventTarget(target)\n ? eventTargetMethods.map((methodName) => (handler) => target[methodName](eventName, handler, options))\n :\n isNodeStyleEventEmitter(target)\n ? nodeEventEmitterMethods.map(toCommonHandlerRegistry(target, eventName))\n : isJQueryStyleEventEmitter(target)\n ? jqueryMethods.map(toCommonHandlerRegistry(target, eventName))\n : [];\n if (!add) {\n if (isArrayLike(target)) {\n return mergeMap((subTarget) => fromEvent(subTarget, eventName, options))(innerFrom(target));\n }\n }\n if (!add) {\n throw new TypeError('Invalid event target');\n }\n return new Observable((subscriber) => {\n const handler = (...args) => subscriber.next(1 < args.length ? args : args[0]);\n add(handler);\n return () => remove(handler);\n });\n}\nfunction toCommonHandlerRegistry(target, eventName) {\n return (methodName) => (handler) => target[methodName](eventName, handler);\n}\nfunction isNodeStyleEventEmitter(target) {\n return isFunction(target.addListener) && isFunction(target.removeListener);\n}\nfunction isJQueryStyleEventEmitter(target) {\n return isFunction(target.on) && isFunction(target.off);\n}\nfunction isEventTarget(target) {\n return isFunction(target.addEventListener) && isFunction(target.removeEventListener);\n}\n","import { __asyncValues, __awaiter } from \"tslib\";\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isPromise } from '../util/isPromise';\nimport { Observable } from '../Observable';\nimport { isInteropObservable } from '../util/isInteropObservable';\nimport { isAsyncIterable } from '../util/isAsyncIterable';\nimport { createInvalidObservableTypeError } from '../util/throwUnobservableError';\nimport { isIterable } from '../util/isIterable';\nimport { isReadableStreamLike, readableStreamLikeToAsyncGenerator } from '../util/isReadableStreamLike';\nimport { isFunction } from '../util/isFunction';\nimport { reportUnhandledError } from '../util/reportUnhandledError';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport function innerFrom(input) {\n if (input instanceof Observable) {\n return input;\n }\n if (input != null) {\n if (isInteropObservable(input)) {\n return fromInteropObservable(input);\n }\n if (isArrayLike(input)) {\n return fromArrayLike(input);\n }\n if (isPromise(input)) {\n return fromPromise(input);\n }\n if (isAsyncIterable(input)) {\n return fromAsyncIterable(input);\n }\n if (isIterable(input)) {\n return fromIterable(input);\n }\n if (isReadableStreamLike(input)) {\n return fromReadableStreamLike(input);\n }\n }\n throw createInvalidObservableTypeError(input);\n}\nexport function fromInteropObservable(obj) {\n return new Observable((subscriber) => {\n const obs = obj[Symbol_observable]();\n if (isFunction(obs.subscribe)) {\n return obs.subscribe(subscriber);\n }\n throw new TypeError('Provided object does not correctly implement Symbol.observable');\n });\n}\nexport function fromArrayLike(array) {\n return new Observable((subscriber) => {\n for (let i = 0; i < array.length && !subscriber.closed; i++) {\n subscriber.next(array[i]);\n }\n subscriber.complete();\n });\n}\nexport function fromPromise(promise) {\n return new Observable((subscriber) => {\n promise\n .then((value) => {\n if (!subscriber.closed) {\n subscriber.next(value);\n subscriber.complete();\n }\n }, (err) => subscriber.error(err))\n .then(null, reportUnhandledError);\n });\n}\nexport function fromIterable(iterable) {\n return new Observable((subscriber) => {\n for (const value of iterable) {\n subscriber.next(value);\n if (subscriber.closed) {\n return;\n }\n }\n subscriber.complete();\n });\n}\nexport function fromAsyncIterable(asyncIterable) {\n return new Observable((subscriber) => {\n process(asyncIterable, subscriber).catch((err) => subscriber.error(err));\n });\n}\nexport function fromReadableStreamLike(readableStream) {\n return fromAsyncIterable(readableStreamLikeToAsyncGenerator(readableStream));\n}\nfunction process(asyncIterable, subscriber) {\n var asyncIterable_1, asyncIterable_1_1;\n var e_1, _a;\n return __awaiter(this, void 0, void 0, function* () {\n try {\n for (asyncIterable_1 = __asyncValues(asyncIterable); asyncIterable_1_1 = yield asyncIterable_1.next(), !asyncIterable_1_1.done;) {\n const value = asyncIterable_1_1.value;\n subscriber.next(value);\n if (subscriber.closed) {\n return;\n }\n }\n }\n catch (e_1_1) { e_1 = { error: e_1_1 }; }\n finally {\n try {\n if (asyncIterable_1_1 && !asyncIterable_1_1.done && (_a = asyncIterable_1.return)) yield _a.call(asyncIterable_1);\n }\n finally { if (e_1) throw e_1.error; }\n }\n subscriber.complete();\n });\n}\n","import { mergeAll } from '../operators/mergeAll';\nimport { innerFrom } from './innerFrom';\nimport { EMPTY } from './empty';\nimport { popNumber, popScheduler } from '../util/args';\nimport { from } from './from';\nexport function merge(...args) {\n const scheduler = popScheduler(args);\n const concurrent = popNumber(args, Infinity);\n const sources = args;\n return !sources.length\n ?\n EMPTY\n : sources.length === 1\n ?\n innerFrom(sources[0])\n :\n mergeAll(concurrent)(from(sources, scheduler));\n}\n","import { popScheduler } from '../util/args';\nimport { from } from './from';\nexport function of(...args) {\n const scheduler = popScheduler(args);\n return from(args, scheduler);\n}\n","import { Observable } from '../Observable';\nimport { isFunction } from '../util/isFunction';\nexport function throwError(errorOrErrorFactory, scheduler) {\n const errorFactory = isFunction(errorOrErrorFactory) ? errorOrErrorFactory : () => errorOrErrorFactory;\n const init = (subscriber) => subscriber.error(errorFactory());\n return new Observable(scheduler ? (subscriber) => scheduler.schedule(init, 0, subscriber) : init);\n}\n","import { Observable } from '../Observable';\nimport { async as asyncScheduler } from '../scheduler/async';\nimport { isScheduler } from '../util/isScheduler';\nimport { isValidDate } from '../util/isDate';\nexport function timer(dueTime = 0, intervalOrScheduler, scheduler = asyncScheduler) {\n let intervalDuration = -1;\n if (intervalOrScheduler != null) {\n if (isScheduler(intervalOrScheduler)) {\n scheduler = intervalOrScheduler;\n }\n else {\n intervalDuration = intervalOrScheduler;\n }\n }\n return new Observable((subscriber) => {\n let due = isValidDate(dueTime) ? +dueTime - scheduler.now() : dueTime;\n if (due < 0) {\n due = 0;\n }\n let n = 0;\n return scheduler.schedule(function () {\n if (!subscriber.closed) {\n subscriber.next(n++);\n if (0 <= intervalDuration) {\n this.schedule(undefined, intervalDuration);\n }\n else {\n subscriber.complete();\n }\n }\n }, due);\n });\n}\n","export function isValidDate(value) {\n return value instanceof Date && !isNaN(value);\n}\n","import { Subscriber } from '../Subscriber';\nexport function createOperatorSubscriber(destination, onNext, onComplete, onError, onFinalize) {\n return new OperatorSubscriber(destination, onNext, onComplete, onError, onFinalize);\n}\nexport class OperatorSubscriber extends Subscriber {\n constructor(destination, onNext, onComplete, onError, onFinalize, shouldUnsubscribe) {\n super(destination);\n this.onFinalize = onFinalize;\n this.shouldUnsubscribe = shouldUnsubscribe;\n this._next = onNext\n ? function (value) {\n try {\n onNext(value);\n }\n catch (err) {\n destination.error(err);\n }\n }\n : super._next;\n this._error = onError\n ? function (err) {\n try {\n onError(err);\n }\n catch (err) {\n destination.error(err);\n }\n finally {\n this.unsubscribe();\n }\n }\n : super._error;\n this._complete = onComplete\n ? function () {\n try {\n onComplete();\n }\n catch (err) {\n destination.error(err);\n }\n finally {\n this.unsubscribe();\n }\n }\n : super._complete;\n }\n unsubscribe() {\n var _a;\n if (!this.shouldUnsubscribe || this.shouldUnsubscribe()) {\n const { closed } = this;\n super.unsubscribe();\n !closed && ((_a = this.onFinalize) === null || _a === void 0 ? void 0 : _a.call(this));\n }\n }\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nimport { operate } from '../util/lift';\nexport function catchError(selector) {\n return operate((source, subscriber) => {\n let innerSub = null;\n let syncUnsub = false;\n let handledResult;\n innerSub = source.subscribe(createOperatorSubscriber(subscriber, undefined, undefined, (err) => {\n handledResult = innerFrom(selector(err, catchError(selector)(source)));\n if (innerSub) {\n innerSub.unsubscribe();\n innerSub = null;\n handledResult.subscribe(subscriber);\n }\n else {\n syncUnsub = true;\n }\n }));\n if (syncUnsub) {\n innerSub.unsubscribe();\n innerSub = null;\n handledResult.subscribe(subscriber);\n }\n });\n}\n","import { mergeMap } from './mergeMap';\nimport { isFunction } from '../util/isFunction';\nexport function concatMap(project, resultSelector) {\n return isFunction(resultSelector) ? mergeMap(project, resultSelector, 1) : mergeMap(project, 1);\n}\n","import { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function defaultIfEmpty(defaultValue) {\n return operate((source, subscriber) => {\n let hasValue = false;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n hasValue = true;\n subscriber.next(value);\n }, () => {\n if (!hasValue) {\n subscriber.next(defaultValue);\n }\n subscriber.complete();\n }));\n });\n}\n","import { concat } from '../observable/concat';\nimport { take } from './take';\nimport { ignoreElements } from './ignoreElements';\nimport { mapTo } from './mapTo';\nimport { mergeMap } from './mergeMap';\nimport { innerFrom } from '../observable/innerFrom';\nexport function delayWhen(delayDurationSelector, subscriptionDelay) {\n if (subscriptionDelay) {\n return (source) => concat(subscriptionDelay.pipe(take(1), ignoreElements()), source.pipe(delayWhen(delayDurationSelector)));\n }\n return mergeMap((value, index) => innerFrom(delayDurationSelector(value, index)).pipe(take(1), mapTo(value)));\n}\n","import { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nimport { noop } from '../util/noop';\nexport function ignoreElements() {\n return operate((source, subscriber) => {\n source.subscribe(createOperatorSubscriber(subscriber, noop));\n });\n}\n","import { asyncScheduler } from '../scheduler/async';\nimport { delayWhen } from './delayWhen';\nimport { timer } from '../observable/timer';\nexport function delay(due, scheduler = asyncScheduler) {\n const duration = timer(due, scheduler);\n return delayWhen(() => duration);\n}\n","import { identity } from '../util/identity';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function distinctUntilChanged(comparator, keySelector = identity) {\n comparator = comparator !== null && comparator !== void 0 ? comparator : defaultCompare;\n return operate((source, subscriber) => {\n let previousKey;\n let first = true;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n const currentKey = keySelector(value);\n if (first || !comparator(previousKey, currentKey)) {\n first = false;\n previousKey = currentKey;\n subscriber.next(value);\n }\n }));\n });\n}\nfunction defaultCompare(a, b) {\n return a === b;\n}\n","import { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function filter(predicate, thisArg) {\n return operate((source, subscriber) => {\n let index = 0;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => predicate.call(thisArg, value, index++) && subscriber.next(value)));\n });\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { take } from './take';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { identity } from '../util/identity';\nexport function first(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, take(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function map(project, thisArg) {\n return operate((source, subscriber) => {\n let index = 0;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n subscriber.next(project.call(thisArg, value, index++));\n }));\n });\n}\n","import { map } from './map';\nexport function mapTo(value) {\n return map(() => value);\n}\n","import { mergeMap } from './mergeMap';\nimport { identity } from '../util/identity';\nexport function mergeAll(concurrent = Infinity) {\n return mergeMap(identity, concurrent);\n}\n","import { map } from './map';\nimport { innerFrom } from '../observable/innerFrom';\nimport { operate } from '../util/lift';\nimport { mergeInternals } from './mergeInternals';\nimport { isFunction } from '../util/isFunction';\nexport function mergeMap(project, resultSelector, concurrent = Infinity) {\n if (isFunction(resultSelector)) {\n return mergeMap((a, i) => map((b, ii) => resultSelector(a, b, i, ii))(innerFrom(project(a, i))), concurrent);\n }\n else if (typeof resultSelector === 'number') {\n concurrent = resultSelector;\n }\n return operate((source, subscriber) => mergeInternals(source, subscriber, project, concurrent));\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { executeSchedule } from '../util/executeSchedule';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function mergeInternals(source, subscriber, project, concurrent, onBeforeNext, expand, innerSubScheduler, additionalFinalizer) {\n const buffer = [];\n let active = 0;\n let index = 0;\n let isComplete = false;\n const checkComplete = () => {\n if (isComplete && !buffer.length && !active) {\n subscriber.complete();\n }\n };\n const outerNext = (value) => (active < concurrent ? doInnerSub(value) : buffer.push(value));\n const doInnerSub = (value) => {\n expand && subscriber.next(value);\n active++;\n let innerComplete = false;\n innerFrom(project(value, index++)).subscribe(createOperatorSubscriber(subscriber, (innerValue) => {\n onBeforeNext === null || onBeforeNext === void 0 ? void 0 : onBeforeNext(innerValue);\n if (expand) {\n outerNext(innerValue);\n }\n else {\n subscriber.next(innerValue);\n }\n }, () => {\n innerComplete = true;\n }, undefined, () => {\n if (innerComplete) {\n try {\n active--;\n while (buffer.length && active < concurrent) {\n const bufferedValue = buffer.shift();\n if (innerSubScheduler) {\n executeSchedule(subscriber, innerSubScheduler, () => doInnerSub(bufferedValue));\n }\n else {\n doInnerSub(bufferedValue);\n }\n }\n checkComplete();\n }\n catch (err) {\n subscriber.error(err);\n }\n }\n }));\n };\n source.subscribe(createOperatorSubscriber(subscriber, outerNext, () => {\n isComplete = true;\n checkComplete();\n }));\n return () => {\n additionalFinalizer === null || additionalFinalizer === void 0 ? void 0 : additionalFinalizer();\n };\n}\n","import { executeSchedule } from '../util/executeSchedule';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function observeOn(scheduler, delay = 0) {\n return operate((source, subscriber) => {\n source.subscribe(createOperatorSubscriber(subscriber, (value) => executeSchedule(subscriber, scheduler, () => subscriber.next(value), delay), () => executeSchedule(subscriber, scheduler, () => subscriber.complete(), delay), (err) => executeSchedule(subscriber, scheduler, () => subscriber.error(err), delay)));\n });\n}\n","import { operate } from '../util/lift';\nimport { scanInternals } from './scanInternals';\nexport function scan(accumulator, seed) {\n return operate(scanInternals(accumulator, seed, arguments.length >= 2, true));\n}\n","import { createOperatorSubscriber } from './OperatorSubscriber';\nexport function scanInternals(accumulator, seed, hasSeed, emitOnNext, emitBeforeComplete) {\n return (source, subscriber) => {\n let hasState = hasSeed;\n let state = seed;\n let index = 0;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n const i = index++;\n state = hasState\n ?\n accumulator(state, value, i)\n :\n ((hasState = true), value);\n emitOnNext && subscriber.next(state);\n }, emitBeforeComplete &&\n (() => {\n hasState && subscriber.next(state);\n subscriber.complete();\n })));\n };\n}\n","import { filter } from './filter';\nexport function skip(count) {\n return filter((_, index) => count <= index);\n}\n","import { concat } from '../observable/concat';\nimport { popScheduler } from '../util/args';\nimport { operate } from '../util/lift';\nexport function startWith(...values) {\n const scheduler = popScheduler(values);\n return operate((source, subscriber) => {\n (scheduler ? concat(values, source, scheduler) : concat(values, source)).subscribe(subscriber);\n });\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function switchMap(project, resultSelector) {\n return operate((source, subscriber) => {\n let innerSubscriber = null;\n let index = 0;\n let isComplete = false;\n const checkComplete = () => isComplete && !innerSubscriber && subscriber.complete();\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n innerSubscriber === null || innerSubscriber === void 0 ? void 0 : innerSubscriber.unsubscribe();\n let innerIndex = 0;\n const outerIndex = index++;\n innerFrom(project(value, outerIndex)).subscribe((innerSubscriber = createOperatorSubscriber(subscriber, (innerValue) => subscriber.next(resultSelector ? resultSelector(value, innerValue, outerIndex, innerIndex++) : innerValue), () => {\n innerSubscriber = null;\n checkComplete();\n })));\n }, () => {\n isComplete = true;\n checkComplete();\n }));\n });\n}\n","import { EMPTY } from '../observable/empty';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function take(count) {\n return count <= 0\n ?\n () => EMPTY\n : operate((source, subscriber) => {\n let seen = 0;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n if (++seen <= count) {\n subscriber.next(value);\n if (count <= seen) {\n subscriber.complete();\n }\n }\n }));\n });\n}\n","import { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nimport { innerFrom } from '../observable/innerFrom';\nimport { noop } from '../util/noop';\nexport function takeUntil(notifier) {\n return operate((source, subscriber) => {\n innerFrom(notifier).subscribe(createOperatorSubscriber(subscriber, () => subscriber.complete(), noop));\n !subscriber.closed && source.subscribe(subscriber);\n });\n}\n","import { isFunction } from '../util/isFunction';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nimport { identity } from '../util/identity';\nexport function tap(observerOrNext, error, complete) {\n const tapObserver = isFunction(observerOrNext) || error || complete\n ?\n { next: observerOrNext, error, complete }\n : observerOrNext;\n return tapObserver\n ? operate((source, subscriber) => {\n var _a;\n (_a = tapObserver.subscribe) === null || _a === void 0 ? void 0 : _a.call(tapObserver);\n let isUnsub = true;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n var _a;\n (_a = tapObserver.next) === null || _a === void 0 ? void 0 : _a.call(tapObserver, value);\n subscriber.next(value);\n }, () => {\n var _a;\n isUnsub = false;\n (_a = tapObserver.complete) === null || _a === void 0 ? void 0 : _a.call(tapObserver);\n subscriber.complete();\n }, (err) => {\n var _a;\n isUnsub = false;\n (_a = tapObserver.error) === null || _a === void 0 ? void 0 : _a.call(tapObserver, err);\n subscriber.error(err);\n }, () => {\n var _a, _b;\n if (isUnsub) {\n (_a = tapObserver.unsubscribe) === null || _a === void 0 ? void 0 : _a.call(tapObserver);\n }\n (_b = tapObserver.finalize) === null || _b === void 0 ? void 0 : _b.call(tapObserver);\n }));\n })\n :\n identity;\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function throwIfEmpty(errorFactory = defaultErrorFactory) {\n return operate((source, subscriber) => {\n let hasValue = false;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n hasValue = true;\n subscriber.next(value);\n }, () => (hasValue ? subscriber.complete() : subscriber.error(errorFactory()))));\n });\n}\nfunction defaultErrorFactory() {\n return new EmptyError();\n}\n","import { Subscription } from '../Subscription';\nexport class Action extends Subscription {\n constructor(scheduler, work) {\n super();\n }\n schedule(state, delay = 0) {\n return this;\n }\n}\n","export const intervalProvider = {\n setInterval(handler, timeout, ...args) {\n const { delegate } = intervalProvider;\n if (delegate === null || delegate === void 0 ? void 0 : delegate.setInterval) {\n return delegate.setInterval(handler, timeout, ...args);\n }\n return setInterval(handler, timeout, ...args);\n },\n clearInterval(handle) {\n const { delegate } = intervalProvider;\n return ((delegate === null || delegate === void 0 ? void 0 : delegate.clearInterval) || clearInterval)(handle);\n },\n delegate: undefined,\n};\n","import { Action } from './Action';\nimport { intervalProvider } from './intervalProvider';\nimport { arrRemove } from '../util/arrRemove';\nexport class AsyncAction extends Action {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n this.pending = false;\n }\n schedule(state, delay = 0) {\n var _a;\n if (this.closed) {\n return this;\n }\n this.state = state;\n const id = this.id;\n const scheduler = this.scheduler;\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, delay);\n }\n this.pending = true;\n this.delay = delay;\n this.id = (_a = this.id) !== null && _a !== void 0 ? _a : this.requestAsyncId(scheduler, this.id, delay);\n return this;\n }\n requestAsyncId(scheduler, _id, delay = 0) {\n return intervalProvider.setInterval(scheduler.flush.bind(scheduler, this), delay);\n }\n recycleAsyncId(_scheduler, id, delay = 0) {\n if (delay != null && this.delay === delay && this.pending === false) {\n return id;\n }\n if (id != null) {\n intervalProvider.clearInterval(id);\n }\n return undefined;\n }\n execute(state, delay) {\n if (this.closed) {\n return new Error('executing a cancelled action');\n }\n this.pending = false;\n const error = this._execute(state, delay);\n if (error) {\n return error;\n }\n else if (this.pending === false && this.id != null) {\n this.id = this.recycleAsyncId(this.scheduler, this.id, null);\n }\n }\n _execute(state, _delay) {\n let errored = false;\n let errorValue;\n try {\n this.work(state);\n }\n catch (e) {\n errored = true;\n errorValue = e ? e : new Error('Scheduled action threw falsy error');\n }\n if (errored) {\n this.unsubscribe();\n return errorValue;\n }\n }\n unsubscribe() {\n if (!this.closed) {\n const { id, scheduler } = this;\n const { actions } = scheduler;\n this.work = this.state = this.scheduler = null;\n this.pending = false;\n arrRemove(actions, this);\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, null);\n }\n this.delay = null;\n super.unsubscribe();\n }\n }\n}\n","import { dateTimestampProvider } from './scheduler/dateTimestampProvider';\nexport class Scheduler {\n constructor(schedulerActionCtor, now = Scheduler.now) {\n this.schedulerActionCtor = schedulerActionCtor;\n this.now = now;\n }\n schedule(work, delay = 0, state) {\n return new this.schedulerActionCtor(this, work).schedule(state, delay);\n }\n}\nScheduler.now = dateTimestampProvider.now;\n","import { Scheduler } from '../Scheduler';\nexport class AsyncScheduler extends Scheduler {\n constructor(SchedulerAction, now = Scheduler.now) {\n super(SchedulerAction, now);\n this.actions = [];\n this._active = false;\n }\n flush(action) {\n const { actions } = this;\n if (this._active) {\n actions.push(action);\n return;\n }\n let error;\n this._active = true;\n do {\n if ((error = action.execute(action.state, action.delay))) {\n break;\n }\n } while ((action = actions.shift()));\n this._active = false;\n if (error) {\n while ((action = actions.shift())) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { Subscription } from '../Subscription';\nexport const animationFrameProvider = {\n schedule(callback) {\n let request = requestAnimationFrame;\n let cancel = cancelAnimationFrame;\n const { delegate } = animationFrameProvider;\n if (delegate) {\n request = delegate.requestAnimationFrame;\n cancel = delegate.cancelAnimationFrame;\n }\n const handle = request((timestamp) => {\n cancel = undefined;\n callback(timestamp);\n });\n return new Subscription(() => cancel === null || cancel === void 0 ? void 0 : cancel(handle));\n },\n requestAnimationFrame(...args) {\n const { delegate } = animationFrameProvider;\n return ((delegate === null || delegate === void 0 ? void 0 : delegate.requestAnimationFrame) || requestAnimationFrame)(...args);\n },\n cancelAnimationFrame(...args) {\n const { delegate } = animationFrameProvider;\n return ((delegate === null || delegate === void 0 ? void 0 : delegate.cancelAnimationFrame) || cancelAnimationFrame)(...args);\n },\n delegate: undefined,\n};\n","import { AnimationFrameAction } from './AnimationFrameAction';\nimport { AnimationFrameScheduler } from './AnimationFrameScheduler';\nexport const animationFrameScheduler = new AnimationFrameScheduler(AnimationFrameAction);\nexport const animationFrame = animationFrameScheduler;\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class AnimationFrameScheduler extends AsyncScheduler {\n flush(action) {\n this._active = true;\n const flushId = this._scheduled;\n this._scheduled = undefined;\n const { actions } = this;\n let error;\n action = action || actions.shift();\n do {\n if ((error = action.execute(action.state, action.delay))) {\n break;\n }\n } while ((action = actions[0]) && action.id === flushId && actions.shift());\n this._active = false;\n if (error) {\n while ((action = actions[0]) && action.id === flushId && actions.shift()) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { AsyncAction } from './AsyncAction';\nimport { animationFrameProvider } from './animationFrameProvider';\nexport class AnimationFrameAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && delay > 0) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n scheduler.actions.push(this);\n return scheduler._scheduled || (scheduler._scheduled = animationFrameProvider.requestAnimationFrame(() => scheduler.flush(undefined)));\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n var _a;\n if (delay != null ? delay > 0 : this.delay > 0) {\n return super.recycleAsyncId(scheduler, id, delay);\n }\n const { actions } = scheduler;\n if (id != null && ((_a = actions[actions.length - 1]) === null || _a === void 0 ? void 0 : _a.id) !== id) {\n animationFrameProvider.cancelAnimationFrame(id);\n scheduler._scheduled = undefined;\n }\n return undefined;\n }\n}\n","import { AsyncAction } from './AsyncAction';\nimport { AsyncScheduler } from './AsyncScheduler';\nexport const asyncScheduler = new AsyncScheduler(AsyncAction);\nexport const async = asyncScheduler;\n","export const dateTimestampProvider = {\n now() {\n return (dateTimestampProvider.delegate || Date).now();\n },\n delegate: undefined,\n};\n","export const timeoutProvider = {\n setTimeout(handler, timeout, ...args) {\n const { delegate } = timeoutProvider;\n if (delegate === null || delegate === void 0 ? void 0 : delegate.setTimeout) {\n return delegate.setTimeout(handler, timeout, ...args);\n }\n return setTimeout(handler, timeout, ...args);\n },\n clearTimeout(handle) {\n const { delegate } = timeoutProvider;\n return ((delegate === null || delegate === void 0 ? void 0 : delegate.clearTimeout) || clearTimeout)(handle);\n },\n delegate: undefined,\n};\n","export function getSymbolIterator() {\n if (typeof Symbol !== 'function' || !Symbol.iterator) {\n return '@@iterator';\n }\n return Symbol.iterator;\n}\nexport const iterator = getSymbolIterator();\n","export const observable = (() => (typeof Symbol === 'function' && Symbol.observable) || '@@observable')();\n","import { createErrorClass } from './createErrorClass';\nexport const EmptyError = createErrorClass((_super) => function EmptyErrorImpl() {\n _super(this);\n this.name = 'EmptyError';\n this.message = 'no elements in sequence';\n});\n","import { isFunction } from './isFunction';\nimport { isScheduler } from './isScheduler';\nfunction last(arr) {\n return arr[arr.length - 1];\n}\nexport function popResultSelector(args) {\n return isFunction(last(args)) ? args.pop() : undefined;\n}\nexport function popScheduler(args) {\n return isScheduler(last(args)) ? args.pop() : undefined;\n}\nexport function popNumber(args, defaultValue) {\n return typeof last(args) === 'number' ? args.pop() : defaultValue;\n}\n","const { isArray } = Array;\nconst { getPrototypeOf, prototype: objectProto, keys: getKeys } = Object;\nexport function argsArgArrayOrObject(args) {\n if (args.length === 1) {\n const first = args[0];\n if (isArray(first)) {\n return { args: first, keys: null };\n }\n if (isPOJO(first)) {\n const keys = getKeys(first);\n return {\n args: keys.map((key) => first[key]),\n keys,\n };\n }\n }\n return { args: args, keys: null };\n}\nfunction isPOJO(obj) {\n return obj && typeof obj === 'object' && getPrototypeOf(obj) === objectProto;\n}\n","export function arrRemove(arr, item) {\n if (arr) {\n const index = arr.indexOf(item);\n 0 <= index && arr.splice(index, 1);\n }\n}\n","export function createErrorClass(createImpl) {\n const _super = (instance) => {\n Error.call(instance);\n instance.stack = new Error().stack;\n };\n const ctorFunc = createImpl(_super);\n ctorFunc.prototype = Object.create(Error.prototype);\n ctorFunc.prototype.constructor = ctorFunc;\n return ctorFunc;\n}\n","export function createObject(keys, values) {\n return keys.reduce((result, key, i) => ((result[key] = values[i]), result), {});\n}\n","import { config } from '../config';\nlet context = null;\nexport function errorContext(cb) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n const isRoot = !context;\n if (isRoot) {\n context = { errorThrown: false, error: null };\n }\n cb();\n if (isRoot) {\n const { errorThrown, error } = context;\n context = null;\n if (errorThrown) {\n throw error;\n }\n }\n }\n else {\n cb();\n }\n}\nexport function captureError(err) {\n if (config.useDeprecatedSynchronousErrorHandling && context) {\n context.errorThrown = true;\n context.error = err;\n }\n}\n","export function executeSchedule(parentSubscription, scheduler, work, delay = 0, repeat = false) {\n const scheduleSubscription = scheduler.schedule(function () {\n work();\n if (repeat) {\n parentSubscription.add(this.schedule(null, delay));\n }\n else {\n this.unsubscribe();\n }\n }, delay);\n parentSubscription.add(scheduleSubscription);\n if (!repeat) {\n return scheduleSubscription;\n }\n}\n","export function identity(x) {\n return x;\n}\n","export const isArrayLike = ((x) => x && typeof x.length === 'number' && typeof x !== 'function');\n","import { isFunction } from './isFunction';\nexport function isAsyncIterable(obj) {\n return Symbol.asyncIterator && isFunction(obj === null || obj === void 0 ? void 0 : obj[Symbol.asyncIterator]);\n}\n","export function isFunction(value) {\n return typeof value === 'function';\n}\n","import { observable as Symbol_observable } from '../symbol/observable';\nimport { isFunction } from './isFunction';\nexport function isInteropObservable(input) {\n return isFunction(input[Symbol_observable]);\n}\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nimport { isFunction } from './isFunction';\nexport function isIterable(input) {\n return isFunction(input === null || input === void 0 ? void 0 : input[Symbol_iterator]);\n}\n","import { isFunction } from \"./isFunction\";\nexport function isPromise(value) {\n return isFunction(value === null || value === void 0 ? void 0 : value.then);\n}\n","import { __asyncGenerator, __await } from \"tslib\";\nimport { isFunction } from './isFunction';\nexport function readableStreamLikeToAsyncGenerator(readableStream) {\n return __asyncGenerator(this, arguments, function* readableStreamLikeToAsyncGenerator_1() {\n const reader = readableStream.getReader();\n try {\n while (true) {\n const { value, done } = yield __await(reader.read());\n if (done) {\n return yield __await(void 0);\n }\n yield yield __await(value);\n }\n }\n finally {\n reader.releaseLock();\n }\n });\n}\nexport function isReadableStreamLike(obj) {\n return isFunction(obj === null || obj === void 0 ? void 0 : obj.getReader);\n}\n","import { isFunction } from './isFunction';\nexport function isScheduler(value) {\n return value && isFunction(value.schedule);\n}\n","import { isFunction } from './isFunction';\nexport function hasLift(source) {\n return isFunction(source === null || source === void 0 ? void 0 : source.lift);\n}\nexport function operate(init) {\n return (source) => {\n if (hasLift(source)) {\n return source.lift(function (liftedSource) {\n try {\n return init(liftedSource, this);\n }\n catch (err) {\n this.error(err);\n }\n });\n }\n throw new TypeError('Unable to lift unknown Observable type');\n };\n}\n","import { map } from \"../operators/map\";\nconst { isArray } = Array;\nfunction callOrApply(fn, args) {\n return isArray(args) ? fn(...args) : fn(args);\n}\nexport function mapOneOrManyArgs(fn) {\n return map(args => callOrApply(fn, args));\n}\n","export function noop() { }\n","import { identity } from './identity';\nexport function pipe(...fns) {\n return pipeFromArray(fns);\n}\nexport function pipeFromArray(fns) {\n if (fns.length === 0) {\n return identity;\n }\n if (fns.length === 1) {\n return fns[0];\n }\n return function piped(input) {\n return fns.reduce((prev, fn) => fn(prev), input);\n };\n}\n","import { config } from '../config';\nimport { timeoutProvider } from '../scheduler/timeoutProvider';\nexport function reportUnhandledError(err) {\n timeoutProvider.setTimeout(() => {\n const { onUnhandledError } = config;\n if (onUnhandledError) {\n onUnhandledError(err);\n }\n else {\n throw err;\n }\n });\n}\n","export function createInvalidObservableTypeError(input) {\n return new TypeError(`You provided ${input !== null && typeof input === 'object' ? 'an invalid object' : `'${input}'`} where a stream was expected. You can provide an Observable, Promise, ReadableStream, Array, AsyncIterable, or Iterable.`);\n}\n","/******************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics = function(d, b) {\r\n extendStatics = Object.setPrototypeOf ||\r\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };\r\n return extendStatics(d, b);\r\n};\r\n\r\nexport function __extends(d, b) {\r\n if (typeof b !== \"function\" && b !== null)\r\n throw new TypeError(\"Class extends value \" + String(b) + \" is not a constructor or null\");\r\n extendStatics(d, b);\r\n function __() { this.constructor = d; }\r\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nexport var __assign = function() {\r\n __assign = Object.assign || function __assign(t) {\r\n for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n s = arguments[i];\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n }\r\n return t;\r\n }\r\n return __assign.apply(this, arguments);\r\n}\r\n\r\nexport function __rest(s, e) {\r\n var t = {};\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n t[p] = s[p];\r\n if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n t[p[i]] = s[p[i]];\r\n }\r\n return t;\r\n}\r\n\r\nexport function __decorate(decorators, target, key, desc) {\r\n var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nexport function __param(paramIndex, decorator) {\r\n return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nexport function __esDecorate(ctor, descriptorIn, decorators, contextIn, initializers, extraInitializers) {\r\n function accept(f) { if (f !== void 0 && typeof f !== \"function\") throw new TypeError(\"Function expected\"); return f; }\r\n var kind = contextIn.kind, key = kind === \"getter\" ? \"get\" : kind === \"setter\" ? \"set\" : \"value\";\r\n var target = !descriptorIn && ctor ? contextIn[\"static\"] ? ctor : ctor.prototype : null;\r\n var descriptor = descriptorIn || (target ? Object.getOwnPropertyDescriptor(target, contextIn.name) : {});\r\n var _, done = false;\r\n for (var i = decorators.length - 1; i >= 0; i--) {\r\n var context = {};\r\n for (var p in contextIn) context[p] = p === \"access\" ? {} : contextIn[p];\r\n for (var p in contextIn.access) context.access[p] = contextIn.access[p];\r\n context.addInitializer = function (f) { if (done) throw new TypeError(\"Cannot add initializers after decoration has completed\"); extraInitializers.push(accept(f || null)); };\r\n var result = (0, decorators[i])(kind === \"accessor\" ? { get: descriptor.get, set: descriptor.set } : descriptor[key], context);\r\n if (kind === \"accessor\") {\r\n if (result === void 0) continue;\r\n if (result === null || typeof result !== \"object\") throw new TypeError(\"Object expected\");\r\n if (_ = accept(result.get)) descriptor.get = _;\r\n if (_ = accept(result.set)) descriptor.set = _;\r\n if (_ = accept(result.init)) initializers.push(_);\r\n }\r\n else if (_ = accept(result)) {\r\n if (kind === \"field\") initializers.push(_);\r\n else descriptor[key] = _;\r\n }\r\n }\r\n if (target) Object.defineProperty(target, contextIn.name, descriptor);\r\n done = true;\r\n};\r\n\r\nexport function __runInitializers(thisArg, initializers, value) {\r\n var useValue = arguments.length > 2;\r\n for (var i = 0; i < initializers.length; i++) {\r\n value = useValue ? initializers[i].call(thisArg, value) : initializers[i].call(thisArg);\r\n }\r\n return useValue ? value : void 0;\r\n};\r\n\r\nexport function __propKey(x) {\r\n return typeof x === \"symbol\" ? x : \"\".concat(x);\r\n};\r\n\r\nexport function __setFunctionName(f, name, prefix) {\r\n if (typeof name === \"symbol\") name = name.description ? \"[\".concat(name.description, \"]\") : \"\";\r\n return Object.defineProperty(f, \"name\", { configurable: true, value: prefix ? \"\".concat(prefix, \" \", name) : name });\r\n};\r\n\r\nexport function __metadata(metadataKey, metadataValue) {\r\n if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nexport function __awaiter(thisArg, _arguments, P, generator) {\r\n function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n return new (P || (P = Promise))(function (resolve, reject) {\r\n function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n });\r\n}\r\n\r\nexport function __generator(thisArg, body) {\r\n var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n function verb(n) { return function (v) { return step([n, v]); }; }\r\n function step(op) {\r\n if (f) throw new TypeError(\"Generator is already executing.\");\r\n while (g && (g = 0, op[0] && (_ = 0)), _) try {\r\n if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n if (y = 0, t) op = [op[0] & 2, t.value];\r\n switch (op[0]) {\r\n case 0: case 1: t = op; break;\r\n case 4: _.label++; return { value: op[1], done: false };\r\n case 5: _.label++; y = op[1]; op = [0]; continue;\r\n case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n default:\r\n if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n if (t[2]) _.ops.pop();\r\n _.trys.pop(); continue;\r\n }\r\n op = body.call(thisArg, _);\r\n } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n }\r\n}\r\n\r\nexport var __createBinding = Object.create ? (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n var desc = Object.getOwnPropertyDescriptor(m, k);\r\n if (!desc || (\"get\" in desc ? !m.__esModule : desc.writable || desc.configurable)) {\r\n desc = { enumerable: true, get: function() { return m[k]; } };\r\n }\r\n Object.defineProperty(o, k2, desc);\r\n}) : (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n o[k2] = m[k];\r\n});\r\n\r\nexport function __exportStar(m, o) {\r\n for (var p in m) if (p !== \"default\" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);\r\n}\r\n\r\nexport function __values(o) {\r\n var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n if (m) return m.call(o);\r\n if (o && typeof o.length === \"number\") return {\r\n next: function () {\r\n if (o && i >= o.length) o = void 0;\r\n return { value: o && o[i++], done: !o };\r\n }\r\n };\r\n throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nexport function __read(o, n) {\r\n var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n if (!m) return o;\r\n var i = m.call(o), r, ar = [], e;\r\n try {\r\n while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n }\r\n catch (error) { e = { error: error }; }\r\n finally {\r\n try {\r\n if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n }\r\n finally { if (e) throw e.error; }\r\n }\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spread() {\r\n for (var ar = [], i = 0; i < arguments.length; i++)\r\n ar = ar.concat(__read(arguments[i]));\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spreadArrays() {\r\n for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n r[k] = a[j];\r\n return r;\r\n}\r\n\r\nexport function __spreadArray(to, from, pack) {\r\n if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {\r\n if (ar || !(i in from)) {\r\n if (!ar) ar = Array.prototype.slice.call(from, 0, i);\r\n ar[i] = from[i];\r\n }\r\n }\r\n return to.concat(ar || Array.prototype.slice.call(from));\r\n}\r\n\r\nexport function __await(v) {\r\n return this instanceof __await ? (this.v = v, this) : new __await(v);\r\n}\r\n\r\nexport function __asyncGenerator(thisArg, _arguments, generator) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n function fulfill(value) { resume(\"next\", value); }\r\n function reject(value) { resume(\"throw\", value); }\r\n function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nexport function __asyncDelegator(o) {\r\n var i, p;\r\n return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: false } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nexport function __asyncValues(o) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var m = o[Symbol.asyncIterator], i;\r\n return m ? m.call(o) : (o = typeof __values === \"function\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nexport function __makeTemplateObject(cooked, raw) {\r\n if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n return cooked;\r\n};\r\n\r\nvar __setModuleDefault = Object.create ? (function(o, v) {\r\n Object.defineProperty(o, \"default\", { enumerable: true, value: v });\r\n}) : function(o, v) {\r\n o[\"default\"] = v;\r\n};\r\n\r\nexport function __importStar(mod) {\r\n if (mod && mod.__esModule) return mod;\r\n var result = {};\r\n if (mod != null) for (var k in mod) if (k !== \"default\" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);\r\n __setModuleDefault(result, mod);\r\n return result;\r\n}\r\n\r\nexport function __importDefault(mod) {\r\n return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nexport function __classPrivateFieldGet(receiver, state, kind, f) {\r\n if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a getter\");\r\n if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot read private member from an object whose class did not declare it\");\r\n return kind === \"m\" ? f : kind === \"a\" ? f.call(receiver) : f ? f.value : state.get(receiver);\r\n}\r\n\r\nexport function __classPrivateFieldSet(receiver, state, value, kind, f) {\r\n if (kind === \"m\") throw new TypeError(\"Private method is not writable\");\r\n if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a setter\");\r\n if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot write private member to an object whose class did not declare it\");\r\n return (kind === \"a\" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value;\r\n}\r\n\r\nexport function __classPrivateFieldIn(state, receiver) {\r\n if (receiver === null || (typeof receiver !== \"object\" && typeof receiver !== \"function\")) throw new TypeError(\"Cannot use 'in' operator on non-object\");\r\n return typeof state === \"function\" ? receiver === state : state.has(receiver);\r\n}\r\n","/**\n * @license Angular v15.2.9\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\n/**\n * An injectable service that produces an animation sequence programmatically within an\n * Angular component or directive.\n * Provided by the `BrowserAnimationsModule` or `NoopAnimationsModule`.\n *\n * @usageNotes\n *\n * To use this service, add it to your component or directive as a dependency.\n * The service is instantiated along with your component.\n *\n * Apps do not typically need to create their own animation players, but if you\n * do need to, follow these steps:\n *\n * 1. Use the [AnimationBuilder.build](api/animations/AnimationBuilder#build)() method\n * to create a programmatic animation. The method returns an `AnimationFactory` instance.\n *\n * 2. Use the factory object to create an `AnimationPlayer` and attach it to a DOM element.\n *\n * 3. Use the player object to control the animation programmatically.\n *\n * For example:\n *\n * ```ts\n * // import the service from BrowserAnimationsModule\n * import {AnimationBuilder} from '@angular/animations';\n * // require the service as a dependency\n * class MyCmp {\n * constructor(private _builder: AnimationBuilder) {}\n *\n * makeAnimation(element: any) {\n * // first define a reusable animation\n * const myAnimation = this._builder.build([\n * style({ width: 0 }),\n * animate(1000, style({ width: '100px' }))\n * ]);\n *\n * // use the returned factory object to create a player\n * const player = myAnimation.create(element);\n *\n * player.play();\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass AnimationBuilder {\n}\n/**\n * A factory object returned from the\n * [AnimationBuilder.build](api/animations/AnimationBuilder#build)()\n * method.\n *\n * @publicApi\n */\nclass AnimationFactory {\n}\n\n/**\n * Specifies automatic styling.\n *\n * @publicApi\n */\nconst AUTO_STYLE = '*';\n/**\n * Creates a named animation trigger, containing a list of [`state()`](api/animations/state)\n * and `transition()` entries to be evaluated when the expression\n * bound to the trigger changes.\n *\n * @param name An identifying string.\n * @param definitions An animation definition object, containing an array of\n * [`state()`](api/animations/state) and `transition()` declarations.\n *\n * @return An object that encapsulates the trigger data.\n *\n * @usageNotes\n * Define an animation trigger in the `animations` section of `@Component` metadata.\n * In the template, reference the trigger by name and bind it to a trigger expression that\n * evaluates to a defined animation state, using the following format:\n *\n * `[@triggerName]=\"expression\"`\n *\n * Animation trigger bindings convert all values to strings, and then match the\n * previous and current values against any linked transitions.\n * Booleans can be specified as `1` or `true` and `0` or `false`.\n *\n * ### Usage Example\n *\n * The following example creates an animation trigger reference based on the provided\n * name value.\n * The provided animation value is expected to be an array consisting of state and\n * transition declarations.\n *\n * ```typescript\n * @Component({\n * selector: \"my-component\",\n * templateUrl: \"my-component-tpl.html\",\n * animations: [\n * trigger(\"myAnimationTrigger\", [\n * state(...),\n * state(...),\n * transition(...),\n * transition(...)\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"something\";\n * }\n * ```\n *\n * The template associated with this component makes use of the defined trigger\n * by binding to an element within its template code.\n *\n * ```html\n * \n *
...
\n * ```\n *\n * ### Using an inline function\n * The `transition` animation method also supports reading an inline function which can decide\n * if its associated animation should be run.\n *\n * ```typescript\n * // this method is run each time the `myAnimationTrigger` trigger value changes.\n * function myInlineMatcherFn(fromState: string, toState: string, element: any, params: {[key:\n string]: any}): boolean {\n * // notice that `element` and `params` are also available here\n * return toState == 'yes-please-animate';\n * }\n *\n * @Component({\n * selector: 'my-component',\n * templateUrl: 'my-component-tpl.html',\n * animations: [\n * trigger('myAnimationTrigger', [\n * transition(myInlineMatcherFn, [\n * // the animation sequence code\n * ]),\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"yes-please-animate\";\n * }\n * ```\n *\n * ### Disabling Animations\n * When true, the special animation control binding `@.disabled` binding prevents\n * all animations from rendering.\n * Place the `@.disabled` binding on an element to disable\n * animations on the element itself, as well as any inner animation triggers\n * within the element.\n *\n * The following example shows how to use this feature:\n *\n * ```typescript\n * @Component({\n * selector: 'my-component',\n * template: `\n *
\n * \n *
\n * `,\n * animations: [\n * trigger(\"childAnimation\", [\n * // ...\n * ])\n * ]\n * })\n * class MyComponent {\n * isDisabled = true;\n * exp = '...';\n * }\n * ```\n *\n * When `@.disabled` is true, it prevents the `@childAnimation` trigger from animating,\n * along with any inner animations.\n *\n * ### Disable animations application-wide\n * When an area of the template is set to have animations disabled,\n * **all** inner components have their animations disabled as well.\n * This means that you can disable all animations for an app\n * by placing a host binding set on `@.disabled` on the topmost Angular component.\n *\n * ```typescript\n * import {Component, HostBinding} from '@angular/core';\n *\n * @Component({\n * selector: 'app-component',\n * templateUrl: 'app.component.html',\n * })\n * class AppComponent {\n * @HostBinding('@.disabled')\n * public animationsDisabled = true;\n * }\n * ```\n *\n * ### Overriding disablement of inner animations\n * Despite inner animations being disabled, a parent animation can `query()`\n * for inner elements located in disabled areas of the template and still animate\n * them if needed. This is also the case for when a sub animation is\n * queried by a parent and then later animated using `animateChild()`.\n *\n * ### Detecting when an animation is disabled\n * If a region of the DOM (or the entire application) has its animations disabled, the animation\n * trigger callbacks still fire, but for zero seconds. When the callback fires, it provides\n * an instance of an `AnimationEvent`. If animations are disabled,\n * the `.disabled` flag on the event is true.\n *\n * @publicApi\n */\nfunction trigger(name, definitions) {\n return { type: 7 /* AnimationMetadataType.Trigger */, name, definitions, options: {} };\n}\n/**\n * Defines an animation step that combines styling information with timing information.\n *\n * @param timings Sets `AnimateTimings` for the parent animation.\n * A string in the format \"duration [delay] [easing]\".\n * - Duration and delay are expressed as a number and optional time unit,\n * such as \"1s\" or \"10ms\" for one second and 10 milliseconds, respectively.\n * The default unit is milliseconds.\n * - The easing value controls how the animation accelerates and decelerates\n * during its runtime. Value is one of `ease`, `ease-in`, `ease-out`,\n * `ease-in-out`, or a `cubic-bezier()` function call.\n * If not supplied, no easing is applied.\n *\n * For example, the string \"1s 100ms ease-out\" specifies a duration of\n * 1000 milliseconds, and delay of 100 ms, and the \"ease-out\" easing style,\n * which decelerates near the end of the duration.\n * @param styles Sets AnimationStyles for the parent animation.\n * A function call to either `style()` or `keyframes()`\n * that returns a collection of CSS style entries to be applied to the parent animation.\n * When null, uses the styles from the destination state.\n * This is useful when describing an animation step that will complete an animation;\n * see \"Animating to the final state\" in `transitions()`.\n * @returns An object that encapsulates the animation step.\n *\n * @usageNotes\n * Call within an animation `sequence()`, `{@link animations/group group()}`, or\n * `transition()` call to specify an animation step\n * that applies given style data to the parent animation for a given amount of time.\n *\n * ### Syntax Examples\n * **Timing examples**\n *\n * The following examples show various `timings` specifications.\n * - `animate(500)` : Duration is 500 milliseconds.\n * - `animate(\"1s\")` : Duration is 1000 milliseconds.\n * - `animate(\"100ms 0.5s\")` : Duration is 100 milliseconds, delay is 500 milliseconds.\n * - `animate(\"5s ease-in\")` : Duration is 5000 milliseconds, easing in.\n * - `animate(\"5s 10ms cubic-bezier(.17,.67,.88,.1)\")` : Duration is 5000 milliseconds, delay is 10\n * milliseconds, easing according to a bezier curve.\n *\n * **Style examples**\n *\n * The following example calls `style()` to set a single CSS style.\n * ```typescript\n * animate(500, style({ background: \"red\" }))\n * ```\n * The following example calls `keyframes()` to set a CSS style\n * to different values for successive keyframes.\n * ```typescript\n * animate(500, keyframes(\n * [\n * style({ background: \"blue\" }),\n * style({ background: \"red\" })\n * ])\n * ```\n *\n * @publicApi\n */\nfunction animate(timings, styles = null) {\n return { type: 4 /* AnimationMetadataType.Animate */, styles, timings };\n}\n/**\n * @description Defines a list of animation steps to be run in parallel.\n *\n * @param steps An array of animation step objects.\n * - When steps are defined by `style()` or `animate()`\n * function calls, each call within the group is executed instantly.\n * - To specify offset styles to be applied at a later time, define steps with\n * `keyframes()`, or use `animate()` calls with a delay value.\n * For example:\n *\n * ```typescript\n * group([\n * animate(\"1s\", style({ background: \"black\" })),\n * animate(\"2s\", style({ color: \"white\" }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the group data.\n *\n * @usageNotes\n * Grouped animations are useful when a series of styles must be\n * animated at different starting times and closed off at different ending times.\n *\n * When called within a `sequence()` or a\n * `transition()` call, does not continue to the next\n * instruction until all of the inner animation steps have completed.\n *\n * @publicApi\n */\nfunction group(steps, options = null) {\n return { type: 3 /* AnimationMetadataType.Group */, steps, options };\n}\n/**\n * Defines a list of animation steps to be run sequentially, one by one.\n *\n * @param steps An array of animation step objects.\n * - Steps defined by `style()` calls apply the styling data immediately.\n * - Steps defined by `animate()` calls apply the styling data over time\n * as specified by the timing data.\n *\n * ```typescript\n * sequence([\n * style({ opacity: 0 }),\n * animate(\"1s\", style({ opacity: 1 }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the sequence data.\n *\n * @usageNotes\n * When you pass an array of steps to a\n * `transition()` call, the steps run sequentially by default.\n * Compare this to the `{@link animations/group group()}` call, which runs animation steps in\n *parallel.\n *\n * When a sequence is used within a `{@link animations/group group()}` or a `transition()` call,\n * execution continues to the next instruction only after each of the inner animation\n * steps have completed.\n *\n * @publicApi\n **/\nfunction sequence(steps, options = null) {\n return { type: 2 /* AnimationMetadataType.Sequence */, steps, options };\n}\n/**\n * Declares a key/value object containing CSS properties/styles that\n * can then be used for an animation [`state`](api/animations/state), within an animation\n *`sequence`, or as styling data for calls to `animate()` and `keyframes()`.\n *\n * @param tokens A set of CSS styles or HTML styles associated with an animation state.\n * The value can be any of the following:\n * - A key-value style pair associating a CSS property with a value.\n * - An array of key-value style pairs.\n * - An asterisk (*), to use auto-styling, where styles are derived from the element\n * being animated and applied to the animation when it starts.\n *\n * Auto-styling can be used to define a state that depends on layout or other\n * environmental factors.\n *\n * @return An object that encapsulates the style data.\n *\n * @usageNotes\n * The following examples create animation styles that collect a set of\n * CSS property values:\n *\n * ```typescript\n * // string values for CSS properties\n * style({ background: \"red\", color: \"blue\" })\n *\n * // numerical pixel values\n * style({ width: 100, height: 0 })\n * ```\n *\n * The following example uses auto-styling to allow an element to animate from\n * a height of 0 up to its full height:\n *\n * ```\n * style({ height: 0 }),\n * animate(\"1s\", style({ height: \"*\" }))\n * ```\n *\n * @publicApi\n **/\nfunction style(tokens) {\n return { type: 6 /* AnimationMetadataType.Style */, styles: tokens, offset: null };\n}\n/**\n * Declares an animation state within a trigger attached to an element.\n *\n * @param name One or more names for the defined state in a comma-separated string.\n * The following reserved state names can be supplied to define a style for specific use\n * cases:\n *\n * - `void` You can associate styles with this name to be used when\n * the element is detached from the application. For example, when an `ngIf` evaluates\n * to false, the state of the associated element is void.\n * - `*` (asterisk) Indicates the default state. You can associate styles with this name\n * to be used as the fallback when the state that is being animated is not declared\n * within the trigger.\n *\n * @param styles A set of CSS styles associated with this state, created using the\n * `style()` function.\n * This set of styles persists on the element once the state has been reached.\n * @param options Parameters that can be passed to the state when it is invoked.\n * 0 or more key-value pairs.\n * @return An object that encapsulates the new state data.\n *\n * @usageNotes\n * Use the `trigger()` function to register states to an animation trigger.\n * Use the `transition()` function to animate between states.\n * When a state is active within a component, its associated styles persist on the element,\n * even when the animation ends.\n *\n * @publicApi\n **/\nfunction state(name, styles, options) {\n return { type: 0 /* AnimationMetadataType.State */, name, styles, options };\n}\n/**\n * Defines a set of animation styles, associating each style with an optional `offset` value.\n *\n * @param steps A set of animation styles with optional offset data.\n * The optional `offset` value for a style specifies a percentage of the total animation\n * time at which that style is applied.\n * @returns An object that encapsulates the keyframes data.\n *\n * @usageNotes\n * Use with the `animate()` call. Instead of applying animations\n * from the current state\n * to the destination state, keyframes describe how each style entry is applied and at what point\n * within the animation arc.\n * Compare [CSS Keyframe Animations](https://www.w3schools.com/css/css3_animations.asp).\n *\n * ### Usage\n *\n * In the following example, the offset values describe\n * when each `backgroundColor` value is applied. The color is red at the start, and changes to\n * blue when 20% of the total time has elapsed.\n *\n * ```typescript\n * // the provided offset values\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\", offset: 0 }),\n * style({ backgroundColor: \"blue\", offset: 0.2 }),\n * style({ backgroundColor: \"orange\", offset: 0.3 }),\n * style({ backgroundColor: \"black\", offset: 1 })\n * ]))\n * ```\n *\n * If there are no `offset` values specified in the style entries, the offsets\n * are calculated automatically.\n *\n * ```typescript\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\" }) // offset = 0\n * style({ backgroundColor: \"blue\" }) // offset = 0.33\n * style({ backgroundColor: \"orange\" }) // offset = 0.66\n * style({ backgroundColor: \"black\" }) // offset = 1\n * ]))\n *```\n\n * @publicApi\n */\nfunction keyframes(steps) {\n return { type: 5 /* AnimationMetadataType.Keyframes */, steps };\n}\n/**\n * Declares an animation transition which is played when a certain specified condition is met.\n *\n * @param stateChangeExpr A string with a specific format or a function that specifies when the\n * animation transition should occur (see [State Change Expression](#state-change-expression)).\n *\n * @param steps One or more animation objects that represent the animation's instructions.\n *\n * @param options An options object that can be used to specify a delay for the animation or provide\n * custom parameters for it.\n *\n * @returns An object that encapsulates the transition data.\n *\n * @usageNotes\n *\n * ### State Change Expression\n *\n * The State Change Expression instructs Angular when to run the transition's animations, it can\n *either be\n * - a string with a specific syntax\n * - or a function that compares the previous and current state (value of the expression bound to\n * the element's trigger) and returns `true` if the transition should occur or `false` otherwise\n *\n * The string format can be:\n * - `fromState => toState`, which indicates that the transition's animations should occur then the\n * expression bound to the trigger's element goes from `fromState` to `toState`\n *\n * _Example:_\n * ```typescript\n * transition('open => closed', animate('.5s ease-out', style({ height: 0 }) ))\n * ```\n *\n * - `fromState <=> toState`, which indicates that the transition's animations should occur then\n * the expression bound to the trigger's element goes from `fromState` to `toState` or vice versa\n *\n * _Example:_\n * ```typescript\n * transition('enabled <=> disabled', animate('1s cubic-bezier(0.8,0.3,0,1)'))\n * ```\n *\n * - `:enter`/`:leave`, which indicates that the transition's animations should occur when the\n * element enters or exists the DOM\n *\n * _Example:_\n * ```typescript\n * transition(':enter', [\n * style({ opacity: 0 }),\n * animate('500ms', style({ opacity: 1 }))\n * ])\n * ```\n *\n * - `:increment`/`:decrement`, which indicates that the transition's animations should occur when\n * the numerical expression bound to the trigger's element has increased in value or decreased\n *\n * _Example:_\n * ```typescript\n * transition(':increment', query('@counter', animateChild()))\n * ```\n *\n * - a sequence of any of the above divided by commas, which indicates that transition's animations\n * should occur whenever one of the state change expressions matches\n *\n * _Example:_\n * ```typescript\n * transition(':increment, * => enabled, :enter', animate('1s ease', keyframes([\n * style({ transform: 'scale(1)', offset: 0}),\n * style({ transform: 'scale(1.1)', offset: 0.7}),\n * style({ transform: 'scale(1)', offset: 1})\n * ]))),\n * ```\n *\n * Also note that in such context:\n * - `void` can be used to indicate the absence of the element\n * - asterisks can be used as wildcards that match any state\n * - (as a consequence of the above, `void => *` is equivalent to `:enter` and `* => void` is\n * equivalent to `:leave`)\n * - `true` and `false` also match expression values of `1` and `0` respectively (but do not match\n * _truthy_ and _falsy_ values)\n *\n *
\n *\n * Be careful about entering end leaving elements as their transitions present a common\n * pitfall for developers.\n *\n * Note that when an element with a trigger enters the DOM its `:enter` transition always\n * gets executed, but its `:leave` transition will not be executed if the element is removed\n * alongside its parent (as it will be removed \"without warning\" before its transition has\n * a chance to be executed, the only way that such transition can occur is if the element\n * is exiting the DOM on its own).\n *\n *\n *
\n *\n * ### Animating to a Final State\n *\n * If the final step in a transition is a call to `animate()` that uses a timing value\n * with no `style` data, that step is automatically considered the final animation arc,\n * for the element to reach the final state, in such case Angular automatically adds or removes\n * CSS styles to ensure that the element is in the correct final state.\n *\n *\n * ### Usage Examples\n *\n * - Transition animations applied based on\n * the trigger's expression value\n *\n * ```HTML\n *
\n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\"on => off, open => closed\", animate(500)),\n * transition(\"* <=> error\", query('.indicator', animateChild()))\n * ])\n * ```\n *\n * - Transition animations applied based on custom logic dependent\n * on the trigger's expression value and provided parameters\n *\n * ```HTML\n *
\n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\n * (fromState, toState, _element, params) =>\n * ['firststep', 'laststep'].includes(fromState.toLowerCase())\n * && toState === params?.['target'],\n * animate('1s')\n * )\n * ])\n * ```\n *\n * @publicApi\n **/\nfunction transition(stateChangeExpr, steps, options = null) {\n return { type: 1 /* AnimationMetadataType.Transition */, expr: stateChangeExpr, animation: steps, options };\n}\n/**\n * Produces a reusable animation that can be invoked in another animation or sequence,\n * by calling the `useAnimation()` function.\n *\n * @param steps One or more animation objects, as returned by the `animate()`\n * or `sequence()` function, that form a transformation from one state to another.\n * A sequence is used by default when you pass an array.\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional developer-defined parameters.\n * Provided values for additional parameters are used as defaults,\n * and override values can be passed to the caller on invocation.\n * @returns An object that encapsulates the animation data.\n *\n * @usageNotes\n * The following example defines a reusable animation, providing some default parameter\n * values.\n *\n * ```typescript\n * var fadeAnimation = animation([\n * style({ opacity: '{{ start }}' }),\n * animate('{{ time }}',\n * style({ opacity: '{{ end }}'}))\n * ],\n * { params: { time: '1000ms', start: 0, end: 1 }});\n * ```\n *\n * The following invokes the defined animation with a call to `useAnimation()`,\n * passing in override parameter values.\n *\n * ```js\n * useAnimation(fadeAnimation, {\n * params: {\n * time: '2s',\n * start: 1,\n * end: 0\n * }\n * })\n * ```\n *\n * If any of the passed-in parameter values are missing from this call,\n * the default values are used. If one or more parameter values are missing before a step is\n * animated, `useAnimation()` throws an error.\n *\n * @publicApi\n */\nfunction animation(steps, options = null) {\n return { type: 8 /* AnimationMetadataType.Reference */, animation: steps, options };\n}\n/**\n * Executes a queried inner animation element within an animation sequence.\n *\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional override values for developer-defined parameters.\n * @return An object that encapsulates the child animation data.\n *\n * @usageNotes\n * Each time an animation is triggered in Angular, the parent animation\n * has priority and any child animations are blocked. In order\n * for a child animation to run, the parent animation must query each of the elements\n * containing child animations, and run them using this function.\n *\n * Note that this feature is designed to be used with `query()` and it will only work\n * with animations that are assigned using the Angular animation library. CSS keyframes\n * and transitions are not handled by this API.\n *\n * @publicApi\n */\nfunction animateChild(options = null) {\n return { type: 9 /* AnimationMetadataType.AnimateChild */, options };\n}\n/**\n * Starts a reusable animation that is created using the `animation()` function.\n *\n * @param animation The reusable animation to start.\n * @param options An options object that can contain a delay value for the start of\n * the animation, and additional override values for developer-defined parameters.\n * @return An object that contains the animation parameters.\n *\n * @publicApi\n */\nfunction useAnimation(animation, options = null) {\n return { type: 10 /* AnimationMetadataType.AnimateRef */, animation, options };\n}\n/**\n * Finds one or more inner elements within the current element that is\n * being animated within a sequence. Use with `animate()`.\n *\n * @param selector The element to query, or a set of elements that contain Angular-specific\n * characteristics, specified with one or more of the following tokens.\n * - `query(\":enter\")` or `query(\":leave\")` : Query for newly inserted/removed elements (not\n * all elements can be queried via these tokens, see\n * [Entering and Leaving Elements](#entering-and-leaving-elements))\n * - `query(\":animating\")` : Query all currently animating elements.\n * - `query(\"@triggerName\")` : Query elements that contain an animation trigger.\n * - `query(\"@*\")` : Query all elements that contain an animation triggers.\n * - `query(\":self\")` : Include the current element into the animation sequence.\n *\n * @param animation One or more animation steps to apply to the queried element or elements.\n * An array is treated as an animation sequence.\n * @param options An options object. Use the 'limit' field to limit the total number of\n * items to collect.\n * @return An object that encapsulates the query data.\n *\n * @usageNotes\n *\n * ### Multiple Tokens\n *\n * Tokens can be merged into a combined query selector string. For example:\n *\n * ```typescript\n * query(':self, .record:enter, .record:leave, @subTrigger', [...])\n * ```\n *\n * The `query()` function collects multiple elements and works internally by using\n * `element.querySelectorAll`. Use the `limit` field of an options object to limit\n * the total number of items to be collected. For example:\n *\n * ```js\n * query('div', [\n * animate(...),\n * animate(...)\n * ], { limit: 1 })\n * ```\n *\n * By default, throws an error when zero items are found. Set the\n * `optional` flag to ignore this error. For example:\n *\n * ```js\n * query('.some-element-that-may-not-be-there', [\n * animate(...),\n * animate(...)\n * ], { optional: true })\n * ```\n *\n * ### Entering and Leaving Elements\n *\n * Not all elements can be queried via the `:enter` and `:leave` tokens, the only ones\n * that can are those that Angular assumes can enter/leave based on their own logic\n * (if their insertion/removal is simply a consequence of that of their parent they\n * should be queried via a different token in their parent's `:enter`/`:leave` transitions).\n *\n * The only elements Angular assumes can enter/leave based on their own logic (thus the only\n * ones that can be queried via the `:enter` and `:leave` tokens) are:\n * - Those inserted dynamically (via `ViewContainerRef`)\n * - Those that have a structural directive (which, under the hood, are a subset of the above ones)\n *\n *
\n *\n * Note that elements will be successfully queried via `:enter`/`:leave` even if their\n * insertion/removal is not done manually via `ViewContainerRef`or caused by their structural\n * directive (e.g. they enter/exit alongside their parent).\n *\n *
\n *\n *
\n *\n * There is an exception to what previously mentioned, besides elements entering/leaving based on\n * their own logic, elements with an animation trigger can always be queried via `:leave` when\n * their parent is also leaving.\n *\n *
\n *\n * ### Usage Example\n *\n * The following example queries for inner elements and animates them\n * individually using `animate()`.\n *\n * ```typescript\n * @Component({\n * selector: 'inner',\n * template: `\n *
\n *
Title
\n *
\n * Blah blah blah\n *
\n *
\n * `,\n * animations: [\n * trigger('queryAnimation', [\n * transition('* => goAnimate', [\n * // hide the inner elements\n * query('h1', style({ opacity: 0 })),\n * query('.content', style({ opacity: 0 })),\n *\n * // animate the inner elements in, one by one\n * query('h1', animate(1000, style({ opacity: 1 }))),\n * query('.content', animate(1000, style({ opacity: 1 }))),\n * ])\n * ])\n * ]\n * })\n * class Cmp {\n * exp = '';\n *\n * goAnimate() {\n * this.exp = 'goAnimate';\n * }\n * }\n * ```\n *\n * @publicApi\n */\nfunction query(selector, animation, options = null) {\n return { type: 11 /* AnimationMetadataType.Query */, selector, animation, options };\n}\n/**\n * Use within an animation `query()` call to issue a timing gap after\n * each queried item is animated.\n *\n * @param timings A delay value.\n * @param animation One ore more animation steps.\n * @returns An object that encapsulates the stagger data.\n *\n * @usageNotes\n * In the following example, a container element wraps a list of items stamped out\n * by an `ngFor`. The container element contains an animation trigger that will later be set\n * to query for each of the inner items.\n *\n * Each time items are added, the opacity fade-in animation runs,\n * and each removed item is faded out.\n * When either of these animations occur, the stagger effect is\n * applied after each item's animation is started.\n *\n * ```html\n * \n * \n * \n *
\n *
\n * {{ item }}\n *
\n *
\n * ```\n *\n * Here is the component code:\n *\n * ```typescript\n * import {trigger, transition, style, animate, query, stagger} from '@angular/animations';\n * @Component({\n * templateUrl: 'list.component.html',\n * animations: [\n * trigger('listAnimation', [\n * ...\n * ])\n * ]\n * })\n * class ListComponent {\n * items = [];\n *\n * showItems() {\n * this.items = [0,1,2,3,4];\n * }\n *\n * hideItems() {\n * this.items = [];\n * }\n *\n * toggle() {\n * this.items.length ? this.hideItems() : this.showItems();\n * }\n * }\n * ```\n *\n * Here is the animation trigger code:\n *\n * ```typescript\n * trigger('listAnimation', [\n * transition('* => *', [ // each time the binding value changes\n * query(':leave', [\n * stagger(100, [\n * animate('0.5s', style({ opacity: 0 }))\n * ])\n * ]),\n * query(':enter', [\n * style({ opacity: 0 }),\n * stagger(100, [\n * animate('0.5s', style({ opacity: 1 }))\n * ])\n * ])\n * ])\n * ])\n * ```\n *\n * @publicApi\n */\nfunction stagger(timings, animation) {\n return { type: 12 /* AnimationMetadataType.Stagger */, timings, animation };\n}\n\nfunction scheduleMicroTask(cb) {\n Promise.resolve().then(cb);\n}\n\n/**\n * An empty programmatic controller for reusable animations.\n * Used internally when animations are disabled, to avoid\n * checking for the null case when an animation player is expected.\n *\n * @see `animate()`\n * @see `AnimationPlayer`\n * @see `GroupPlayer`\n *\n * @publicApi\n */\nclass NoopAnimationPlayer {\n constructor(duration = 0, delay = 0) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._originalOnDoneFns = [];\n this._originalOnStartFns = [];\n this._started = false;\n this._destroyed = false;\n this._finished = false;\n this._position = 0;\n this.parentPlayer = null;\n this.totalTime = duration + delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n onStart(fn) {\n this._originalOnStartFns.push(fn);\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._originalOnDoneFns.push(fn);\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n init() { }\n play() {\n if (!this.hasStarted()) {\n this._onStart();\n this.triggerMicrotask();\n }\n this._started = true;\n }\n /** @internal */\n triggerMicrotask() {\n scheduleMicroTask(() => this._onFinish());\n }\n _onStart() {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n pause() { }\n restart() { }\n finish() {\n this._onFinish();\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n if (!this.hasStarted()) {\n this._onStart();\n }\n this.finish();\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this._started = false;\n this._finished = false;\n this._onStartFns = this._originalOnStartFns;\n this._onDoneFns = this._originalOnDoneFns;\n }\n setPosition(position) {\n this._position = this.totalTime ? position * this.totalTime : 1;\n }\n getPosition() {\n return this.totalTime ? this._position / this.totalTime : 1;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\n/**\n * A programmatic controller for a group of reusable animations.\n * Used internally to control animations.\n *\n * @see `AnimationPlayer`\n * @see `{@link animations/group group()}`\n *\n */\nclass AnimationGroupPlayer {\n constructor(_players) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n this._onDestroyFns = [];\n this.parentPlayer = null;\n this.totalTime = 0;\n this.players = _players;\n let doneCount = 0;\n let destroyCount = 0;\n let startCount = 0;\n const total = this.players.length;\n if (total == 0) {\n scheduleMicroTask(() => this._onFinish());\n }\n else {\n this.players.forEach(player => {\n player.onDone(() => {\n if (++doneCount == total) {\n this._onFinish();\n }\n });\n player.onDestroy(() => {\n if (++destroyCount == total) {\n this._onDestroy();\n }\n });\n player.onStart(() => {\n if (++startCount == total) {\n this._onStart();\n }\n });\n });\n }\n this.totalTime = this.players.reduce((time, player) => Math.max(time, player.totalTime), 0);\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this.players.forEach(player => player.init());\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n _onStart() {\n if (!this.hasStarted()) {\n this._started = true;\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n play() {\n if (!this.parentPlayer) {\n this.init();\n }\n this._onStart();\n this.players.forEach(player => player.play());\n }\n pause() {\n this.players.forEach(player => player.pause());\n }\n restart() {\n this.players.forEach(player => player.restart());\n }\n finish() {\n this._onFinish();\n this.players.forEach(player => player.finish());\n }\n destroy() {\n this._onDestroy();\n }\n _onDestroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._onFinish();\n this.players.forEach(player => player.destroy());\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this.players.forEach(player => player.reset());\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n }\n setPosition(p) {\n const timeAtPosition = p * this.totalTime;\n this.players.forEach(player => {\n const position = player.totalTime ? Math.min(1, timeAtPosition / player.totalTime) : 1;\n player.setPosition(position);\n });\n }\n getPosition() {\n const longestPlayer = this.players.reduce((longestSoFar, player) => {\n const newPlayerIsLongest = longestSoFar === null || player.totalTime > longestSoFar.totalTime;\n return newPlayerIsLongest ? player : longestSoFar;\n }, null);\n return longestPlayer != null ? longestPlayer.getPosition() : 0;\n }\n beforeDestroy() {\n this.players.forEach(player => {\n if (player.beforeDestroy) {\n player.beforeDestroy();\n }\n });\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\nconst ɵPRE_STYLE = '!';\n\n/**\n * @module\n * @description\n * Entry point for all animation APIs of the animation package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AUTO_STYLE, AnimationBuilder, AnimationFactory, NoopAnimationPlayer, animate, animateChild, animation, group, keyframes, query, sequence, stagger, state, style, transition, trigger, useAnimation, AnimationGroupPlayer as ɵAnimationGroupPlayer, ɵPRE_STYLE };\n","import * as i0 from '@angular/core';\nimport { InjectionToken, inject, EventEmitter, Injectable, Optional, Inject, Directive, Output, Input, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token used to inject the document into Directionality.\n * This is used so that the value can be faked in tests.\n *\n * We can't use the real document in tests because changing the real `dir` causes geometry-based\n * tests in Safari to fail.\n *\n * We also can't re-provide the DOCUMENT token from platform-brower because the unit tests\n * themselves use things like `querySelector` in test code.\n *\n * This token is defined in a separate file from Directionality as a workaround for\n * https://github.com/angular/angular/issues/22559\n *\n * @docs-private\n */\nconst DIR_DOCUMENT = new InjectionToken('cdk-dir-doc', {\n providedIn: 'root',\n factory: DIR_DOCUMENT_FACTORY,\n});\n/** @docs-private */\nfunction DIR_DOCUMENT_FACTORY() {\n return inject(DOCUMENT);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Regex that matches locales with an RTL script. Taken from `goog.i18n.bidi.isRtlLanguage`. */\nconst RTL_LOCALE_PATTERN = /^(ar|ckb|dv|he|iw|fa|nqo|ps|sd|ug|ur|yi|.*[-_](Adlm|Arab|Hebr|Nkoo|Rohg|Thaa))(?!.*[-_](Latn|Cyrl)($|-|_))($|-|_)/i;\n/** Resolves a string value to a specific direction. */\nfunction _resolveDirectionality(rawValue) {\n const value = rawValue?.toLowerCase() || '';\n if (value === 'auto' && typeof navigator !== 'undefined' && navigator?.language) {\n return RTL_LOCALE_PATTERN.test(navigator.language) ? 'rtl' : 'ltr';\n }\n return value === 'rtl' ? 'rtl' : 'ltr';\n}\n/**\n * The directionality (LTR / RTL) context for the application (or a subtree of it).\n * Exposes the current direction and a stream of direction changes.\n */\nclass Directionality {\n constructor(_document) {\n /** The current 'ltr' or 'rtl' value. */\n this.value = 'ltr';\n /** Stream that emits whenever the 'ltr' / 'rtl' state changes. */\n this.change = new EventEmitter();\n if (_document) {\n const bodyDir = _document.body ? _document.body.dir : null;\n const htmlDir = _document.documentElement ? _document.documentElement.dir : null;\n this.value = _resolveDirectionality(bodyDir || htmlDir || 'ltr');\n }\n }\n ngOnDestroy() {\n this.change.complete();\n }\n}\nDirectionality.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: Directionality, deps: [{ token: DIR_DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nDirectionality.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: Directionality, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: Directionality, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DIR_DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Directive to listen for changes of direction of part of the DOM.\n *\n * Provides itself as Directionality such that descendant directives only need to ever inject\n * Directionality to get the closest direction.\n */\nclass Dir {\n constructor() {\n /** Normalized direction that accounts for invalid/unsupported values. */\n this._dir = 'ltr';\n /** Whether the `value` has been set to its initial value. */\n this._isInitialized = false;\n /** Event emitted when the direction changes. */\n this.change = new EventEmitter();\n }\n /** @docs-private */\n get dir() {\n return this._dir;\n }\n set dir(value) {\n const previousValue = this._dir;\n // Note: `_resolveDirectionality` resolves the language based on the browser's language,\n // whereas the browser does it based on the content of the element. Since doing so based\n // on the content can be expensive, for now we're doing the simpler matching.\n this._dir = _resolveDirectionality(value);\n this._rawDir = value;\n if (previousValue !== this._dir && this._isInitialized) {\n this.change.emit(this._dir);\n }\n }\n /** Current layout direction of the element. */\n get value() {\n return this.dir;\n }\n /** Initialize once default value has been set. */\n ngAfterContentInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n this.change.complete();\n }\n}\nDir.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: Dir, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nDir.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: Dir, selector: \"[dir]\", inputs: { dir: \"dir\" }, outputs: { change: \"dirChange\" }, host: { properties: { \"attr.dir\": \"_rawDir\" } }, providers: [{ provide: Directionality, useExisting: Dir }], exportAs: [\"dir\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: Dir, decorators: [{\n type: Directive,\n args: [{\n selector: '[dir]',\n providers: [{ provide: Directionality, useExisting: Dir }],\n host: { '[attr.dir]': '_rawDir' },\n exportAs: 'dir',\n }]\n }], propDecorators: { change: [{\n type: Output,\n args: ['dirChange']\n }], dir: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass BidiModule {\n}\nBidiModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: BidiModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nBidiModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: BidiModule, declarations: [Dir], exports: [Dir] });\nBidiModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: BidiModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: BidiModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [Dir],\n declarations: [Dir],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BidiModule, DIR_DOCUMENT, Dir, Directionality };\n","import { ElementRef } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Coerces a data-bound value (typically a string) to a boolean. */\nfunction coerceBooleanProperty(value) {\n return value != null && `${value}` !== 'false';\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction coerceNumberProperty(value, fallbackValue = 0) {\n return _isNumberValue(value) ? Number(value) : fallbackValue;\n}\n/**\n * Whether the provided value is considered a number.\n * @docs-private\n */\nfunction _isNumberValue(value) {\n // parseFloat(value) handles most of the cases we're interested in (it treats null, empty string,\n // and other non-number values as NaN, where Number just uses 0) but it considers the string\n // '123hello' to be a valid number. Therefore we also check if Number(value) is NaN.\n return !isNaN(parseFloat(value)) && !isNaN(Number(value));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction coerceArray(value) {\n return Array.isArray(value) ? value : [value];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Coerces a value to a CSS pixel value. */\nfunction coerceCssPixelValue(value) {\n if (value == null) {\n return '';\n }\n return typeof value === 'string' ? value : `${value}px`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Coerces an ElementRef or an Element into an element.\n * Useful for APIs that can accept either a ref or the native element itself.\n */\nfunction coerceElement(elementOrRef) {\n return elementOrRef instanceof ElementRef ? elementOrRef.nativeElement : elementOrRef;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Coerces a value to an array of trimmed non-empty strings.\n * Any input that is not an array, `null` or `undefined` will be turned into a string\n * via `toString()` and subsequently split with the given separator.\n * `null` and `undefined` will result in an empty array.\n * This results in the following outcomes:\n * - `null` -> `[]`\n * - `[null]` -> `[\"null\"]`\n * - `[\"a\", \"b \", \" \"]` -> `[\"a\", \"b\"]`\n * - `[1, [2, 3]]` -> `[\"1\", \"2,3\"]`\n * - `[{ a: 0 }]` -> `[\"[object Object]\"]`\n * - `{ a: 0 }` -> `[\"[object\", \"Object]\"]`\n *\n * Useful for defining CSS classes or table columns.\n * @param value the value to coerce into an array of strings\n * @param separator split-separator if value isn't an array\n */\nfunction coerceStringArray(value, separator = /\\s+/) {\n const result = [];\n if (value != null) {\n const sourceValues = Array.isArray(value) ? value : `${value}`.split(separator);\n for (const sourceValue of sourceValues) {\n const trimmedString = `${sourceValue}`.trim();\n if (trimmedString) {\n result.push(trimmedString);\n }\n }\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\nexport { _isNumberValue, coerceArray, coerceBooleanProperty, coerceCssPixelValue, coerceElement, coerceNumberProperty, coerceStringArray };\n","import * as i0 from '@angular/core';\nimport { PLATFORM_ID, Injectable, Inject, NgModule } from '@angular/core';\nimport { isPlatformBrowser } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Whether the current platform supports the V8 Break Iterator. The V8 check\n// is necessary to detect all Blink based browsers.\nlet hasV8BreakIterator;\n// We need a try/catch around the reference to `Intl`, because accessing it in some cases can\n// cause IE to throw. These cases are tied to particular versions of Windows and can happen if\n// the consumer is providing a polyfilled `Map`. See:\n// https://github.com/Microsoft/ChakraCore/issues/3189\n// https://github.com/angular/components/issues/15687\ntry {\n hasV8BreakIterator = typeof Intl !== 'undefined' && Intl.v8BreakIterator;\n}\ncatch {\n hasV8BreakIterator = false;\n}\n/**\n * Service to detect the current platform by comparing the userAgent strings and\n * checking browser-specific global properties.\n */\nclass Platform {\n constructor(_platformId) {\n this._platformId = _platformId;\n // We want to use the Angular platform check because if the Document is shimmed\n // without the navigator, the following checks will fail. This is preferred because\n // sometimes the Document may be shimmed without the user's knowledge or intention\n /** Whether the Angular application is being rendered in the browser. */\n this.isBrowser = this._platformId\n ? isPlatformBrowser(this._platformId)\n : typeof document === 'object' && !!document;\n /** Whether the current browser is Microsoft Edge. */\n this.EDGE = this.isBrowser && /(edge)/i.test(navigator.userAgent);\n /** Whether the current rendering engine is Microsoft Trident. */\n this.TRIDENT = this.isBrowser && /(msie|trident)/i.test(navigator.userAgent);\n // EdgeHTML and Trident mock Blink specific things and need to be excluded from this check.\n /** Whether the current rendering engine is Blink. */\n this.BLINK = this.isBrowser &&\n !!(window.chrome || hasV8BreakIterator) &&\n typeof CSS !== 'undefined' &&\n !this.EDGE &&\n !this.TRIDENT;\n // Webkit is part of the userAgent in EdgeHTML, Blink and Trident. Therefore we need to\n // ensure that Webkit runs standalone and is not used as another engine's base.\n /** Whether the current rendering engine is WebKit. */\n this.WEBKIT = this.isBrowser &&\n /AppleWebKit/i.test(navigator.userAgent) &&\n !this.BLINK &&\n !this.EDGE &&\n !this.TRIDENT;\n /** Whether the current platform is Apple iOS. */\n this.IOS = this.isBrowser && /iPad|iPhone|iPod/.test(navigator.userAgent) && !('MSStream' in window);\n // It's difficult to detect the plain Gecko engine, because most of the browsers identify\n // them self as Gecko-like browsers and modify the userAgent's according to that.\n // Since we only cover one explicit Firefox case, we can simply check for Firefox\n // instead of having an unstable check for Gecko.\n /** Whether the current browser is Firefox. */\n this.FIREFOX = this.isBrowser && /(firefox|minefield)/i.test(navigator.userAgent);\n /** Whether the current platform is Android. */\n // Trident on mobile adds the android platform to the userAgent to trick detections.\n this.ANDROID = this.isBrowser && /android/i.test(navigator.userAgent) && !this.TRIDENT;\n // Safari browsers will include the Safari keyword in their userAgent. Some browsers may fake\n // this and just place the Safari keyword in the userAgent. To be more safe about Safari every\n // Safari browser should also use Webkit as its layout engine.\n /** Whether the current browser is Safari. */\n this.SAFARI = this.isBrowser && /safari/i.test(navigator.userAgent) && this.WEBKIT;\n }\n}\nPlatform.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: Platform, deps: [{ token: PLATFORM_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nPlatform.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: Platform, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: Platform, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: Object, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass PlatformModule {\n}\nPlatformModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: PlatformModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nPlatformModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: PlatformModule });\nPlatformModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: PlatformModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: PlatformModule, decorators: [{\n type: NgModule,\n args: [{}]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result Set of input types support by the current browser. */\nlet supportedInputTypes;\n/** Types of `` that *might* be supported. */\nconst candidateInputTypes = [\n // `color` must come first. Chrome 56 shows a warning if we change the type to `color` after\n // first changing it to something else:\n // The specified value \"\" does not conform to the required format.\n // The format is \"#rrggbb\" where rr, gg, bb are two-digit hexadecimal numbers.\n 'color',\n 'button',\n 'checkbox',\n 'date',\n 'datetime-local',\n 'email',\n 'file',\n 'hidden',\n 'image',\n 'month',\n 'number',\n 'password',\n 'radio',\n 'range',\n 'reset',\n 'search',\n 'submit',\n 'tel',\n 'text',\n 'time',\n 'url',\n 'week',\n];\n/** @returns The input types supported by this browser. */\nfunction getSupportedInputTypes() {\n // Result is cached.\n if (supportedInputTypes) {\n return supportedInputTypes;\n }\n // We can't check if an input type is not supported until we're on the browser, so say that\n // everything is supported when not on the browser. We don't use `Platform` here since it's\n // just a helper function and can't inject it.\n if (typeof document !== 'object' || !document) {\n supportedInputTypes = new Set(candidateInputTypes);\n return supportedInputTypes;\n }\n let featureTestInput = document.createElement('input');\n supportedInputTypes = new Set(candidateInputTypes.filter(value => {\n featureTestInput.setAttribute('type', value);\n return featureTestInput.type === value;\n }));\n return supportedInputTypes;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result of whether the user's browser supports passive event listeners. */\nlet supportsPassiveEvents;\n/**\n * Checks whether the user's browser supports passive event listeners.\n * See: https://github.com/WICG/EventListenerOptions/blob/gh-pages/explainer.md\n */\nfunction supportsPassiveEventListeners() {\n if (supportsPassiveEvents == null && typeof window !== 'undefined') {\n try {\n window.addEventListener('test', null, Object.defineProperty({}, 'passive', {\n get: () => (supportsPassiveEvents = true),\n }));\n }\n finally {\n supportsPassiveEvents = supportsPassiveEvents || false;\n }\n }\n return supportsPassiveEvents;\n}\n/**\n * Normalizes an `AddEventListener` object to something that can be passed\n * to `addEventListener` on any browser, no matter whether it supports the\n * `options` parameter.\n * @param options Object to be normalized.\n */\nfunction normalizePassiveListenerOptions(options) {\n return supportsPassiveEventListeners() ? options : !!options.capture;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result of the way the browser handles the horizontal scroll axis in RTL mode. */\nlet rtlScrollAxisType;\n/** Cached result of the check that indicates whether the browser supports scroll behaviors. */\nlet scrollBehaviorSupported;\n/** Check whether the browser supports scroll behaviors. */\nfunction supportsScrollBehavior() {\n if (scrollBehaviorSupported == null) {\n // If we're not in the browser, it can't be supported. Also check for `Element`, because\n // some projects stub out the global `document` during SSR which can throw us off.\n if (typeof document !== 'object' || !document || typeof Element !== 'function' || !Element) {\n scrollBehaviorSupported = false;\n return scrollBehaviorSupported;\n }\n // If the element can have a `scrollBehavior` style, we can be sure that it's supported.\n if ('scrollBehavior' in document.documentElement.style) {\n scrollBehaviorSupported = true;\n }\n else {\n // At this point we have 3 possibilities: `scrollTo` isn't supported at all, it's\n // supported but it doesn't handle scroll behavior, or it has been polyfilled.\n const scrollToFunction = Element.prototype.scrollTo;\n if (scrollToFunction) {\n // We can detect if the function has been polyfilled by calling `toString` on it. Native\n // functions are obfuscated using `[native code]`, whereas if it was overwritten we'd get\n // the actual function source. Via https://davidwalsh.name/detect-native-function. Consider\n // polyfilled functions as supporting scroll behavior.\n scrollBehaviorSupported = !/\\{\\s*\\[native code\\]\\s*\\}/.test(scrollToFunction.toString());\n }\n else {\n scrollBehaviorSupported = false;\n }\n }\n }\n return scrollBehaviorSupported;\n}\n/**\n * Checks the type of RTL scroll axis used by this browser. As of time of writing, Chrome is NORMAL,\n * Firefox & Safari are NEGATED, and IE & Edge are INVERTED.\n */\nfunction getRtlScrollAxisType() {\n // We can't check unless we're on the browser. Just assume 'normal' if we're not.\n if (typeof document !== 'object' || !document) {\n return 0 /* NORMAL */;\n }\n if (rtlScrollAxisType == null) {\n // Create a 1px wide scrolling container and a 2px wide content element.\n const scrollContainer = document.createElement('div');\n const containerStyle = scrollContainer.style;\n scrollContainer.dir = 'rtl';\n containerStyle.width = '1px';\n containerStyle.overflow = 'auto';\n containerStyle.visibility = 'hidden';\n containerStyle.pointerEvents = 'none';\n containerStyle.position = 'absolute';\n const content = document.createElement('div');\n const contentStyle = content.style;\n contentStyle.width = '2px';\n contentStyle.height = '1px';\n scrollContainer.appendChild(content);\n document.body.appendChild(scrollContainer);\n rtlScrollAxisType = 0 /* NORMAL */;\n // The viewport starts scrolled all the way to the right in RTL mode. If we are in a NORMAL\n // browser this would mean that the scrollLeft should be 1. If it's zero instead we know we're\n // dealing with one of the other two types of browsers.\n if (scrollContainer.scrollLeft === 0) {\n // In a NEGATED browser the scrollLeft is always somewhere in [-maxScrollAmount, 0]. For an\n // INVERTED browser it is always somewhere in [0, maxScrollAmount]. We can determine which by\n // setting to the scrollLeft to 1. This is past the max for a NEGATED browser, so it will\n // return 0 when we read it again.\n scrollContainer.scrollLeft = 1;\n rtlScrollAxisType =\n scrollContainer.scrollLeft === 0 ? 1 /* NEGATED */ : 2 /* INVERTED */;\n }\n scrollContainer.remove();\n }\n return rtlScrollAxisType;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet shadowDomIsSupported;\n/** Checks whether the user's browser support Shadow DOM. */\nfunction _supportsShadowDom() {\n if (shadowDomIsSupported == null) {\n const head = typeof document !== 'undefined' ? document.head : null;\n shadowDomIsSupported = !!(head && (head.createShadowRoot || head.attachShadow));\n }\n return shadowDomIsSupported;\n}\n/** Gets the shadow root of an element, if supported and the element is inside the Shadow DOM. */\nfunction _getShadowRoot(element) {\n if (_supportsShadowDom()) {\n const rootNode = element.getRootNode ? element.getRootNode() : null;\n // Note that this should be caught by `_supportsShadowDom`, but some\n // teams have been able to hit this code path on unsupported browsers.\n if (typeof ShadowRoot !== 'undefined' && ShadowRoot && rootNode instanceof ShadowRoot) {\n return rootNode;\n }\n }\n return null;\n}\n/**\n * Gets the currently-focused element on the page while\n * also piercing through Shadow DOM boundaries.\n */\nfunction _getFocusedElementPierceShadowDom() {\n let activeElement = typeof document !== 'undefined' && document\n ? document.activeElement\n : null;\n while (activeElement && activeElement.shadowRoot) {\n const newActiveElement = activeElement.shadowRoot.activeElement;\n if (newActiveElement === activeElement) {\n break;\n }\n else {\n activeElement = newActiveElement;\n }\n }\n return activeElement;\n}\n/** Gets the target of an event while accounting for Shadow DOM. */\nfunction _getEventTarget(event) {\n // If an event is bound outside the Shadow DOM, the `event.target` will\n // point to the shadow root so we have to use `composedPath` instead.\n return (event.composedPath ? event.composedPath()[0] : event.target);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Gets whether the code is currently running in a test environment. */\nfunction _isTestEnvironment() {\n // We can't use `declare const` because it causes conflicts inside Google with the real typings\n // for these symbols and we can't read them off the global object, because they don't appear to\n // be attached there for some runners like Jest.\n // (see: https://github.com/angular/components/issues/23365#issuecomment-938146643)\n return (\n // @ts-ignore\n (typeof __karma__ !== 'undefined' && !!__karma__) ||\n // @ts-ignore\n (typeof jasmine !== 'undefined' && !!jasmine) ||\n // @ts-ignore\n (typeof jest !== 'undefined' && !!jest) ||\n // @ts-ignore\n (typeof Mocha !== 'undefined' && !!Mocha));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { Platform, PlatformModule, _getEventTarget, _getFocusedElementPierceShadowDom, _getShadowRoot, _isTestEnvironment, _supportsShadowDom, getRtlScrollAxisType, getSupportedInputTypes, normalizePassiveListenerOptions, supportsPassiveEventListeners, supportsScrollBehavior };\n","let nextHandle = 1;\nlet resolved;\nconst activeHandles = {};\nfunction findAndClearHandle(handle) {\n if (handle in activeHandles) {\n delete activeHandles[handle];\n return true;\n }\n return false;\n}\nexport const Immediate = {\n setImmediate(cb) {\n const handle = nextHandle++;\n activeHandles[handle] = true;\n if (!resolved) {\n resolved = Promise.resolve();\n }\n resolved.then(() => findAndClearHandle(handle) && cb());\n return handle;\n },\n clearImmediate(handle) {\n findAndClearHandle(handle);\n },\n};\nexport const TestTools = {\n pending() {\n return Object.keys(activeHandles).length;\n }\n};\n","import { Immediate } from '../util/Immediate';\nconst { setImmediate, clearImmediate } = Immediate;\nexport const immediateProvider = {\n setImmediate(...args) {\n const { delegate } = immediateProvider;\n return ((delegate === null || delegate === void 0 ? void 0 : delegate.setImmediate) || setImmediate)(...args);\n },\n clearImmediate(handle) {\n const { delegate } = immediateProvider;\n return ((delegate === null || delegate === void 0 ? void 0 : delegate.clearImmediate) || clearImmediate)(handle);\n },\n delegate: undefined,\n};\n","import { AsapAction } from './AsapAction';\nimport { AsapScheduler } from './AsapScheduler';\nexport const asapScheduler = new AsapScheduler(AsapAction);\nexport const asap = asapScheduler;\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class AsapScheduler extends AsyncScheduler {\n flush(action) {\n this._active = true;\n const flushId = this._scheduled;\n this._scheduled = undefined;\n const { actions } = this;\n let error;\n action = action || actions.shift();\n do {\n if ((error = action.execute(action.state, action.delay))) {\n break;\n }\n } while ((action = actions[0]) && action.id === flushId && actions.shift());\n this._active = false;\n if (error) {\n while ((action = actions[0]) && action.id === flushId && actions.shift()) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { AsyncAction } from './AsyncAction';\nimport { immediateProvider } from './immediateProvider';\nexport class AsapAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && delay > 0) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n scheduler.actions.push(this);\n return scheduler._scheduled || (scheduler._scheduled = immediateProvider.setImmediate(scheduler.flush.bind(scheduler, undefined)));\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n var _a;\n if (delay != null ? delay > 0 : this.delay > 0) {\n return super.recycleAsyncId(scheduler, id, delay);\n }\n const { actions } = scheduler;\n if (id != null && ((_a = actions[actions.length - 1]) === null || _a === void 0 ? void 0 : _a.id) !== id) {\n immediateProvider.clearImmediate(id);\n if (scheduler._scheduled === id) {\n scheduler._scheduled = undefined;\n }\n }\n return undefined;\n }\n}\n","import { asyncScheduler } from '../scheduler/async';\nimport { audit } from './audit';\nimport { timer } from '../observable/timer';\nexport function auditTime(duration, scheduler = asyncScheduler) {\n return audit(() => timer(duration, scheduler));\n}\n","import { operate } from '../util/lift';\nimport { innerFrom } from '../observable/innerFrom';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function audit(durationSelector) {\n return operate((source, subscriber) => {\n let hasValue = false;\n let lastValue = null;\n let durationSubscriber = null;\n let isComplete = false;\n const endDuration = () => {\n durationSubscriber === null || durationSubscriber === void 0 ? void 0 : durationSubscriber.unsubscribe();\n durationSubscriber = null;\n if (hasValue) {\n hasValue = false;\n const value = lastValue;\n lastValue = null;\n subscriber.next(value);\n }\n isComplete && subscriber.complete();\n };\n const cleanupDuration = () => {\n durationSubscriber = null;\n isComplete && subscriber.complete();\n };\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n hasValue = true;\n lastValue = value;\n if (!durationSubscriber) {\n innerFrom(durationSelector(value)).subscribe((durationSubscriber = createOperatorSubscriber(subscriber, endDuration, cleanupDuration)));\n }\n }, () => {\n isComplete = true;\n (!hasValue || !durationSubscriber || durationSubscriber.closed) && subscriber.complete();\n }));\n });\n}\n","import { coerceNumberProperty, coerceElement, coerceBooleanProperty } from '@angular/cdk/coercion';\nimport * as i0 from '@angular/core';\nimport { InjectionToken, forwardRef, Directive, Input, Injectable, Optional, Inject, Component, ViewEncapsulation, ChangeDetectionStrategy, Output, ViewChild, SkipSelf, NgModule } from '@angular/core';\nimport { Subject, of, Observable, fromEvent, animationFrameScheduler, asapScheduler, Subscription, isObservable } from 'rxjs';\nimport { distinctUntilChanged, auditTime, filter, takeUntil, startWith, pairwise, switchMap, shareReplay } from 'rxjs/operators';\nimport * as i1 from '@angular/cdk/platform';\nimport { getRtlScrollAxisType, supportsScrollBehavior } from '@angular/cdk/platform';\nimport { DOCUMENT } from '@angular/common';\nimport * as i2 from '@angular/cdk/bidi';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport * as i2$1 from '@angular/cdk/collections';\nimport { isDataSource, ArrayDataSource, _VIEW_REPEATER_STRATEGY, _RecycleViewRepeaterStrategy } from '@angular/cdk/collections';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The injection token used to specify the virtual scrolling strategy. */\nconst VIRTUAL_SCROLL_STRATEGY = new InjectionToken('VIRTUAL_SCROLL_STRATEGY');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Virtual scrolling strategy for lists with items of known fixed size. */\nclass FixedSizeVirtualScrollStrategy {\n /**\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n constructor(itemSize, minBufferPx, maxBufferPx) {\n this._scrolledIndexChange = new Subject();\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n this.scrolledIndexChange = this._scrolledIndexChange.pipe(distinctUntilChanged());\n /** The attached viewport. */\n this._viewport = null;\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n }\n /**\n * Attaches this scroll strategy to a viewport.\n * @param viewport The viewport to attach this strategy to.\n */\n attach(viewport) {\n this._viewport = viewport;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** Detaches this scroll strategy from the currently attached viewport. */\n detach() {\n this._scrolledIndexChange.complete();\n this._viewport = null;\n }\n /**\n * Update the item size and buffer size.\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n updateItemAndBufferSize(itemSize, minBufferPx, maxBufferPx) {\n if (maxBufferPx < minBufferPx && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CDK virtual scroll: maxBufferPx must be greater than or equal to minBufferPx');\n }\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentScrolled() {\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onDataLengthChanged() {\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentRendered() {\n /* no-op */\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onRenderedOffsetChanged() {\n /* no-op */\n }\n /**\n * Scroll to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling.\n */\n scrollToIndex(index, behavior) {\n if (this._viewport) {\n this._viewport.scrollToOffset(index * this._itemSize, behavior);\n }\n }\n /** Update the viewport's total content size. */\n _updateTotalContentSize() {\n if (!this._viewport) {\n return;\n }\n this._viewport.setTotalContentSize(this._viewport.getDataLength() * this._itemSize);\n }\n /** Update the viewport's rendered range. */\n _updateRenderedRange() {\n if (!this._viewport) {\n return;\n }\n const renderedRange = this._viewport.getRenderedRange();\n const newRange = { start: renderedRange.start, end: renderedRange.end };\n const viewportSize = this._viewport.getViewportSize();\n const dataLength = this._viewport.getDataLength();\n let scrollOffset = this._viewport.measureScrollOffset();\n // Prevent NaN as result when dividing by zero.\n let firstVisibleIndex = this._itemSize > 0 ? scrollOffset / this._itemSize : 0;\n // If user scrolls to the bottom of the list and data changes to a smaller list\n if (newRange.end > dataLength) {\n // We have to recalculate the first visible index based on new data length and viewport size.\n const maxVisibleItems = Math.ceil(viewportSize / this._itemSize);\n const newVisibleIndex = Math.max(0, Math.min(firstVisibleIndex, dataLength - maxVisibleItems));\n // If first visible index changed we must update scroll offset to handle start/end buffers\n // Current range must also be adjusted to cover the new position (bottom of new list).\n if (firstVisibleIndex != newVisibleIndex) {\n firstVisibleIndex = newVisibleIndex;\n scrollOffset = newVisibleIndex * this._itemSize;\n newRange.start = Math.floor(firstVisibleIndex);\n }\n newRange.end = Math.max(0, Math.min(dataLength, newRange.start + maxVisibleItems));\n }\n const startBuffer = scrollOffset - newRange.start * this._itemSize;\n if (startBuffer < this._minBufferPx && newRange.start != 0) {\n const expandStart = Math.ceil((this._maxBufferPx - startBuffer) / this._itemSize);\n newRange.start = Math.max(0, newRange.start - expandStart);\n newRange.end = Math.min(dataLength, Math.ceil(firstVisibleIndex + (viewportSize + this._minBufferPx) / this._itemSize));\n }\n else {\n const endBuffer = newRange.end * this._itemSize - (scrollOffset + viewportSize);\n if (endBuffer < this._minBufferPx && newRange.end != dataLength) {\n const expandEnd = Math.ceil((this._maxBufferPx - endBuffer) / this._itemSize);\n if (expandEnd > 0) {\n newRange.end = Math.min(dataLength, newRange.end + expandEnd);\n newRange.start = Math.max(0, Math.floor(firstVisibleIndex - this._minBufferPx / this._itemSize));\n }\n }\n }\n this._viewport.setRenderedRange(newRange);\n this._viewport.setRenderedContentOffset(this._itemSize * newRange.start);\n this._scrolledIndexChange.next(Math.floor(firstVisibleIndex));\n }\n}\n/**\n * Provider factory for `FixedSizeVirtualScrollStrategy` that simply extracts the already created\n * `FixedSizeVirtualScrollStrategy` from the given directive.\n * @param fixedSizeDir The instance of `CdkFixedSizeVirtualScroll` to extract the\n * `FixedSizeVirtualScrollStrategy` from.\n */\nfunction _fixedSizeVirtualScrollStrategyFactory(fixedSizeDir) {\n return fixedSizeDir._scrollStrategy;\n}\n/** A virtual scroll strategy that supports fixed-size items. */\nclass CdkFixedSizeVirtualScroll {\n constructor() {\n this._itemSize = 20;\n this._minBufferPx = 100;\n this._maxBufferPx = 200;\n /** The scroll strategy used by this directive. */\n this._scrollStrategy = new FixedSizeVirtualScrollStrategy(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n /** The size of the items in the list (in pixels). */\n get itemSize() {\n return this._itemSize;\n }\n set itemSize(value) {\n this._itemSize = coerceNumberProperty(value);\n }\n /**\n * The minimum amount of buffer rendered beyond the viewport (in pixels).\n * If the amount of buffer dips below this number, more items will be rendered. Defaults to 100px.\n */\n get minBufferPx() {\n return this._minBufferPx;\n }\n set minBufferPx(value) {\n this._minBufferPx = coerceNumberProperty(value);\n }\n /**\n * The number of pixels worth of buffer to render for when rendering new items. Defaults to 200px.\n */\n get maxBufferPx() {\n return this._maxBufferPx;\n }\n set maxBufferPx(value) {\n this._maxBufferPx = coerceNumberProperty(value);\n }\n ngOnChanges() {\n this._scrollStrategy.updateItemAndBufferSize(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n}\nCdkFixedSizeVirtualScroll.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkFixedSizeVirtualScroll, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nCdkFixedSizeVirtualScroll.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: CdkFixedSizeVirtualScroll, selector: \"cdk-virtual-scroll-viewport[itemSize]\", inputs: { itemSize: \"itemSize\", minBufferPx: \"minBufferPx\", maxBufferPx: \"maxBufferPx\" }, providers: [\n {\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)],\n },\n ], usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkFixedSizeVirtualScroll, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-virtual-scroll-viewport[itemSize]',\n providers: [\n {\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)],\n },\n ],\n }]\n }], propDecorators: { itemSize: [{\n type: Input\n }], minBufferPx: [{\n type: Input\n }], maxBufferPx: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Time in ms to throttle the scrolling events by default. */\nconst DEFAULT_SCROLL_TIME = 20;\n/**\n * Service contained all registered Scrollable references and emits an event when any one of the\n * Scrollable references emit a scrolled event.\n */\nclass ScrollDispatcher {\n constructor(_ngZone, _platform, document) {\n this._ngZone = _ngZone;\n this._platform = _platform;\n /** Subject for notifying that a registered scrollable reference element has been scrolled. */\n this._scrolled = new Subject();\n /** Keeps track of the global `scroll` and `resize` subscriptions. */\n this._globalSubscription = null;\n /** Keeps track of the amount of subscriptions to `scrolled`. Used for cleaning up afterwards. */\n this._scrolledCount = 0;\n /**\n * Map of all the scrollable references that are registered with the service and their\n * scroll event subscriptions.\n */\n this.scrollContainers = new Map();\n this._document = document;\n }\n /**\n * Registers a scrollable instance with the service and listens for its scrolled events. When the\n * scrollable is scrolled, the service emits the event to its scrolled observable.\n * @param scrollable Scrollable instance to be registered.\n */\n register(scrollable) {\n if (!this.scrollContainers.has(scrollable)) {\n this.scrollContainers.set(scrollable, scrollable.elementScrolled().subscribe(() => this._scrolled.next(scrollable)));\n }\n }\n /**\n * Deregisters a Scrollable reference and unsubscribes from its scroll event observable.\n * @param scrollable Scrollable instance to be deregistered.\n */\n deregister(scrollable) {\n const scrollableReference = this.scrollContainers.get(scrollable);\n if (scrollableReference) {\n scrollableReference.unsubscribe();\n this.scrollContainers.delete(scrollable);\n }\n }\n /**\n * Returns an observable that emits an event whenever any of the registered Scrollable\n * references (or window, document, or body) fire a scrolled event. Can provide a time in ms\n * to override the default \"throttle\" time.\n *\n * **Note:** in order to avoid hitting change detection for every scroll event,\n * all of the events emitted from this stream will be run outside the Angular zone.\n * If you need to update any data bindings as a result of a scroll event, you have\n * to run the callback using `NgZone.run`.\n */\n scrolled(auditTimeInMs = DEFAULT_SCROLL_TIME) {\n if (!this._platform.isBrowser) {\n return of();\n }\n return new Observable((observer) => {\n if (!this._globalSubscription) {\n this._addGlobalListener();\n }\n // In the case of a 0ms delay, use an observable without auditTime\n // since it does add a perceptible delay in processing overhead.\n const subscription = auditTimeInMs > 0\n ? this._scrolled.pipe(auditTime(auditTimeInMs)).subscribe(observer)\n : this._scrolled.subscribe(observer);\n this._scrolledCount++;\n return () => {\n subscription.unsubscribe();\n this._scrolledCount--;\n if (!this._scrolledCount) {\n this._removeGlobalListener();\n }\n };\n });\n }\n ngOnDestroy() {\n this._removeGlobalListener();\n this.scrollContainers.forEach((_, container) => this.deregister(container));\n this._scrolled.complete();\n }\n /**\n * Returns an observable that emits whenever any of the\n * scrollable ancestors of an element are scrolled.\n * @param elementOrElementRef Element whose ancestors to listen for.\n * @param auditTimeInMs Time to throttle the scroll events.\n */\n ancestorScrolled(elementOrElementRef, auditTimeInMs) {\n const ancestors = this.getAncestorScrollContainers(elementOrElementRef);\n return this.scrolled(auditTimeInMs).pipe(filter(target => {\n return !target || ancestors.indexOf(target) > -1;\n }));\n }\n /** Returns all registered Scrollables that contain the provided element. */\n getAncestorScrollContainers(elementOrElementRef) {\n const scrollingContainers = [];\n this.scrollContainers.forEach((_subscription, scrollable) => {\n if (this._scrollableContainsElement(scrollable, elementOrElementRef)) {\n scrollingContainers.push(scrollable);\n }\n });\n return scrollingContainers;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Returns true if the element is contained within the provided Scrollable. */\n _scrollableContainsElement(scrollable, elementOrElementRef) {\n let element = coerceElement(elementOrElementRef);\n let scrollableElement = scrollable.getElementRef().nativeElement;\n // Traverse through the element parents until we reach null, checking if any of the elements\n // are the scrollable's element.\n do {\n if (element == scrollableElement) {\n return true;\n }\n } while ((element = element.parentElement));\n return false;\n }\n /** Sets up the global scroll listeners. */\n _addGlobalListener() {\n this._globalSubscription = this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n return fromEvent(window.document, 'scroll').subscribe(() => this._scrolled.next());\n });\n }\n /** Cleans up the global scroll listener. */\n _removeGlobalListener() {\n if (this._globalSubscription) {\n this._globalSubscription.unsubscribe();\n this._globalSubscription = null;\n }\n }\n}\nScrollDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ScrollDispatcher, deps: [{ token: i0.NgZone }, { token: i1.Platform }, { token: DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nScrollDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ScrollDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ScrollDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i0.NgZone }, { type: i1.Platform }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Sends an event when the directive's element is scrolled. Registers itself with the\n * ScrollDispatcher service to include itself as part of its collection of scrolling events that it\n * can be listened to through the service.\n */\nclass CdkScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n this.elementRef = elementRef;\n this.scrollDispatcher = scrollDispatcher;\n this.ngZone = ngZone;\n this.dir = dir;\n this._destroyed = new Subject();\n this._elementScrolled = new Observable((observer) => this.ngZone.runOutsideAngular(() => fromEvent(this.elementRef.nativeElement, 'scroll')\n .pipe(takeUntil(this._destroyed))\n .subscribe(observer)));\n }\n ngOnInit() {\n this.scrollDispatcher.register(this);\n }\n ngOnDestroy() {\n this.scrollDispatcher.deregister(this);\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** Returns observable that emits when a scroll event is fired on the host element. */\n elementScrolled() {\n return this._elementScrolled;\n }\n /** Gets the ElementRef for the viewport. */\n getElementRef() {\n return this.elementRef;\n }\n /**\n * Scrolls to the specified offsets. This is a normalized version of the browser's native scrollTo\n * method, since browsers are not consistent about what scrollLeft means in RTL. For this method\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param options specified the offsets to scroll to.\n */\n scrollTo(options) {\n const el = this.elementRef.nativeElement;\n const isRtl = this.dir && this.dir.value == 'rtl';\n // Rewrite start & end offsets as right or left offsets.\n if (options.left == null) {\n options.left = isRtl ? options.end : options.start;\n }\n if (options.right == null) {\n options.right = isRtl ? options.start : options.end;\n }\n // Rewrite the bottom offset as a top offset.\n if (options.bottom != null) {\n options.top =\n el.scrollHeight - el.clientHeight - options.bottom;\n }\n // Rewrite the right offset as a left offset.\n if (isRtl && getRtlScrollAxisType() != 0 /* NORMAL */) {\n if (options.left != null) {\n options.right =\n el.scrollWidth - el.clientWidth - options.left;\n }\n if (getRtlScrollAxisType() == 2 /* INVERTED */) {\n options.left = options.right;\n }\n else if (getRtlScrollAxisType() == 1 /* NEGATED */) {\n options.left = options.right ? -options.right : options.right;\n }\n }\n else {\n if (options.right != null) {\n options.left =\n el.scrollWidth - el.clientWidth - options.right;\n }\n }\n this._applyScrollToOptions(options);\n }\n _applyScrollToOptions(options) {\n const el = this.elementRef.nativeElement;\n if (supportsScrollBehavior()) {\n el.scrollTo(options);\n }\n else {\n if (options.top != null) {\n el.scrollTop = options.top;\n }\n if (options.left != null) {\n el.scrollLeft = options.left;\n }\n }\n }\n /**\n * Measures the scroll offset relative to the specified edge of the viewport. This method can be\n * used instead of directly checking scrollLeft or scrollTop, since browsers are not consistent\n * about what scrollLeft means in RTL. The values returned by this method are normalized such that\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param from The edge to measure from.\n */\n measureScrollOffset(from) {\n const LEFT = 'left';\n const RIGHT = 'right';\n const el = this.elementRef.nativeElement;\n if (from == 'top') {\n return el.scrollTop;\n }\n if (from == 'bottom') {\n return el.scrollHeight - el.clientHeight - el.scrollTop;\n }\n // Rewrite start & end as left or right offsets.\n const isRtl = this.dir && this.dir.value == 'rtl';\n if (from == 'start') {\n from = isRtl ? RIGHT : LEFT;\n }\n else if (from == 'end') {\n from = isRtl ? LEFT : RIGHT;\n }\n if (isRtl && getRtlScrollAxisType() == 2 /* INVERTED */) {\n // For INVERTED, scrollLeft is (scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n else {\n return el.scrollLeft;\n }\n }\n else if (isRtl && getRtlScrollAxisType() == 1 /* NEGATED */) {\n // For NEGATED, scrollLeft is -(scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft + el.scrollWidth - el.clientWidth;\n }\n else {\n return -el.scrollLeft;\n }\n }\n else {\n // For NORMAL, as well as non-RTL contexts, scrollLeft is 0 when scrolled all the way left and\n // (scrollWidth - clientWidth) when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft;\n }\n else {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n }\n }\n}\nCdkScrollable.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkScrollable, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkScrollable.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: CdkScrollable, selector: \"[cdk-scrollable], [cdkScrollable]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkScrollable, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-scrollable], [cdkScrollable]',\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Time in ms to throttle the resize events by default. */\nconst DEFAULT_RESIZE_TIME = 20;\n/**\n * Simple utility for getting the bounds of the browser viewport.\n * @docs-private\n */\nclass ViewportRuler {\n constructor(_platform, ngZone, document) {\n this._platform = _platform;\n /** Stream of viewport change events. */\n this._change = new Subject();\n /** Event listener that will be used to handle the viewport change events. */\n this._changeListener = (event) => {\n this._change.next(event);\n };\n this._document = document;\n ngZone.runOutsideAngular(() => {\n if (_platform.isBrowser) {\n const window = this._getWindow();\n // Note that bind the events ourselves, rather than going through something like RxJS's\n // `fromEvent` so that we can ensure that they're bound outside of the NgZone.\n window.addEventListener('resize', this._changeListener);\n window.addEventListener('orientationchange', this._changeListener);\n }\n // Clear the cached position so that the viewport is re-measured next time it is required.\n // We don't need to keep track of the subscription, because it is completed on destroy.\n this.change().subscribe(() => (this._viewportSize = null));\n });\n }\n ngOnDestroy() {\n if (this._platform.isBrowser) {\n const window = this._getWindow();\n window.removeEventListener('resize', this._changeListener);\n window.removeEventListener('orientationchange', this._changeListener);\n }\n this._change.complete();\n }\n /** Returns the viewport's width and height. */\n getViewportSize() {\n if (!this._viewportSize) {\n this._updateViewportSize();\n }\n const output = { width: this._viewportSize.width, height: this._viewportSize.height };\n // If we're not on a browser, don't cache the size since it'll be mocked out anyway.\n if (!this._platform.isBrowser) {\n this._viewportSize = null;\n }\n return output;\n }\n /** Gets a ClientRect for the viewport's bounds. */\n getViewportRect() {\n // Use the document element's bounding rect rather than the window scroll properties\n // (e.g. pageYOffset, scrollY) due to in issue in Chrome and IE where window scroll\n // properties and client coordinates (boundingClientRect, clientX/Y, etc.) are in different\n // conceptual viewports. Under most circumstances these viewports are equivalent, but they\n // can disagree when the page is pinch-zoomed (on devices that support touch).\n // See https://bugs.chromium.org/p/chromium/issues/detail?id=489206#c4\n // We use the documentElement instead of the body because, by default (without a css reset)\n // browsers typically give the document body an 8px margin, which is not included in\n // getBoundingClientRect().\n const scrollPosition = this.getViewportScrollPosition();\n const { width, height } = this.getViewportSize();\n return {\n top: scrollPosition.top,\n left: scrollPosition.left,\n bottom: scrollPosition.top + height,\n right: scrollPosition.left + width,\n height,\n width,\n };\n }\n /** Gets the (top, left) scroll position of the viewport. */\n getViewportScrollPosition() {\n // While we can get a reference to the fake document\n // during SSR, it doesn't have getBoundingClientRect.\n if (!this._platform.isBrowser) {\n return { top: 0, left: 0 };\n }\n // The top-left-corner of the viewport is determined by the scroll position of the document\n // body, normally just (scrollLeft, scrollTop). However, Chrome and Firefox disagree about\n // whether `document.body` or `document.documentElement` is the scrolled element, so reading\n // `scrollTop` and `scrollLeft` is inconsistent. However, using the bounding rect of\n // `document.documentElement` works consistently, where the `top` and `left` values will\n // equal negative the scroll position.\n const document = this._document;\n const window = this._getWindow();\n const documentElement = document.documentElement;\n const documentRect = documentElement.getBoundingClientRect();\n const top = -documentRect.top ||\n document.body.scrollTop ||\n window.scrollY ||\n documentElement.scrollTop ||\n 0;\n const left = -documentRect.left ||\n document.body.scrollLeft ||\n window.scrollX ||\n documentElement.scrollLeft ||\n 0;\n return { top, left };\n }\n /**\n * Returns a stream that emits whenever the size of the viewport changes.\n * This stream emits outside of the Angular zone.\n * @param throttleTime Time in milliseconds to throttle the stream.\n */\n change(throttleTime = DEFAULT_RESIZE_TIME) {\n return throttleTime > 0 ? this._change.pipe(auditTime(throttleTime)) : this._change;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Updates the cached viewport size. */\n _updateViewportSize() {\n const window = this._getWindow();\n this._viewportSize = this._platform.isBrowser\n ? { width: window.innerWidth, height: window.innerHeight }\n : { width: 0, height: 0 };\n }\n}\nViewportRuler.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ViewportRuler, deps: [{ token: i1.Platform }, { token: i0.NgZone }, { token: DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nViewportRuler.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ViewportRuler, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ViewportRuler, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Checks if the given ranges are equal. */\nfunction rangesEqual(r1, r2) {\n return r1.start == r2.start && r1.end == r2.end;\n}\n/**\n * Scheduler to be used for scroll events. Needs to fall back to\n * something that doesn't rely on requestAnimationFrame on environments\n * that don't support it (e.g. server-side rendering).\n */\nconst SCROLL_SCHEDULER = typeof requestAnimationFrame !== 'undefined' ? animationFrameScheduler : asapScheduler;\n/** A viewport that virtualizes its scrolling with the help of `CdkVirtualForOf`. */\nclass CdkVirtualScrollViewport extends CdkScrollable {\n constructor(elementRef, _changeDetectorRef, ngZone, _scrollStrategy, dir, scrollDispatcher, viewportRuler) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n this.elementRef = elementRef;\n this._changeDetectorRef = _changeDetectorRef;\n this._scrollStrategy = _scrollStrategy;\n /** Emits when the viewport is detached from a CdkVirtualForOf. */\n this._detachedSubject = new Subject();\n /** Emits when the rendered range changes. */\n this._renderedRangeSubject = new Subject();\n this._orientation = 'vertical';\n this._appendOnly = false;\n // Note: we don't use the typical EventEmitter here because we need to subscribe to the scroll\n // strategy lazily (i.e. only if the user is actually listening to the events). We do this because\n // depending on how the strategy calculates the scrolled index, it may come at a cost to\n // performance.\n /** Emits when the index of the first element visible in the viewport changes. */\n this.scrolledIndexChange = new Observable((observer) => this._scrollStrategy.scrolledIndexChange.subscribe(index => Promise.resolve().then(() => this.ngZone.run(() => observer.next(index)))));\n /** A stream that emits whenever the rendered range changes. */\n this.renderedRangeStream = this._renderedRangeSubject;\n /**\n * The total size of all content (in pixels), including content that is not currently rendered.\n */\n this._totalContentSize = 0;\n /** A string representing the `style.width` property value to be used for the spacer element. */\n this._totalContentWidth = '';\n /** A string representing the `style.height` property value to be used for the spacer element. */\n this._totalContentHeight = '';\n /** The currently rendered range of indices. */\n this._renderedRange = { start: 0, end: 0 };\n /** The length of the data bound to this viewport (in number of items). */\n this._dataLength = 0;\n /** The size of the viewport (in pixels). */\n this._viewportSize = 0;\n /** The last rendered content offset that was set. */\n this._renderedContentOffset = 0;\n /**\n * Whether the last rendered content offset was to the end of the content (and therefore needs to\n * be rewritten as an offset to the start of the content).\n */\n this._renderedContentOffsetNeedsRewrite = false;\n /** Whether there is a pending change detection cycle. */\n this._isChangeDetectionPending = false;\n /** A list of functions to run after the next change detection cycle. */\n this._runAfterChangeDetection = [];\n /** Subscription to changes in the viewport size. */\n this._viewportChanges = Subscription.EMPTY;\n if (!_scrollStrategy && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Error: cdk-virtual-scroll-viewport requires the \"itemSize\" property to be set.');\n }\n this._viewportChanges = viewportRuler.change().subscribe(() => {\n this.checkViewportSize();\n });\n }\n /** The direction the viewport scrolls. */\n get orientation() {\n return this._orientation;\n }\n set orientation(orientation) {\n if (this._orientation !== orientation) {\n this._orientation = orientation;\n this._calculateSpacerSize();\n }\n }\n /**\n * Whether rendered items should persist in the DOM after scrolling out of view. By default, items\n * will be removed.\n */\n get appendOnly() {\n return this._appendOnly;\n }\n set appendOnly(value) {\n this._appendOnly = coerceBooleanProperty(value);\n }\n ngOnInit() {\n super.ngOnInit();\n // It's still too early to measure the viewport at this point. Deferring with a promise allows\n // the Viewport to be rendered with the correct size before we measure. We run this outside the\n // zone to avoid causing more change detection cycles. We handle the change detection loop\n // ourselves instead.\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._measureViewportSize();\n this._scrollStrategy.attach(this);\n this.elementScrolled()\n .pipe(\n // Start off with a fake scroll event so we properly detect our initial position.\n startWith(null), \n // Collect multiple events into one until the next animation frame. This way if\n // there are multiple scroll events in the same frame we only need to recheck\n // our layout once.\n auditTime(0, SCROLL_SCHEDULER))\n .subscribe(() => this._scrollStrategy.onContentScrolled());\n this._markChangeDetectionNeeded();\n }));\n }\n ngOnDestroy() {\n this.detach();\n this._scrollStrategy.detach();\n // Complete all subjects\n this._renderedRangeSubject.complete();\n this._detachedSubject.complete();\n this._viewportChanges.unsubscribe();\n super.ngOnDestroy();\n }\n /** Attaches a `CdkVirtualScrollRepeater` to this viewport. */\n attach(forOf) {\n if (this._forOf && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CdkVirtualScrollViewport is already attached.');\n }\n // Subscribe to the data stream of the CdkVirtualForOf to keep track of when the data length\n // changes. Run outside the zone to avoid triggering change detection, since we're managing the\n // change detection loop ourselves.\n this.ngZone.runOutsideAngular(() => {\n this._forOf = forOf;\n this._forOf.dataStream.pipe(takeUntil(this._detachedSubject)).subscribe(data => {\n const newLength = data.length;\n if (newLength !== this._dataLength) {\n this._dataLength = newLength;\n this._scrollStrategy.onDataLengthChanged();\n }\n this._doChangeDetection();\n });\n });\n }\n /** Detaches the current `CdkVirtualForOf`. */\n detach() {\n this._forOf = null;\n this._detachedSubject.next();\n }\n /** Gets the length of the data bound to this viewport (in number of items). */\n getDataLength() {\n return this._dataLength;\n }\n /** Gets the size of the viewport (in pixels). */\n getViewportSize() {\n return this._viewportSize;\n }\n // TODO(mmalerba): This is technically out of sync with what's really rendered until a render\n // cycle happens. I'm being careful to only call it after the render cycle is complete and before\n // setting it to something else, but its error prone and should probably be split into\n // `pendingRange` and `renderedRange`, the latter reflecting whats actually in the DOM.\n /** Get the current rendered range of items. */\n getRenderedRange() {\n return this._renderedRange;\n }\n /**\n * Sets the total size of all content (in pixels), including content that is not currently\n * rendered.\n */\n setTotalContentSize(size) {\n if (this._totalContentSize !== size) {\n this._totalContentSize = size;\n this._calculateSpacerSize();\n this._markChangeDetectionNeeded();\n }\n }\n /** Sets the currently rendered range of indices. */\n setRenderedRange(range) {\n if (!rangesEqual(this._renderedRange, range)) {\n if (this.appendOnly) {\n range = { start: 0, end: Math.max(this._renderedRange.end, range.end) };\n }\n this._renderedRangeSubject.next((this._renderedRange = range));\n this._markChangeDetectionNeeded(() => this._scrollStrategy.onContentRendered());\n }\n }\n /**\n * Gets the offset from the start of the viewport to the start of the rendered data (in pixels).\n */\n getOffsetToRenderedContentStart() {\n return this._renderedContentOffsetNeedsRewrite ? null : this._renderedContentOffset;\n }\n /**\n * Sets the offset from the start of the viewport to either the start or end of the rendered data\n * (in pixels).\n */\n setRenderedContentOffset(offset, to = 'to-start') {\n // For a horizontal viewport in a right-to-left language we need to translate along the x-axis\n // in the negative direction.\n const isRtl = this.dir && this.dir.value == 'rtl';\n const isHorizontal = this.orientation == 'horizontal';\n const axis = isHorizontal ? 'X' : 'Y';\n const axisDirection = isHorizontal && isRtl ? -1 : 1;\n let transform = `translate${axis}(${Number(axisDirection * offset)}px)`;\n // in appendOnly, we always start from the top\n offset = this.appendOnly && to === 'to-start' ? 0 : offset;\n this._renderedContentOffset = offset;\n if (to === 'to-end') {\n transform += ` translate${axis}(-100%)`;\n // The viewport should rewrite this as a `to-start` offset on the next render cycle. Otherwise\n // elements will appear to expand in the wrong direction (e.g. `mat-expansion-panel` would\n // expand upward).\n this._renderedContentOffsetNeedsRewrite = true;\n }\n if (this._renderedContentTransform != transform) {\n // We know this value is safe because we parse `offset` with `Number()` before passing it\n // into the string.\n this._renderedContentTransform = transform;\n this._markChangeDetectionNeeded(() => {\n if (this._renderedContentOffsetNeedsRewrite) {\n this._renderedContentOffset -= this.measureRenderedContentSize();\n this._renderedContentOffsetNeedsRewrite = false;\n this.setRenderedContentOffset(this._renderedContentOffset);\n }\n else {\n this._scrollStrategy.onRenderedOffsetChanged();\n }\n });\n }\n }\n /**\n * Scrolls to the given offset from the start of the viewport. Please note that this is not always\n * the same as setting `scrollTop` or `scrollLeft`. In a horizontal viewport with right-to-left\n * direction, this would be the equivalent of setting a fictional `scrollRight` property.\n * @param offset The offset to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToOffset(offset, behavior = 'auto') {\n const options = { behavior };\n if (this.orientation === 'horizontal') {\n options.start = offset;\n }\n else {\n options.top = offset;\n }\n this.scrollTo(options);\n }\n /**\n * Scrolls to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToIndex(index, behavior = 'auto') {\n this._scrollStrategy.scrollToIndex(index, behavior);\n }\n /**\n * Gets the current scroll offset from the start of the viewport (in pixels).\n * @param from The edge to measure the offset from. Defaults to 'top' in vertical mode and 'start'\n * in horizontal mode.\n */\n measureScrollOffset(from) {\n return from\n ? super.measureScrollOffset(from)\n : super.measureScrollOffset(this.orientation === 'horizontal' ? 'start' : 'top');\n }\n /** Measure the combined size of all of the rendered items. */\n measureRenderedContentSize() {\n const contentEl = this._contentWrapper.nativeElement;\n return this.orientation === 'horizontal' ? contentEl.offsetWidth : contentEl.offsetHeight;\n }\n /**\n * Measure the total combined size of the given range. Throws if the range includes items that are\n * not rendered.\n */\n measureRangeSize(range) {\n if (!this._forOf) {\n return 0;\n }\n return this._forOf.measureRangeSize(range, this.orientation);\n }\n /** Update the viewport dimensions and re-render. */\n checkViewportSize() {\n // TODO: Cleanup later when add logic for handling content resize\n this._measureViewportSize();\n this._scrollStrategy.onDataLengthChanged();\n }\n /** Measure the viewport size. */\n _measureViewportSize() {\n const viewportEl = this.elementRef.nativeElement;\n this._viewportSize =\n this.orientation === 'horizontal' ? viewportEl.clientWidth : viewportEl.clientHeight;\n }\n /** Queue up change detection to run. */\n _markChangeDetectionNeeded(runAfter) {\n if (runAfter) {\n this._runAfterChangeDetection.push(runAfter);\n }\n // Use a Promise to batch together calls to `_doChangeDetection`. This way if we set a bunch of\n // properties sequentially we only have to run `_doChangeDetection` once at the end.\n if (!this._isChangeDetectionPending) {\n this._isChangeDetectionPending = true;\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._doChangeDetection();\n }));\n }\n }\n /** Run change detection. */\n _doChangeDetection() {\n this._isChangeDetectionPending = false;\n // Apply the content transform. The transform can't be set via an Angular binding because\n // bypassSecurityTrustStyle is banned in Google. However the value is safe, it's composed of\n // string literals, a variable that can only be 'X' or 'Y', and user input that is run through\n // the `Number` function first to coerce it to a numeric value.\n this._contentWrapper.nativeElement.style.transform = this._renderedContentTransform;\n // Apply changes to Angular bindings. Note: We must call `markForCheck` to run change detection\n // from the root, since the repeated items are content projected in. Calling `detectChanges`\n // instead does not properly check the projected content.\n this.ngZone.run(() => this._changeDetectorRef.markForCheck());\n const runAfterChangeDetection = this._runAfterChangeDetection;\n this._runAfterChangeDetection = [];\n for (const fn of runAfterChangeDetection) {\n fn();\n }\n }\n /** Calculates the `style.width` and `style.height` for the spacer element. */\n _calculateSpacerSize() {\n this._totalContentHeight =\n this.orientation === 'horizontal' ? '' : `${this._totalContentSize}px`;\n this._totalContentWidth =\n this.orientation === 'horizontal' ? `${this._totalContentSize}px` : '';\n }\n}\nCdkVirtualScrollViewport.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkVirtualScrollViewport, deps: [{ token: i0.ElementRef }, { token: i0.ChangeDetectorRef }, { token: i0.NgZone }, { token: VIRTUAL_SCROLL_STRATEGY, optional: true }, { token: i2.Directionality, optional: true }, { token: ScrollDispatcher }, { token: ViewportRuler }], target: i0.ɵɵFactoryTarget.Component });\nCdkVirtualScrollViewport.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"12.0.0\", version: \"13.3.0\", type: CdkVirtualScrollViewport, selector: \"cdk-virtual-scroll-viewport\", inputs: { orientation: \"orientation\", appendOnly: \"appendOnly\" }, outputs: { scrolledIndexChange: \"scrolledIndexChange\" }, host: { properties: { \"class.cdk-virtual-scroll-orientation-horizontal\": \"orientation === \\\"horizontal\\\"\", \"class.cdk-virtual-scroll-orientation-vertical\": \"orientation !== \\\"horizontal\\\"\" }, classAttribute: \"cdk-virtual-scroll-viewport\" }, providers: [\n {\n provide: CdkScrollable,\n useExisting: CdkVirtualScrollViewport,\n },\n ], viewQueries: [{ propertyName: \"_contentWrapper\", first: true, predicate: [\"contentWrapper\"], descendants: true, static: true }], usesInheritance: true, ngImport: i0, template: \"\\n
\\n\\n\\n\", styles: [\"cdk-virtual-scroll-viewport{display:block;position:relative;overflow:auto;contain:strict;transform:translateZ(0);will-change:scroll-position;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{position:absolute;top:0;left:0;height:1px;width:1px;transform-origin:0 0}[dir=rtl] .cdk-virtual-scroll-spacer{right:0;left:auto;transform-origin:100% 0}\\n\"] }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.ChangeDetectorRef }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [VIRTUAL_SCROLL_STRATEGY]\n }] }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }, { type: ScrollDispatcher }, { type: ViewportRuler }]; }, propDecorators: { orientation: [{\n type: Input\n }], appendOnly: [{\n type: Input\n }], scrolledIndexChange: [{\n type: Output\n }], _contentWrapper: [{\n type: ViewChild,\n args: ['contentWrapper', { static: true }]\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Helper to extract the offset of a DOM Node in a certain direction. */\nfunction getOffset(orientation, direction, node) {\n const el = node;\n if (!el.getBoundingClientRect) {\n return 0;\n }\n const rect = el.getBoundingClientRect();\n if (orientation === 'horizontal') {\n return direction === 'start' ? rect.left : rect.right;\n }\n return direction === 'start' ? rect.top : rect.bottom;\n}\n/**\n * A directive similar to `ngForOf` to be used for rendering data inside a virtual scrolling\n * container.\n */\nclass CdkVirtualForOf {\n constructor(\n /** The view container to add items to. */\n _viewContainerRef, \n /** The template to use when stamping out new items. */\n _template, \n /** The set of available differs. */\n _differs, \n /** The strategy used to render items in the virtual scroll viewport. */\n _viewRepeater, \n /** The virtual scrolling viewport that these items are being rendered in. */\n _viewport, ngZone) {\n this._viewContainerRef = _viewContainerRef;\n this._template = _template;\n this._differs = _differs;\n this._viewRepeater = _viewRepeater;\n this._viewport = _viewport;\n /** Emits when the rendered view of the data changes. */\n this.viewChange = new Subject();\n /** Subject that emits when a new DataSource instance is given. */\n this._dataSourceChanges = new Subject();\n /** Emits whenever the data in the current DataSource changes. */\n this.dataStream = this._dataSourceChanges.pipe(\n // Start off with null `DataSource`.\n startWith(null), \n // Bundle up the previous and current data sources so we can work with both.\n pairwise(), \n // Use `_changeDataSource` to disconnect from the previous data source and connect to the\n // new one, passing back a stream of data changes which we run through `switchMap` to give\n // us a data stream that emits the latest data from whatever the current `DataSource` is.\n switchMap(([prev, cur]) => this._changeDataSource(prev, cur)), \n // Replay the last emitted data when someone subscribes.\n shareReplay(1));\n /** The differ used to calculate changes to the data. */\n this._differ = null;\n /** Whether the rendered data should be updated during the next ngDoCheck cycle. */\n this._needsUpdate = false;\n this._destroyed = new Subject();\n this.dataStream.subscribe(data => {\n this._data = data;\n this._onRenderedDataChange();\n });\n this._viewport.renderedRangeStream.pipe(takeUntil(this._destroyed)).subscribe(range => {\n this._renderedRange = range;\n if (this.viewChange.observers.length) {\n ngZone.run(() => this.viewChange.next(this._renderedRange));\n }\n this._onRenderedDataChange();\n });\n this._viewport.attach(this);\n }\n /** The DataSource to display. */\n get cdkVirtualForOf() {\n return this._cdkVirtualForOf;\n }\n set cdkVirtualForOf(value) {\n this._cdkVirtualForOf = value;\n if (isDataSource(value)) {\n this._dataSourceChanges.next(value);\n }\n else {\n // If value is an an NgIterable, convert it to an array.\n this._dataSourceChanges.next(new ArrayDataSource(isObservable(value) ? value : Array.from(value || [])));\n }\n }\n /**\n * The `TrackByFunction` to use for tracking changes. The `TrackByFunction` takes the index and\n * the item and produces a value to be used as the item's identity when tracking changes.\n */\n get cdkVirtualForTrackBy() {\n return this._cdkVirtualForTrackBy;\n }\n set cdkVirtualForTrackBy(fn) {\n this._needsUpdate = true;\n this._cdkVirtualForTrackBy = fn\n ? (index, item) => fn(index + (this._renderedRange ? this._renderedRange.start : 0), item)\n : undefined;\n }\n /** The template used to stamp out new elements. */\n set cdkVirtualForTemplate(value) {\n if (value) {\n this._needsUpdate = true;\n this._template = value;\n }\n }\n /**\n * The size of the cache used to store templates that are not being used for re-use later.\n * Setting the cache size to `0` will disable caching. Defaults to 20 templates.\n */\n get cdkVirtualForTemplateCacheSize() {\n return this._viewRepeater.viewCacheSize;\n }\n set cdkVirtualForTemplateCacheSize(size) {\n this._viewRepeater.viewCacheSize = coerceNumberProperty(size);\n }\n /**\n * Measures the combined size (width for horizontal orientation, height for vertical) of all items\n * in the specified range. Throws an error if the range includes items that are not currently\n * rendered.\n */\n measureRangeSize(range, orientation) {\n if (range.start >= range.end) {\n return 0;\n }\n if ((range.start < this._renderedRange.start || range.end > this._renderedRange.end) &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error(`Error: attempted to measure an item that isn't rendered.`);\n }\n // The index into the list of rendered views for the first item in the range.\n const renderedStartIndex = range.start - this._renderedRange.start;\n // The length of the range we're measuring.\n const rangeLen = range.end - range.start;\n // Loop over all the views, find the first and land node and compute the size by subtracting\n // the top of the first node from the bottom of the last one.\n let firstNode;\n let lastNode;\n // Find the first node by starting from the beginning and going forwards.\n for (let i = 0; i < rangeLen; i++) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n firstNode = lastNode = view.rootNodes[0];\n break;\n }\n }\n // Find the last node by starting from the end and going backwards.\n for (let i = rangeLen - 1; i > -1; i--) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n lastNode = view.rootNodes[view.rootNodes.length - 1];\n break;\n }\n }\n return firstNode && lastNode\n ? getOffset(orientation, 'end', lastNode) - getOffset(orientation, 'start', firstNode)\n : 0;\n }\n ngDoCheck() {\n if (this._differ && this._needsUpdate) {\n // TODO(mmalerba): We should differentiate needs update due to scrolling and a new portion of\n // this list being rendered (can use simpler algorithm) vs needs update due to data actually\n // changing (need to do this diff).\n const changes = this._differ.diff(this._renderedItems);\n if (!changes) {\n this._updateContext();\n }\n else {\n this._applyChanges(changes);\n }\n this._needsUpdate = false;\n }\n }\n ngOnDestroy() {\n this._viewport.detach();\n this._dataSourceChanges.next(undefined);\n this._dataSourceChanges.complete();\n this.viewChange.complete();\n this._destroyed.next();\n this._destroyed.complete();\n this._viewRepeater.detach();\n }\n /** React to scroll state changes in the viewport. */\n _onRenderedDataChange() {\n if (!this._renderedRange) {\n return;\n }\n this._renderedItems = this._data.slice(this._renderedRange.start, this._renderedRange.end);\n if (!this._differ) {\n // Use a wrapper function for the `trackBy` so any new values are\n // picked up automatically without having to recreate the differ.\n this._differ = this._differs.find(this._renderedItems).create((index, item) => {\n return this.cdkVirtualForTrackBy ? this.cdkVirtualForTrackBy(index, item) : item;\n });\n }\n this._needsUpdate = true;\n }\n /** Swap out one `DataSource` for another. */\n _changeDataSource(oldDs, newDs) {\n if (oldDs) {\n oldDs.disconnect(this);\n }\n this._needsUpdate = true;\n return newDs ? newDs.connect(this) : of();\n }\n /** Update the `CdkVirtualForOfContext` for all views. */\n _updateContext() {\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n view.detectChanges();\n }\n }\n /** Apply changes to the DOM. */\n _applyChanges(changes) {\n this._viewRepeater.applyChanges(changes, this._viewContainerRef, (record, _adjustedPreviousIndex, currentIndex) => this._getEmbeddedViewArgs(record, currentIndex), record => record.item);\n // Update $implicit for any items that had an identity change.\n changes.forEachIdentityChange((record) => {\n const view = this._viewContainerRef.get(record.currentIndex);\n view.context.$implicit = record.item;\n });\n // Update the context variables on all items.\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n }\n }\n /** Update the computed properties on the `CdkVirtualForOfContext`. */\n _updateComputedContextProperties(context) {\n context.first = context.index === 0;\n context.last = context.index === context.count - 1;\n context.even = context.index % 2 === 0;\n context.odd = !context.even;\n }\n _getEmbeddedViewArgs(record, index) {\n // Note that it's important that we insert the item directly at the proper index,\n // rather than inserting it and the moving it in place, because if there's a directive\n // on the same node that injects the `ViewContainerRef`, Angular will insert another\n // comment node which can throw off the move when it's being repeated for all items.\n return {\n templateRef: this._template,\n context: {\n $implicit: record.item,\n // It's guaranteed that the iterable is not \"undefined\" or \"null\" because we only\n // generate views for elements if the \"cdkVirtualForOf\" iterable has elements.\n cdkVirtualForOf: this._cdkVirtualForOf,\n index: -1,\n count: -1,\n first: false,\n last: false,\n odd: false,\n even: false,\n },\n index,\n };\n }\n}\nCdkVirtualForOf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkVirtualForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }, { token: _VIEW_REPEATER_STRATEGY }, { token: CdkVirtualScrollViewport, skipSelf: true }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive });\nCdkVirtualForOf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"13.3.0\", type: CdkVirtualForOf, selector: \"[cdkVirtualFor][cdkVirtualForOf]\", inputs: { cdkVirtualForOf: \"cdkVirtualForOf\", cdkVirtualForTrackBy: \"cdkVirtualForTrackBy\", cdkVirtualForTemplate: \"cdkVirtualForTemplate\", cdkVirtualForTemplateCacheSize: \"cdkVirtualForTemplateCacheSize\" }, providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkVirtualForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkVirtualFor][cdkVirtualForOf]',\n providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }],\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }, { type: i2$1._RecycleViewRepeaterStrategy, decorators: [{\n type: Inject,\n args: [_VIEW_REPEATER_STRATEGY]\n }] }, { type: CdkVirtualScrollViewport, decorators: [{\n type: SkipSelf\n }] }, { type: i0.NgZone }]; }, propDecorators: { cdkVirtualForOf: [{\n type: Input\n }], cdkVirtualForTrackBy: [{\n type: Input\n }], cdkVirtualForTemplate: [{\n type: Input\n }], cdkVirtualForTemplateCacheSize: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass CdkScrollableModule {\n}\nCdkScrollableModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkScrollableModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCdkScrollableModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkScrollableModule, declarations: [CdkScrollable], exports: [CdkScrollable] });\nCdkScrollableModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkScrollableModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: CdkScrollableModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkScrollable],\n declarations: [CdkScrollable],\n }]\n }] });\n/**\n * @docs-primary-export\n */\nclass ScrollingModule {\n}\nScrollingModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ScrollingModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nScrollingModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ScrollingModule, declarations: [CdkFixedSizeVirtualScroll, CdkVirtualForOf, CdkVirtualScrollViewport], imports: [BidiModule, CdkScrollableModule], exports: [BidiModule, CdkScrollableModule, CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport] });\nScrollingModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ScrollingModule, imports: [[BidiModule, CdkScrollableModule], BidiModule, CdkScrollableModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"13.3.0\", ngImport: i0, type: ScrollingModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [BidiModule, CdkScrollableModule],\n exports: [\n BidiModule,\n CdkScrollableModule,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n ],\n declarations: [CdkFixedSizeVirtualScroll, CdkVirtualForOf, CdkVirtualScrollViewport],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkFixedSizeVirtualScroll, CdkScrollable, CdkScrollableModule, CdkVirtualForOf, CdkVirtualScrollViewport, DEFAULT_RESIZE_TIME, DEFAULT_SCROLL_TIME, FixedSizeVirtualScrollStrategy, ScrollDispatcher, ScrollingModule, VIRTUAL_SCROLL_STRATEGY, ViewportRuler, _fixedSizeVirtualScrollStrategyFactory };\n","/**\n * @license Angular v15.2.9\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { InjectionToken, Injectable, ɵɵinject, Inject, inject, Optional, EventEmitter, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵstringify, Directive, Input, createNgModule, NgModuleRef, ɵRuntimeError, Host, Attribute, RendererStyleFlags2, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, NgModule, Version, ɵɵdefineInjectable, ɵformatRuntimeError, Renderer2, ElementRef, Injector, PLATFORM_ID, NgZone } from '@angular/core';\n\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setRootDomAdapter(adapter) {\n if (!_DOM) {\n _DOM = adapter;\n }\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * A DI Token representing the main rendering context.\n * In a browser and SSR this is the DOM Document.\n * When using SSR, that document is created by [Domino](https://github.com/angular/domino).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken('DocumentToken');\n\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: useBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: useBrowserPlatformLocation\n }]\n }] });\nfunction useBrowserPlatformLocation() {\n return ɵɵinject(BrowserPlatformLocation);\n}\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken('Location Initialized');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * @publicApi\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor(_doc) {\n super();\n this._doc = _doc;\n this._location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this._location.href;\n }\n get protocol() {\n return this._location.protocol;\n }\n get hostname() {\n return this._location.hostname;\n }\n get port() {\n return this._location.port;\n }\n get pathname() {\n return this._location.pathname;\n }\n get search() {\n return this._location.search;\n }\n get hash() {\n return this._location.hash;\n }\n set pathname(newPath) {\n this._location.pathname = newPath;\n }\n pushState(state, title, url) {\n if (supportsState()) {\n this._history.pushState(state, title, url);\n }\n else {\n this._location.hash = url;\n }\n }\n replaceState(state, title, url) {\n if (supportsState()) {\n this._history.replaceState(state, title, url);\n }\n else {\n this._location.hash = url;\n }\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n}\nBrowserPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserPlatformLocation, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBrowserPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: createBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: createBrowserPlatformLocation,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\nfunction supportsState() {\n return !!window.history.pushState;\n}\nfunction createBrowserPlatformLocation() {\n return new BrowserPlatformLocation(ɵɵinject(DOCUMENT));\n}\n\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = match && match.index || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com#/foo,\n * and `PathLocationStrategy` produces\n * http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: () => inject(PathLocationStrategy) });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }]\n }] });\n/**\n * A predefined [DI token](guide/glossary#di-token) for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {Component, NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken('appBaseHref');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you may provide a {@link APP_BASE_HREF}\n * or add a `` element to the document to override the default.\n *\n * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,\n * the `` and/or `APP_BASE_HREF` should end with a `/`.\n *\n * Similarly, if you add `` to the document and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`.\n *\n * Note that when using `PathLocationStrategy`, neither the query nor\n * the fragment in the `` will be preserved, as outlined\n * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass PathLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, href) {\n super();\n this._platformLocation = _platformLocation;\n this._removeListenerFns = [];\n this._baseHref = href ?? this._platformLocation.getBaseHrefFromDOM() ??\n inject(DOCUMENT).location?.origin ?? '';\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n prepareExternalUrl(internal) {\n return joinWithSlash(this._baseHref, internal);\n }\n path(includeHash = false) {\n const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);\n const hash = this._platformLocation.hash;\n return hash && includeHash ? `${pathname}${hash}` : pathname;\n }\n pushState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.pushState(state, title, externalUrl);\n }\n replaceState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.replaceState(state, title, externalUrl);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n}\nPathLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PathLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nPathLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PathLocationStrategy, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PathLocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; } });\n\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)\n * of the browser's URL.\n *\n * For instance, if you call `location.go('/foo')`, the browser's URL will become\n * `example.com#/foo`.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/hash_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass HashLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, _baseHref) {\n super();\n this._platformLocation = _platformLocation;\n this._baseHref = '';\n this._removeListenerFns = [];\n if (_baseHref != null) {\n this._baseHref = _baseHref;\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n path(includeHash = false) {\n // the hash value is always prefixed with a `#`\n // and if it is empty then it will stay empty\n let path = this._platformLocation.hash;\n if (path == null)\n path = '#';\n return path.length > 0 ? path.substring(1) : path;\n }\n prepareExternalUrl(internal) {\n const url = joinWithSlash(this._baseHref, internal);\n return url.length > 0 ? ('#' + url) : url;\n }\n pushState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.pushState(state, title, url);\n }\n replaceState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.replaceState(state, title, url);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n}\nHashLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HashLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nHashLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HashLocationStrategy });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HashLocationStrategy, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; } });\n\n/**\n * @description\n *\n * A service that applications can use to interact with a browser's URL.\n *\n * Depending on the `LocationStrategy` used, `Location` persists\n * to the URL's path or the URL's hash segment.\n *\n * @usageNotes\n *\n * It's better to use the `Router.navigate()` service to trigger route changes. Use\n * `Location` only if you need to interact with or create normalized URLs outside of\n * routing.\n *\n * `Location` is responsible for normalizing the URL against the application's base href.\n * A normalized URL is absolute from the URL host, includes the application's base href, and has no\n * trailing slash:\n * - `/my/app/user/123` is normalized\n * - `my/app/user/123` **is not** normalized\n * - `/my/app/user/123/` **is not** normalized\n *\n * ### Example\n *\n * \n *\n * @publicApi\n */\nclass Location {\n constructor(locationStrategy) {\n /** @internal */\n this._subject = new EventEmitter();\n /** @internal */\n this._urlChangeListeners = [];\n /** @internal */\n this._urlChangeSubscription = null;\n this._locationStrategy = locationStrategy;\n const baseHref = this._locationStrategy.getBaseHref();\n // Note: This class's interaction with base HREF does not fully follow the rules\n // outlined in the spec https://www.freesoft.org/CIE/RFC/1808/18.htm.\n // Instead of trying to fix individual bugs with more and more code, we should\n // investigate using the URL constructor and providing the base as a second\n // argument.\n // https://developer.mozilla.org/en-US/docs/Web/API/URL/URL#parameters\n this._basePath = _stripOrigin(stripTrailingSlash(_stripIndexHtml(baseHref)));\n this._locationStrategy.onPopState((ev) => {\n this._subject.emit({\n 'url': this.path(true),\n 'pop': true,\n 'state': ev.state,\n 'type': ev.type,\n });\n });\n }\n /** @nodoc */\n ngOnDestroy() {\n this._urlChangeSubscription?.unsubscribe();\n this._urlChangeListeners = [];\n }\n /**\n * Normalizes the URL path for this location.\n *\n * @param includeHash True to include an anchor fragment in the path.\n *\n * @returns The normalized URL path.\n */\n // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is\n // removed.\n path(includeHash = false) {\n return this.normalize(this._locationStrategy.path(includeHash));\n }\n /**\n * Reports the current state of the location history.\n * @returns The current value of the `history.state` object.\n */\n getState() {\n return this._locationStrategy.getState();\n }\n /**\n * Normalizes the given path and compares to the current normalized path.\n *\n * @param path The given URL path.\n * @param query Query parameters.\n *\n * @returns True if the given URL path is equal to the current normalized path, false\n * otherwise.\n */\n isCurrentPathEqualTo(path, query = '') {\n return this.path() == this.normalize(path + normalizeQueryParams(query));\n }\n /**\n * Normalizes a URL path by stripping any trailing slashes.\n *\n * @param url String representing a URL.\n *\n * @returns The normalized URL string.\n */\n normalize(url) {\n return Location.stripTrailingSlash(_stripBasePath(this._basePath, _stripIndexHtml(url)));\n }\n /**\n * Normalizes an external URL path.\n * If the given URL doesn't begin with a leading slash (`'/'`), adds one\n * before normalizing. Adds a hash if `HashLocationStrategy` is\n * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.\n *\n * @param url String representing a URL.\n *\n * @returns A normalized platform-specific URL.\n */\n prepareExternalUrl(url) {\n if (url && url[0] !== '/') {\n url = '/' + url;\n }\n return this._locationStrategy.prepareExternalUrl(url);\n }\n // TODO: rename this method to pushState\n /**\n * Changes the browser's URL to a normalized version of a given URL, and pushes a\n * new item onto the platform's history.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n *\n */\n go(path, query = '', state = null) {\n this._locationStrategy.pushState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Changes the browser's URL to a normalized version of the given URL, and replaces\n * the top item on the platform's history stack.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n */\n replaceState(path, query = '', state = null) {\n this._locationStrategy.replaceState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Navigates forward in the platform's history.\n */\n forward() {\n this._locationStrategy.forward();\n }\n /**\n * Navigates back in the platform's history.\n */\n back() {\n this._locationStrategy.back();\n }\n /**\n * Navigate to a specific page from session history, identified by its relative position to the\n * current page.\n *\n * @param relativePosition Position of the target page in the history relative to the current\n * page.\n * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`\n * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go\n * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs\n * when `relativePosition` equals 0.\n * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history\n */\n historyGo(relativePosition = 0) {\n this._locationStrategy.historyGo?.(relativePosition);\n }\n /**\n * Registers a URL change listener. Use to catch updates performed by the Angular\n * framework that are not detectible through \"popstate\" or \"hashchange\" events.\n *\n * @param fn The change handler function, which take a URL and a location history state.\n * @returns A function that, when executed, unregisters a URL change listener.\n */\n onUrlChange(fn) {\n this._urlChangeListeners.push(fn);\n if (!this._urlChangeSubscription) {\n this._urlChangeSubscription = this.subscribe(v => {\n this._notifyUrlChangeListeners(v.url, v.state);\n });\n }\n return () => {\n const fnIndex = this._urlChangeListeners.indexOf(fn);\n this._urlChangeListeners.splice(fnIndex, 1);\n if (this._urlChangeListeners.length === 0) {\n this._urlChangeSubscription?.unsubscribe();\n this._urlChangeSubscription = null;\n }\n };\n }\n /** @internal */\n _notifyUrlChangeListeners(url = '', state) {\n this._urlChangeListeners.forEach(fn => fn(url, state));\n }\n /**\n * Subscribes to the platform's `popState` events.\n *\n * Note: `Location.go()` does not trigger the `popState` event in the browser. Use\n * `Location.onUrlChange()` to subscribe to URL changes instead.\n *\n * @param value Event that is triggered when the state history changes.\n * @param exception The exception to throw.\n *\n * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)\n *\n * @returns Subscribed events.\n */\n subscribe(onNext, onThrow, onReturn) {\n return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });\n }\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nLocation.normalizeQueryParams = normalizeQueryParams;\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nLocation.joinWithSlash = joinWithSlash;\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nLocation.stripTrailingSlash = stripTrailingSlash;\nLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: Location, deps: [{ token: LocationStrategy }], target: i0.ɵɵFactoryTarget.Injectable });\nLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: Location, providedIn: 'root', useFactory: createLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: Location, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n // See #23917\n useFactory: createLocation,\n }]\n }], ctorParameters: function () { return [{ type: LocationStrategy }]; } });\nfunction createLocation() {\n return new Location(ɵɵinject(LocationStrategy));\n}\nfunction _stripBasePath(basePath, url) {\n if (!basePath || !url.startsWith(basePath)) {\n return url;\n }\n const strippedUrl = url.substring(basePath.length);\n if (strippedUrl === '' || ['/', ';', '?', '#'].includes(strippedUrl[0])) {\n return strippedUrl;\n }\n return url;\n}\nfunction _stripIndexHtml(url) {\n return url.replace(/\\/index.html$/, '');\n}\nfunction _stripOrigin(baseHref) {\n // DO NOT REFACTOR! Previously, this check looked like this:\n // `/^(https?:)?\\/\\//.test(baseHref)`, but that resulted in\n // syntactically incorrect code after Closure Compiler minification.\n // This was likely caused by a bug in Closure Compiler, but\n // for now, the check is rewritten to use `new RegExp` instead.\n const isAbsoluteUrl = (new RegExp('^(https?:)?//')).test(baseHref);\n if (isAbsoluteUrl) {\n const [, pathname] = baseHref.split(/\\/\\/[^\\/]+/);\n return pathname;\n }\n return baseHref;\n}\n\n/** @internal */\nconst CURRENCIES_EN = { \"ADP\": [undefined, undefined, 0], \"AFN\": [undefined, \"؋\", 0], \"ALL\": [undefined, undefined, 0], \"AMD\": [undefined, \"֏\", 2], \"AOA\": [undefined, \"Kz\"], \"ARS\": [undefined, \"$\"], \"AUD\": [\"A$\", \"$\"], \"AZN\": [undefined, \"₼\"], \"BAM\": [undefined, \"KM\"], \"BBD\": [undefined, \"$\"], \"BDT\": [undefined, \"৳\"], \"BHD\": [undefined, undefined, 3], \"BIF\": [undefined, undefined, 0], \"BMD\": [undefined, \"$\"], \"BND\": [undefined, \"$\"], \"BOB\": [undefined, \"Bs\"], \"BRL\": [\"R$\"], \"BSD\": [undefined, \"$\"], \"BWP\": [undefined, \"P\"], \"BYN\": [undefined, undefined, 2], \"BYR\": [undefined, undefined, 0], \"BZD\": [undefined, \"$\"], \"CAD\": [\"CA$\", \"$\", 2], \"CHF\": [undefined, undefined, 2], \"CLF\": [undefined, undefined, 4], \"CLP\": [undefined, \"$\", 0], \"CNY\": [\"CN¥\", \"¥\"], \"COP\": [undefined, \"$\", 2], \"CRC\": [undefined, \"₡\", 2], \"CUC\": [undefined, \"$\"], \"CUP\": [undefined, \"$\"], \"CZK\": [undefined, \"Kč\", 2], \"DJF\": [undefined, undefined, 0], \"DKK\": [undefined, \"kr\", 2], \"DOP\": [undefined, \"$\"], \"EGP\": [undefined, \"E£\"], \"ESP\": [undefined, \"₧\", 0], \"EUR\": [\"€\"], \"FJD\": [undefined, \"$\"], \"FKP\": [undefined, \"£\"], \"GBP\": [\"£\"], \"GEL\": [undefined, \"₾\"], \"GHS\": [undefined, \"GH₵\"], \"GIP\": [undefined, \"£\"], \"GNF\": [undefined, \"FG\", 0], \"GTQ\": [undefined, \"Q\"], \"GYD\": [undefined, \"$\", 2], \"HKD\": [\"HK$\", \"$\"], \"HNL\": [undefined, \"L\"], \"HRK\": [undefined, \"kn\"], \"HUF\": [undefined, \"Ft\", 2], \"IDR\": [undefined, \"Rp\", 2], \"ILS\": [\"₪\"], \"INR\": [\"₹\"], \"IQD\": [undefined, undefined, 0], \"IRR\": [undefined, undefined, 0], \"ISK\": [undefined, \"kr\", 0], \"ITL\": [undefined, undefined, 0], \"JMD\": [undefined, \"$\"], \"JOD\": [undefined, undefined, 3], \"JPY\": [\"¥\", undefined, 0], \"KHR\": [undefined, \"៛\"], \"KMF\": [undefined, \"CF\", 0], \"KPW\": [undefined, \"₩\", 0], \"KRW\": [\"₩\", undefined, 0], \"KWD\": [undefined, undefined, 3], \"KYD\": [undefined, \"$\"], \"KZT\": [undefined, \"₸\"], \"LAK\": [undefined, \"₭\", 0], \"LBP\": [undefined, \"L£\", 0], \"LKR\": [undefined, \"Rs\"], \"LRD\": [undefined, \"$\"], \"LTL\": [undefined, \"Lt\"], \"LUF\": [undefined, undefined, 0], \"LVL\": [undefined, \"Ls\"], \"LYD\": [undefined, undefined, 3], \"MGA\": [undefined, \"Ar\", 0], \"MGF\": [undefined, undefined, 0], \"MMK\": [undefined, \"K\", 0], \"MNT\": [undefined, \"₮\", 2], \"MRO\": [undefined, undefined, 0], \"MUR\": [undefined, \"Rs\", 2], \"MXN\": [\"MX$\", \"$\"], \"MYR\": [undefined, \"RM\"], \"NAD\": [undefined, \"$\"], \"NGN\": [undefined, \"₦\"], \"NIO\": [undefined, \"C$\"], \"NOK\": [undefined, \"kr\", 2], \"NPR\": [undefined, \"Rs\"], \"NZD\": [\"NZ$\", \"$\"], \"OMR\": [undefined, undefined, 3], \"PHP\": [\"₱\"], \"PKR\": [undefined, \"Rs\", 2], \"PLN\": [undefined, \"zł\"], \"PYG\": [undefined, \"₲\", 0], \"RON\": [undefined, \"lei\"], \"RSD\": [undefined, undefined, 0], \"RUB\": [undefined, \"₽\"], \"RWF\": [undefined, \"RF\", 0], \"SBD\": [undefined, \"$\"], \"SEK\": [undefined, \"kr\", 2], \"SGD\": [undefined, \"$\"], \"SHP\": [undefined, \"£\"], \"SLE\": [undefined, undefined, 2], \"SLL\": [undefined, undefined, 0], \"SOS\": [undefined, undefined, 0], \"SRD\": [undefined, \"$\"], \"SSP\": [undefined, \"£\"], \"STD\": [undefined, undefined, 0], \"STN\": [undefined, \"Db\"], \"SYP\": [undefined, \"£\", 0], \"THB\": [undefined, \"฿\"], \"TMM\": [undefined, undefined, 0], \"TND\": [undefined, undefined, 3], \"TOP\": [undefined, \"T$\"], \"TRL\": [undefined, undefined, 0], \"TRY\": [undefined, \"₺\"], \"TTD\": [undefined, \"$\"], \"TWD\": [\"NT$\", \"$\", 2], \"TZS\": [undefined, undefined, 2], \"UAH\": [undefined, \"₴\"], \"UGX\": [undefined, undefined, 0], \"USD\": [\"$\"], \"UYI\": [undefined, undefined, 0], \"UYU\": [undefined, \"$\"], \"UYW\": [undefined, undefined, 4], \"UZS\": [undefined, undefined, 2], \"VEF\": [undefined, \"Bs\", 2], \"VND\": [\"₫\", undefined, 0], \"VUV\": [undefined, undefined, 0], \"XAF\": [\"FCFA\", undefined, 0], \"XCD\": [\"EC$\", \"$\"], \"XOF\": [\"F CFA\", undefined, 0], \"XPF\": [\"CFPF\", undefined, 0], \"XXX\": [\"¤\"], \"YER\": [undefined, undefined, 0], \"ZAR\": [undefined, \"R\"], \"ZMK\": [undefined, undefined, 0], \"ZMW\": [undefined, \"ZK\"], \"ZWD\": [undefined, undefined, 0] };\n\n/**\n * Format styles that can be used to represent numbers.\n * @see `getLocaleNumberFormat()`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberFormatStyle;\n(function (NumberFormatStyle) {\n NumberFormatStyle[NumberFormatStyle[\"Decimal\"] = 0] = \"Decimal\";\n NumberFormatStyle[NumberFormatStyle[\"Percent\"] = 1] = \"Percent\";\n NumberFormatStyle[NumberFormatStyle[\"Currency\"] = 2] = \"Currency\";\n NumberFormatStyle[NumberFormatStyle[\"Scientific\"] = 3] = \"Scientific\";\n})(NumberFormatStyle || (NumberFormatStyle = {}));\n/**\n * Plurality cases used for translating plurals to different languages.\n *\n * @see `NgPlural`\n * @see `NgPluralCase`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar Plural;\n(function (Plural) {\n Plural[Plural[\"Zero\"] = 0] = \"Zero\";\n Plural[Plural[\"One\"] = 1] = \"One\";\n Plural[Plural[\"Two\"] = 2] = \"Two\";\n Plural[Plural[\"Few\"] = 3] = \"Few\";\n Plural[Plural[\"Many\"] = 4] = \"Many\";\n Plural[Plural[\"Other\"] = 5] = \"Other\";\n})(Plural || (Plural = {}));\n/**\n * Context-dependant translation forms for strings.\n * Typically the standalone version is for the nominative form of the word,\n * and the format version is used for the genitive case.\n * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar FormStyle;\n(function (FormStyle) {\n FormStyle[FormStyle[\"Format\"] = 0] = \"Format\";\n FormStyle[FormStyle[\"Standalone\"] = 1] = \"Standalone\";\n})(FormStyle || (FormStyle = {}));\n/**\n * String widths available for translations.\n * The specific character widths are locale-specific.\n * Examples are given for the word \"Sunday\" in English.\n *\n * @publicApi\n */\nvar TranslationWidth;\n(function (TranslationWidth) {\n /** 1 character for `en-US`. For example: 'S' */\n TranslationWidth[TranslationWidth[\"Narrow\"] = 0] = \"Narrow\";\n /** 3 characters for `en-US`. For example: 'Sun' */\n TranslationWidth[TranslationWidth[\"Abbreviated\"] = 1] = \"Abbreviated\";\n /** Full length for `en-US`. For example: \"Sunday\" */\n TranslationWidth[TranslationWidth[\"Wide\"] = 2] = \"Wide\";\n /** 2 characters for `en-US`, For example: \"Su\" */\n TranslationWidth[TranslationWidth[\"Short\"] = 3] = \"Short\";\n})(TranslationWidth || (TranslationWidth = {}));\n/**\n * String widths available for date-time formats.\n * The specific character widths are locale-specific.\n * Examples are given for `en-US`.\n *\n * @see `getLocaleDateFormat()`\n * @see `getLocaleTimeFormat()`\n * @see `getLocaleDateTimeFormat()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n */\nvar FormatWidth;\n(function (FormatWidth) {\n /**\n * For `en-US`, 'M/d/yy, h:mm a'`\n * (Example: `6/15/15, 9:03 AM`)\n */\n FormatWidth[FormatWidth[\"Short\"] = 0] = \"Short\";\n /**\n * For `en-US`, `'MMM d, y, h:mm:ss a'`\n * (Example: `Jun 15, 2015, 9:03:01 AM`)\n */\n FormatWidth[FormatWidth[\"Medium\"] = 1] = \"Medium\";\n /**\n * For `en-US`, `'MMMM d, y, h:mm:ss a z'`\n * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)\n */\n FormatWidth[FormatWidth[\"Long\"] = 2] = \"Long\";\n /**\n * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`\n * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)\n */\n FormatWidth[FormatWidth[\"Full\"] = 3] = \"Full\";\n})(FormatWidth || (FormatWidth = {}));\n/**\n * Symbols that can be used to replace placeholders in number patterns.\n * Examples are based on `en-US` values.\n *\n * @see `getLocaleNumberSymbol()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberSymbol;\n(function (NumberSymbol) {\n /**\n * Decimal separator.\n * For `en-US`, the dot character.\n * Example: 2,345`.`67\n */\n NumberSymbol[NumberSymbol[\"Decimal\"] = 0] = \"Decimal\";\n /**\n * Grouping separator, typically for thousands.\n * For `en-US`, the comma character.\n * Example: 2`,`345.67\n */\n NumberSymbol[NumberSymbol[\"Group\"] = 1] = \"Group\";\n /**\n * List-item separator.\n * Example: \"one, two, and three\"\n */\n NumberSymbol[NumberSymbol[\"List\"] = 2] = \"List\";\n /**\n * Sign for percentage (out of 100).\n * Example: 23.4%\n */\n NumberSymbol[NumberSymbol[\"PercentSign\"] = 3] = \"PercentSign\";\n /**\n * Sign for positive numbers.\n * Example: +23\n */\n NumberSymbol[NumberSymbol[\"PlusSign\"] = 4] = \"PlusSign\";\n /**\n * Sign for negative numbers.\n * Example: -23\n */\n NumberSymbol[NumberSymbol[\"MinusSign\"] = 5] = \"MinusSign\";\n /**\n * Computer notation for exponential value (n times a power of 10).\n * Example: 1.2E3\n */\n NumberSymbol[NumberSymbol[\"Exponential\"] = 6] = \"Exponential\";\n /**\n * Human-readable format of exponential.\n * Example: 1.2x103\n */\n NumberSymbol[NumberSymbol[\"SuperscriptingExponent\"] = 7] = \"SuperscriptingExponent\";\n /**\n * Sign for permille (out of 1000).\n * Example: 23.4‰\n */\n NumberSymbol[NumberSymbol[\"PerMille\"] = 8] = \"PerMille\";\n /**\n * Infinity, can be used with plus and minus.\n * Example: ∞, +∞, -∞\n */\n NumberSymbol[NumberSymbol[\"Infinity\"] = 9] = \"Infinity\";\n /**\n * Not a number.\n * Example: NaN\n */\n NumberSymbol[NumberSymbol[\"NaN\"] = 10] = \"NaN\";\n /**\n * Symbol used between time units.\n * Example: 10:52\n */\n NumberSymbol[NumberSymbol[\"TimeSeparator\"] = 11] = \"TimeSeparator\";\n /**\n * Decimal separator for currency values (fallback to `Decimal`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyDecimal\"] = 12] = \"CurrencyDecimal\";\n /**\n * Group separator for currency values (fallback to `Group`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyGroup\"] = 13] = \"CurrencyGroup\";\n})(NumberSymbol || (NumberSymbol = {}));\n/**\n * The value for each day of the week, based on the `en-US` locale\n *\n * @publicApi\n */\nvar WeekDay;\n(function (WeekDay) {\n WeekDay[WeekDay[\"Sunday\"] = 0] = \"Sunday\";\n WeekDay[WeekDay[\"Monday\"] = 1] = \"Monday\";\n WeekDay[WeekDay[\"Tuesday\"] = 2] = \"Tuesday\";\n WeekDay[WeekDay[\"Wednesday\"] = 3] = \"Wednesday\";\n WeekDay[WeekDay[\"Thursday\"] = 4] = \"Thursday\";\n WeekDay[WeekDay[\"Friday\"] = 5] = \"Friday\";\n WeekDay[WeekDay[\"Saturday\"] = 6] = \"Saturday\";\n})(WeekDay || (WeekDay = {}));\n/**\n * Retrieves the locale ID from the currently loaded locale.\n * The loaded locale could be, for example, a global one rather than a regional one.\n * @param locale A locale code, such as `fr-FR`.\n * @returns The locale code. For example, `fr`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleId(locale) {\n return ɵfindLocaleData(locale)[ɵLocaleDataIndex.LocaleId];\n}\n/**\n * Retrieves day period strings for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const amPmData = [\n data[ɵLocaleDataIndex.DayPeriodsFormat], data[ɵLocaleDataIndex.DayPeriodsStandalone]\n ];\n const amPm = getLastDefinedValue(amPmData, formStyle);\n return getLastDefinedValue(amPm, width);\n}\n/**\n * Retrieves days of the week for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example,`[Sunday, Monday, ... Saturday]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const daysData = [data[ɵLocaleDataIndex.DaysFormat], data[ɵLocaleDataIndex.DaysStandalone]];\n const days = getLastDefinedValue(daysData, formStyle);\n return getLastDefinedValue(days, width);\n}\n/**\n * Retrieves months of the year for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example, `[January, February, ...]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleMonthNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const monthsData = [data[ɵLocaleDataIndex.MonthsFormat], data[ɵLocaleDataIndex.MonthsStandalone]];\n const months = getLastDefinedValue(monthsData, formStyle);\n return getLastDefinedValue(months, width);\n}\n/**\n * Retrieves Gregorian-calendar eras for the given locale.\n * @param locale A locale code for the locale format rules to use.\n * @param width The required character width.\n\n * @returns An array of localized era strings.\n * For example, `[AD, BC]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleEraNames(locale, width) {\n const data = ɵfindLocaleData(locale);\n const erasData = data[ɵLocaleDataIndex.Eras];\n return getLastDefinedValue(erasData, width);\n}\n/**\n * Retrieves the first day of the week for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns A day index number, using the 0-based week-day index for `en-US`\n * (Sunday = 0, Monday = 1, ...).\n * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleFirstDayOfWeek(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.FirstDayOfWeek];\n}\n/**\n * Range of week days that are considered the week-end for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The range of day values, `[startDay, endDay]`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleWeekEndRange(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.WeekendRange];\n}\n/**\n * Retrieves a localized date-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.DateFormat], width);\n}\n/**\n * Retrieves a localized time-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n\n * @publicApi\n */\nfunction getLocaleTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.TimeFormat], width);\n}\n/**\n * Retrieves a localized date-time formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n const dateTimeFormatData = data[ɵLocaleDataIndex.DateTimeFormat];\n return getLastDefinedValue(dateTimeFormatData, width);\n}\n/**\n * Retrieves a localized number symbol that can be used to replace placeholders in number formats.\n * @param locale The locale code.\n * @param symbol The symbol to localize.\n * @returns The character for the localized symbol.\n * @see `NumberSymbol`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberSymbol(locale, symbol) {\n const data = ɵfindLocaleData(locale);\n const res = data[ɵLocaleDataIndex.NumberSymbols][symbol];\n if (typeof res === 'undefined') {\n if (symbol === NumberSymbol.CurrencyDecimal) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];\n }\n else if (symbol === NumberSymbol.CurrencyGroup) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Group];\n }\n }\n return res;\n}\n/**\n * Retrieves a number format for a given locale.\n *\n * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`\n * when used to format the number 12345.678 could result in \"12'345,678\". That would happen if the\n * grouping separator for your language is an apostrophe, and the decimal separator is a comma.\n *\n * Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see `NumberFormatStyle`\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @alias core/ɵgetLocalePluralCase\n * @publicApi\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex\n .LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see `getLocaleExtraDayPeriods()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ɵExtraLocaleDataIndex.ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see `getLocaleExtraDayPeriodRules()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ɵExtraLocaleDataIndex.ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ɵExtraLocaleDataIndex.ExtraDayPeriodStandalone */]\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* ɵCurrencyIndex.SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* ɵCurrencyIndex.Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* ɵCurrencyIndex.NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\nconst ISO8601_DATE_REGEX = /^(\\d{4,})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\nvar ZoneWidth;\n(function (ZoneWidth) {\n ZoneWidth[ZoneWidth[\"Short\"] = 0] = \"Short\";\n ZoneWidth[ZoneWidth[\"ShortGMT\"] = 1] = \"ShortGMT\";\n ZoneWidth[ZoneWidth[\"Long\"] = 2] = \"Long\";\n ZoneWidth[ZoneWidth[\"Extended\"] = 3] = \"Extended\";\n})(ZoneWidth || (ZoneWidth = {}));\nvar DateType;\n(function (DateType) {\n DateType[DateType[\"FullYear\"] = 0] = \"FullYear\";\n DateType[DateType[\"Month\"] = 1] = \"Month\";\n DateType[DateType[\"Date\"] = 2] = \"Date\";\n DateType[DateType[\"Hours\"] = 3] = \"Hours\";\n DateType[DateType[\"Minutes\"] = 4] = \"Minutes\";\n DateType[DateType[\"Seconds\"] = 5] = \"Seconds\";\n DateType[DateType[\"FractionalSeconds\"] = 6] = \"FractionalSeconds\";\n DateType[DateType[\"Day\"] = 7] = \"Day\";\n})(DateType || (DateType = {}));\nvar TranslationType;\n(function (TranslationType) {\n TranslationType[TranslationType[\"DayPeriods\"] = 0] = \"DayPeriods\";\n TranslationType[TranslationType[\"Days\"] = 1] = \"Days\";\n TranslationType[TranslationType[\"Months\"] = 2] = \"Months\";\n TranslationType[TranslationType[\"Eras\"] = 3] = \"Eras\";\n})(TranslationType || (TranslationType = {}));\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),\n * or a standard UTC/GMT or continental US time zone abbreviation.\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see `DatePipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach(value => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter ? dateFormatter(date, locale, dateTimezoneOffset) :\n value === '\\'\\'' ? '\\'' :\n value.replace(/(^'|'$)/g, '').replace(/''/g, '\\'');\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return (opt_values != null && key in opt_values) ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.slice(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substring(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === DateType.Hours) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === DateType.FractionalSeconds) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case DateType.FullYear:\n return date.getFullYear();\n case DateType.Month:\n return date.getMonth();\n case DateType.Date:\n return date.getDate();\n case DateType.Hours:\n return date.getHours();\n case DateType.Minutes:\n return date.getMinutes();\n case DateType.Seconds:\n return date.getSeconds();\n case DateType.FractionalSeconds:\n return date.getMilliseconds();\n case DateType.Day:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case TranslationType.Months:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case TranslationType.Days:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case TranslationType.DayPeriods:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex(rule => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = (currentHours < to.hours ||\n (currentHours === to.hours && currentMinutes < to.minutes));\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else { // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case TranslationType.Eras:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case ZoneWidth.Short:\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.ShortGMT:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);\n case ZoneWidth.Long:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.Extended:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\nfunction getThursdayThisWeek(datetime) {\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(DateType.FullYear, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(DateType.FullYear, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(DateType.FullYear, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(DateType.FullYear, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(DateType.Month, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(DateType.Month, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(DateType.Date, 1);\n break;\n case 'dd':\n formatter = dateGetter(DateType.Date, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(DateType.Day, 1);\n break;\n case 'ccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter =\n dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(DateType.Hours, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(DateType.Hours, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(DateType.Hours, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(DateType.Hours, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(DateType.Minutes, 1);\n break;\n case 'mm':\n formatter = dateGetter(DateType.Minutes, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(DateType.Seconds, 1);\n break;\n case 'ss':\n formatter = dateGetter(DateType.Seconds, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(DateType.FractionalSeconds, 1);\n break;\n case 'SS':\n formatter = dateGetter(DateType.FractionalSeconds, 2);\n break;\n case 'SSS':\n formatter = dateGetter(DateType.FractionalSeconds, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(ZoneWidth.Short);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(ZoneWidth.Extended);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(ZoneWidth.ShortGMT);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(ZoneWidth.Long);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if (match = value.match(ISO8601_DATE_REGEX)) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every(d => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is suppressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim();\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?\n positive.split(DECIMAL_SEP) :\n [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substring(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substring(0, pos).replace(/'/g, '');\n p.negSuf = negative.slice(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, roundAt = fractionSize + 1);\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @publicApi\n */\nclass NgLocalization {\n}\nNgLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocalization, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocalization, providedIn: 'root', useFactory: (locale) => new NgLocaleLocalization(locale), deps: [{ token: LOCALE_ID }] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocalization, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n useFactory: (locale) => new NgLocaleLocalization(locale),\n deps: [LOCALE_ID],\n }]\n }] });\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n}\nNgLocaleLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocaleLocalization, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocaleLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocaleLocalization });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocaleLocalization, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n-common-format-data-locale) to know how to import additional locale\n * data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\nconst WS_REGEXP = /\\s+/;\nconst EMPTY_ARRAY = [];\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(\n // leaving references to differs in place since flex layout is extending NgClass...\n _iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {\n this._iterableDiffers = _iterableDiffers;\n this._keyValueDiffers = _keyValueDiffers;\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this.initialClasses = EMPTY_ARRAY;\n this.stateMap = new Map();\n }\n set klass(value) {\n this.initialClasses = value != null ? value.trim().split(WS_REGEXP) : EMPTY_ARRAY;\n }\n set ngClass(value) {\n this.rawClass = typeof value === 'string' ? value.trim().split(WS_REGEXP) : value;\n }\n /*\n The NgClass directive uses the custom change detection algorithm for its inputs. The custom\n algorithm is necessary since inputs are represented as complex object or arrays that need to be\n deeply-compared.\n \n This algorithm is perf-sensitive since NgClass is used very frequently and its poor performance\n might negatively impact runtime performance of the entire change detection cycle. The design of\n this algorithm is making sure that:\n - there is no unnecessary DOM manipulation (CSS classes are added / removed from the DOM only when\n needed), even if references to bound objects change;\n - there is no memory allocation if nothing changes (even relatively modest memory allocation\n during the change detection cycle can result in GC pauses for some of the CD cycles).\n \n The algorithm works by iterating over the set of bound classes, staring with [class] binding and\n then going over [ngClass] binding. For each CSS class name:\n - check if it was seen before (this information is tracked in the state map) and if its value\n changed;\n - mark it as \"touched\" - names that are not marked are not present in the latest set of binding\n and we can remove such class name from the internal data structures;\n \n After iteration over all the CSS class names we've got data structure with all the information\n necessary to synchronize changes to the DOM - it is enough to iterate over the state map, flush\n changes to the DOM and reset internal data structures so those are ready for the next change\n detection cycle.\n */\n ngDoCheck() {\n // classes from the [class] binding\n for (const klass of this.initialClasses) {\n this._updateState(klass, true);\n }\n // classes from the [ngClass] binding\n const rawClass = this.rawClass;\n if (Array.isArray(rawClass) || rawClass instanceof Set) {\n for (const klass of rawClass) {\n this._updateState(klass, true);\n }\n }\n else if (rawClass != null) {\n for (const klass of Object.keys(rawClass)) {\n this._updateState(klass, Boolean(rawClass[klass]));\n }\n }\n this._applyStateDiff();\n }\n _updateState(klass, nextEnabled) {\n const state = this.stateMap.get(klass);\n if (state !== undefined) {\n if (state.enabled !== nextEnabled) {\n state.changed = true;\n state.enabled = nextEnabled;\n }\n state.touched = true;\n }\n else {\n this.stateMap.set(klass, { enabled: nextEnabled, changed: true, touched: true });\n }\n }\n _applyStateDiff() {\n for (const stateEntry of this.stateMap) {\n const klass = stateEntry[0];\n const state = stateEntry[1];\n if (state.changed) {\n this._toggleClass(klass, state.enabled);\n state.changed = false;\n }\n else if (!state.touched) {\n // A class that was previously active got removed from the new collection of classes -\n // remove from the DOM as well.\n if (state.enabled) {\n this._toggleClass(klass, false);\n }\n this.stateMap.delete(klass);\n }\n state.touched = false;\n }\n }\n _toggleClass(klass, enabled) {\n if (ngDevMode) {\n if (typeof klass !== 'string') {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(klass)}`);\n }\n }\n klass = klass.trim();\n if (klass.length > 0) {\n klass.split(WS_REGEXP).forEach(klass => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n}\nNgClass.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgClass, deps: [{ token: i0.IterableDiffers }, { token: i0.KeyValueDiffers }, { token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgClass.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgClass, isStandalone: true, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngClass]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.IterableDiffers }, { type: i0.KeyValueDiffers }, { type: i0.ElementRef }, { type: i0.Renderer2 }]; }, propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * Instantiates a {@link Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModule`: Optional NgModule class reference to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * * `ngComponentOutletNgModuleFactory`: Deprecated config option that allows providing optional\n * NgModule factory to allow loading another module dynamically, then loading a component from that\n * module. Use `ngComponentOutletNgModule` instead.\n *\n * ### Syntax\n *\n * Simple\n * ```\n * \n * ```\n *\n * Customized injector/content\n * ```\n * \n * \n * ```\n *\n * Customized NgModule reference\n * ```\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this.ngComponentOutlet = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n const { _viewContainerRef: viewContainerRef, ngComponentOutletNgModule: ngModule, ngComponentOutletNgModuleFactory: ngModuleFactory, } = this;\n viewContainerRef.clear();\n this._componentRef = undefined;\n if (this.ngComponentOutlet) {\n const injector = this.ngComponentOutletInjector || viewContainerRef.parentInjector;\n if (changes['ngComponentOutletNgModule'] || changes['ngComponentOutletNgModuleFactory']) {\n if (this._moduleRef)\n this._moduleRef.destroy();\n if (ngModule) {\n this._moduleRef = createNgModule(ngModule, getParentInjector(injector));\n }\n else if (ngModuleFactory) {\n this._moduleRef = ngModuleFactory.create(getParentInjector(injector));\n }\n else {\n this._moduleRef = undefined;\n }\n }\n this._componentRef = viewContainerRef.createComponent(this.ngComponentOutlet, {\n index: viewContainerRef.length,\n injector,\n ngModuleRef: this._moduleRef,\n projectableNodes: this.ngComponentOutletContent,\n });\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n if (this._moduleRef)\n this._moduleRef.destroy();\n }\n}\nNgComponentOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgComponentOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgComponentOutlet, isStandalone: true, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModule: \"ngComponentOutletNgModule\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngComponentOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModule: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n// Helper function that returns an Injector instance of a parent NgModule.\nfunction getParentInjector(injector) {\n const parentNgModule = injector.get(NgModuleRef);\n return parentNgModule.injector;\n}\n\nconst NG_DEV_MODE = typeof ngDevMode === 'undefined' || !!ngDevMode;\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor($implicit, ngForOf, index, count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n get first() {\n return this.index === 0;\n }\n get last() {\n return this.index === this.count - 1;\n }\n get even() {\n return this.index % 2 === 0;\n }\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `
` element.\n *\n * ```\n *
...
\n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `
` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n *
...
\n * \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/structural-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For further discussion, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n *
\n * {{i}}/{{users.length}}. {{user}} default\n *
\n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/structural-directives#shorthand).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.\n *\n * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object\n * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)\n * as the key.\n *\n * `NgForOf` uses the computed key to associate items in an iterable with DOM elements\n * it produces for these items.\n *\n * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an\n * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a\n * primary key), and this iterable could be updated with new object instances that still\n * represent the same underlying entity (for example, when data is re-fetched from the server,\n * and the iterable is recreated and re-rendered, but most of the data is still the same).\n *\n * @see `TrackByFunction`\n */\n set ngForTrackBy(fn) {\n if (NG_DEV_MODE && fn != null && typeof fn !== 'function') {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n this._ngForOf = null;\n this._ngForOfDirty = true;\n this._differ = null;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n * @nodoc\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (NG_DEV_MODE) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch {\n let errorMessage = `Cannot find a differ supporting object '${value}' of type '` +\n `${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;\n if (typeof value === 'object') {\n errorMessage += ' Did you mean to use the keyvalue pipe?';\n }\n throw new ɵRuntimeError(-2200 /* RuntimeErrorCode.NG_FOR_MISSING_DIFFER */, errorMessage);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgForOf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive });\nNgForOf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgForOf, isStandalone: true, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngFor][ngForOf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }]; }, propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n *
Content to render when condition is true.
\n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n *
Content to render when condition is\n * true.
\n * ```\n *\n * Form with an \"else\" block:\n *\n * ```\n *
Content to render when condition is true.
\n * Content to render when condition is false.\n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n * \n * Content to render when condition is true.\n * Content to render when condition is false.\n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n *
{{value}}
\n * Content to render when value is null.\n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n *
\n * ...\n *
\n *\n * \n *
Loading...
\n * \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n *
\n * ...\n *
\n * \n *\n * \n *
Loading...
\n * \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef =\n this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef =\n this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgIf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgIf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgIf, isStandalone: true, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngIf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }]; }, propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ...\n * ...\n * ...\n * \n * ...\n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ...\n * ...\n * ...\n * \n * \n * \n * \n * \n * ...\n * \n * ```\n *\n * @publicApi\n * @see `NgSwitchCase`\n * @see `NgSwitchDefault`\n * @see [Structural Directives](guide/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultViews = [];\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value == this._ngSwitch;\n this._lastCasesMatched = this._lastCasesMatched || matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews.length > 0 && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (const defaultView of this._defaultViews) {\n defaultView.enforceState(useDefault);\n }\n }\n }\n}\nNgSwitch.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitch.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgSwitch, isStandalone: true, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitch]',\n standalone: true,\n }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * Unlike JavaScript, which uses strict equality, Angular uses loose equality.\n * This means that the empty string, `\"\"` matches 0.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchDefault`\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n * @nodoc\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n}\nNgSwitchCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgSwitchCase, isStandalone: true, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchCase]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; }, propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchCase`\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n}\nNgSwitchDefault.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchDefault.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgSwitchDefault, isStandalone: true, selector: \"[ngSwitchDefault]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchDefault]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; } });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* RuntimeErrorCode.PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing\n * there is one\n * there are a few\n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._updateView(value);\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView(switchValue) {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n}\nNgPlural.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive });\nNgPlural.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgPlural, isStandalone: true, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPlural]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; }, propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ...\n * ...\n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n}\nNgPluralCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgPluralCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgPluralCase, isStandalone: true, selector: \"[ngPluralCase]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPluralCase]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }]; } });\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ...\n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n const flags = name.indexOf('-') === -1 ? undefined : RendererStyleFlags2.DashCase;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n}\nNgStyle.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgStyle.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgStyle, isStandalone: true, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngStyle]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }]; }, propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n this.ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n this.ngTemplateOutlet = null;\n /** Injector to be used within the embedded view. */\n this.ngTemplateOutletInjector = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (changes['ngTemplateOutlet'] || changes['ngTemplateOutletInjector']) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n if (this.ngTemplateOutlet) {\n const { ngTemplateOutlet: template, ngTemplateOutletContext: context, ngTemplateOutletInjector: injector } = this;\n this._viewRef = viewContainerRef.createEmbeddedView(template, context, injector ? { injector } : undefined);\n }\n else {\n this._viewRef = null;\n }\n }\n else if (this._viewRef && changes['ngTemplateOutletContext'] && this.ngTemplateOutletContext) {\n this._viewRef.context = this.ngTemplateOutletContext;\n }\n }\n}\nNgTemplateOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgTemplateOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgTemplateOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgTemplateOutlet, isStandalone: true, selector: \"[ngTemplateOutlet]\", inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\", ngTemplateOutletInjector: \"ngTemplateOutletInjector\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgTemplateOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngTemplateOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }], ngTemplateOutletInjector: [{\n type: Input\n }] } });\n\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\nfunction invalidPipeArgumentError(type, value) {\n return new ɵRuntimeError(2100 /* RuntimeErrorCode.INVALID_PIPE_ARGUMENT */, ngDevMode && `InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'`);\n}\n\nclass SubscribableStrategy {\n createSubscription(async, updateLatestValue) {\n return async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n }\n });\n }\n dispose(subscription) {\n subscription.unsubscribe();\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, e => {\n throw e;\n });\n }\n dispose(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _subscribableStrategy = new SubscribableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks. When the reference of the expression changes, the `async` pipe\n * automatically unsubscribes from the old `Observable` or `Promise` and subscribes to the new one.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n constructor(ref) {\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n this._strategy = null;\n // Assign `ref` into `this._ref` manually instead of declaring `_ref` in the constructor\n // parameter list, as the type of `this._ref` includes `null` unlike the type of `ref`.\n this._ref = ref;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n // Clear the `ChangeDetectorRef` and its association with the view data, to mitigate\n // potential memory leaks in Observables that could otherwise cause the view data to\n // be retained.\n // https://github.com/angular/angular/issues/17624\n this._ref = null;\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n this._subscribe(obj);\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisSubscribable(obj)) {\n return _subscribableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n // Note: `dispose` is only called if a subscription has been initialized before, indicating\n // that `this._strategy` is also available.\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n // Note: `this._ref` is only cleared in `ngOnDestroy` so is known to be available when a\n // value is being updated.\n this._ref.markForCheck();\n }\n }\n}\nAsyncPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: AsyncPipe, deps: [{ token: i0.ChangeDetectorRef }], target: i0.ɵɵFactoryTarget.Pipe });\nAsyncPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: AsyncPipe, isStandalone: true, name: \"async\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: AsyncPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'async',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }]; } });\n\n/**\n * Transforms text to all lower case.\n *\n * @see `UpperCasePipe`\n * @see `TitleCasePipe`\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n}\nLowerCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LowerCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nLowerCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: LowerCasePipe, isStandalone: true, name: \"lowercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LowerCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'lowercase',\n standalone: true,\n }]\n }] });\n//\n// Regex below matches any Unicode word and number compatible with ES5. In ES2018 the same result\n// can be achieved by using /[0-9\\p{L}]\\S*/gu and also known as Unicode Property Escapes\n// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+%2F%5B0-9%5Cp%7BL%7D%5D%5CS*%2Fgu%3B%0A%0A&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[0-9A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0560-\\u0588\\u05D0-\\u05EA\\u05EF-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u0870-\\u0887\\u0889-\\u088E\\u08A0-\\u08C9\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C5D\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D04-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E86-\\u0E8A\\u0E8C-\\u0EA3\\u0EA5\\u0EA7-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u1711\\u171F-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1878\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4C\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1C90-\\u1CBA\\u1CBD-\\u1CBF\\u1CE9-\\u1CEC\\u1CEE-\\u1CF3\\u1CF5\\u1CF6\\u1CFA\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312F\\u3131-\\u318E\\u31A0-\\u31BF\\u31F0-\\u31FF\\u3400-\\u4DBF\\u4E00-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7CA\\uA7D0\\uA7D1\\uA7D3\\uA7D5-\\uA7D9\\uA7F2-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA8FE\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB69\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDD70-\\uDD7A\\uDD7C-\\uDD8A\\uDD8C-\\uDD92\\uDD94\\uDD95\\uDD97-\\uDDA1\\uDDA3-\\uDDB1\\uDDB3-\\uDDB9\\uDDBB\\uDDBC\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67\\uDF80-\\uDF85\\uDF87-\\uDFB0\\uDFB2-\\uDFBA]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE35\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2\\uDD00-\\uDD23\\uDE80-\\uDEA9\\uDEB0\\uDEB1\\uDF00-\\uDF1C\\uDF27\\uDF30-\\uDF45\\uDF70-\\uDF81\\uDFB0-\\uDFC4\\uDFE0-\\uDFF6]|\\uD804[\\uDC03-\\uDC37\\uDC71\\uDC72\\uDC75\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD44\\uDD47\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC5F-\\uDC61\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDEB8\\uDF00-\\uDF1A\\uDF40-\\uDF46]|\\uD806[\\uDC00-\\uDC2B\\uDCA0-\\uDCDF\\uDCFF-\\uDD06\\uDD09\\uDD0C-\\uDD13\\uDD15\\uDD16\\uDD18-\\uDD2F\\uDD3F\\uDD41\\uDDA0-\\uDDA7\\uDDAA-\\uDDD0\\uDDE1\\uDDE3\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE89\\uDE9D\\uDEB0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46\\uDD60-\\uDD65\\uDD67\\uDD68\\uDD6A-\\uDD89\\uDD98\\uDEE0-\\uDEF2\\uDFB0]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|\\uD80B[\\uDF90-\\uDFF0]|[\\uD80C\\uD81C-\\uD820\\uD822\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879\\uD880-\\uD883][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDE70-\\uDEBE\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDE40-\\uDE7F\\uDF00-\\uDF4A\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1\\uDFE3]|\\uD821[\\uDC00-\\uDFF7]|\\uD823[\\uDC00-\\uDCD5\\uDD00-\\uDD08]|\\uD82B[\\uDFF0-\\uDFF3\\uDFF5-\\uDFFB\\uDFFD\\uDFFE]|\\uD82C[\\uDC00-\\uDD22\\uDD50-\\uDD52\\uDD64-\\uDD67\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD837[\\uDF00-\\uDF1E]|\\uD838[\\uDD00-\\uDD2C\\uDD37-\\uDD3D\\uDD4E\\uDE90-\\uDEAD\\uDEC0-\\uDEEB]|\\uD839[\\uDFE0-\\uDFE6\\uDFE8-\\uDFEB\\uDFED\\uDFEE\\uDFF0-\\uDFFE]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43\\uDD4B]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDEDF\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF38\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D]|\\uD884[\\uDC00-\\uDF4A])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see `LowerCasePipe`\n * @see `UpperCasePipe`\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.slice(1).toLowerCase()));\n }\n}\nTitleCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: TitleCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nTitleCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: TitleCasePipe, isStandalone: true, name: \"titlecase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: TitleCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'titlecase',\n standalone: true,\n }]\n }] });\n/**\n * Transforms text to all upper case.\n * @see `LowerCasePipe`\n * @see `TitleCasePipe`\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n}\nUpperCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: UpperCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nUpperCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: UpperCasePipe, isStandalone: true, name: \"uppercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: UpperCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'uppercase',\n standalone: true,\n }]\n }] });\n\n/**\n * The default date format of Angular date pipe, which corresponds to the following format:\n * `'MMM d,y'` (e.g. `Jun 15, 2015`)\n */\nconst DEFAULT_DATE_FORMAT = 'mediumDate';\n\n/**\n * Optionally-provided default timezone to use for all instances of `DatePipe` (such as `'+0430'`).\n * If the value isn't provided, the `DatePipe` will use the end-user's local system timezone.\n *\n * @deprecated use DATE_PIPE_DEFAULT_OPTIONS token to configure DatePipe\n */\nconst DATE_PIPE_DEFAULT_TIMEZONE = new InjectionToken('DATE_PIPE_DEFAULT_TIMEZONE');\n/**\n * DI token that allows to provide default configuration for the `DatePipe` instances in an\n * application. The value is an object which can include the following fields:\n * - `dateFormat`: configures the default date format. If not provided, the `DatePipe`\n * will use the 'mediumDate' as a value.\n * - `timezone`: configures the default timezone. If not provided, the `DatePipe` will\n * use the end-user's local system timezone.\n *\n * @see `DatePipeConfig`\n *\n * @usageNotes\n *\n * Various date pipe default values can be overwritten by providing this token with\n * the value that has this interface.\n *\n * For example:\n *\n * Override the default date format by providing a value using the token:\n * ```typescript\n * providers: [\n * {provide: DATE_PIPE_DEFAULT_OPTIONS, useValue: {dateFormat: 'shortDate'}}\n * ]\n * ```\n *\n * Override the default timezone by providing a value using the token:\n * ```typescript\n * providers: [\n * {provide: DATE_PIPE_DEFAULT_OPTIONS, useValue: {timezone: '-1200'}}\n * ]\n * ```\n */\nconst DATE_PIPE_DEFAULT_OPTIONS = new InjectionToken('DATE_PIPE_DEFAULT_OPTIONS');\n// clang-format off\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * `DatePipe` is executed only when it detects a pure change to the input value.\n * A pure change is either a change to a primitive input value\n * (such as `String`, `Number`, `Boolean`, or `Symbol`),\n * or a changed object reference (such as `Date`, `Array`, `Function`, or `Object`).\n *\n * Note that mutating a `Date` object does not cause the pipe to be rendered again.\n * To ensure that the pipe is executed, you must create a new `Date` object.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n-common-format-data-locale) for more information.\n *\n * The time zone of the formatted value can be specified either by passing it in as the second\n * parameter of the pipe, or by setting the default through the `DATE_PIPE_DEFAULT_OPTIONS`\n * injection token. The value that is passed in as the second parameter takes precedence over\n * the one defined using the injection token.\n *\n * @see `formatDate()`\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * | Option | Equivalent to | Examples (given in `en-US` locale) |\n * |---------------|-------------------------------------|-------------------------------------------------|\n * | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |\n * | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |\n * | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |\n * | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |\n * | `'shortDate'` | `'M/d/yy'` | `6/15/15` |\n * | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |\n * | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |\n * | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |\n * | `'shortTime'` | `'h:mm a'` | `9:03 AM` |\n * | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |\n * | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |\n * | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |-------------------- |-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Week-numbering year | Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Week day standalone | c, cc | Numeric: 1 digit | 2 |\n * | | ccc | Abbreviated | Tue |\n * | | cccc | Wide | Tuesday |\n * | | ccccc | Narrow | T |\n * | | cccccc | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```\n * @Component({\n * selector: 'date-pipe',\n * template: `
\n *
Today is {{today | date}}
\n *
Or if you prefer, {{today | date:'fullDate'}}
\n *
The time is {{today | date:'h:mm a z'}}
\n *
`\n * })\n * // Get the current date and time as a date-time value.\n * export class DatePipeComponent {\n * today: number = Date.now();\n * }\n * ```\n *\n * @publicApi\n */\n// clang-format on\nclass DatePipe {\n constructor(locale, defaultTimezone, defaultOptions) {\n this.locale = locale;\n this.defaultTimezone = defaultTimezone;\n this.defaultOptions = defaultOptions;\n }\n transform(value, format, timezone, locale) {\n if (value == null || value === '' || value !== value)\n return null;\n try {\n const _format = format ?? this.defaultOptions?.dateFormat ?? DEFAULT_DATE_FORMAT;\n const _timezone = timezone ?? this.defaultOptions?.timezone ?? this.defaultTimezone ?? undefined;\n return formatDate(value, _format, locale || this.locale, _timezone);\n }\n catch (error) {\n throw invalidPipeArgumentError(DatePipe, error.message);\n }\n }\n}\nDatePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: DatePipe, deps: [{ token: LOCALE_ID }, { token: DATE_PIPE_DEFAULT_TIMEZONE, optional: true }, { token: DATE_PIPE_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Pipe });\nDatePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: DatePipe, isStandalone: true, name: \"date\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: DatePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'date',\n pure: true,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_TIMEZONE]\n }, {\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_OPTIONS]\n }, {\n type: Optional\n }] }]; } });\n\nconst _INTERPOLATION_REGEXP = /#/g;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Maps a value to a string that pluralizes the value according to locale rules.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'}\n *\n * @publicApi\n */\nclass I18nPluralPipe {\n constructor(_localization) {\n this._localization = _localization;\n }\n /**\n * @param value the number to be formatted\n * @param pluralMap an object that mimics the ICU format, see\n * https://unicode-org.github.io/icu/userguide/format_parse/messages/.\n * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by\n * default).\n */\n transform(value, pluralMap, locale) {\n if (value == null)\n return '';\n if (typeof pluralMap !== 'object' || pluralMap === null) {\n throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);\n }\n const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);\n return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());\n }\n}\nI18nPluralPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nPluralPipe, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Pipe });\nI18nPluralPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nPluralPipe, isStandalone: true, name: \"i18nPlural\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nPluralPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nPlural',\n pure: true,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; } });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Generic selector that displays the string that matches the current value.\n *\n * If none of the keys of the `mapping` match the `value`, then the content\n * of the `other` key is returned when present, otherwise an empty string is returned.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'}\n *\n * @publicApi\n */\nclass I18nSelectPipe {\n /**\n * @param value a string to be internationalized.\n * @param mapping an object that indicates the text that should be displayed\n * for different values of the provided `value`.\n */\n transform(value, mapping) {\n if (value == null)\n return '';\n if (typeof mapping !== 'object' || typeof value !== 'string') {\n throw invalidPipeArgumentError(I18nSelectPipe, mapping);\n }\n if (mapping.hasOwnProperty(value)) {\n return mapping[value];\n }\n if (mapping.hasOwnProperty('other')) {\n return mapping['other'];\n }\n return '';\n }\n}\nI18nSelectPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nSelectPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nI18nSelectPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nSelectPipe, isStandalone: true, name: \"i18nSelect\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nSelectPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nSelect',\n pure: true,\n standalone: true,\n }]\n }] });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Converts a value into its JSON-format representation. Useful for debugging.\n *\n * @usageNotes\n *\n * The following component uses a JSON pipe to convert an object\n * to JSON format, and displays the string in both formats for comparison.\n *\n * {@example common/pipes/ts/json_pipe.ts region='JsonPipe'}\n *\n * @publicApi\n */\nclass JsonPipe {\n /**\n * @param value A value of any type to convert into a JSON-format string.\n */\n transform(value) {\n return JSON.stringify(value, null, 2);\n }\n}\nJsonPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: JsonPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nJsonPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: JsonPipe, isStandalone: true, name: \"json\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: JsonPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'json',\n pure: false,\n standalone: true,\n }]\n }] });\n\nfunction makeKeyValuePair(key, value) {\n return { key: key, value: value };\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms Object or Map into an array of key value pairs.\n *\n * The output array will be ordered by keys.\n * By default the comparator will be by Unicode point value.\n * You can optionally pass a compareFn if your keys are complex types.\n *\n * @usageNotes\n * ### Examples\n *\n * This examples show how an Object or a Map can be iterated by ngFor with the use of this\n * keyvalue pipe.\n *\n * {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'}\n *\n * @publicApi\n */\nclass KeyValuePipe {\n constructor(differs) {\n this.differs = differs;\n this.keyValues = [];\n this.compareFn = defaultComparator;\n }\n transform(input, compareFn = defaultComparator) {\n if (!input || (!(input instanceof Map) && typeof input !== 'object')) {\n return null;\n }\n if (!this.differ) {\n // make a differ for whatever type we've been passed in\n this.differ = this.differs.find(input).create();\n }\n const differChanges = this.differ.diff(input);\n const compareFnChanged = compareFn !== this.compareFn;\n if (differChanges) {\n this.keyValues = [];\n differChanges.forEachItem((r) => {\n this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));\n });\n }\n if (differChanges || compareFnChanged) {\n this.keyValues.sort(compareFn);\n this.compareFn = compareFn;\n }\n return this.keyValues;\n }\n}\nKeyValuePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: KeyValuePipe, deps: [{ token: i0.KeyValueDiffers }], target: i0.ɵɵFactoryTarget.Pipe });\nKeyValuePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: KeyValuePipe, isStandalone: true, name: \"keyvalue\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: KeyValuePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'keyvalue',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.KeyValueDiffers }]; } });\nfunction defaultComparator(keyValueA, keyValueB) {\n const a = keyValueA.key;\n const b = keyValueB.key;\n // if same exit with 0;\n if (a === b)\n return 0;\n // make sure that undefined are at the end of the sort.\n if (a === undefined)\n return 1;\n if (b === undefined)\n return -1;\n // make sure that nulls are at the end of the sort.\n if (a === null)\n return 1;\n if (b === null)\n return -1;\n if (typeof a == 'string' && typeof b == 'string') {\n return a < b ? -1 : 1;\n }\n if (typeof a == 'number' && typeof b == 'number') {\n return a - b;\n }\n if (typeof a == 'boolean' && typeof b == 'boolean') {\n return a < b ? -1 : 1;\n }\n // `a` and `b` are of different types. Compare their string values.\n const aString = String(a);\n const bString = String(b);\n return aString == bString ? 0 : aString < bString ? -1 : 1;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a value according to digit options and locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * @see `formatNumber()`\n *\n * @usageNotes\n *\n * ### digitsInfo\n *\n * The value's decimal representation is specified by the `digitsInfo`\n * parameter, written in the following format: \n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n-common-locale-id).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass DecimalPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n * @param value The value to be formatted.\n * @param digitsInfo Sets digit and decimal representation.\n * [See more](#digitsinfo).\n * @param locale Specifies what locale format rules to use.\n * [See more](#locale).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatNumber(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(DecimalPipe, error.message);\n }\n }\n}\nDecimalPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: DecimalPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nDecimalPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: DecimalPipe, isStandalone: true, name: \"number\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: DecimalPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'number',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a percentage\n * string, formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * @see `formatPercent()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass PercentPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n *\n * @param value The number to be formatted as a percentage.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format: \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n}\nPercentPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nPercentPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: PercentPipe, isStandalone: true, name: \"percent\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'percent',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n *\n * @see `getCurrencySymbol()`\n * @see `formatCurrency()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass CurrencyPipe {\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n /**\n *\n * @param value The number to be formatted as currency.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,\n * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be\n * configured using the `DEFAULT_CURRENCY_CODE` injection token.\n * @param display The format for the currency indicator. One of the following:\n * - `code`: Show the code (such as `USD`).\n * - `symbol`(default): Show the symbol (such as `$`).\n * - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their\n * currency.\n * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the\n * locale has no narrow symbol, uses the standard symbol for the locale.\n * - String: Use the given string value instead of a code or a symbol.\n * For example, an empty string will suppress the currency & symbol.\n * - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.\n *\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format: \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n}\nCurrencyPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe });\nCurrencyPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: CurrencyPipe, isStandalone: true, name: \"currency\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'currency',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }]; } });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n *
b
\n *
c
\n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n}\nSlicePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nSlicePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: SlicePipe, isStandalone: true, name: \"slice\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'slice',\n pure: false,\n standalone: true,\n }]\n }] });\n\n/**\n * @module\n * @description\n * This module provides a set of common Pipes.\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * @publicApi\n */\nclass CommonModule {\n}\nCommonModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCommonModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: CommonModule, imports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] });\nCommonModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: CommonModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n }]\n }] });\n\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\nconst PLATFORM_WORKER_APP_ID = 'browserWorkerApp';\nconst PLATFORM_WORKER_UI_ID = 'browserWorkerUi';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n/**\n * Returns whether a platform id represents a web worker app platform.\n * @publicApi\n */\nfunction isPlatformWorkerApp(platformId) {\n return platformId === PLATFORM_WORKER_APP_ID;\n}\n/**\n * Returns whether a platform id represents a web worker UI platform.\n * @publicApi\n */\nfunction isPlatformWorkerUi(platformId) {\n return platformId === PLATFORM_WORKER_UI_ID;\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('15.2.9');\n\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n}\n// De-sugared tree-shakable injection\n// See #23917\n/** @nocollapse */\nViewportScroller.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => new BrowserViewportScroller(ɵɵinject(DOCUMENT), window)\n});\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n if (this.supportsScrolling()) {\n return [this.window.pageXOffset, this.window.pageYOffset];\n }\n else {\n return [0, 0];\n }\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n if (this.supportsScrolling()) {\n this.window.scrollTo(position[0], position[1]);\n }\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n if (!this.supportsScrolling()) {\n return;\n }\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n //\n // @see https://html.spec.whatwg.org/#get-the-focusable-area\n // @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n // @see https://html.spec.whatwg.org/#focusable-area\n elSelected.focus();\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n if (this.supportScrollRestoration()) {\n const history = this.window.history;\n if (history && history.scrollRestoration) {\n history.scrollRestoration = scrollRestoration;\n }\n }\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n /**\n * We only support scroll restoration when we can get a hold of window.\n * This means that we do not support this behavior when running in a web worker.\n *\n * Lifting this restriction right now would require more changes in the dom adapter.\n * Since webworkers aren't widely used, we will lift it once RouterScroller is\n * battle-tested.\n */\n supportScrollRestoration() {\n try {\n if (!this.supportsScrolling()) {\n return false;\n }\n // The `scrollRestoration` property could be on the `history` instance or its prototype.\n const scrollRestorationDescriptor = getScrollRestorationProperty(this.window.history) ||\n getScrollRestorationProperty(Object.getPrototypeOf(this.window.history));\n // We can write to the `scrollRestoration` property if it is a writable data field or it has a\n // setter function.\n return !!scrollRestorationDescriptor &&\n !!(scrollRestorationDescriptor.writable || scrollRestorationDescriptor.set);\n }\n catch {\n return false;\n }\n }\n supportsScrolling() {\n try {\n return !!this.window && !!this.window.scrollTo && 'pageXOffset' in this.window;\n }\n catch {\n return false;\n }\n }\n}\nfunction getScrollRestorationProperty(obj) {\n return Object.getOwnPropertyDescriptor(obj, 'scrollRestoration');\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' && document.body &&\n (document.body.createShadowRoot || document.body.attachShadow)) {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n// Converts a string that represents a URL into a URL class instance.\nfunction getUrl(src, win) {\n // Don't use a base URL is the URL is absolute.\n return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);\n}\n// Checks whether a URL is absolute (i.e. starts with `http://` or `https://`).\nfunction isAbsoluteUrl(src) {\n return /^https?:\\/\\//.test(src);\n}\n// Given a URL, extract the hostname part.\n// If a URL is a relative one - the URL is returned as is.\nfunction extractHostname(url) {\n return isAbsoluteUrl(url) ? (new URL(url)).hostname : url;\n}\nfunction isValidPath(path) {\n const isString = typeof path === 'string';\n if (!isString || path.trim() === '') {\n return false;\n }\n // Calling new URL() will throw if the path string is malformed\n try {\n const url = new URL(path);\n return true;\n }\n catch {\n return false;\n }\n}\nfunction normalizePath(path) {\n return path.endsWith('/') ? path.slice(0, -1) : path;\n}\nfunction normalizeSrc(src) {\n return src.startsWith('/') ? src.slice(1) : src;\n}\n\n/**\n * Noop image loader that does no transformation to the original src and just returns it as is.\n * This loader is used as a default one if more specific logic is not provided in an app config.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n */\nconst noopImageLoader = (config) => config.src;\n/**\n * Injection token that configures the image loader function.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n * @publicApi\n */\nconst IMAGE_LOADER = new InjectionToken('ImageLoader', {\n providedIn: 'root',\n factory: () => noopImageLoader,\n});\n/**\n * Internal helper function that makes it easier to introduce custom image loaders for the\n * `NgOptimizedImage` directive. It is enough to specify a URL builder function to obtain full DI\n * configuration for a given loader: a DI token corresponding to the actual loader function, plus DI\n * tokens managing preconnect check functionality.\n * @param buildUrlFn a function returning a full URL based on loader's configuration\n * @param exampleUrls example of full URLs for a given loader (used in error messages)\n * @returns a set of DI providers corresponding to the configured image loader\n */\nfunction createImageLoader(buildUrlFn, exampleUrls) {\n return function provideImageLoader(path) {\n if (!isValidPath(path)) {\n throwInvalidPathError(path, exampleUrls || []);\n }\n // The trailing / is stripped (if provided) to make URL construction (concatenation) easier in\n // the individual loader functions.\n path = normalizePath(path);\n const loaderFn = (config) => {\n if (isAbsoluteUrl(config.src)) {\n // Image loader functions expect an image file name (e.g. `my-image.png`)\n // or a relative path + a file name (e.g. `/a/b/c/my-image.png`) as an input,\n // so the final absolute URL can be constructed.\n // When an absolute URL is provided instead - the loader can not\n // build a final URL, thus the error is thrown to indicate that.\n throwUnexpectedAbsoluteUrlError(path, config.src);\n }\n return buildUrlFn(path, { ...config, src: normalizeSrc(config.src) });\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n };\n}\nfunction throwInvalidPathError(path, exampleUrls) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply a path using one of the following formats: ${exampleUrls.join(' or ')}`);\n}\nfunction throwUnexpectedAbsoluteUrlError(path, url) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected a \\`\\` tag with an invalid \\`ngSrc\\` attribute: ${url}. ` +\n `This image loader expects \\`ngSrc\\` to be a relative URL - ` +\n `however the provided value is an absolute URL. ` +\n `To fix this, provide \\`ngSrc\\` as a path relative to the base URL ` +\n `configured for this loader (\\`${path}\\`).`);\n}\n\n/**\n * Function that generates an ImageLoader for [Cloudflare Image\n * Resizing](https://developers.cloudflare.com/images/image-resizing/) and turns it into an Angular\n * provider. Note: Cloudflare has multiple image products - this provider is specifically for\n * Cloudflare Image Resizing; it will not work with Cloudflare Images or Cloudflare Polish.\n *\n * @param path Your domain name, e.g. https://mysite.com\n * @returns Provider that provides an ImageLoader function\n *\n * @publicApi\n */\nconst provideCloudflareLoader = createImageLoader(createCloudflareUrl, ngDevMode ? ['https:///cdn-cgi/image//'] : undefined);\nfunction createCloudflareUrl(path, config) {\n let params = `format=auto`;\n if (config.width) {\n params += `,width=${config.width}`;\n }\n // Cloudflare image URLs format:\n // https://developers.cloudflare.com/images/image-resizing/url-format/\n return `${path}/cdn-cgi/image/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for Cloudinary.\n */\nconst cloudinaryLoaderInfo = {\n name: 'Cloudinary',\n testUrl: isCloudinaryUrl\n};\nconst CLOUDINARY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.cloudinary\\.com\\/.+/;\n/**\n * Tests whether a URL is from Cloudinary CDN.\n */\nfunction isCloudinaryUrl(url) {\n return CLOUDINARY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Cloudinary and turns it into an Angular provider.\n *\n * @param path Base URL of your Cloudinary images\n * This URL should match one of the following formats:\n * https://res.cloudinary.com/mysite\n * https://mysite.cloudinary.com\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the Cloudinary loader.\n *\n * @publicApi\n */\nconst provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode ?\n [\n 'https://res.cloudinary.com/mysite', 'https://mysite.cloudinary.com',\n 'https://subdomain.mysite.com'\n ] :\n undefined);\nfunction createCloudinaryUrl(path, config) {\n // Cloudinary image URLformat:\n // https://cloudinary.com/documentation/image_transformations#transformation_url_structure\n // Example of a Cloudinary image URL:\n // https://res.cloudinary.com/mysite/image/upload/c_scale,f_auto,q_auto,w_600/marketing/tile-topics-m.png\n let params = `f_auto,q_auto`; // sets image format and quality to \"auto\"\n if (config.width) {\n params += `,w_${config.width}`;\n }\n return `${path}/image/upload/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for ImageKit.\n */\nconst imageKitLoaderInfo = {\n name: 'ImageKit',\n testUrl: isImageKitUrl,\n};\nconst IMAGE_KIT_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imagekit\\.io\\/.+/;\n/**\n * Tests whether a URL is from ImageKit CDN.\n */\nfunction isImageKitUrl(url) {\n return IMAGE_KIT_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for ImageKit and turns it into an Angular provider.\n *\n * @param path Base URL of your ImageKit images\n * This URL should match one of the following formats:\n * https://ik.imagekit.io/myaccount\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the ImageKit loader.\n *\n * @publicApi\n */\nconst provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ['https://ik.imagekit.io/mysite', 'https://subdomain.mysite.com'] : undefined);\nfunction createImagekitUrl(path, config) {\n // Example of an ImageKit image URL:\n // https://ik.imagekit.io/demo/tr:w-300,h-300/medium_cafe_B1iTdD0C.jpg\n const { src, width } = config;\n let urlSegments;\n if (width) {\n const params = `tr:w-${width}`;\n urlSegments = [path, params, src];\n }\n else {\n urlSegments = [path, src];\n }\n return urlSegments.join('/');\n}\n\n/**\n * Name and URL tester for Imgix.\n */\nconst imgixLoaderInfo = {\n name: 'Imgix',\n testUrl: isImgixUrl\n};\nconst IMGIX_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imgix\\.net\\/.+/;\n/**\n * Tests whether a URL is from Imgix CDN.\n */\nfunction isImgixUrl(url) {\n return IMGIX_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Imgix and turns it into an Angular provider.\n *\n * @param path path to the desired Imgix origin,\n * e.g. https://somepath.imgix.net or https://images.mysite.com\n * @returns Set of providers to configure the Imgix loader.\n *\n * @publicApi\n */\nconst provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ['https://somepath.imgix.net/'] : undefined);\nfunction createImgixUrl(path, config) {\n const url = new URL(`${path}/${config.src}`);\n // This setting ensures the smallest allowable format is set.\n url.searchParams.set('auto', 'format');\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n return url.href;\n}\n\n// Assembles directive details string, useful for error messages.\nfunction imgDirectiveDetails(ngSrc, includeNgSrc = true) {\n const ngSrcInfo = includeNgSrc ? `(activated on an element with the \\`ngSrc=\"${ngSrc}\"\\`) ` : '';\n return `The NgOptimizedImage directive ${ngSrcInfo}has detected that`;\n}\n\n/**\n * Asserts that the application is in development mode. Throws an error if the application is in\n * production mode. This assert can be used to make sure that there is no dev-mode code invoked in\n * the prod mode accidentally.\n */\nfunction assertDevMode(checkName) {\n if (!ngDevMode) {\n throw new ɵRuntimeError(2958 /* RuntimeErrorCode.UNEXPECTED_DEV_MODE_CHECK_IN_PROD_MODE */, `Unexpected invocation of the ${checkName} in the prod mode. ` +\n `Please make sure that the prod mode is enabled for production builds.`);\n }\n}\n\n/**\n * Observer that detects whether an image with `NgOptimizedImage`\n * is treated as a Largest Contentful Paint (LCP) element. If so,\n * asserts that the image has the `priority` attribute.\n *\n * Note: this is a dev-mode only class and it does not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n *\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript.\n */\nclass LCPImageObserver {\n constructor() {\n // Map of full image URLs -> original `ngSrc` values.\n this.images = new Map();\n // Keep track of images for which `console.warn` was produced.\n this.alreadyWarned = new Set();\n this.window = null;\n this.observer = null;\n assertDevMode('LCP checker');\n const win = inject(DOCUMENT).defaultView;\n if (typeof win !== 'undefined' && typeof PerformanceObserver !== 'undefined') {\n this.window = win;\n this.observer = this.initPerformanceObserver();\n }\n }\n /**\n * Inits PerformanceObserver and subscribes to LCP events.\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript\n */\n initPerformanceObserver() {\n const observer = new PerformanceObserver((entryList) => {\n const entries = entryList.getEntries();\n if (entries.length === 0)\n return;\n // We use the latest entry produced by the `PerformanceObserver` as the best\n // signal on which element is actually an LCP one. As an example, the first image to load on\n // a page, by virtue of being the only thing on the page so far, is often a LCP candidate\n // and gets reported by PerformanceObserver, but isn't necessarily the LCP element.\n const lcpElement = entries[entries.length - 1];\n // Cast to `any` due to missing `element` on the `LargestContentfulPaint` type of entry.\n // See https://developer.mozilla.org/en-US/docs/Web/API/LargestContentfulPaint\n const imgSrc = lcpElement.element?.src ?? '';\n // Exclude `data:` and `blob:` URLs, since they are not supported by the directive.\n if (imgSrc.startsWith('data:') || imgSrc.startsWith('blob:'))\n return;\n const imgNgSrc = this.images.get(imgSrc);\n if (imgNgSrc && !this.alreadyWarned.has(imgSrc)) {\n this.alreadyWarned.add(imgSrc);\n logMissingPriorityWarning(imgSrc);\n }\n });\n observer.observe({ type: 'largest-contentful-paint', buffered: true });\n return observer;\n }\n registerImage(rewrittenSrc, originalNgSrc) {\n if (!this.observer)\n return;\n this.images.set(getUrl(rewrittenSrc, this.window).href, originalNgSrc);\n }\n unregisterImage(rewrittenSrc) {\n if (!this.observer)\n return;\n this.images.delete(getUrl(rewrittenSrc, this.window).href);\n }\n ngOnDestroy() {\n if (!this.observer)\n return;\n this.observer.disconnect();\n this.images.clear();\n this.alreadyWarned.clear();\n }\n}\nLCPImageObserver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LCPImageObserver, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLCPImageObserver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LCPImageObserver, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LCPImageObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\nfunction logMissingPriorityWarning(ngSrc) {\n const directiveDetails = imgDirectiveDetails(ngSrc);\n console.warn(ɵformatRuntimeError(2955 /* RuntimeErrorCode.LCP_IMG_MISSING_PRIORITY */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element but was not marked \"priority\". This image should be marked ` +\n `\"priority\" in order to prioritize its loading. ` +\n `To fix this, add the \"priority\" attribute.`));\n}\n\n// Set of origins that are always excluded from the preconnect checks.\nconst INTERNAL_PRECONNECT_CHECK_BLOCKLIST = new Set(['localhost', '127.0.0.1', '0.0.0.0']);\n/**\n * Injection token to configure which origins should be excluded\n * from the preconnect checks. It can either be a single string or an array of strings\n * to represent a group of origins, for example:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST, useValue: 'https://your-domain.com'}\n * ```\n *\n * or:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST,\n * useValue: ['https://your-domain-1.com', 'https://your-domain-2.com']}\n * ```\n *\n * @publicApi\n */\nconst PRECONNECT_CHECK_BLOCKLIST = new InjectionToken('PRECONNECT_CHECK_BLOCKLIST');\n/**\n * Contains the logic to detect whether an image, marked with the \"priority\" attribute\n * has a corresponding `` tag in the `document.head`.\n *\n * Note: this is a dev-mode only class, which should not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n */\nclass PreconnectLinkChecker {\n constructor() {\n this.document = inject(DOCUMENT);\n /**\n * Set of tags found on this page.\n * The `null` value indicates that there was no DOM query operation performed.\n */\n this.preconnectLinks = null;\n /*\n * Keep track of all already seen origin URLs to avoid repeating the same check.\n */\n this.alreadySeen = new Set();\n this.window = null;\n this.blocklist = new Set(INTERNAL_PRECONNECT_CHECK_BLOCKLIST);\n assertDevMode('preconnect link checker');\n const win = this.document.defaultView;\n if (typeof win !== 'undefined') {\n this.window = win;\n }\n const blocklist = inject(PRECONNECT_CHECK_BLOCKLIST, { optional: true });\n if (blocklist) {\n this.populateBlocklist(blocklist);\n }\n }\n populateBlocklist(origins) {\n if (Array.isArray(origins)) {\n deepForEach(origins, origin => {\n this.blocklist.add(extractHostname(origin));\n });\n }\n else {\n this.blocklist.add(extractHostname(origins));\n }\n }\n /**\n * Checks that a preconnect resource hint exists in the head for the\n * given src.\n *\n * @param rewrittenSrc src formatted with loader\n * @param originalNgSrc ngSrc value\n */\n assertPreconnect(rewrittenSrc, originalNgSrc) {\n if (!this.window)\n return;\n const imgUrl = getUrl(rewrittenSrc, this.window);\n if (this.blocklist.has(imgUrl.hostname) || this.alreadySeen.has(imgUrl.origin))\n return;\n // Register this origin as seen, so we don't check it again later.\n this.alreadySeen.add(imgUrl.origin);\n if (!this.preconnectLinks) {\n // Note: we query for preconnect links only *once* and cache the results\n // for the entire lifespan of an application, since it's unlikely that the\n // list would change frequently. This allows to make sure there are no\n // performance implications of making extra DOM lookups for each image.\n this.preconnectLinks = this.queryPreconnectLinks();\n }\n if (!this.preconnectLinks.has(imgUrl.origin)) {\n console.warn(ɵformatRuntimeError(2956 /* RuntimeErrorCode.PRIORITY_IMG_MISSING_PRECONNECT_TAG */, `${imgDirectiveDetails(originalNgSrc)} there is no preconnect tag present for this ` +\n `image. Preconnecting to the origin(s) that serve priority images ensures that these ` +\n `images are delivered as soon as possible. To fix this, please add the following ` +\n `element into the of the document:\\n` +\n ` `));\n }\n }\n queryPreconnectLinks() {\n const preconnectUrls = new Set();\n const selector = 'link[rel=preconnect]';\n const links = Array.from(this.document.querySelectorAll(selector));\n for (let link of links) {\n const url = getUrl(link.href, this.window);\n preconnectUrls.add(url.origin);\n }\n return preconnectUrls;\n }\n ngOnDestroy() {\n this.preconnectLinks?.clear();\n this.alreadySeen.clear();\n }\n}\nPreconnectLinkChecker.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreconnectLinkChecker, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPreconnectLinkChecker.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreconnectLinkChecker, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreconnectLinkChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\n/**\n * Invokes a callback for each element in the array. Also invokes a callback\n * recursively for each nested array.\n */\nfunction deepForEach(input, fn) {\n for (let value of input) {\n Array.isArray(value) ? deepForEach(value, fn) : fn(value);\n }\n}\n\n/**\n * In SSR scenarios, a preload `` element is generated for priority images.\n * Having a large number of preload tags may negatively affect the performance,\n * so we warn developers (by throwing an error) if the number of preloaded images\n * is above a certain threshold. This const specifies this threshold.\n */\nconst DEFAULT_PRELOADED_IMAGES_LIMIT = 5;\n/**\n * Helps to keep track of priority images that already have a corresponding\n * preload tag (to avoid generating multiple preload tags with the same URL).\n *\n * This Set tracks the original src passed into the `ngSrc` input not the src after it has been\n * run through the specified `IMAGE_LOADER`.\n */\nconst PRELOADED_IMAGES = new InjectionToken('NG_OPTIMIZED_PRELOADED_IMAGES', { providedIn: 'root', factory: () => new Set() });\n\n/**\n * @description Contains the logic needed to track and add preload link tags to the `` tag. It\n * will also track what images have already had preload link tags added so as to not duplicate link\n * tags.\n *\n * In dev mode this service will validate that the number of preloaded images does not exceed the\n * configured default preloaded images limit: {@link DEFAULT_PRELOADED_IMAGES_LIMIT}.\n */\nclass PreloadLinkCreator {\n constructor() {\n this.preloadedImages = inject(PRELOADED_IMAGES);\n this.document = inject(DOCUMENT);\n }\n /**\n * @description Add a preload `` to the `` of the `index.html` that is served from the\n * server while using Angular Universal and SSR to kick off image loads for high priority images.\n *\n * The `sizes` (passed in from the user) and `srcset` (parsed and formatted from `ngSrcset`)\n * properties used to set the corresponding attributes, `imagesizes` and `imagesrcset`\n * respectively, on the preload `` tag so that the correctly sized image is preloaded from\n * the CDN.\n *\n * {@link https://web.dev/preload-responsive-images/#imagesrcset-and-imagesizes}\n *\n * @param renderer The `Renderer2` passed in from the directive\n * @param src The original src of the image that is set on the `ngSrc` input.\n * @param srcset The parsed and formatted srcset created from the `ngSrcset` input\n * @param sizes The value of the `sizes` attribute passed in to the `` tag\n */\n createPreloadLinkTag(renderer, src, srcset, sizes) {\n if (ngDevMode) {\n if (this.preloadedImages.size >= DEFAULT_PRELOADED_IMAGES_LIMIT) {\n throw new ɵRuntimeError(2961 /* RuntimeErrorCode.TOO_MANY_PRELOADED_IMAGES */, ngDevMode &&\n `The \\`NgOptimizedImage\\` directive has detected that more than ` +\n `${DEFAULT_PRELOADED_IMAGES_LIMIT} images were marked as priority. ` +\n `This might negatively affect an overall performance of the page. ` +\n `To fix this, remove the \"priority\" attribute from images with less priority.`);\n }\n }\n if (this.preloadedImages.has(src)) {\n return;\n }\n this.preloadedImages.add(src);\n const preload = renderer.createElement('link');\n renderer.setAttribute(preload, 'as', 'image');\n renderer.setAttribute(preload, 'href', src);\n renderer.setAttribute(preload, 'rel', 'preload');\n renderer.setAttribute(preload, 'fetchpriority', 'high');\n if (sizes) {\n renderer.setAttribute(preload, 'imageSizes', sizes);\n }\n if (srcset) {\n renderer.setAttribute(preload, 'imageSrcset', srcset);\n }\n renderer.appendChild(this.document.head, preload);\n }\n}\nPreloadLinkCreator.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreloadLinkCreator, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPreloadLinkCreator.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreloadLinkCreator, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreloadLinkCreator, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * When a Base64-encoded image is passed as an input to the `NgOptimizedImage` directive,\n * an error is thrown. The image content (as a string) might be very long, thus making\n * it hard to read an error message if the entire string is included. This const defines\n * the number of characters that should be included into the error message. The rest\n * of the content is truncated.\n */\nconst BASE64_IMG_MAX_LENGTH_IN_ERROR = 50;\n/**\n * RegExpr to determine whether a src in a srcset is using width descriptors.\n * Should match something like: \"100w, 200w\".\n */\nconst VALID_WIDTH_DESCRIPTOR_SRCSET = /^((\\s*\\d+w\\s*(,|$)){1,})$/;\n/**\n * RegExpr to determine whether a src in a srcset is using density descriptors.\n * Should match something like: \"1x, 2x, 50x\". Also supports decimals like \"1.5x, 1.50x\".\n */\nconst VALID_DENSITY_DESCRIPTOR_SRCSET = /^((\\s*\\d+(\\.\\d+)?x\\s*(,|$)){1,})$/;\n/**\n * Srcset values with a density descriptor higher than this value will actively\n * throw an error. Such densities are not permitted as they cause image sizes\n * to be unreasonably large and slow down LCP.\n */\nconst ABSOLUTE_SRCSET_DENSITY_CAP = 3;\n/**\n * Used only in error message text to communicate best practices, as we will\n * only throw based on the slightly more conservative ABSOLUTE_SRCSET_DENSITY_CAP.\n */\nconst RECOMMENDED_SRCSET_DENSITY_CAP = 2;\n/**\n * Used in generating automatic density-based srcsets\n */\nconst DENSITY_SRCSET_MULTIPLIERS = [1, 2];\n/**\n * Used to determine which breakpoints to use on full-width images\n */\nconst VIEWPORT_BREAKPOINT_CUTOFF = 640;\n/**\n * Used to determine whether two aspect ratios are similar in value.\n */\nconst ASPECT_RATIO_TOLERANCE = .1;\n/**\n * Used to determine whether the image has been requested at an overly\n * large size compared to the actual rendered image size (after taking\n * into account a typical device pixel ratio). In pixels.\n */\nconst OVERSIZED_IMAGE_TOLERANCE = 1000;\n/**\n * Used to limit automatic srcset generation of very large sources for\n * fixed-size images. In pixels.\n */\nconst FIXED_SRCSET_WIDTH_LIMIT = 1920;\nconst FIXED_SRCSET_HEIGHT_LIMIT = 1080;\n/** Info about built-in loaders we can test for. */\nconst BUILT_IN_LOADERS = [imgixLoaderInfo, imageKitLoaderInfo, cloudinaryLoaderInfo];\nconst defaultConfig = {\n breakpoints: [16, 32, 48, 64, 96, 128, 256, 384, 640, 750, 828, 1080, 1200, 1920, 2048, 3840],\n};\n/**\n * Injection token that configures the image optimized image functionality.\n *\n * @see `NgOptimizedImage`\n * @publicApi\n * @developerPreview\n */\nconst IMAGE_CONFIG = new InjectionToken('ImageConfig', { providedIn: 'root', factory: () => defaultConfig });\n/**\n * Directive that improves image loading performance by enforcing best practices.\n *\n * `NgOptimizedImage` ensures that the loading of the Largest Contentful Paint (LCP) image is\n * prioritized by:\n * - Automatically setting the `fetchpriority` attribute on the `` tag\n * - Lazy loading non-priority images by default\n * - Asserting that there is a corresponding preconnect link tag in the document head\n *\n * In addition, the directive:\n * - Generates appropriate asset URLs if a corresponding `ImageLoader` function is provided\n * - Automatically generates a srcset\n * - Requires that `width` and `height` are set\n * - Warns if `width` or `height` have been set incorrectly\n * - Warns if the image will be visually distorted when rendered\n *\n * @usageNotes\n * The `NgOptimizedImage` directive is marked as [standalone](guide/standalone-components) and can\n * be imported directly.\n *\n * Follow the steps below to enable and use the directive:\n * 1. Import it into the necessary NgModule or a standalone Component.\n * 2. Optionally provide an `ImageLoader` if you use an image hosting service.\n * 3. Update the necessary `` tags in templates and replace `src` attributes with `ngSrc`.\n * Using a `ngSrc` allows the directive to control when the `src` gets set, which triggers an image\n * download.\n *\n * Step 1: import the `NgOptimizedImage` directive.\n *\n * ```typescript\n * import { NgOptimizedImage } from '@angular/common';\n *\n * // Include it into the necessary NgModule\n * @NgModule({\n * imports: [NgOptimizedImage],\n * })\n * class AppModule {}\n *\n * // ... or a standalone Component\n * @Component({\n * standalone: true\n * imports: [NgOptimizedImage],\n * })\n * class MyStandaloneComponent {}\n * ```\n *\n * Step 2: configure a loader.\n *\n * To use the **default loader**: no additional code changes are necessary. The URL returned by the\n * generic loader will always match the value of \"src\". In other words, this loader applies no\n * transformations to the resource URL and the value of the `ngSrc` attribute will be used as is.\n *\n * To use an existing loader for a **third-party image service**: add the provider factory for your\n * chosen service to the `providers` array. In the example below, the Imgix loader is used:\n *\n * ```typescript\n * import {provideImgixLoader} from '@angular/common';\n *\n * // Call the function and add the result to the `providers` array:\n * providers: [\n * provideImgixLoader(\"https://my.base.url/\"),\n * ],\n * ```\n *\n * The `NgOptimizedImage` directive provides the following functions:\n * - `provideCloudflareLoader`\n * - `provideCloudinaryLoader`\n * - `provideImageKitLoader`\n * - `provideImgixLoader`\n *\n * If you use a different image provider, you can create a custom loader function as described\n * below.\n *\n * To use a **custom loader**: provide your loader function as a value for the `IMAGE_LOADER` DI\n * token.\n *\n * ```typescript\n * import {IMAGE_LOADER, ImageLoaderConfig} from '@angular/common';\n *\n * // Configure the loader using the `IMAGE_LOADER` token.\n * providers: [\n * {\n * provide: IMAGE_LOADER,\n * useValue: (config: ImageLoaderConfig) => {\n * return `https://example.com/${config.src}-${config.width}.jpg}`;\n * }\n * },\n * ],\n * ```\n *\n * Step 3: update `` tags in templates to use `ngSrc` instead of `src`.\n *\n * ```\n * \n * ```\n *\n * @publicApi\n */\nclass NgOptimizedImage {\n constructor() {\n this.imageLoader = inject(IMAGE_LOADER);\n this.config = processConfig(inject(IMAGE_CONFIG));\n this.renderer = inject(Renderer2);\n this.imgElement = inject(ElementRef).nativeElement;\n this.injector = inject(Injector);\n this.isServer = isPlatformServer(inject(PLATFORM_ID));\n this.preloadLinkChecker = inject(PreloadLinkCreator);\n // a LCP image observer - should be injected only in the dev mode\n this.lcpObserver = ngDevMode ? this.injector.get(LCPImageObserver) : null;\n /**\n * Calculate the rewritten `src` once and store it.\n * This is needed to avoid repetitive calculations and make sure the directive cleanup in the\n * `ngOnDestroy` does not rely on the `IMAGE_LOADER` logic (which in turn can rely on some other\n * instance that might be already destroyed).\n */\n this._renderedSrc = null;\n this._priority = false;\n this._disableOptimizedSrcset = false;\n this._fill = false;\n }\n /**\n * For responsive images: the intrinsic width of the image in pixels.\n * For fixed size images: the desired rendered width of the image in pixels.\n */\n set width(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'width');\n this._width = inputToInteger(value);\n }\n get width() {\n return this._width;\n }\n /**\n * For responsive images: the intrinsic height of the image in pixels.\n * For fixed size images: the desired rendered height of the image in pixels.* The intrinsic\n * height of the image in pixels.\n */\n set height(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'height');\n this._height = inputToInteger(value);\n }\n get height() {\n return this._height;\n }\n /**\n * Indicates whether this image should have a high priority.\n */\n set priority(value) {\n this._priority = inputToBoolean(value);\n }\n get priority() {\n return this._priority;\n }\n /**\n * Disables automatic srcset generation for this image.\n */\n set disableOptimizedSrcset(value) {\n this._disableOptimizedSrcset = inputToBoolean(value);\n }\n get disableOptimizedSrcset() {\n return this._disableOptimizedSrcset;\n }\n /**\n * Sets the image to \"fill mode\", which eliminates the height/width requirement and adds\n * styles such that the image fills its containing element.\n *\n * @developerPreview\n */\n set fill(value) {\n this._fill = inputToBoolean(value);\n }\n get fill() {\n return this._fill;\n }\n /** @nodoc */\n ngOnInit() {\n if (ngDevMode) {\n assertNonEmptyInput(this, 'ngSrc', this.ngSrc);\n assertValidNgSrcset(this, this.ngSrcset);\n assertNoConflictingSrc(this);\n if (this.ngSrcset) {\n assertNoConflictingSrcset(this);\n }\n assertNotBase64Image(this);\n assertNotBlobUrl(this);\n if (this.fill) {\n assertEmptyWidthAndHeight(this);\n assertNonZeroRenderedHeight(this, this.imgElement, this.renderer);\n }\n else {\n assertNonEmptyWidthAndHeight(this);\n // Only check for distorted images when not in fill mode, where\n // images may be intentionally stretched, cropped or letterboxed.\n assertNoImageDistortion(this, this.imgElement, this.renderer);\n }\n assertValidLoadingInput(this);\n if (!this.ngSrcset) {\n assertNoComplexSizes(this);\n }\n assertNotMissingBuiltInLoader(this.ngSrc, this.imageLoader);\n assertNoNgSrcsetWithoutLoader(this, this.imageLoader);\n assertNoLoaderParamsWithoutLoader(this, this.imageLoader);\n if (this.priority) {\n const checker = this.injector.get(PreconnectLinkChecker);\n checker.assertPreconnect(this.getRewrittenSrc(), this.ngSrc);\n }\n else {\n // Monitor whether an image is an LCP element only in case\n // the `priority` attribute is missing. Otherwise, an image\n // has the necessary settings and no extra checks are required.\n if (this.lcpObserver !== null) {\n const ngZone = this.injector.get(NgZone);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver.registerImage(this.getRewrittenSrc(), this.ngSrc);\n });\n }\n }\n }\n this.setHostAttributes();\n }\n setHostAttributes() {\n // Must set width/height explicitly in case they are bound (in which case they will\n // only be reflected and not found by the browser)\n if (this.fill) {\n if (!this.sizes) {\n this.sizes = '100vw';\n }\n }\n else {\n this.setHostAttribute('width', this.width.toString());\n this.setHostAttribute('height', this.height.toString());\n }\n this.setHostAttribute('loading', this.getLoadingBehavior());\n this.setHostAttribute('fetchpriority', this.getFetchPriority());\n // The `data-ng-img` attribute flags an image as using the directive, to allow\n // for analysis of the directive's performance.\n this.setHostAttribute('ng-img', 'true');\n // The `src` and `srcset` attributes should be set last since other attributes\n // could affect the image's loading behavior.\n const rewrittenSrc = this.getRewrittenSrc();\n this.setHostAttribute('src', rewrittenSrc);\n let rewrittenSrcset = undefined;\n if (this.sizes) {\n this.setHostAttribute('sizes', this.sizes);\n }\n if (this.ngSrcset) {\n rewrittenSrcset = this.getRewrittenSrcset();\n }\n else if (this.shouldGenerateAutomaticSrcset()) {\n rewrittenSrcset = this.getAutomaticSrcset();\n }\n if (rewrittenSrcset) {\n this.setHostAttribute('srcset', rewrittenSrcset);\n }\n if (this.isServer && this.priority) {\n this.preloadLinkChecker.createPreloadLinkTag(this.renderer, rewrittenSrc, rewrittenSrcset, this.sizes);\n }\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (ngDevMode) {\n assertNoPostInitInputChange(this, changes, [\n 'ngSrc',\n 'ngSrcset',\n 'width',\n 'height',\n 'priority',\n 'fill',\n 'loading',\n 'sizes',\n 'loaderParams',\n 'disableOptimizedSrcset',\n ]);\n }\n }\n callImageLoader(configWithoutCustomParams) {\n let augmentedConfig = configWithoutCustomParams;\n if (this.loaderParams) {\n augmentedConfig.loaderParams = this.loaderParams;\n }\n return this.imageLoader(augmentedConfig);\n }\n getLoadingBehavior() {\n if (!this.priority && this.loading !== undefined) {\n return this.loading;\n }\n return this.priority ? 'eager' : 'lazy';\n }\n getFetchPriority() {\n return this.priority ? 'high' : 'auto';\n }\n getRewrittenSrc() {\n // ImageLoaderConfig supports setting a width property. However, we're not setting width here\n // because if the developer uses rendered width instead of intrinsic width in the HTML width\n // attribute, the image requested may be too small for 2x+ screens.\n if (!this._renderedSrc) {\n const imgConfig = { src: this.ngSrc };\n // Cache calculated image src to reuse it later in the code.\n this._renderedSrc = this.callImageLoader(imgConfig);\n }\n return this._renderedSrc;\n }\n getRewrittenSrcset() {\n const widthSrcSet = VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset);\n const finalSrcs = this.ngSrcset.split(',').filter(src => src !== '').map(srcStr => {\n srcStr = srcStr.trim();\n const width = widthSrcSet ? parseFloat(srcStr) : parseFloat(srcStr) * this.width;\n return `${this.callImageLoader({ src: this.ngSrc, width })} ${srcStr}`;\n });\n return finalSrcs.join(', ');\n }\n getAutomaticSrcset() {\n if (this.sizes) {\n return this.getResponsiveSrcset();\n }\n else {\n return this.getFixedSrcset();\n }\n }\n getResponsiveSrcset() {\n const { breakpoints } = this.config;\n let filteredBreakpoints = breakpoints;\n if (this.sizes?.trim() === '100vw') {\n // Since this is a full-screen-width image, our srcset only needs to include\n // breakpoints with full viewport widths.\n filteredBreakpoints = breakpoints.filter(bp => bp >= VIEWPORT_BREAKPOINT_CUTOFF);\n }\n const finalSrcs = filteredBreakpoints.map(bp => `${this.callImageLoader({ src: this.ngSrc, width: bp })} ${bp}w`);\n return finalSrcs.join(', ');\n }\n getFixedSrcset() {\n const finalSrcs = DENSITY_SRCSET_MULTIPLIERS.map(multiplier => `${this.callImageLoader({\n src: this.ngSrc,\n width: this.width * multiplier\n })} ${multiplier}x`);\n return finalSrcs.join(', ');\n }\n shouldGenerateAutomaticSrcset() {\n return !this._disableOptimizedSrcset && !this.srcset && this.imageLoader !== noopImageLoader &&\n !(this.width > FIXED_SRCSET_WIDTH_LIMIT || this.height > FIXED_SRCSET_HEIGHT_LIMIT);\n }\n /** @nodoc */\n ngOnDestroy() {\n if (ngDevMode) {\n if (!this.priority && this._renderedSrc !== null && this.lcpObserver !== null) {\n this.lcpObserver.unregisterImage(this._renderedSrc);\n }\n }\n }\n setHostAttribute(name, value) {\n this.renderer.setAttribute(this.imgElement, name, value);\n }\n}\nNgOptimizedImage.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgOptimizedImage, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgOptimizedImage.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgOptimizedImage, isStandalone: true, selector: \"img[ngSrc]\", inputs: { ngSrc: \"ngSrc\", ngSrcset: \"ngSrcset\", sizes: \"sizes\", width: \"width\", height: \"height\", loading: \"loading\", priority: \"priority\", loaderParams: \"loaderParams\", disableOptimizedSrcset: \"disableOptimizedSrcset\", fill: \"fill\", src: \"src\", srcset: \"srcset\" }, host: { properties: { \"style.position\": \"fill ? \\\"absolute\\\" : null\", \"style.width\": \"fill ? \\\"100%\\\" : null\", \"style.height\": \"fill ? \\\"100%\\\" : null\", \"style.inset\": \"fill ? \\\"0px\\\" : null\" } }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgOptimizedImage, decorators: [{\n type: Directive,\n args: [{\n standalone: true,\n selector: 'img[ngSrc]',\n host: {\n '[style.position]': 'fill ? \"absolute\" : null',\n '[style.width]': 'fill ? \"100%\" : null',\n '[style.height]': 'fill ? \"100%\" : null',\n '[style.inset]': 'fill ? \"0px\" : null'\n }\n }]\n }], propDecorators: { ngSrc: [{\n type: Input\n }], ngSrcset: [{\n type: Input\n }], sizes: [{\n type: Input\n }], width: [{\n type: Input\n }], height: [{\n type: Input\n }], loading: [{\n type: Input\n }], priority: [{\n type: Input\n }], loaderParams: [{\n type: Input\n }], disableOptimizedSrcset: [{\n type: Input\n }], fill: [{\n type: Input\n }], src: [{\n type: Input\n }], srcset: [{\n type: Input\n }] } });\n/***** Helpers *****/\n/**\n * Convert input value to integer.\n */\nfunction inputToInteger(value) {\n return typeof value === 'string' ? parseInt(value, 10) : value;\n}\n/**\n * Convert input value to boolean.\n */\nfunction inputToBoolean(value) {\n return value != null && `${value}` !== 'false';\n}\n/**\n * Sorts provided config breakpoints and uses defaults.\n */\nfunction processConfig(config) {\n let sortedBreakpoints = {};\n if (config.breakpoints) {\n sortedBreakpoints.breakpoints = config.breakpoints.sort((a, b) => a - b);\n }\n return Object.assign({}, defaultConfig, config, sortedBreakpoints);\n}\n/***** Assert functions *****/\n/**\n * Verifies that there is no `src` set on a host element.\n */\nfunction assertNoConflictingSrc(dir) {\n if (dir.src) {\n throw new ɵRuntimeError(2950 /* RuntimeErrorCode.UNEXPECTED_SRC_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`src\\` and \\`ngSrc\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`src\\` itself based on the value of \\`ngSrc\\`. ` +\n `To fix this, please remove the \\`src\\` attribute.`);\n }\n}\n/**\n * Verifies that there is no `srcset` set on a host element.\n */\nfunction assertNoConflictingSrcset(dir) {\n if (dir.srcset) {\n throw new ɵRuntimeError(2951 /* RuntimeErrorCode.UNEXPECTED_SRCSET_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`srcset\\` and \\`ngSrcset\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`srcset\\` itself based on the value of ` +\n `\\`ngSrcset\\`. To fix this, please remove the \\`srcset\\` attribute.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Base64-encoded image.\n */\nfunction assertNotBase64Image(dir) {\n let ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('data:')) {\n if (ngSrc.length > BASE64_IMG_MAX_LENGTH_IN_ERROR) {\n ngSrc = ngSrc.substring(0, BASE64_IMG_MAX_LENGTH_IN_ERROR) + '...';\n }\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`ngSrc\\` is a Base64-encoded string ` +\n `(${ngSrc}). NgOptimizedImage does not support Base64-encoded strings. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a standard \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the 'sizes' only includes responsive values.\n */\nfunction assertNoComplexSizes(dir) {\n let sizes = dir.sizes;\n if (sizes?.match(/((\\)|,)\\s|^)\\d+px/)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`sizes\\` was set to a string including ` +\n `pixel values. For automatic \\`srcset\\` generation, \\`sizes\\` must only include responsive ` +\n `values, such as \\`sizes=\"50vw\"\\` or \\`sizes=\"(min-width: 768px) 50vw, 100vw\"\\`. ` +\n `To fix this, modify the \\`sizes\\` attribute, or provide your own \\`ngSrcset\\` value directly.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Blob URL.\n */\nfunction assertNotBlobUrl(dir) {\n const ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('blob:')) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrc\\` was set to a blob URL (${ngSrc}). ` +\n `Blob URLs are not supported by the NgOptimizedImage directive. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a regular \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the input is set to a non-empty string.\n */\nfunction assertNonEmptyInput(dir, name, value) {\n const isString = typeof value === 'string';\n const isEmptyString = isString && value.trim() === '';\n if (!isString || isEmptyString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${name}\\` has an invalid value ` +\n `(\\`${value}\\`). To fix this, change the value to a non-empty string.`);\n }\n}\n/**\n * Verifies that the `ngSrcset` is in a valid format, e.g. \"100w, 200w\" or \"1x, 2x\".\n */\nfunction assertValidNgSrcset(dir, value) {\n if (value == null)\n return;\n assertNonEmptyInput(dir, 'ngSrcset', value);\n const stringVal = value;\n const isValidWidthDescriptor = VALID_WIDTH_DESCRIPTOR_SRCSET.test(stringVal);\n const isValidDensityDescriptor = VALID_DENSITY_DESCRIPTOR_SRCSET.test(stringVal);\n if (isValidDensityDescriptor) {\n assertUnderDensityCap(dir, stringVal);\n }\n const isValidSrcset = isValidWidthDescriptor || isValidDensityDescriptor;\n if (!isValidSrcset) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrcset\\` has an invalid value (\\`${value}\\`). ` +\n `To fix this, supply \\`ngSrcset\\` using a comma-separated list of one or more width ` +\n `descriptors (e.g. \"100w, 200w\") or density descriptors (e.g. \"1x, 2x\").`);\n }\n}\nfunction assertUnderDensityCap(dir, value) {\n const underDensityCap = value.split(',').every(num => num === '' || parseFloat(num) <= ABSOLUTE_SRCSET_DENSITY_CAP);\n if (!underDensityCap) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` contains an unsupported image density:` +\n `\\`${value}\\`. NgOptimizedImage generally recommends a max image density of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}x but supports image densities up to ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x. The human eye cannot distinguish between image densities ` +\n `greater than ${RECOMMENDED_SRCSET_DENSITY_CAP}x - which makes them unnecessary for ` +\n `most use cases. Images that will be pinch-zoomed are typically the primary use case for ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x images. Please remove the high density descriptor and try again.`);\n }\n}\n/**\n * Creates a `RuntimeError` instance to represent a situation when an input is set after\n * the directive has initialized.\n */\nfunction postInitInputChangeError(dir, inputName) {\n let reason;\n if (inputName === 'width' || inputName === 'height') {\n reason = `Changing \\`${inputName}\\` may result in different attribute value ` +\n `applied to the underlying image element and cause layout shifts on a page.`;\n }\n else {\n reason = `Changing the \\`${inputName}\\` would have no effect on the underlying ` +\n `image element, because the resource loading has already occurred.`;\n }\n return new ɵRuntimeError(2953 /* RuntimeErrorCode.UNEXPECTED_INPUT_CHANGE */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` was updated after initialization. ` +\n `The NgOptimizedImage directive will not react to this input change. ${reason} ` +\n `To fix this, either switch \\`${inputName}\\` to a static value ` +\n `or wrap the image element in an *ngIf that is gated on the necessary value.`);\n}\n/**\n * Verify that none of the listed inputs has changed.\n */\nfunction assertNoPostInitInputChange(dir, changes, inputs) {\n inputs.forEach(input => {\n const isUpdated = changes.hasOwnProperty(input);\n if (isUpdated && !changes[input].isFirstChange()) {\n if (input === 'ngSrc') {\n // When the `ngSrc` input changes, we detect that only in the\n // `ngOnChanges` hook, thus the `ngSrc` is already set. We use\n // `ngSrc` in the error message, so we use a previous value, but\n // not the updated one in it.\n dir = { ngSrc: changes[input].previousValue };\n }\n throw postInitInputChangeError(dir, input);\n }\n });\n}\n/**\n * Verifies that a specified input is a number greater than 0.\n */\nfunction assertGreaterThanZero(dir, inputValue, inputName) {\n const validNumber = typeof inputValue === 'number' && inputValue > 0;\n const validString = typeof inputValue === 'string' && /^\\d+$/.test(inputValue.trim()) && parseInt(inputValue) > 0;\n if (!validNumber && !validString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` has an invalid value ` +\n `(\\`${inputValue}\\`). To fix this, provide \\`${inputName}\\` ` +\n `as a number greater than 0.`);\n }\n}\n/**\n * Verifies that the rendered image is not visually distorted. Effectively this is checking:\n * - Whether the \"width\" and \"height\" attributes reflect the actual dimensions of the image.\n * - Whether image styling is \"correct\" (see below for a longer explanation).\n */\nfunction assertNoImageDistortion(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n const computedStyle = window.getComputedStyle(img);\n let renderedWidth = parseFloat(computedStyle.getPropertyValue('width'));\n let renderedHeight = parseFloat(computedStyle.getPropertyValue('height'));\n const boxSizing = computedStyle.getPropertyValue('box-sizing');\n if (boxSizing === 'border-box') {\n const paddingTop = computedStyle.getPropertyValue('padding-top');\n const paddingRight = computedStyle.getPropertyValue('padding-right');\n const paddingBottom = computedStyle.getPropertyValue('padding-bottom');\n const paddingLeft = computedStyle.getPropertyValue('padding-left');\n renderedWidth -= parseFloat(paddingRight) + parseFloat(paddingLeft);\n renderedHeight -= parseFloat(paddingTop) + parseFloat(paddingBottom);\n }\n const renderedAspectRatio = renderedWidth / renderedHeight;\n const nonZeroRenderedDimensions = renderedWidth !== 0 && renderedHeight !== 0;\n const intrinsicWidth = img.naturalWidth;\n const intrinsicHeight = img.naturalHeight;\n const intrinsicAspectRatio = intrinsicWidth / intrinsicHeight;\n const suppliedWidth = dir.width;\n const suppliedHeight = dir.height;\n const suppliedAspectRatio = suppliedWidth / suppliedHeight;\n // Tolerance is used to account for the impact of subpixel rendering.\n // Due to subpixel rendering, the rendered, intrinsic, and supplied\n // aspect ratios of a correctly configured image may not exactly match.\n // For example, a `width=4030 height=3020` image might have a rendered\n // size of \"1062w, 796.48h\". (An aspect ratio of 1.334... vs. 1.333...)\n const inaccurateDimensions = Math.abs(suppliedAspectRatio - intrinsicAspectRatio) > ASPECT_RATIO_TOLERANCE;\n const stylingDistortion = nonZeroRenderedDimensions &&\n Math.abs(intrinsicAspectRatio - renderedAspectRatio) > ASPECT_RATIO_TOLERANCE;\n if (inaccurateDimensions) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the image does not match ` +\n `the aspect ratio indicated by the width and height attributes. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). \\nSupplied width and height attributes: ` +\n `${suppliedWidth}w x ${suppliedHeight}h (aspect-ratio: ${suppliedAspectRatio}). ` +\n `\\nTo fix this, update the width and height attributes.`));\n }\n else if (stylingDistortion) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the rendered image ` +\n `does not match the image's intrinsic aspect ratio. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). \\nRendered image size: ` +\n `${renderedWidth}w x ${renderedHeight}h (aspect-ratio: ` +\n `${renderedAspectRatio}). \\nThis issue can occur if \"width\" and \"height\" ` +\n `attributes are added to an image without updating the corresponding ` +\n `image styling. To fix this, adjust image styling. In most cases, ` +\n `adding \"height: auto\" or \"width: auto\" to the image styling will fix ` +\n `this issue.`));\n }\n else if (!dir.ngSrcset && nonZeroRenderedDimensions) {\n // If `ngSrcset` hasn't been set, sanity check the intrinsic size.\n const recommendedWidth = RECOMMENDED_SRCSET_DENSITY_CAP * renderedWidth;\n const recommendedHeight = RECOMMENDED_SRCSET_DENSITY_CAP * renderedHeight;\n const oversizedWidth = (intrinsicWidth - recommendedWidth) >= OVERSIZED_IMAGE_TOLERANCE;\n const oversizedHeight = (intrinsicHeight - recommendedHeight) >= OVERSIZED_IMAGE_TOLERANCE;\n if (oversizedWidth || oversizedHeight) {\n console.warn(ɵformatRuntimeError(2960 /* RuntimeErrorCode.OVERSIZED_IMAGE */, `${imgDirectiveDetails(dir.ngSrc)} the intrinsic image is significantly ` +\n `larger than necessary. ` +\n `\\nRendered image size: ${renderedWidth}w x ${renderedHeight}h. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h. ` +\n `\\nRecommended intrinsic image size: ${recommendedWidth}w x ${recommendedHeight}h. ` +\n `\\nNote: Recommended intrinsic image size is calculated assuming a maximum DPR of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}. To improve loading time, resize the image ` +\n `or consider using the \"ngSrcset\" and \"sizes\" attributes.`));\n }\n }\n });\n}\n/**\n * Verifies that a specified input is set.\n */\nfunction assertNonEmptyWidthAndHeight(dir) {\n let missingAttributes = [];\n if (dir.width === undefined)\n missingAttributes.push('width');\n if (dir.height === undefined)\n missingAttributes.push('height');\n if (missingAttributes.length > 0) {\n throw new ɵRuntimeError(2954 /* RuntimeErrorCode.REQUIRED_INPUT_MISSING */, `${imgDirectiveDetails(dir.ngSrc)} these required attributes ` +\n `are missing: ${missingAttributes.map(attr => `\"${attr}\"`).join(', ')}. ` +\n `Including \"width\" and \"height\" attributes will prevent image-related layout shifts. ` +\n `To fix this, include \"width\" and \"height\" attributes on the image tag or turn on ` +\n `\"fill\" mode with the \\`fill\\` attribute.`);\n }\n}\n/**\n * Verifies that width and height are not set. Used in fill mode, where those attributes don't make\n * sense.\n */\nfunction assertEmptyWidthAndHeight(dir) {\n if (dir.width || dir.height) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the attributes \\`height\\` and/or \\`width\\` are present ` +\n `along with the \\`fill\\` attribute. Because \\`fill\\` mode causes an image to fill its containing ` +\n `element, the size attributes have no effect and should be removed.`);\n }\n}\n/**\n * Verifies that the rendered image has a nonzero height. If the image is in fill mode, provides\n * guidance that this can be caused by the containing element's CSS position property.\n */\nfunction assertNonZeroRenderedHeight(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n const renderedHeight = img.clientHeight;\n if (dir.fill && renderedHeight === 0) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the height of the fill-mode image is zero. ` +\n `This is likely because the containing element does not have the CSS 'position' ` +\n `property set to one of the following: \"relative\", \"fixed\", or \"absolute\". ` +\n `To fix this problem, make sure the container element has the CSS 'position' ` +\n `property defined and the height of the element is not zero.`));\n }\n });\n}\n/**\n * Verifies that the `loading` attribute is set to a valid input &\n * is not used on priority images.\n */\nfunction assertValidLoadingInput(dir) {\n if (dir.loading && dir.priority) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `was used on an image that was marked \"priority\". ` +\n `Setting \\`loading\\` on priority images is not allowed ` +\n `because these images will always be eagerly loaded. ` +\n `To fix this, remove the “loading” attribute from the priority image.`);\n }\n const validInputs = ['auto', 'eager', 'lazy'];\n if (typeof dir.loading === 'string' && !validInputs.includes(dir.loading)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `has an invalid value (\\`${dir.loading}\\`). ` +\n `To fix this, provide a valid value (\"lazy\", \"eager\", or \"auto\").`);\n }\n}\n/**\n * Warns if NOT using a loader (falling back to the generic loader) and\n * the image appears to be hosted on one of the image CDNs for which\n * we do have a built-in image loader. Suggests switching to the\n * built-in loader.\n *\n * @param ngSrc Value of the ngSrc attribute\n * @param imageLoader ImageLoader provided\n */\nfunction assertNotMissingBuiltInLoader(ngSrc, imageLoader) {\n if (imageLoader === noopImageLoader) {\n let builtInLoaderName = '';\n for (const loader of BUILT_IN_LOADERS) {\n if (loader.testUrl(ngSrc)) {\n builtInLoaderName = loader.name;\n break;\n }\n }\n if (builtInLoaderName) {\n console.warn(ɵformatRuntimeError(2962 /* RuntimeErrorCode.MISSING_BUILTIN_LOADER */, `NgOptimizedImage: It looks like your images may be hosted on the ` +\n `${builtInLoaderName} CDN, but your app is not using Angular's ` +\n `built-in loader for that CDN. We recommend switching to use ` +\n `the built-in by calling \\`provide${builtInLoaderName}Loader()\\` ` +\n `in your \\`providers\\` and passing it your instance's base URL. ` +\n `If you don't want to use the built-in loader, define a custom ` +\n `loader function using IMAGE_LOADER to silence this warning.`));\n }\n }\n}\n/**\n * Warns if ngSrcset is present and no loader is configured (i.e. the default one is being used).\n */\nfunction assertNoNgSrcsetWithoutLoader(dir, imageLoader) {\n if (dir.ngSrcset && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which would result in the same image being used for all configured sizes. ` +\n `To fix this, provide a loader or remove the \\`ngSrcset\\` attribute from the image.`));\n }\n}\n/**\n * Warns if loaderParams is present and no loader is configured (i.e. the default one is being\n * used).\n */\nfunction assertNoLoaderParamsWithoutLoader(dir, imageLoader) {\n if (dir.loaderParams && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loaderParams\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which means that the loaderParams data will not be consumed and will not affect the URL. ` +\n `To fix this, provide a custom loader or remove the \\`loaderParams\\` attribute from the image.`));\n }\n}\n\n// These exports represent the set of symbols exposed as a public API.\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, BrowserPlatformLocation, CommonModule, CurrencyPipe, DATE_PIPE_DEFAULT_OPTIONS, DATE_PIPE_DEFAULT_TIMEZONE, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, IMAGE_CONFIG, IMAGE_LOADER, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf as NgFor, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgOptimizedImage, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PRECONNECT_CHECK_BLOCKLIST, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, XhrFactory, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, provideCloudflareLoader, provideCloudinaryLoader, provideImageKitLoader, provideImgixLoader, registerLocaleData, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PLATFORM_WORKER_APP_ID as ɵPLATFORM_WORKER_APP_ID, PLATFORM_WORKER_UI_ID as ɵPLATFORM_WORKER_UI_ID, getDOM as ɵgetDOM, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n","/**\n * @license Angular v15.2.9\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i1 from '@angular/common';\nimport { DOCUMENT, ɵparseCookieValue, XhrFactory as XhrFactory$1 } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken, inject, Inject, PLATFORM_ID, makeEnvironmentProviders, NgModule } from '@angular/core';\nimport { of, Observable } from 'rxjs';\nimport { concatMap, filter, map } from 'rxjs/operators';\n\n/**\n * Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a\n * `HttpResponse`.\n *\n * `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the\n * first interceptor in the chain, which dispatches to the second, etc, eventually reaching the\n * `HttpBackend`.\n *\n * In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain.\n *\n * @publicApi\n */\nclass HttpHandler {\n}\n/**\n * A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend.\n *\n * Interceptors sit between the `HttpClient` interface and the `HttpBackend`.\n *\n * When injected, `HttpBackend` dispatches requests directly to the backend, without going\n * through the interceptor chain.\n *\n * @publicApi\n */\nclass HttpBackend {\n}\n\n/**\n * Represents the header configuration options for an HTTP request.\n * Instances are immutable. Modifying methods return a cloned\n * instance with the change. The original object is never changed.\n *\n * @publicApi\n */\nclass HttpHeaders {\n /** Constructs a new HTTP header object with the given values.*/\n constructor(headers) {\n /**\n * Internal map of lowercased header names to the normalized\n * form of the name (the form seen first).\n */\n this.normalizedNames = new Map();\n /**\n * Queued updates to be materialized the next initialization.\n */\n this.lazyUpdate = null;\n if (!headers) {\n this.headers = new Map();\n }\n else if (typeof headers === 'string') {\n this.lazyInit = () => {\n this.headers = new Map();\n headers.split('\\n').forEach(line => {\n const index = line.indexOf(':');\n if (index > 0) {\n const name = line.slice(0, index);\n const key = name.toLowerCase();\n const value = line.slice(index + 1).trim();\n this.maybeSetNormalizedName(name, key);\n if (this.headers.has(key)) {\n this.headers.get(key).push(value);\n }\n else {\n this.headers.set(key, [value]);\n }\n }\n });\n };\n }\n else {\n this.lazyInit = () => {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n assertValidHeaders(headers);\n }\n this.headers = new Map();\n Object.entries(headers).forEach(([name, values]) => {\n let headerValues;\n if (typeof values === 'string') {\n headerValues = [values];\n }\n else if (typeof values === 'number') {\n headerValues = [values.toString()];\n }\n else {\n headerValues = values.map((value) => value.toString());\n }\n if (headerValues.length > 0) {\n const key = name.toLowerCase();\n this.headers.set(key, headerValues);\n this.maybeSetNormalizedName(name, key);\n }\n });\n };\n }\n }\n /**\n * Checks for existence of a given header.\n *\n * @param name The header name to check for existence.\n *\n * @returns True if the header exists, false otherwise.\n */\n has(name) {\n this.init();\n return this.headers.has(name.toLowerCase());\n }\n /**\n * Retrieves the first value of a given header.\n *\n * @param name The header name.\n *\n * @returns The value string if the header exists, null otherwise\n */\n get(name) {\n this.init();\n const values = this.headers.get(name.toLowerCase());\n return values && values.length > 0 ? values[0] : null;\n }\n /**\n * Retrieves the names of the headers.\n *\n * @returns A list of header names.\n */\n keys() {\n this.init();\n return Array.from(this.normalizedNames.values());\n }\n /**\n * Retrieves a list of values for a given header.\n *\n * @param name The header name from which to retrieve values.\n *\n * @returns A string of values if the header exists, null otherwise.\n */\n getAll(name) {\n this.init();\n return this.headers.get(name.toLowerCase()) || null;\n }\n /**\n * Appends a new value to the existing set of values for a header\n * and returns them in a clone of the original instance.\n *\n * @param name The header name for which to append the values.\n * @param value The value to append.\n *\n * @returns A clone of the HTTP headers object with the value appended to the given header.\n */\n append(name, value) {\n return this.clone({ name, value, op: 'a' });\n }\n /**\n * Sets or modifies a value for a given header in a clone of the original instance.\n * If the header already exists, its value is replaced with the given value\n * in the returned object.\n *\n * @param name The header name.\n * @param value The value or values to set or override for the given header.\n *\n * @returns A clone of the HTTP headers object with the newly set header value.\n */\n set(name, value) {\n return this.clone({ name, value, op: 's' });\n }\n /**\n * Deletes values for a given header in a clone of the original instance.\n *\n * @param name The header name.\n * @param value The value or values to delete for the given header.\n *\n * @returns A clone of the HTTP headers object with the given value deleted.\n */\n delete(name, value) {\n return this.clone({ name, value, op: 'd' });\n }\n maybeSetNormalizedName(name, lcName) {\n if (!this.normalizedNames.has(lcName)) {\n this.normalizedNames.set(lcName, name);\n }\n }\n init() {\n if (!!this.lazyInit) {\n if (this.lazyInit instanceof HttpHeaders) {\n this.copyFrom(this.lazyInit);\n }\n else {\n this.lazyInit();\n }\n this.lazyInit = null;\n if (!!this.lazyUpdate) {\n this.lazyUpdate.forEach(update => this.applyUpdate(update));\n this.lazyUpdate = null;\n }\n }\n }\n copyFrom(other) {\n other.init();\n Array.from(other.headers.keys()).forEach(key => {\n this.headers.set(key, other.headers.get(key));\n this.normalizedNames.set(key, other.normalizedNames.get(key));\n });\n }\n clone(update) {\n const clone = new HttpHeaders();\n clone.lazyInit =\n (!!this.lazyInit && this.lazyInit instanceof HttpHeaders) ? this.lazyInit : this;\n clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);\n return clone;\n }\n applyUpdate(update) {\n const key = update.name.toLowerCase();\n switch (update.op) {\n case 'a':\n case 's':\n let value = update.value;\n if (typeof value === 'string') {\n value = [value];\n }\n if (value.length === 0) {\n return;\n }\n this.maybeSetNormalizedName(update.name, key);\n const base = (update.op === 'a' ? this.headers.get(key) : undefined) || [];\n base.push(...value);\n this.headers.set(key, base);\n break;\n case 'd':\n const toDelete = update.value;\n if (!toDelete) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n let existing = this.headers.get(key);\n if (!existing) {\n return;\n }\n existing = existing.filter(value => toDelete.indexOf(value) === -1);\n if (existing.length === 0) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n this.headers.set(key, existing);\n }\n }\n break;\n }\n }\n /**\n * @internal\n */\n forEach(fn) {\n this.init();\n Array.from(this.normalizedNames.keys())\n .forEach(key => fn(this.normalizedNames.get(key), this.headers.get(key)));\n }\n}\n/**\n * Verifies that the headers object has the right shape: the values\n * must be either strings, numbers or arrays. Throws an error if an invalid\n * header value is present.\n */\nfunction assertValidHeaders(headers) {\n for (const [key, value] of Object.entries(headers)) {\n if (!(typeof value === 'string' || typeof value === 'number') && !Array.isArray(value)) {\n throw new Error(`Unexpected value of the \\`${key}\\` header provided. ` +\n `Expecting either a string, a number or an array, but got: \\`${value}\\`.`);\n }\n }\n}\n\n/**\n * Provides encoding and decoding of URL parameter and query-string values.\n *\n * Serializes and parses URL parameter keys and values to encode and decode them.\n * If you pass URL query parameters without encoding,\n * the query parameters can be misinterpreted at the receiving end.\n *\n *\n * @publicApi\n */\nclass HttpUrlEncodingCodec {\n /**\n * Encodes a key name for a URL parameter or query-string.\n * @param key The key name.\n * @returns The encoded key name.\n */\n encodeKey(key) {\n return standardEncoding(key);\n }\n /**\n * Encodes the value of a URL parameter or query-string.\n * @param value The value.\n * @returns The encoded value.\n */\n encodeValue(value) {\n return standardEncoding(value);\n }\n /**\n * Decodes an encoded URL parameter or query-string key.\n * @param key The encoded key name.\n * @returns The decoded key name.\n */\n decodeKey(key) {\n return decodeURIComponent(key);\n }\n /**\n * Decodes an encoded URL parameter or query-string value.\n * @param value The encoded value.\n * @returns The decoded value.\n */\n decodeValue(value) {\n return decodeURIComponent(value);\n }\n}\nfunction paramParser(rawParams, codec) {\n const map = new Map();\n if (rawParams.length > 0) {\n // The `window.location.search` can be used while creating an instance of the `HttpParams` class\n // (e.g. `new HttpParams({ fromString: window.location.search })`). The `window.location.search`\n // may start with the `?` char, so we strip it if it's present.\n const params = rawParams.replace(/^\\?/, '').split('&');\n params.forEach((param) => {\n const eqIdx = param.indexOf('=');\n const [key, val] = eqIdx == -1 ?\n [codec.decodeKey(param), ''] :\n [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];\n const list = map.get(key) || [];\n list.push(val);\n map.set(key, list);\n });\n }\n return map;\n}\n/**\n * Encode input string with standard encodeURIComponent and then un-encode specific characters.\n */\nconst STANDARD_ENCODING_REGEX = /%(\\d[a-f0-9])/gi;\nconst STANDARD_ENCODING_REPLACEMENTS = {\n '40': '@',\n '3A': ':',\n '24': '$',\n '2C': ',',\n '3B': ';',\n '3D': '=',\n '3F': '?',\n '2F': '/',\n};\nfunction standardEncoding(v) {\n return encodeURIComponent(v).replace(STANDARD_ENCODING_REGEX, (s, t) => STANDARD_ENCODING_REPLACEMENTS[t] ?? s);\n}\nfunction valueToString(value) {\n return `${value}`;\n}\n/**\n * An HTTP request/response body that represents serialized parameters,\n * per the MIME type `application/x-www-form-urlencoded`.\n *\n * This class is immutable; all mutation operations return a new instance.\n *\n * @publicApi\n */\nclass HttpParams {\n constructor(options = {}) {\n this.updates = null;\n this.cloneFrom = null;\n this.encoder = options.encoder || new HttpUrlEncodingCodec();\n if (!!options.fromString) {\n if (!!options.fromObject) {\n throw new Error(`Cannot specify both fromString and fromObject.`);\n }\n this.map = paramParser(options.fromString, this.encoder);\n }\n else if (!!options.fromObject) {\n this.map = new Map();\n Object.keys(options.fromObject).forEach(key => {\n const value = options.fromObject[key];\n // convert the values to strings\n const values = Array.isArray(value) ? value.map(valueToString) : [valueToString(value)];\n this.map.set(key, values);\n });\n }\n else {\n this.map = null;\n }\n }\n /**\n * Reports whether the body includes one or more values for a given parameter.\n * @param param The parameter name.\n * @returns True if the parameter has one or more values,\n * false if it has no value or is not present.\n */\n has(param) {\n this.init();\n return this.map.has(param);\n }\n /**\n * Retrieves the first value for a parameter.\n * @param param The parameter name.\n * @returns The first value of the given parameter,\n * or `null` if the parameter is not present.\n */\n get(param) {\n this.init();\n const res = this.map.get(param);\n return !!res ? res[0] : null;\n }\n /**\n * Retrieves all values for a parameter.\n * @param param The parameter name.\n * @returns All values in a string array,\n * or `null` if the parameter not present.\n */\n getAll(param) {\n this.init();\n return this.map.get(param) || null;\n }\n /**\n * Retrieves all the parameters for this body.\n * @returns The parameter names in a string array.\n */\n keys() {\n this.init();\n return Array.from(this.map.keys());\n }\n /**\n * Appends a new value to existing values for a parameter.\n * @param param The parameter name.\n * @param value The new value to add.\n * @return A new body with the appended value.\n */\n append(param, value) {\n return this.clone({ param, value, op: 'a' });\n }\n /**\n * Constructs a new body with appended values for the given parameter name.\n * @param params parameters and values\n * @return A new body with the new value.\n */\n appendAll(params) {\n const updates = [];\n Object.keys(params).forEach(param => {\n const value = params[param];\n if (Array.isArray(value)) {\n value.forEach(_value => {\n updates.push({ param, value: _value, op: 'a' });\n });\n }\n else {\n updates.push({ param, value: value, op: 'a' });\n }\n });\n return this.clone(updates);\n }\n /**\n * Replaces the value for a parameter.\n * @param param The parameter name.\n * @param value The new value.\n * @return A new body with the new value.\n */\n set(param, value) {\n return this.clone({ param, value, op: 's' });\n }\n /**\n * Removes a given value or all values from a parameter.\n * @param param The parameter name.\n * @param value The value to remove, if provided.\n * @return A new body with the given value removed, or with all values\n * removed if no value is specified.\n */\n delete(param, value) {\n return this.clone({ param, value, op: 'd' });\n }\n /**\n * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are\n * separated by `&`s.\n */\n toString() {\n this.init();\n return this.keys()\n .map(key => {\n const eKey = this.encoder.encodeKey(key);\n // `a: ['1']` produces `'a=1'`\n // `b: []` produces `''`\n // `c: ['1', '2']` produces `'c=1&c=2'`\n return this.map.get(key).map(value => eKey + '=' + this.encoder.encodeValue(value))\n .join('&');\n })\n // filter out empty values because `b: []` produces `''`\n // which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't\n .filter(param => param !== '')\n .join('&');\n }\n clone(update) {\n const clone = new HttpParams({ encoder: this.encoder });\n clone.cloneFrom = this.cloneFrom || this;\n clone.updates = (this.updates || []).concat(update);\n return clone;\n }\n init() {\n if (this.map === null) {\n this.map = new Map();\n }\n if (this.cloneFrom !== null) {\n this.cloneFrom.init();\n this.cloneFrom.keys().forEach(key => this.map.set(key, this.cloneFrom.map.get(key)));\n this.updates.forEach(update => {\n switch (update.op) {\n case 'a':\n case 's':\n const base = (update.op === 'a' ? this.map.get(update.param) : undefined) || [];\n base.push(valueToString(update.value));\n this.map.set(update.param, base);\n break;\n case 'd':\n if (update.value !== undefined) {\n let base = this.map.get(update.param) || [];\n const idx = base.indexOf(valueToString(update.value));\n if (idx !== -1) {\n base.splice(idx, 1);\n }\n if (base.length > 0) {\n this.map.set(update.param, base);\n }\n else {\n this.map.delete(update.param);\n }\n }\n else {\n this.map.delete(update.param);\n break;\n }\n }\n });\n this.cloneFrom = this.updates = null;\n }\n }\n}\n\n/**\n * A token used to manipulate and access values stored in `HttpContext`.\n *\n * @publicApi\n */\nclass HttpContextToken {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n}\n/**\n * Http context stores arbitrary user defined values and ensures type safety without\n * actually knowing the types. It is backed by a `Map` and guarantees that keys do not clash.\n *\n * This context is mutable and is shared between cloned requests unless explicitly specified.\n *\n * @usageNotes\n *\n * ### Usage Example\n *\n * ```typescript\n * // inside cache.interceptors.ts\n * export const IS_CACHE_ENABLED = new HttpContextToken(() => false);\n *\n * export class CacheInterceptor implements HttpInterceptor {\n *\n * intercept(req: HttpRequest, delegate: HttpHandler): Observable> {\n * if (req.context.get(IS_CACHE_ENABLED) === true) {\n * return ...;\n * }\n * return delegate.handle(req);\n * }\n * }\n *\n * // inside a service\n *\n * this.httpClient.get('/api/weather', {\n * context: new HttpContext().set(IS_CACHE_ENABLED, true)\n * }).subscribe(...);\n * ```\n *\n * @publicApi\n */\nclass HttpContext {\n constructor() {\n this.map = new Map();\n }\n /**\n * Store a value in the context. If a value is already present it will be overwritten.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n * @param value The value to store.\n *\n * @returns A reference to itself for easy chaining.\n */\n set(token, value) {\n this.map.set(token, value);\n return this;\n }\n /**\n * Retrieve the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns The stored value or default if one is defined.\n */\n get(token) {\n if (!this.map.has(token)) {\n this.map.set(token, token.defaultValue());\n }\n return this.map.get(token);\n }\n /**\n * Delete the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns A reference to itself for easy chaining.\n */\n delete(token) {\n this.map.delete(token);\n return this;\n }\n /**\n * Checks for existence of a given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns True if the token exists, false otherwise.\n */\n has(token) {\n return this.map.has(token);\n }\n /**\n * @returns a list of tokens currently stored in the context.\n */\n keys() {\n return this.map.keys();\n }\n}\n\n/**\n * Determine whether the given HTTP method may include a body.\n */\nfunction mightHaveBody(method) {\n switch (method) {\n case 'DELETE':\n case 'GET':\n case 'HEAD':\n case 'OPTIONS':\n case 'JSONP':\n return false;\n default:\n return true;\n }\n}\n/**\n * Safely assert whether the given value is an ArrayBuffer.\n *\n * In some execution environments ArrayBuffer is not defined.\n */\nfunction isArrayBuffer(value) {\n return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;\n}\n/**\n * Safely assert whether the given value is a Blob.\n *\n * In some execution environments Blob is not defined.\n */\nfunction isBlob(value) {\n return typeof Blob !== 'undefined' && value instanceof Blob;\n}\n/**\n * Safely assert whether the given value is a FormData instance.\n *\n * In some execution environments FormData is not defined.\n */\nfunction isFormData(value) {\n return typeof FormData !== 'undefined' && value instanceof FormData;\n}\n/**\n * Safely assert whether the given value is a URLSearchParams instance.\n *\n * In some execution environments URLSearchParams is not defined.\n */\nfunction isUrlSearchParams(value) {\n return typeof URLSearchParams !== 'undefined' && value instanceof URLSearchParams;\n}\n/**\n * An outgoing HTTP request with an optional typed body.\n *\n * `HttpRequest` represents an outgoing request, including URL, method,\n * headers, body, and other request configuration options. Instances should be\n * assumed to be immutable. To modify a `HttpRequest`, the `clone`\n * method should be used.\n *\n * @publicApi\n */\nclass HttpRequest {\n constructor(method, url, third, fourth) {\n this.url = url;\n /**\n * The request body, or `null` if one isn't set.\n *\n * Bodies are not enforced to be immutable, as they can include a reference to any\n * user-defined data type. However, interceptors should take care to preserve\n * idempotence by treating them as such.\n */\n this.body = null;\n /**\n * Whether this request should be made in a way that exposes progress events.\n *\n * Progress events are expensive (change detection runs on each event) and so\n * they should only be requested if the consumer intends to monitor them.\n */\n this.reportProgress = false;\n /**\n * Whether this request should be sent with outgoing credentials (cookies).\n */\n this.withCredentials = false;\n /**\n * The expected response type of the server.\n *\n * This is used to parse the response appropriately before returning it to\n * the requestee.\n */\n this.responseType = 'json';\n this.method = method.toUpperCase();\n // Next, need to figure out which argument holds the HttpRequestInit\n // options, if any.\n let options;\n // Check whether a body argument is expected. The only valid way to omit\n // the body argument is to use a known no-body method like GET.\n if (mightHaveBody(this.method) || !!fourth) {\n // Body is the third argument, options are the fourth.\n this.body = (third !== undefined) ? third : null;\n options = fourth;\n }\n else {\n // No body required, options are the third argument. The body stays null.\n options = third;\n }\n // If options have been passed, interpret them.\n if (options) {\n // Normalize reportProgress and withCredentials.\n this.reportProgress = !!options.reportProgress;\n this.withCredentials = !!options.withCredentials;\n // Override default response type of 'json' if one is provided.\n if (!!options.responseType) {\n this.responseType = options.responseType;\n }\n // Override headers if they're provided.\n if (!!options.headers) {\n this.headers = options.headers;\n }\n if (!!options.context) {\n this.context = options.context;\n }\n if (!!options.params) {\n this.params = options.params;\n }\n }\n // If no headers have been passed in, construct a new HttpHeaders instance.\n if (!this.headers) {\n this.headers = new HttpHeaders();\n }\n // If no context have been passed in, construct a new HttpContext instance.\n if (!this.context) {\n this.context = new HttpContext();\n }\n // If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.\n if (!this.params) {\n this.params = new HttpParams();\n this.urlWithParams = url;\n }\n else {\n // Encode the parameters to a string in preparation for inclusion in the URL.\n const params = this.params.toString();\n if (params.length === 0) {\n // No parameters, the visible URL is just the URL given at creation time.\n this.urlWithParams = url;\n }\n else {\n // Does the URL already have query parameters? Look for '?'.\n const qIdx = url.indexOf('?');\n // There are 3 cases to handle:\n // 1) No existing parameters -> append '?' followed by params.\n // 2) '?' exists and is followed by existing query string ->\n // append '&' followed by params.\n // 3) '?' exists at the end of the url -> append params directly.\n // This basically amounts to determining the character, if any, with\n // which to join the URL and parameters.\n const sep = qIdx === -1 ? '?' : (qIdx < url.length - 1 ? '&' : '');\n this.urlWithParams = url + sep + params;\n }\n }\n }\n /**\n * Transform the free-form body into a serialized format suitable for\n * transmission to the server.\n */\n serializeBody() {\n // If no body is present, no need to serialize it.\n if (this.body === null) {\n return null;\n }\n // Check whether the body is already in a serialized form. If so,\n // it can just be returned directly.\n if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) ||\n isUrlSearchParams(this.body) || typeof this.body === 'string') {\n return this.body;\n }\n // Check whether the body is an instance of HttpUrlEncodedParams.\n if (this.body instanceof HttpParams) {\n return this.body.toString();\n }\n // Check whether the body is an object or array, and serialize with JSON if so.\n if (typeof this.body === 'object' || typeof this.body === 'boolean' ||\n Array.isArray(this.body)) {\n return JSON.stringify(this.body);\n }\n // Fall back on toString() for everything else.\n return this.body.toString();\n }\n /**\n * Examine the body and attempt to infer an appropriate MIME type\n * for it.\n *\n * If no such type can be inferred, this method will return `null`.\n */\n detectContentTypeHeader() {\n // An empty body has no content type.\n if (this.body === null) {\n return null;\n }\n // FormData bodies rely on the browser's content type assignment.\n if (isFormData(this.body)) {\n return null;\n }\n // Blobs usually have their own content type. If it doesn't, then\n // no type can be inferred.\n if (isBlob(this.body)) {\n return this.body.type || null;\n }\n // Array buffers have unknown contents and thus no type can be inferred.\n if (isArrayBuffer(this.body)) {\n return null;\n }\n // Technically, strings could be a form of JSON data, but it's safe enough\n // to assume they're plain strings.\n if (typeof this.body === 'string') {\n return 'text/plain';\n }\n // `HttpUrlEncodedParams` has its own content-type.\n if (this.body instanceof HttpParams) {\n return 'application/x-www-form-urlencoded;charset=UTF-8';\n }\n // Arrays, objects, boolean and numbers will be encoded as JSON.\n if (typeof this.body === 'object' || typeof this.body === 'number' ||\n typeof this.body === 'boolean') {\n return 'application/json';\n }\n // No type could be inferred.\n return null;\n }\n clone(update = {}) {\n // For method, url, and responseType, take the current value unless\n // it is overridden in the update hash.\n const method = update.method || this.method;\n const url = update.url || this.url;\n const responseType = update.responseType || this.responseType;\n // The body is somewhat special - a `null` value in update.body means\n // whatever current body is present is being overridden with an empty\n // body, whereas an `undefined` value in update.body implies no\n // override.\n const body = (update.body !== undefined) ? update.body : this.body;\n // Carefully handle the boolean options to differentiate between\n // `false` and `undefined` in the update args.\n const withCredentials = (update.withCredentials !== undefined) ? update.withCredentials : this.withCredentials;\n const reportProgress = (update.reportProgress !== undefined) ? update.reportProgress : this.reportProgress;\n // Headers and params may be appended to if `setHeaders` or\n // `setParams` are used.\n let headers = update.headers || this.headers;\n let params = update.params || this.params;\n // Pass on context if needed\n const context = update.context ?? this.context;\n // Check whether the caller has asked to add headers.\n if (update.setHeaders !== undefined) {\n // Set every requested header.\n headers =\n Object.keys(update.setHeaders)\n .reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers);\n }\n // Check whether the caller has asked to set params.\n if (update.setParams) {\n // Set every requested param.\n params = Object.keys(update.setParams)\n .reduce((params, param) => params.set(param, update.setParams[param]), params);\n }\n // Finally, construct the new HttpRequest using the pieces from above.\n return new HttpRequest(method, url, body, {\n params,\n headers,\n context,\n reportProgress,\n responseType,\n withCredentials,\n });\n }\n}\n\n/**\n * Type enumeration for the different kinds of `HttpEvent`.\n *\n * @publicApi\n */\nvar HttpEventType;\n(function (HttpEventType) {\n /**\n * The request was sent out over the wire.\n */\n HttpEventType[HttpEventType[\"Sent\"] = 0] = \"Sent\";\n /**\n * An upload progress event was received.\n */\n HttpEventType[HttpEventType[\"UploadProgress\"] = 1] = \"UploadProgress\";\n /**\n * The response status code and headers were received.\n */\n HttpEventType[HttpEventType[\"ResponseHeader\"] = 2] = \"ResponseHeader\";\n /**\n * A download progress event was received.\n */\n HttpEventType[HttpEventType[\"DownloadProgress\"] = 3] = \"DownloadProgress\";\n /**\n * The full response including the body was received.\n */\n HttpEventType[HttpEventType[\"Response\"] = 4] = \"Response\";\n /**\n * A custom event from an interceptor or a backend.\n */\n HttpEventType[HttpEventType[\"User\"] = 5] = \"User\";\n})(HttpEventType || (HttpEventType = {}));\n/**\n * Base class for both `HttpResponse` and `HttpHeaderResponse`.\n *\n * @publicApi\n */\nclass HttpResponseBase {\n /**\n * Super-constructor for all responses.\n *\n * The single parameter accepted is an initialization hash. Any properties\n * of the response passed there will override the default values.\n */\n constructor(init, defaultStatus = 200 /* HttpStatusCode.Ok */, defaultStatusText = 'OK') {\n // If the hash has values passed, use them to initialize the response.\n // Otherwise use the default values.\n this.headers = init.headers || new HttpHeaders();\n this.status = init.status !== undefined ? init.status : defaultStatus;\n this.statusText = init.statusText || defaultStatusText;\n this.url = init.url || null;\n // Cache the ok value to avoid defining a getter.\n this.ok = this.status >= 200 && this.status < 300;\n }\n}\n/**\n * A partial HTTP response which only includes the status and header data,\n * but no response body.\n *\n * `HttpHeaderResponse` is a `HttpEvent` available on the response\n * event stream, only when progress events are requested.\n *\n * @publicApi\n */\nclass HttpHeaderResponse extends HttpResponseBase {\n /**\n * Create a new `HttpHeaderResponse` with the given parameters.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.ResponseHeader;\n }\n /**\n * Copy this `HttpHeaderResponse`, overriding its contents with the\n * given parameter hash.\n */\n clone(update = {}) {\n // Perform a straightforward initialization of the new HttpHeaderResponse,\n // overriding the current parameters with new ones if given.\n return new HttpHeaderResponse({\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A full HTTP response, including a typed response body (which may be `null`\n * if one was not returned).\n *\n * `HttpResponse` is a `HttpEvent` available on the response event\n * stream.\n *\n * @publicApi\n */\nclass HttpResponse extends HttpResponseBase {\n /**\n * Construct a new `HttpResponse`.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.Response;\n this.body = init.body !== undefined ? init.body : null;\n }\n clone(update = {}) {\n return new HttpResponse({\n body: (update.body !== undefined) ? update.body : this.body,\n headers: update.headers || this.headers,\n status: (update.status !== undefined) ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A response that represents an error or failure, either from a\n * non-successful HTTP status, an error while executing the request,\n * or some other failure which occurred during the parsing of the response.\n *\n * Any error returned on the `Observable` response stream will be\n * wrapped in an `HttpErrorResponse` to provide additional context about\n * the state of the HTTP layer when the error occurred. The error property\n * will contain either a wrapped Error object or the error response returned\n * from the server.\n *\n * @publicApi\n */\nclass HttpErrorResponse extends HttpResponseBase {\n constructor(init) {\n // Initialize with a default status of 0 / Unknown Error.\n super(init, 0, 'Unknown Error');\n this.name = 'HttpErrorResponse';\n /**\n * Errors are never okay, even when the status code is in the 2xx success range.\n */\n this.ok = false;\n // If the response was successful, then this was a parse error. Otherwise, it was\n // a protocol-level failure of some sort. Either the request failed in transit\n // or the server returned an unsuccessful status code.\n if (this.status >= 200 && this.status < 300) {\n this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;\n }\n else {\n this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;\n }\n this.error = init.error || null;\n }\n}\n\n/**\n * Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and\n * the given `body`. This function clones the object and adds the body.\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n *\n */\nfunction addBody(options, body) {\n return {\n body,\n headers: options.headers,\n context: options.context,\n observe: options.observe,\n params: options.params,\n reportProgress: options.reportProgress,\n responseType: options.responseType,\n withCredentials: options.withCredentials,\n };\n}\n/**\n * Performs HTTP requests.\n * This service is available as an injectable class, with methods to perform HTTP requests.\n * Each request method has multiple signatures, and the return type varies based on\n * the signature that is called (mainly the values of `observe` and `responseType`).\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n\n *\n * @usageNotes\n * Sample HTTP requests for the [Tour of Heroes](/tutorial/tour-of-heroes/toh-pt0) application.\n *\n * ### HTTP Request Example\n *\n * ```\n * // GET heroes whose name contains search term\n * searchHeroes(term: string): observable{\n *\n * const params = new HttpParams({fromString: 'name=term'});\n * return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params});\n * }\n * ```\n *\n * Alternatively, the parameter string can be used without invoking HttpParams\n * by directly joining to the URL.\n * ```\n * this.httpClient.request('GET', this.heroesUrl + '?' + 'name=term', {responseType:'json'});\n * ```\n *\n *\n * ### JSONP Example\n * ```\n * requestJsonp(url, callback = 'callback') {\n * return this.httpClient.jsonp(this.heroesURL, callback);\n * }\n * ```\n *\n * ### PATCH Example\n * ```\n * // PATCH one of the heroes' name\n * patchHero (id: number, heroName: string): Observable<{}> {\n * const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42\n * return this.httpClient.patch(url, {name: heroName}, httpOptions)\n * .pipe(catchError(this.handleError('patchHero')));\n * }\n * ```\n *\n * @see [HTTP Guide](guide/http)\n * @see [HTTP Request](api/common/http/HttpRequest)\n *\n * @publicApi\n */\nclass HttpClient {\n constructor(handler) {\n this.handler = handler;\n }\n /**\n * Constructs an observable for a generic HTTP request that, when subscribed,\n * fires the request through the chain of registered interceptors and on to the\n * server.\n *\n * You can pass an `HttpRequest` directly as the only parameter. In this case,\n * the call returns an observable of the raw `HttpEvent` stream.\n *\n * Alternatively you can pass an HTTP method as the first parameter,\n * a URL string as the second, and an options hash containing the request body as the third.\n * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the\n * type of returned observable.\n * * The `responseType` value determines how a successful response body is parsed.\n * * If `responseType` is the default `json`, you can pass a type interface for the resulting\n * object as a type parameter to the call.\n *\n * The `observe` value determines the return type, according to what you are interested in\n * observing.\n * * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including\n * progress events by default.\n * * An `observe` value of response returns an observable of `HttpResponse`,\n * where the `T` parameter depends on the `responseType` and any optionally provided type\n * parameter.\n * * An `observe` value of body returns an observable of `` with the same `T` body type.\n *\n */\n request(first, url, options = {}) {\n let req;\n // First, check whether the primary argument is an instance of `HttpRequest`.\n if (first instanceof HttpRequest) {\n // It is. The other arguments must be undefined (per the signatures) and can be\n // ignored.\n req = first;\n }\n else {\n // It's a string, so it represents a URL. Construct a request based on it,\n // and incorporate the remaining arguments (assuming `GET` unless a method is\n // provided.\n // Figure out the headers.\n let headers = undefined;\n if (options.headers instanceof HttpHeaders) {\n headers = options.headers;\n }\n else {\n headers = new HttpHeaders(options.headers);\n }\n // Sort out parameters.\n let params = undefined;\n if (!!options.params) {\n if (options.params instanceof HttpParams) {\n params = options.params;\n }\n else {\n params = new HttpParams({ fromObject: options.params });\n }\n }\n // Construct the request.\n req = new HttpRequest(first, url, (options.body !== undefined ? options.body : null), {\n headers,\n context: options.context,\n params,\n reportProgress: options.reportProgress,\n // By default, JSON is assumed to be returned for all calls.\n responseType: options.responseType || 'json',\n withCredentials: options.withCredentials,\n });\n }\n // Start with an Observable.of() the initial request, and run the handler (which\n // includes all interceptors) inside a concatMap(). This way, the handler runs\n // inside an Observable chain, which causes interceptors to be re-run on every\n // subscription (this also makes retries re-run the handler, including interceptors).\n const events$ = of(req).pipe(concatMap((req) => this.handler.handle(req)));\n // If coming via the API signature which accepts a previously constructed HttpRequest,\n // the only option is to get the event stream. Otherwise, return the event stream if\n // that is what was requested.\n if (first instanceof HttpRequest || options.observe === 'events') {\n return events$;\n }\n // The requested stream contains either the full response or the body. In either\n // case, the first step is to filter the event stream to extract a stream of\n // responses(s).\n const res$ = events$.pipe(filter((event) => event instanceof HttpResponse));\n // Decide which stream to return.\n switch (options.observe || 'body') {\n case 'body':\n // The requested stream is the body. Map the response stream to the response\n // body. This could be done more simply, but a misbehaving interceptor might\n // transform the response body into a different format and ignore the requested\n // responseType. Guard against this by validating that the response is of the\n // requested type.\n switch (req.responseType) {\n case 'arraybuffer':\n return res$.pipe(map((res) => {\n // Validate that the body is an ArrayBuffer.\n if (res.body !== null && !(res.body instanceof ArrayBuffer)) {\n throw new Error('Response is not an ArrayBuffer.');\n }\n return res.body;\n }));\n case 'blob':\n return res$.pipe(map((res) => {\n // Validate that the body is a Blob.\n if (res.body !== null && !(res.body instanceof Blob)) {\n throw new Error('Response is not a Blob.');\n }\n return res.body;\n }));\n case 'text':\n return res$.pipe(map((res) => {\n // Validate that the body is a string.\n if (res.body !== null && typeof res.body !== 'string') {\n throw new Error('Response is not a string.');\n }\n return res.body;\n }));\n case 'json':\n default:\n // No validation needed for JSON responses, as they can be of any type.\n return res$.pipe(map((res) => res.body));\n }\n case 'response':\n // The response stream was requested directly, so return it.\n return res$;\n default:\n // Guard against new future observe types being added.\n throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);\n }\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `DELETE` request to execute on the server. See the individual overloads for\n * details on the return type.\n *\n * @param url The endpoint URL.\n * @param options The HTTP options to send with the request.\n *\n */\n delete(url, options = {}) {\n return this.request('DELETE', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `GET` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n get(url, options = {}) {\n return this.request('GET', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `HEAD` request to execute on the server. The `HEAD` method returns\n * meta information about the resource without transferring the\n * resource itself. See the individual overloads for\n * details on the return type.\n */\n head(url, options = {}) {\n return this.request('HEAD', url, options);\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes a request with the special method\n * `JSONP` to be dispatched via the interceptor pipeline.\n * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain\n * API endpoints that don't support newer,\n * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.\n * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the\n * requests even if the API endpoint is not located on the same domain (origin) as the client-side\n * application making the request.\n * The endpoint API must support JSONP callback for JSONP requests to work.\n * The resource API returns the JSON response wrapped in a callback function.\n * You can pass the callback function name as one of the query parameters.\n * Note that JSONP requests can only be used with `GET` requests.\n *\n * @param url The resource URL.\n * @param callbackParam The callback function name.\n *\n */\n jsonp(url, callbackParam) {\n return this.request('JSONP', url, {\n params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),\n observe: 'body',\n responseType: 'json',\n });\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes the configured\n * `OPTIONS` request to execute on the server. This method allows the client\n * to determine the supported HTTP methods and other capabilities of an endpoint,\n * without implying a resource action. See the individual overloads for\n * details on the return type.\n */\n options(url, options = {}) {\n return this.request('OPTIONS', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PATCH` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n patch(url, body, options = {}) {\n return this.request('PATCH', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `POST` request to execute on the server. The server responds with the location of\n * the replaced resource. See the individual overloads for\n * details on the return type.\n */\n post(url, body, options = {}) {\n return this.request('POST', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PUT` request to execute on the server. The `PUT` method replaces an existing resource\n * with a new set of values.\n * See the individual overloads for details on the return type.\n */\n put(url, body, options = {}) {\n return this.request('PUT', url, addBody(options, body));\n }\n}\nHttpClient.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpClient, deps: [{ token: HttpHandler }], target: i0.ɵɵFactoryTarget.Injectable });\nHttpClient.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpClient });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpClient, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: HttpHandler }]; } });\n\nfunction interceptorChainEndFn(req, finalHandlerFn) {\n return finalHandlerFn(req);\n}\n/**\n * Constructs a `ChainedInterceptorFn` which adapts a legacy `HttpInterceptor` to the\n * `ChainedInterceptorFn` interface.\n */\nfunction adaptLegacyInterceptorToChain(chainTailFn, interceptor) {\n return (initialRequest, finalHandlerFn) => interceptor.intercept(initialRequest, {\n handle: (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn),\n });\n}\n/**\n * Constructs a `ChainedInterceptorFn` which wraps and invokes a functional interceptor in the given\n * injector.\n */\nfunction chainedInterceptorFn(chainTailFn, interceptorFn, injector) {\n // clang-format off\n return (initialRequest, finalHandlerFn) => injector.runInContext(() => interceptorFn(initialRequest, downstreamRequest => chainTailFn(downstreamRequest, finalHandlerFn)));\n // clang-format on\n}\n/**\n * A multi-provider token that represents the array of registered\n * `HttpInterceptor` objects.\n *\n * @publicApi\n */\nconst HTTP_INTERCEPTORS = new InjectionToken('HTTP_INTERCEPTORS');\n/**\n * A multi-provided token of `HttpInterceptorFn`s.\n */\nconst HTTP_INTERCEPTOR_FNS = new InjectionToken('HTTP_INTERCEPTOR_FNS');\n/**\n * Creates an `HttpInterceptorFn` which lazily initializes an interceptor chain from the legacy\n * class-based interceptors and runs the request through it.\n */\nfunction legacyInterceptorFnFactory() {\n let chain = null;\n return (req, handler) => {\n if (chain === null) {\n const interceptors = inject(HTTP_INTERCEPTORS, { optional: true }) ?? [];\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `interceptors` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n chain = interceptors.reduceRight(adaptLegacyInterceptorToChain, interceptorChainEndFn);\n }\n return chain(req, handler);\n };\n}\nclass HttpInterceptorHandler extends HttpHandler {\n constructor(backend, injector) {\n super();\n this.backend = backend;\n this.injector = injector;\n this.chain = null;\n }\n handle(initialRequest) {\n if (this.chain === null) {\n const dedupedInterceptorFns = Array.from(new Set(this.injector.get(HTTP_INTERCEPTOR_FNS)));\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `dedupedInterceptorFns` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n this.chain = dedupedInterceptorFns.reduceRight((nextSequencedFn, interceptorFn) => chainedInterceptorFn(nextSequencedFn, interceptorFn, this.injector), interceptorChainEndFn);\n }\n return this.chain(initialRequest, downstreamRequest => this.backend.handle(downstreamRequest));\n }\n}\nHttpInterceptorHandler.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpInterceptorHandler, deps: [{ token: HttpBackend }, { token: i0.EnvironmentInjector }], target: i0.ɵɵFactoryTarget.Injectable });\nHttpInterceptorHandler.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpInterceptorHandler });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpInterceptorHandler, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: HttpBackend }, { type: i0.EnvironmentInjector }]; } });\n\n// Every request made through JSONP needs a callback name that's unique across the\n// whole page. Each request is assigned an id and the callback name is constructed\n// from that. The next id to be assigned is tracked in a global variable here that\n// is shared among all applications on the page.\nlet nextRequestId = 0;\n/**\n * When a pending
![\"Circle](\"{{)
\n {{ item.title }}\n ![\"Logo\"](\"https://glinttoyshoppics.s3.ap-south-1.amazonaws.com/25189682-9d61-4ac3-a1b3-a2901d84b188-20230718220716095.png\")
Shop by Age \n \n ![\"Card](\"https://glinttoyshoppics.s3.ap-south-1.amazonaws.com/1.webp\")
\n ![\"Card](\"https://glinttoyshoppics.s3.ap-south-1.amazonaws.com/2.webp\")
\n ![\"Card](\"https://glinttoyshoppics.s3.ap-south-1.amazonaws.com/3.webp\")
\n ![\"Card](\"https://glinttoyshoppics.s3.ap-south-1.amazonaws.com/4.png\")
\n ![\"Card](\"https://glinttoyshoppics.s3.ap-south-1.amazonaws.com/5.png\")
\n ![\"Card](\"https://glinttoyshoppics.s3.ap-south-1.amazonaws.com/6.webp\")
\n